From 63959564d7aa7eec41df585b6cc8795a089f7a9b Mon Sep 17 00:00:00 2001 From: root Date: Mon, 13 May 2013 16:43:07 +0300 Subject: [PATCH 1/2] File editor --- README.md | 0 config/modules/social.php | 0 exceptions/YAccessDeniedException.php | 0 exceptions/YPageNotFoundException.php | 0 exceptions/YServerErrorException.php | 0 modules/documentation/install/documentation.php | 0 modules/geo/GeoModule.php | 0 modules/geo/controllers/DefaultController.php | 0 modules/geo/controllers/GeoController.php | 0 modules/geo/data/README-WHERE-IS-DATA.txt | 0 modules/geo/extensions/sxgeo/CSxGeoIP.php | 0 modules/geo/extensions/sxgeo/SxGeo.php | 0 modules/geo/install/geo.php | 0 modules/geo/messages/en/geo.php | 0 modules/geo/models/GeoCity.php | 0 modules/geo/models/GeoCountry.php | 0 modules/geo/models/GeoProfile.php | 0 modules/geo/views/default/index.php | 0 modules/geo/views/geo_profile.php | 0 modules/search/SearchModule.php | 0 .../components/DGSphinxSearch/DGSphinxSearch.php | 0 .../search/components/DGSphinxSearch/LICENSE.txt | 0 modules/search/components/DGSphinxSearch/README.txt | 0 .../DGSphinxSearch/models/DGSphinxSearchResult.php | 0 .../search/components/DGSphinxSearch/sphinxapi.php | 0 modules/search/controllers/DefaultController.php | 0 modules/search/controllers/SearchController.php | 0 modules/search/install/search.php | 0 modules/search/messages/en/search.php | 0 modules/search/views/search/search_results.php | 0 modules/social/components/CustomGoogleService.php | 0 modules/social/components/CustomMailruService.php | 0 modules/social/components/CustomTwitterService.php | 0 .../social/components/CustomVKontakteService.php | 0 modules/social/components/CustomYandexService.php | 0 modules/social/components/ServiceUserIdentity.php | 0 modules/social/controllers/SocialController.php | 0 modules/social/extensions/eauth/CHANGELOG.md | 0 modules/social/extensions/eauth/EAuth.php | 0 .../social/extensions/eauth/EAuthRedirectWidget.php | 0 .../social/extensions/eauth/EAuthServiceBase.php | 0 .../social/extensions/eauth/EAuthUserIdentity.php | 0 modules/social/extensions/eauth/EAuthWidget.php | 0 modules/social/extensions/eauth/EOAuth2Service.php | 0 modules/social/extensions/eauth/EOAuthService.php | 0 modules/social/extensions/eauth/EOpenIDService.php | 0 modules/social/extensions/eauth/IAuthService.php | 0 modules/social/extensions/eauth/LICENSE | 0 modules/social/extensions/eauth/README.md | 0 modules/social/extensions/eauth/README_RU.md | 0 modules/social/extensions/eauth/assets/css/auth.css | 0 .../social/extensions/eauth/assets/images/auth.png | Bin modules/social/extensions/eauth/assets/js/auth.js | 0 .../eauth/custom_services/CustomFacebookService.php | 0 .../custom_services/CustomGitHubOAuthService.php | 0 .../eauth/custom_services/CustomGoogleService.php | 0 .../eauth/custom_services/CustomMailruService.php | 0 .../custom_services/CustomOdnoklassnikiService.php | 0 .../eauth/custom_services/CustomTwitterService.php | 0 .../custom_services/CustomVKontakteService.php | 0 .../custom_services/CustomYandexOAuthService.php | 0 .../eauth/custom_services/CustomYandexService.php | 0 .../extensions/eauth/messages/blank/eauth.php | 0 .../social/extensions/eauth/messages/en/eauth.php | 0 .../social/extensions/eauth/messages/ru/eauth.php | 0 .../eauth/services/FacebookOAuthService.php | 0 .../eauth/services/GitHubOAuthService.php | 0 .../eauth/services/GoogleOAuthService.php | 0 .../eauth/services/GoogleOpenIDService.php | 0 .../eauth/services/LinkedinOAuthService.php | 0 .../extensions/eauth/services/LiveOAuthService.php | 0 .../eauth/services/MailruOAuthService.php | 0 .../eauth/services/MoikrugOAuthService.php | 0 .../eauth/services/OdnoklassnikiOAuthService.php | 0 .../eauth/services/TwitterOAuthService.php | 0 .../eauth/services/VKontakteOAuthService.php | 0 .../eauth/services/YandexOAuthService.php | 0 .../eauth/services/YandexOpenIDService.php | 0 modules/social/extensions/eauth/views/auth.php | 0 modules/social/extensions/eauth/views/redirect.php | 0 .../social/extensions/eoauth/EOAuthComponent.php | 0 modules/social/extensions/eoauth/EOAuthProvider.php | 0 .../social/extensions/eoauth/EOAuthUserIdentity.php | 0 modules/social/extensions/eoauth/EOAuthUtils.php | 0 modules/social/extensions/eoauth/LICENSE | 0 modules/social/extensions/eoauth/NOTICE | 0 modules/social/extensions/eoauth/README.md | 0 .../social/extensions/eoauth/lib/OAuthConsumer.php | 0 .../social/extensions/eoauth/lib/OAuthDataStore.php | 0 .../social/extensions/eoauth/lib/OAuthException.php | 0 .../social/extensions/eoauth/lib/OAuthRequest.php | 0 .../social/extensions/eoauth/lib/OAuthServer.php | 0 .../extensions/eoauth/lib/OAuthSignatureMethod.php | 0 .../eoauth/lib/OAuthSignatureMethod_HMAC_SHA1.php | 0 .../eoauth/lib/OAuthSignatureMethod_PLAINTEXT.php | 0 .../eoauth/lib/OAuthSignatureMethod_RSA_SHA1.php | 0 modules/social/extensions/eoauth/lib/OAuthToken.php | 0 modules/social/extensions/eoauth/lib/OAuthUtil.php | 0 .../migrations/m000000_000000_social_base.php | 0 modules/social/install/social.php | 0 modules/social/messages/en/social.php | 0 modules/social/views/default/index.php | 0 modules/social/views/login/_form.php | 0 modules/social/views/login/_search.php | 0 modules/social/views/login/index.php | 0 modules/social/views/login/update.php | 0 modules/social/views/login/view.php | 0 modules/social/views/social/registration.php | 0 .../install/migrations/m000000_000000_vote_base.php | 0 modules/vote/install/vote.php | 0 modules/vote/messages/en/vote.php | 0 modules/vote/views/default/_form.php | 0 modules/vote/views/default/_search.php | 0 modules/vote/views/default/create.php | 0 modules/vote/views/default/index.php | 0 modules/vote/views/default/update.php | 0 modules/vote/views/default/view.php | 0 widgets/YCacheableWidget.php | 0 widgets/YandexMetrika.php | 0 119 files changed, 0 insertions(+), 0 deletions(-) mode change 100644 => 100755 README.md mode change 100644 => 100755 config/modules/social.php mode change 100644 => 100755 exceptions/YAccessDeniedException.php mode change 100644 => 100755 exceptions/YPageNotFoundException.php mode change 100644 => 100755 exceptions/YServerErrorException.php mode change 100644 => 100755 modules/documentation/install/documentation.php mode change 100644 => 100755 modules/geo/GeoModule.php mode change 100644 => 100755 modules/geo/controllers/DefaultController.php mode change 100644 => 100755 modules/geo/controllers/GeoController.php mode change 100644 => 100755 modules/geo/data/README-WHERE-IS-DATA.txt mode change 100644 => 100755 modules/geo/extensions/sxgeo/CSxGeoIP.php mode change 100644 => 100755 modules/geo/extensions/sxgeo/SxGeo.php mode change 100644 => 100755 modules/geo/install/geo.php mode change 100644 => 100755 modules/geo/messages/en/geo.php mode change 100644 => 100755 modules/geo/models/GeoCity.php mode change 100644 => 100755 modules/geo/models/GeoCountry.php mode change 100644 => 100755 modules/geo/models/GeoProfile.php mode change 100644 => 100755 modules/geo/views/default/index.php mode change 100644 => 100755 modules/geo/views/geo_profile.php mode change 100644 => 100755 modules/search/SearchModule.php mode change 100644 => 100755 modules/search/components/DGSphinxSearch/DGSphinxSearch.php mode change 100644 => 100755 modules/search/components/DGSphinxSearch/LICENSE.txt mode change 100644 => 100755 modules/search/components/DGSphinxSearch/README.txt mode change 100644 => 100755 modules/search/components/DGSphinxSearch/models/DGSphinxSearchResult.php mode change 100644 => 100755 modules/search/components/DGSphinxSearch/sphinxapi.php mode change 100644 => 100755 modules/search/controllers/DefaultController.php mode change 100644 => 100755 modules/search/controllers/SearchController.php mode change 100644 => 100755 modules/search/install/search.php mode change 100644 => 100755 modules/search/messages/en/search.php mode change 100644 => 100755 modules/search/views/search/search_results.php mode change 100644 => 100755 modules/social/components/CustomGoogleService.php mode change 100644 => 100755 modules/social/components/CustomMailruService.php mode change 100644 => 100755 modules/social/components/CustomTwitterService.php mode change 100644 => 100755 modules/social/components/CustomVKontakteService.php mode change 100644 => 100755 modules/social/components/CustomYandexService.php mode change 100644 => 100755 modules/social/components/ServiceUserIdentity.php mode change 100644 => 100755 modules/social/controllers/SocialController.php mode change 100644 => 100755 modules/social/extensions/eauth/CHANGELOG.md mode change 100644 => 100755 modules/social/extensions/eauth/EAuth.php mode change 100644 => 100755 modules/social/extensions/eauth/EAuthRedirectWidget.php mode change 100644 => 100755 modules/social/extensions/eauth/EAuthServiceBase.php mode change 100644 => 100755 modules/social/extensions/eauth/EAuthUserIdentity.php mode change 100644 => 100755 modules/social/extensions/eauth/EAuthWidget.php mode change 100644 => 100755 modules/social/extensions/eauth/EOAuth2Service.php mode change 100644 => 100755 modules/social/extensions/eauth/EOAuthService.php mode change 100644 => 100755 modules/social/extensions/eauth/EOpenIDService.php mode change 100644 => 100755 modules/social/extensions/eauth/IAuthService.php mode change 100644 => 100755 modules/social/extensions/eauth/LICENSE mode change 100644 => 100755 modules/social/extensions/eauth/README.md mode change 100644 => 100755 modules/social/extensions/eauth/README_RU.md mode change 100644 => 100755 modules/social/extensions/eauth/assets/css/auth.css mode change 100644 => 100755 modules/social/extensions/eauth/assets/images/auth.png mode change 100644 => 100755 modules/social/extensions/eauth/assets/js/auth.js mode change 100644 => 100755 modules/social/extensions/eauth/custom_services/CustomFacebookService.php mode change 100644 => 100755 modules/social/extensions/eauth/custom_services/CustomGitHubOAuthService.php mode change 100644 => 100755 modules/social/extensions/eauth/custom_services/CustomGoogleService.php mode change 100644 => 100755 modules/social/extensions/eauth/custom_services/CustomMailruService.php mode change 100644 => 100755 modules/social/extensions/eauth/custom_services/CustomOdnoklassnikiService.php mode change 100644 => 100755 modules/social/extensions/eauth/custom_services/CustomTwitterService.php mode change 100644 => 100755 modules/social/extensions/eauth/custom_services/CustomVKontakteService.php mode change 100644 => 100755 modules/social/extensions/eauth/custom_services/CustomYandexOAuthService.php mode change 100644 => 100755 modules/social/extensions/eauth/custom_services/CustomYandexService.php mode change 100644 => 100755 modules/social/extensions/eauth/messages/blank/eauth.php mode change 100644 => 100755 modules/social/extensions/eauth/messages/en/eauth.php mode change 100644 => 100755 modules/social/extensions/eauth/messages/ru/eauth.php mode change 100644 => 100755 modules/social/extensions/eauth/services/FacebookOAuthService.php mode change 100644 => 100755 modules/social/extensions/eauth/services/GitHubOAuthService.php mode change 100644 => 100755 modules/social/extensions/eauth/services/GoogleOAuthService.php mode change 100644 => 100755 modules/social/extensions/eauth/services/GoogleOpenIDService.php mode change 100644 => 100755 modules/social/extensions/eauth/services/LinkedinOAuthService.php mode change 100644 => 100755 modules/social/extensions/eauth/services/LiveOAuthService.php mode change 100644 => 100755 modules/social/extensions/eauth/services/MailruOAuthService.php mode change 100644 => 100755 modules/social/extensions/eauth/services/MoikrugOAuthService.php mode change 100644 => 100755 modules/social/extensions/eauth/services/OdnoklassnikiOAuthService.php mode change 100644 => 100755 modules/social/extensions/eauth/services/TwitterOAuthService.php mode change 100644 => 100755 modules/social/extensions/eauth/services/VKontakteOAuthService.php mode change 100644 => 100755 modules/social/extensions/eauth/services/YandexOAuthService.php mode change 100644 => 100755 modules/social/extensions/eauth/services/YandexOpenIDService.php mode change 100644 => 100755 modules/social/extensions/eauth/views/auth.php mode change 100644 => 100755 modules/social/extensions/eauth/views/redirect.php mode change 100644 => 100755 modules/social/extensions/eoauth/EOAuthComponent.php mode change 100644 => 100755 modules/social/extensions/eoauth/EOAuthProvider.php mode change 100644 => 100755 modules/social/extensions/eoauth/EOAuthUserIdentity.php mode change 100644 => 100755 modules/social/extensions/eoauth/EOAuthUtils.php mode change 100644 => 100755 modules/social/extensions/eoauth/LICENSE mode change 100644 => 100755 modules/social/extensions/eoauth/NOTICE mode change 100644 => 100755 modules/social/extensions/eoauth/README.md mode change 100644 => 100755 modules/social/extensions/eoauth/lib/OAuthConsumer.php mode change 100644 => 100755 modules/social/extensions/eoauth/lib/OAuthDataStore.php mode change 100644 => 100755 modules/social/extensions/eoauth/lib/OAuthException.php mode change 100644 => 100755 modules/social/extensions/eoauth/lib/OAuthRequest.php mode change 100644 => 100755 modules/social/extensions/eoauth/lib/OAuthServer.php mode change 100644 => 100755 modules/social/extensions/eoauth/lib/OAuthSignatureMethod.php mode change 100644 => 100755 modules/social/extensions/eoauth/lib/OAuthSignatureMethod_HMAC_SHA1.php mode change 100644 => 100755 modules/social/extensions/eoauth/lib/OAuthSignatureMethod_PLAINTEXT.php mode change 100644 => 100755 modules/social/extensions/eoauth/lib/OAuthSignatureMethod_RSA_SHA1.php mode change 100644 => 100755 modules/social/extensions/eoauth/lib/OAuthToken.php mode change 100644 => 100755 modules/social/extensions/eoauth/lib/OAuthUtil.php mode change 100644 => 100755 modules/social/install/migrations/m000000_000000_social_base.php mode change 100644 => 100755 modules/social/install/social.php mode change 100644 => 100755 modules/social/messages/en/social.php mode change 100644 => 100755 modules/social/views/default/index.php mode change 100644 => 100755 modules/social/views/login/_form.php mode change 100644 => 100755 modules/social/views/login/_search.php mode change 100644 => 100755 modules/social/views/login/index.php mode change 100644 => 100755 modules/social/views/login/update.php mode change 100644 => 100755 modules/social/views/login/view.php mode change 100644 => 100755 modules/social/views/social/registration.php mode change 100644 => 100755 modules/vote/install/migrations/m000000_000000_vote_base.php mode change 100644 => 100755 modules/vote/install/vote.php mode change 100644 => 100755 modules/vote/messages/en/vote.php mode change 100644 => 100755 modules/vote/views/default/_form.php mode change 100644 => 100755 modules/vote/views/default/_search.php mode change 100644 => 100755 modules/vote/views/default/create.php mode change 100644 => 100755 modules/vote/views/default/index.php mode change 100644 => 100755 modules/vote/views/default/update.php mode change 100644 => 100755 modules/vote/views/default/view.php mode change 100644 => 100755 widgets/YCacheableWidget.php mode change 100644 => 100755 widgets/YandexMetrika.php diff --git a/README.md b/README.md old mode 100644 new mode 100755 diff --git a/config/modules/social.php b/config/modules/social.php old mode 100644 new mode 100755 diff --git a/exceptions/YAccessDeniedException.php b/exceptions/YAccessDeniedException.php old mode 100644 new mode 100755 diff --git a/exceptions/YPageNotFoundException.php b/exceptions/YPageNotFoundException.php old mode 100644 new mode 100755 diff --git a/exceptions/YServerErrorException.php b/exceptions/YServerErrorException.php old mode 100644 new mode 100755 diff --git a/modules/documentation/install/documentation.php b/modules/documentation/install/documentation.php old mode 100644 new mode 100755 diff --git a/modules/geo/GeoModule.php b/modules/geo/GeoModule.php old mode 100644 new mode 100755 diff --git a/modules/geo/controllers/DefaultController.php b/modules/geo/controllers/DefaultController.php old mode 100644 new mode 100755 diff --git a/modules/geo/controllers/GeoController.php b/modules/geo/controllers/GeoController.php old mode 100644 new mode 100755 diff --git a/modules/geo/data/README-WHERE-IS-DATA.txt b/modules/geo/data/README-WHERE-IS-DATA.txt old mode 100644 new mode 100755 diff --git a/modules/geo/extensions/sxgeo/CSxGeoIP.php b/modules/geo/extensions/sxgeo/CSxGeoIP.php old mode 100644 new mode 100755 diff --git a/modules/geo/extensions/sxgeo/SxGeo.php b/modules/geo/extensions/sxgeo/SxGeo.php old mode 100644 new mode 100755 diff --git a/modules/geo/install/geo.php b/modules/geo/install/geo.php old mode 100644 new mode 100755 diff --git a/modules/geo/messages/en/geo.php b/modules/geo/messages/en/geo.php old mode 100644 new mode 100755 diff --git a/modules/geo/models/GeoCity.php b/modules/geo/models/GeoCity.php old mode 100644 new mode 100755 diff --git a/modules/geo/models/GeoCountry.php b/modules/geo/models/GeoCountry.php old mode 100644 new mode 100755 diff --git a/modules/geo/models/GeoProfile.php b/modules/geo/models/GeoProfile.php old mode 100644 new mode 100755 diff --git a/modules/geo/views/default/index.php b/modules/geo/views/default/index.php old mode 100644 new mode 100755 diff --git a/modules/geo/views/geo_profile.php b/modules/geo/views/geo_profile.php old mode 100644 new mode 100755 diff --git a/modules/search/SearchModule.php b/modules/search/SearchModule.php old mode 100644 new mode 100755 diff --git a/modules/search/components/DGSphinxSearch/DGSphinxSearch.php b/modules/search/components/DGSphinxSearch/DGSphinxSearch.php old mode 100644 new mode 100755 diff --git a/modules/search/components/DGSphinxSearch/LICENSE.txt b/modules/search/components/DGSphinxSearch/LICENSE.txt old mode 100644 new mode 100755 diff --git a/modules/search/components/DGSphinxSearch/README.txt b/modules/search/components/DGSphinxSearch/README.txt old mode 100644 new mode 100755 diff --git a/modules/search/components/DGSphinxSearch/models/DGSphinxSearchResult.php b/modules/search/components/DGSphinxSearch/models/DGSphinxSearchResult.php old mode 100644 new mode 100755 diff --git a/modules/search/components/DGSphinxSearch/sphinxapi.php b/modules/search/components/DGSphinxSearch/sphinxapi.php old mode 100644 new mode 100755 diff --git a/modules/search/controllers/DefaultController.php b/modules/search/controllers/DefaultController.php old mode 100644 new mode 100755 diff --git a/modules/search/controllers/SearchController.php b/modules/search/controllers/SearchController.php old mode 100644 new mode 100755 diff --git a/modules/search/install/search.php b/modules/search/install/search.php old mode 100644 new mode 100755 diff --git a/modules/search/messages/en/search.php b/modules/search/messages/en/search.php old mode 100644 new mode 100755 diff --git a/modules/search/views/search/search_results.php b/modules/search/views/search/search_results.php old mode 100644 new mode 100755 diff --git a/modules/social/components/CustomGoogleService.php b/modules/social/components/CustomGoogleService.php old mode 100644 new mode 100755 diff --git a/modules/social/components/CustomMailruService.php b/modules/social/components/CustomMailruService.php old mode 100644 new mode 100755 diff --git a/modules/social/components/CustomTwitterService.php b/modules/social/components/CustomTwitterService.php old mode 100644 new mode 100755 diff --git a/modules/social/components/CustomVKontakteService.php b/modules/social/components/CustomVKontakteService.php old mode 100644 new mode 100755 diff --git a/modules/social/components/CustomYandexService.php b/modules/social/components/CustomYandexService.php old mode 100644 new mode 100755 diff --git a/modules/social/components/ServiceUserIdentity.php b/modules/social/components/ServiceUserIdentity.php old mode 100644 new mode 100755 diff --git a/modules/social/controllers/SocialController.php b/modules/social/controllers/SocialController.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/CHANGELOG.md b/modules/social/extensions/eauth/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/EAuth.php b/modules/social/extensions/eauth/EAuth.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/EAuthRedirectWidget.php b/modules/social/extensions/eauth/EAuthRedirectWidget.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/EAuthServiceBase.php b/modules/social/extensions/eauth/EAuthServiceBase.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/EAuthUserIdentity.php b/modules/social/extensions/eauth/EAuthUserIdentity.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/EAuthWidget.php b/modules/social/extensions/eauth/EAuthWidget.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/EOAuth2Service.php b/modules/social/extensions/eauth/EOAuth2Service.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/EOAuthService.php b/modules/social/extensions/eauth/EOAuthService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/EOpenIDService.php b/modules/social/extensions/eauth/EOpenIDService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/IAuthService.php b/modules/social/extensions/eauth/IAuthService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/LICENSE b/modules/social/extensions/eauth/LICENSE old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/README.md b/modules/social/extensions/eauth/README.md old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/README_RU.md b/modules/social/extensions/eauth/README_RU.md old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/assets/css/auth.css b/modules/social/extensions/eauth/assets/css/auth.css old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/assets/images/auth.png b/modules/social/extensions/eauth/assets/images/auth.png old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/assets/js/auth.js b/modules/social/extensions/eauth/assets/js/auth.js old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/custom_services/CustomFacebookService.php b/modules/social/extensions/eauth/custom_services/CustomFacebookService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/custom_services/CustomGitHubOAuthService.php b/modules/social/extensions/eauth/custom_services/CustomGitHubOAuthService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/custom_services/CustomGoogleService.php b/modules/social/extensions/eauth/custom_services/CustomGoogleService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/custom_services/CustomMailruService.php b/modules/social/extensions/eauth/custom_services/CustomMailruService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/custom_services/CustomOdnoklassnikiService.php b/modules/social/extensions/eauth/custom_services/CustomOdnoklassnikiService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/custom_services/CustomTwitterService.php b/modules/social/extensions/eauth/custom_services/CustomTwitterService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/custom_services/CustomVKontakteService.php b/modules/social/extensions/eauth/custom_services/CustomVKontakteService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/custom_services/CustomYandexOAuthService.php b/modules/social/extensions/eauth/custom_services/CustomYandexOAuthService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/custom_services/CustomYandexService.php b/modules/social/extensions/eauth/custom_services/CustomYandexService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/messages/blank/eauth.php b/modules/social/extensions/eauth/messages/blank/eauth.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/messages/en/eauth.php b/modules/social/extensions/eauth/messages/en/eauth.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/messages/ru/eauth.php b/modules/social/extensions/eauth/messages/ru/eauth.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/services/FacebookOAuthService.php b/modules/social/extensions/eauth/services/FacebookOAuthService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/services/GitHubOAuthService.php b/modules/social/extensions/eauth/services/GitHubOAuthService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/services/GoogleOAuthService.php b/modules/social/extensions/eauth/services/GoogleOAuthService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/services/GoogleOpenIDService.php b/modules/social/extensions/eauth/services/GoogleOpenIDService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/services/LinkedinOAuthService.php b/modules/social/extensions/eauth/services/LinkedinOAuthService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/services/LiveOAuthService.php b/modules/social/extensions/eauth/services/LiveOAuthService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/services/MailruOAuthService.php b/modules/social/extensions/eauth/services/MailruOAuthService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/services/MoikrugOAuthService.php b/modules/social/extensions/eauth/services/MoikrugOAuthService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/services/OdnoklassnikiOAuthService.php b/modules/social/extensions/eauth/services/OdnoklassnikiOAuthService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/services/TwitterOAuthService.php b/modules/social/extensions/eauth/services/TwitterOAuthService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/services/VKontakteOAuthService.php b/modules/social/extensions/eauth/services/VKontakteOAuthService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/services/YandexOAuthService.php b/modules/social/extensions/eauth/services/YandexOAuthService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/services/YandexOpenIDService.php b/modules/social/extensions/eauth/services/YandexOpenIDService.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/views/auth.php b/modules/social/extensions/eauth/views/auth.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eauth/views/redirect.php b/modules/social/extensions/eauth/views/redirect.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/EOAuthComponent.php b/modules/social/extensions/eoauth/EOAuthComponent.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/EOAuthProvider.php b/modules/social/extensions/eoauth/EOAuthProvider.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/EOAuthUserIdentity.php b/modules/social/extensions/eoauth/EOAuthUserIdentity.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/EOAuthUtils.php b/modules/social/extensions/eoauth/EOAuthUtils.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/LICENSE b/modules/social/extensions/eoauth/LICENSE old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/NOTICE b/modules/social/extensions/eoauth/NOTICE old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/README.md b/modules/social/extensions/eoauth/README.md old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/lib/OAuthConsumer.php b/modules/social/extensions/eoauth/lib/OAuthConsumer.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/lib/OAuthDataStore.php b/modules/social/extensions/eoauth/lib/OAuthDataStore.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/lib/OAuthException.php b/modules/social/extensions/eoauth/lib/OAuthException.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/lib/OAuthRequest.php b/modules/social/extensions/eoauth/lib/OAuthRequest.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/lib/OAuthServer.php b/modules/social/extensions/eoauth/lib/OAuthServer.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/lib/OAuthSignatureMethod.php b/modules/social/extensions/eoauth/lib/OAuthSignatureMethod.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/lib/OAuthSignatureMethod_HMAC_SHA1.php b/modules/social/extensions/eoauth/lib/OAuthSignatureMethod_HMAC_SHA1.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/lib/OAuthSignatureMethod_PLAINTEXT.php b/modules/social/extensions/eoauth/lib/OAuthSignatureMethod_PLAINTEXT.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/lib/OAuthSignatureMethod_RSA_SHA1.php b/modules/social/extensions/eoauth/lib/OAuthSignatureMethod_RSA_SHA1.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/lib/OAuthToken.php b/modules/social/extensions/eoauth/lib/OAuthToken.php old mode 100644 new mode 100755 diff --git a/modules/social/extensions/eoauth/lib/OAuthUtil.php b/modules/social/extensions/eoauth/lib/OAuthUtil.php old mode 100644 new mode 100755 diff --git a/modules/social/install/migrations/m000000_000000_social_base.php b/modules/social/install/migrations/m000000_000000_social_base.php old mode 100644 new mode 100755 diff --git a/modules/social/install/social.php b/modules/social/install/social.php old mode 100644 new mode 100755 diff --git a/modules/social/messages/en/social.php b/modules/social/messages/en/social.php old mode 100644 new mode 100755 diff --git a/modules/social/views/default/index.php b/modules/social/views/default/index.php old mode 100644 new mode 100755 diff --git a/modules/social/views/login/_form.php b/modules/social/views/login/_form.php old mode 100644 new mode 100755 diff --git a/modules/social/views/login/_search.php b/modules/social/views/login/_search.php old mode 100644 new mode 100755 diff --git a/modules/social/views/login/index.php b/modules/social/views/login/index.php old mode 100644 new mode 100755 diff --git a/modules/social/views/login/update.php b/modules/social/views/login/update.php old mode 100644 new mode 100755 diff --git a/modules/social/views/login/view.php b/modules/social/views/login/view.php old mode 100644 new mode 100755 diff --git a/modules/social/views/social/registration.php b/modules/social/views/social/registration.php old mode 100644 new mode 100755 diff --git a/modules/vote/install/migrations/m000000_000000_vote_base.php b/modules/vote/install/migrations/m000000_000000_vote_base.php old mode 100644 new mode 100755 diff --git a/modules/vote/install/vote.php b/modules/vote/install/vote.php old mode 100644 new mode 100755 diff --git a/modules/vote/messages/en/vote.php b/modules/vote/messages/en/vote.php old mode 100644 new mode 100755 diff --git a/modules/vote/views/default/_form.php b/modules/vote/views/default/_form.php old mode 100644 new mode 100755 diff --git a/modules/vote/views/default/_search.php b/modules/vote/views/default/_search.php old mode 100644 new mode 100755 diff --git a/modules/vote/views/default/create.php b/modules/vote/views/default/create.php old mode 100644 new mode 100755 diff --git a/modules/vote/views/default/index.php b/modules/vote/views/default/index.php old mode 100644 new mode 100755 diff --git a/modules/vote/views/default/update.php b/modules/vote/views/default/update.php old mode 100644 new mode 100755 diff --git a/modules/vote/views/default/view.php b/modules/vote/views/default/view.php old mode 100644 new mode 100755 diff --git a/widgets/YCacheableWidget.php b/widgets/YCacheableWidget.php old mode 100644 new mode 100755 diff --git a/widgets/YandexMetrika.php b/widgets/YandexMetrika.php old mode 100644 new mode 100755 From d9437493d1effb6fc0a4b3a1a8033b417e65d6d2 Mon Sep 17 00:00:00 2001 From: root Date: Mon, 13 May 2013 16:48:53 +0300 Subject: [PATCH 2/2] Module for file aditing --- config/modules/files.php | 9 + modules/files/FilesModule.php | 146 + .../files/controllers/DefaultController.php | 69 + modules/files/views/default/_form.php | 60 + .../default/assets/addon/dialog/dialog.css | 32 + .../default/assets/addon/dialog/dialog.js | 80 + .../assets/addon/display/placeholder.js | 54 + .../assets/addon/edit/closebrackets.js | 54 + .../default/assets/addon/edit/closetag.js | 86 + .../assets/addon/edit/continuecomment.js | 44 + .../default/assets/addon/edit/continuelist.js | 25 + .../assets/addon/edit/matchbrackets.js | 82 + .../default/assets/addon/fold/brace-fold.js | 31 + .../default/assets/addon/fold/foldcode.js | 32 + .../default/assets/addon/fold/indent-fold.js | 11 + .../default/assets/addon/fold/xml-fold.js | 64 + .../default/assets/addon/hint/html-hint.js | 582 + .../assets/addon/hint/javascript-hint.js | 142 + .../default/assets/addon/hint/pig-hint.js | 117 + .../default/assets/addon/hint/python-hint.js | 93 + .../default/assets/addon/hint/show-hint.css | 38 + .../default/assets/addon/hint/show-hint.js | 180 + .../default/assets/addon/hint/xml-hint.js | 118 + .../assets/addon/lint/javascript-lint.js | 127 + .../default/assets/addon/lint/json-lint.js | 14 + .../views/default/assets/addon/lint/lint.css | 96 + .../views/default/assets/addon/lint/lint.js | 197 + .../default/assets/addon/mode/loadmode.js | 51 + .../default/assets/addon/mode/multiplex.js | 95 + .../default/assets/addon/mode/overlay.js | 59 + .../default/assets/addon/runmode/colorize.js | 29 + .../addon/runmode/runmode-standalone.js | 130 + .../default/assets/addon/runmode/runmode.js | 52 + .../assets/addon/runmode/runmode.node.js | 89 + .../assets/addon/search/match-highlighter.js | 60 + .../default/assets/addon/search/search.js | 131 + .../assets/addon/search/searchcursor.js | 133 + .../assets/addon/selection/active-line.js | 39 + .../assets/addon/selection/mark-selection.js | 34 + .../views/default/assets/jquery/README.txt | 27 + .../default/assets/jquery/jquery-ui.custom.js | 11727 ++++++++++++++++ .../assets/jquery/jquery-ui.custom.min.js | 125 + .../default/assets/jquery/jquery.cookie.js | 97 + .../views/default/assets/jquery/jquery.js | 9440 +++++++++++++ .../views/default/assets/jquery/jquery.min.js | 2 + .../views/default/assets/lib/codemirror.css | 246 + .../views/default/assets/lib/codemirror.js | 5585 ++++++++ .../views/default/assets/mode/apl/apl.js | 160 + .../views/default/assets/mode/apl/index.html | 61 + .../default/assets/mode/asterisk/asterisk.js | 183 + .../default/assets/mode/asterisk/index.html | 142 + .../views/default/assets/mode/clike/clike.js | 302 + .../default/assets/mode/clike/index.html | 103 + .../default/assets/mode/clike/scala.html | 767 + .../default/assets/mode/clojure/clojure.js | 222 + .../default/assets/mode/clojure/index.html | 76 + .../default/assets/mode/coffeescript/LICENSE | 22 + .../assets/mode/coffeescript/coffeescript.js | 346 + .../assets/mode/coffeescript/index.html | 728 + .../assets/mode/commonlisp/commonlisp.js | 101 + .../default/assets/mode/commonlisp/index.html | 165 + .../views/default/assets/mode/css/css.js | 567 + .../views/default/assets/mode/css/index.html | 58 + .../views/default/assets/mode/css/scss.html | 145 + .../default/assets/mode/css/scss_test.js | 80 + .../views/default/assets/mode/css/test.js | 113 + .../files/views/default/assets/mode/d/d.js | 205 + .../views/default/assets/mode/d/index.html | 262 + .../views/default/assets/mode/diff/diff.js | 32 + .../views/default/assets/mode/diff/index.html | 105 + .../views/default/assets/mode/ecl/ecl.js | 192 + .../views/default/assets/mode/ecl/index.html | 39 + .../default/assets/mode/erlang/erlang.js | 463 + .../default/assets/mode/erlang/index.html | 64 + .../views/default/assets/mode/gas/gas.js | 326 + .../views/default/assets/mode/gas/index.html | 57 + .../views/default/assets/mode/gfm/gfm.js | 96 + .../views/default/assets/mode/gfm/index.html | 74 + .../views/default/assets/mode/gfm/test.js | 112 + .../files/views/default/assets/mode/go/go.js | 165 + .../views/default/assets/mode/go/index.html | 74 + .../default/assets/mode/groovy/groovy.js | 210 + .../default/assets/mode/groovy/index.html | 73 + .../default/assets/mode/haskell/haskell.js | 242 + .../default/assets/mode/haskell/index.html | 62 + .../views/default/assets/mode/haxe/haxe.js | 429 + .../views/default/assets/mode/haxe/index.html | 90 + .../assets/mode/htmlembedded/htmlembedded.js | 73 + .../assets/mode/htmlembedded/index.html | 49 + .../assets/mode/htmlmixed/htmlmixed.js | 104 + .../default/assets/mode/htmlmixed/index.html | 73 + .../views/default/assets/mode/http/http.js | 98 + .../views/default/assets/mode/http/index.html | 32 + .../default/assets/mode/javascript/index.html | 92 + .../assets/mode/javascript/javascript.js | 467 + .../assets/mode/javascript/typescript.html | 48 + .../default/assets/mode/jinja2/index.html | 38 + .../default/assets/mode/jinja2/jinja2.js | 42 + .../views/default/assets/mode/less/index.html | 741 + .../views/default/assets/mode/less/less.js | 266 + .../default/assets/mode/livescript/LICENSE | 23 + .../default/assets/mode/livescript/index.html | 446 + .../assets/mode/livescript/livescript.js | 267 + .../assets/mode/livescript/livescript.ls | 266 + .../views/default/assets/mode/lua/index.html | 74 + .../views/default/assets/mode/lua/lua.js | 140 + .../default/assets/mode/markdown/index.html | 344 + .../default/assets/mode/markdown/markdown.js | 526 + .../default/assets/mode/markdown/test.js | 636 + .../files/views/default/assets/mode/meta.js | 75 + .../views/default/assets/mode/mirc/index.html | 149 + .../views/default/assets/mode/mirc/mirc.js | 177 + .../default/assets/mode/ntriples/index.html | 33 + .../default/assets/mode/ntriples/ntriples.js | 170 + .../default/assets/mode/ocaml/index.html | 131 + .../views/default/assets/mode/ocaml/ocaml.js | 113 + .../views/default/assets/mode/pascal/LICENSE | 7 + .../default/assets/mode/pascal/index.html | 48 + .../default/assets/mode/pascal/pascal.js | 94 + .../views/default/assets/mode/perl/LICENSE | 19 + .../views/default/assets/mode/perl/index.html | 62 + .../views/default/assets/mode/perl/perl.js | 816 ++ .../views/default/assets/mode/php/index.html | 51 + .../views/default/assets/mode/php/php.js | 129 + .../views/default/assets/mode/pig/index.html | 42 + .../views/default/assets/mode/pig/pig.js | 171 + .../default/assets/mode/properties/index.html | 41 + .../assets/mode/properties/properties.js | 63 + .../default/assets/mode/python/LICENSE.txt | 21 + .../default/assets/mode/python/index.html | 135 + .../default/assets/mode/python/python.js | 340 + .../views/default/assets/mode/q/index.html | 131 + .../files/views/default/assets/mode/q/q.js | 124 + .../files/views/default/assets/mode/r/LICENSE | 24 + .../views/default/assets/mode/r/index.html | 74 + .../files/views/default/assets/mode/r/r.js | 141 + .../assets/mode/rpm/changes/changes.js | 19 + .../assets/mode/rpm/changes/index.html | 53 + .../default/assets/mode/rpm/spec/index.html | 99 + .../default/assets/mode/rpm/spec/spec.css | 5 + .../default/assets/mode/rpm/spec/spec.js | 66 + .../views/default/assets/mode/rst/LICENSE.txt | 21 + .../views/default/assets/mode/rst/index.html | 524 + .../views/default/assets/mode/rst/rst.js | 550 + .../views/default/assets/mode/ruby/LICENSE | 24 + .../views/default/assets/mode/ruby/index.html | 173 + .../views/default/assets/mode/ruby/ruby.js | 195 + .../views/default/assets/mode/rust/index.html | 48 + .../views/default/assets/mode/rust/rust.js | 432 + .../views/default/assets/mode/sass/index.html | 54 + .../views/default/assets/mode/sass/sass.js | 349 + .../default/assets/mode/scheme/index.html | 65 + .../default/assets/mode/scheme/scheme.js | 230 + .../default/assets/mode/shell/index.html | 51 + .../views/default/assets/mode/shell/shell.js | 118 + .../views/default/assets/mode/sieve/LICENSE | 19 + .../default/assets/mode/sieve/index.html | 81 + .../views/default/assets/mode/sieve/sieve.js | 183 + .../default/assets/mode/smalltalk/index.html | 57 + .../assets/mode/smalltalk/smalltalk.js | 139 + .../default/assets/mode/smarty/index.html | 83 + .../default/assets/mode/smarty/smarty.js | 148 + .../default/assets/mode/sparql/index.html | 42 + .../default/assets/mode/sparql/sparql.js | 143 + .../views/default/assets/mode/sql/index.html | 68 + .../views/default/assets/mode/sql/sql.js | 268 + .../views/default/assets/mode/stex/index.html | 98 + .../views/default/assets/mode/stex/stex.js | 246 + .../views/default/assets/mode/stex/test.js | 117 + .../views/default/assets/mode/tcl/index.html | 129 + .../views/default/assets/mode/tcl/tcl.js | 131 + .../default/assets/mode/tiddlywiki/index.html | 142 + .../assets/mode/tiddlywiki/tiddlywiki.css | 14 + .../assets/mode/tiddlywiki/tiddlywiki.js | 353 + .../views/default/assets/mode/tiki/index.html | 81 + .../views/default/assets/mode/tiki/tiki.css | 26 + .../views/default/assets/mode/tiki/tiki.js | 308 + .../default/assets/mode/turtle/index.html | 39 + .../default/assets/mode/turtle/turtle.js | 145 + .../views/default/assets/mode/vb/LICENSE.txt | 21 + .../views/default/assets/mode/vb/index.html | 88 + .../files/views/default/assets/mode/vb/vb.js | 259 + .../default/assets/mode/vbscript/index.html | 42 + .../default/assets/mode/vbscript/vbscript.js | 26 + .../default/assets/mode/velocity/index.html | 103 + .../default/assets/mode/velocity/velocity.js | 144 + .../default/assets/mode/verilog/index.html | 121 + .../default/assets/mode/verilog/verilog.js | 182 + .../views/default/assets/mode/xml/index.html | 45 + .../views/default/assets/mode/xml/xml.js | 328 + .../views/default/assets/mode/xquery/LICENSE | 20 + .../default/assets/mode/xquery/index.html | 221 + .../views/default/assets/mode/xquery/test.js | 64 + .../default/assets/mode/xquery/xquery.js | 450 + .../views/default/assets/mode/yaml/index.html | 68 + .../views/default/assets/mode/yaml/yaml.js | 95 + .../views/default/assets/mode/z80/index.html | 39 + .../views/default/assets/mode/z80/z80.js | 85 + .../views/default/assets/src/GPL-LICENSE.txt | 278 + .../views/default/assets/src/MIT-License.txt | 7 + .../default/assets/src/jquery.dynatree.js | 3432 +++++ .../default/assets/src/skin-vista/icons.gif | Bin 0 -> 5512 bytes .../default/assets/src/skin-vista/loading.gif | Bin 0 -> 3111 bytes .../assets/src/skin-vista/ui.dynatree.css | 452 + .../default/assets/src/skin/icons-rtl.gif | Bin 0 -> 4046 bytes .../views/default/assets/src/skin/icons.gif | Bin 0 -> 4041 bytes .../views/default/assets/src/skin/loading.gif | Bin 0 -> 570 bytes .../default/assets/src/skin/ui.dynatree.css | 440 + .../default/assets/src/skin/vline-rtl.gif | Bin 0 -> 842 bytes .../views/default/assets/src/skin/vline.gif | Bin 0 -> 844 bytes .../default/assets/theme/ambiance-mobile.css | 5 + .../views/default/assets/theme/ambiance.css | 75 + .../views/default/assets/theme/blackboard.css | 25 + .../views/default/assets/theme/cobalt.css | 18 + .../views/default/assets/theme/eclipse.css | 25 + .../views/default/assets/theme/elegant.css | 10 + .../default/assets/theme/erlang-dark.css | 21 + .../default/assets/theme/lesser-dark.css | 44 + .../views/default/assets/theme/midnight.css | 52 + .../views/default/assets/theme/monokai.css | 28 + .../files/views/default/assets/theme/neat.css | 9 + .../views/default/assets/theme/night.css | 21 + .../views/default/assets/theme/rubyblue.css | 21 + .../views/default/assets/theme/solarized.css | 207 + .../views/default/assets/theme/twilight.css | 26 + .../default/assets/theme/vibrant-ink.css | 27 + .../views/default/assets/theme/xq-dark.css | 46 + .../views/default/assets/theme/xq-light.css | 43 + modules/files/views/default/index.php | 58 + 229 files changed, 60580 insertions(+) create mode 100644 config/modules/files.php create mode 100755 modules/files/FilesModule.php create mode 100755 modules/files/controllers/DefaultController.php create mode 100755 modules/files/views/default/_form.php create mode 100755 modules/files/views/default/assets/addon/dialog/dialog.css create mode 100755 modules/files/views/default/assets/addon/dialog/dialog.js create mode 100755 modules/files/views/default/assets/addon/display/placeholder.js create mode 100755 modules/files/views/default/assets/addon/edit/closebrackets.js create mode 100755 modules/files/views/default/assets/addon/edit/closetag.js create mode 100755 modules/files/views/default/assets/addon/edit/continuecomment.js create mode 100755 modules/files/views/default/assets/addon/edit/continuelist.js create mode 100755 modules/files/views/default/assets/addon/edit/matchbrackets.js create mode 100755 modules/files/views/default/assets/addon/fold/brace-fold.js create mode 100755 modules/files/views/default/assets/addon/fold/foldcode.js create mode 100755 modules/files/views/default/assets/addon/fold/indent-fold.js create mode 100755 modules/files/views/default/assets/addon/fold/xml-fold.js create mode 100755 modules/files/views/default/assets/addon/hint/html-hint.js create mode 100755 modules/files/views/default/assets/addon/hint/javascript-hint.js create mode 100755 modules/files/views/default/assets/addon/hint/pig-hint.js create mode 100755 modules/files/views/default/assets/addon/hint/python-hint.js create mode 100755 modules/files/views/default/assets/addon/hint/show-hint.css create mode 100755 modules/files/views/default/assets/addon/hint/show-hint.js create mode 100755 modules/files/views/default/assets/addon/hint/xml-hint.js create mode 100755 modules/files/views/default/assets/addon/lint/javascript-lint.js create mode 100755 modules/files/views/default/assets/addon/lint/json-lint.js create mode 100755 modules/files/views/default/assets/addon/lint/lint.css create mode 100755 modules/files/views/default/assets/addon/lint/lint.js create mode 100755 modules/files/views/default/assets/addon/mode/loadmode.js create mode 100755 modules/files/views/default/assets/addon/mode/multiplex.js create mode 100755 modules/files/views/default/assets/addon/mode/overlay.js create mode 100755 modules/files/views/default/assets/addon/runmode/colorize.js create mode 100755 modules/files/views/default/assets/addon/runmode/runmode-standalone.js create mode 100755 modules/files/views/default/assets/addon/runmode/runmode.js create mode 100755 modules/files/views/default/assets/addon/runmode/runmode.node.js create mode 100755 modules/files/views/default/assets/addon/search/match-highlighter.js create mode 100755 modules/files/views/default/assets/addon/search/search.js create mode 100755 modules/files/views/default/assets/addon/search/searchcursor.js create mode 100755 modules/files/views/default/assets/addon/selection/active-line.js create mode 100755 modules/files/views/default/assets/addon/selection/mark-selection.js create mode 100755 modules/files/views/default/assets/jquery/README.txt create mode 100755 modules/files/views/default/assets/jquery/jquery-ui.custom.js create mode 100755 modules/files/views/default/assets/jquery/jquery-ui.custom.min.js create mode 100755 modules/files/views/default/assets/jquery/jquery.cookie.js create mode 100755 modules/files/views/default/assets/jquery/jquery.js create mode 100755 modules/files/views/default/assets/jquery/jquery.min.js create mode 100755 modules/files/views/default/assets/lib/codemirror.css create mode 100755 modules/files/views/default/assets/lib/codemirror.js create mode 100755 modules/files/views/default/assets/mode/apl/apl.js create mode 100755 modules/files/views/default/assets/mode/apl/index.html create mode 100755 modules/files/views/default/assets/mode/asterisk/asterisk.js create mode 100755 modules/files/views/default/assets/mode/asterisk/index.html create mode 100755 modules/files/views/default/assets/mode/clike/clike.js create mode 100755 modules/files/views/default/assets/mode/clike/index.html create mode 100755 modules/files/views/default/assets/mode/clike/scala.html create mode 100755 modules/files/views/default/assets/mode/clojure/clojure.js create mode 100755 modules/files/views/default/assets/mode/clojure/index.html create mode 100755 modules/files/views/default/assets/mode/coffeescript/LICENSE create mode 100755 modules/files/views/default/assets/mode/coffeescript/coffeescript.js create mode 100755 modules/files/views/default/assets/mode/coffeescript/index.html create mode 100755 modules/files/views/default/assets/mode/commonlisp/commonlisp.js create mode 100755 modules/files/views/default/assets/mode/commonlisp/index.html create mode 100755 modules/files/views/default/assets/mode/css/css.js create mode 100755 modules/files/views/default/assets/mode/css/index.html create mode 100755 modules/files/views/default/assets/mode/css/scss.html create mode 100755 modules/files/views/default/assets/mode/css/scss_test.js create mode 100755 modules/files/views/default/assets/mode/css/test.js create mode 100755 modules/files/views/default/assets/mode/d/d.js create mode 100755 modules/files/views/default/assets/mode/d/index.html create mode 100755 modules/files/views/default/assets/mode/diff/diff.js create mode 100755 modules/files/views/default/assets/mode/diff/index.html create mode 100755 modules/files/views/default/assets/mode/ecl/ecl.js create mode 100755 modules/files/views/default/assets/mode/ecl/index.html create mode 100755 modules/files/views/default/assets/mode/erlang/erlang.js create mode 100755 modules/files/views/default/assets/mode/erlang/index.html create mode 100755 modules/files/views/default/assets/mode/gas/gas.js create mode 100755 modules/files/views/default/assets/mode/gas/index.html create mode 100755 modules/files/views/default/assets/mode/gfm/gfm.js create mode 100755 modules/files/views/default/assets/mode/gfm/index.html create mode 100755 modules/files/views/default/assets/mode/gfm/test.js create mode 100755 modules/files/views/default/assets/mode/go/go.js create mode 100755 modules/files/views/default/assets/mode/go/index.html create mode 100755 modules/files/views/default/assets/mode/groovy/groovy.js create mode 100755 modules/files/views/default/assets/mode/groovy/index.html create mode 100755 modules/files/views/default/assets/mode/haskell/haskell.js create mode 100755 modules/files/views/default/assets/mode/haskell/index.html create mode 100755 modules/files/views/default/assets/mode/haxe/haxe.js create mode 100755 modules/files/views/default/assets/mode/haxe/index.html create mode 100755 modules/files/views/default/assets/mode/htmlembedded/htmlembedded.js create mode 100755 modules/files/views/default/assets/mode/htmlembedded/index.html create mode 100755 modules/files/views/default/assets/mode/htmlmixed/htmlmixed.js create mode 100755 modules/files/views/default/assets/mode/htmlmixed/index.html create mode 100755 modules/files/views/default/assets/mode/http/http.js create mode 100755 modules/files/views/default/assets/mode/http/index.html create mode 100755 modules/files/views/default/assets/mode/javascript/index.html create mode 100755 modules/files/views/default/assets/mode/javascript/javascript.js create mode 100755 modules/files/views/default/assets/mode/javascript/typescript.html create mode 100755 modules/files/views/default/assets/mode/jinja2/index.html create mode 100755 modules/files/views/default/assets/mode/jinja2/jinja2.js create mode 100755 modules/files/views/default/assets/mode/less/index.html create mode 100755 modules/files/views/default/assets/mode/less/less.js create mode 100755 modules/files/views/default/assets/mode/livescript/LICENSE create mode 100755 modules/files/views/default/assets/mode/livescript/index.html create mode 100755 modules/files/views/default/assets/mode/livescript/livescript.js create mode 100755 modules/files/views/default/assets/mode/livescript/livescript.ls create mode 100755 modules/files/views/default/assets/mode/lua/index.html create mode 100755 modules/files/views/default/assets/mode/lua/lua.js create mode 100755 modules/files/views/default/assets/mode/markdown/index.html create mode 100755 modules/files/views/default/assets/mode/markdown/markdown.js create mode 100755 modules/files/views/default/assets/mode/markdown/test.js create mode 100755 modules/files/views/default/assets/mode/meta.js create mode 100755 modules/files/views/default/assets/mode/mirc/index.html create mode 100755 modules/files/views/default/assets/mode/mirc/mirc.js create mode 100755 modules/files/views/default/assets/mode/ntriples/index.html create mode 100755 modules/files/views/default/assets/mode/ntriples/ntriples.js create mode 100755 modules/files/views/default/assets/mode/ocaml/index.html create mode 100755 modules/files/views/default/assets/mode/ocaml/ocaml.js create mode 100755 modules/files/views/default/assets/mode/pascal/LICENSE create mode 100755 modules/files/views/default/assets/mode/pascal/index.html create mode 100755 modules/files/views/default/assets/mode/pascal/pascal.js create mode 100755 modules/files/views/default/assets/mode/perl/LICENSE create mode 100755 modules/files/views/default/assets/mode/perl/index.html create mode 100755 modules/files/views/default/assets/mode/perl/perl.js create mode 100755 modules/files/views/default/assets/mode/php/index.html create mode 100755 modules/files/views/default/assets/mode/php/php.js create mode 100755 modules/files/views/default/assets/mode/pig/index.html create mode 100755 modules/files/views/default/assets/mode/pig/pig.js create mode 100755 modules/files/views/default/assets/mode/properties/index.html create mode 100755 modules/files/views/default/assets/mode/properties/properties.js create mode 100755 modules/files/views/default/assets/mode/python/LICENSE.txt create mode 100755 modules/files/views/default/assets/mode/python/index.html create mode 100755 modules/files/views/default/assets/mode/python/python.js create mode 100755 modules/files/views/default/assets/mode/q/index.html create mode 100755 modules/files/views/default/assets/mode/q/q.js create mode 100755 modules/files/views/default/assets/mode/r/LICENSE create mode 100755 modules/files/views/default/assets/mode/r/index.html create mode 100755 modules/files/views/default/assets/mode/r/r.js create mode 100755 modules/files/views/default/assets/mode/rpm/changes/changes.js create mode 100755 modules/files/views/default/assets/mode/rpm/changes/index.html create mode 100755 modules/files/views/default/assets/mode/rpm/spec/index.html create mode 100755 modules/files/views/default/assets/mode/rpm/spec/spec.css create mode 100755 modules/files/views/default/assets/mode/rpm/spec/spec.js create mode 100755 modules/files/views/default/assets/mode/rst/LICENSE.txt create mode 100755 modules/files/views/default/assets/mode/rst/index.html create mode 100755 modules/files/views/default/assets/mode/rst/rst.js create mode 100755 modules/files/views/default/assets/mode/ruby/LICENSE create mode 100755 modules/files/views/default/assets/mode/ruby/index.html create mode 100755 modules/files/views/default/assets/mode/ruby/ruby.js create mode 100755 modules/files/views/default/assets/mode/rust/index.html create mode 100755 modules/files/views/default/assets/mode/rust/rust.js create mode 100755 modules/files/views/default/assets/mode/sass/index.html create mode 100755 modules/files/views/default/assets/mode/sass/sass.js create mode 100755 modules/files/views/default/assets/mode/scheme/index.html create mode 100755 modules/files/views/default/assets/mode/scheme/scheme.js create mode 100755 modules/files/views/default/assets/mode/shell/index.html create mode 100755 modules/files/views/default/assets/mode/shell/shell.js create mode 100755 modules/files/views/default/assets/mode/sieve/LICENSE create mode 100755 modules/files/views/default/assets/mode/sieve/index.html create mode 100755 modules/files/views/default/assets/mode/sieve/sieve.js create mode 100755 modules/files/views/default/assets/mode/smalltalk/index.html create mode 100755 modules/files/views/default/assets/mode/smalltalk/smalltalk.js create mode 100755 modules/files/views/default/assets/mode/smarty/index.html create mode 100755 modules/files/views/default/assets/mode/smarty/smarty.js create mode 100755 modules/files/views/default/assets/mode/sparql/index.html create mode 100755 modules/files/views/default/assets/mode/sparql/sparql.js create mode 100755 modules/files/views/default/assets/mode/sql/index.html create mode 100755 modules/files/views/default/assets/mode/sql/sql.js create mode 100755 modules/files/views/default/assets/mode/stex/index.html create mode 100755 modules/files/views/default/assets/mode/stex/stex.js create mode 100755 modules/files/views/default/assets/mode/stex/test.js create mode 100755 modules/files/views/default/assets/mode/tcl/index.html create mode 100755 modules/files/views/default/assets/mode/tcl/tcl.js create mode 100755 modules/files/views/default/assets/mode/tiddlywiki/index.html create mode 100755 modules/files/views/default/assets/mode/tiddlywiki/tiddlywiki.css create mode 100755 modules/files/views/default/assets/mode/tiddlywiki/tiddlywiki.js create mode 100755 modules/files/views/default/assets/mode/tiki/index.html create mode 100755 modules/files/views/default/assets/mode/tiki/tiki.css create mode 100755 modules/files/views/default/assets/mode/tiki/tiki.js create mode 100755 modules/files/views/default/assets/mode/turtle/index.html create mode 100755 modules/files/views/default/assets/mode/turtle/turtle.js create mode 100755 modules/files/views/default/assets/mode/vb/LICENSE.txt create mode 100755 modules/files/views/default/assets/mode/vb/index.html create mode 100755 modules/files/views/default/assets/mode/vb/vb.js create mode 100755 modules/files/views/default/assets/mode/vbscript/index.html create mode 100755 modules/files/views/default/assets/mode/vbscript/vbscript.js create mode 100755 modules/files/views/default/assets/mode/velocity/index.html create mode 100755 modules/files/views/default/assets/mode/velocity/velocity.js create mode 100755 modules/files/views/default/assets/mode/verilog/index.html create mode 100755 modules/files/views/default/assets/mode/verilog/verilog.js create mode 100755 modules/files/views/default/assets/mode/xml/index.html create mode 100755 modules/files/views/default/assets/mode/xml/xml.js create mode 100755 modules/files/views/default/assets/mode/xquery/LICENSE create mode 100755 modules/files/views/default/assets/mode/xquery/index.html create mode 100755 modules/files/views/default/assets/mode/xquery/test.js create mode 100755 modules/files/views/default/assets/mode/xquery/xquery.js create mode 100755 modules/files/views/default/assets/mode/yaml/index.html create mode 100755 modules/files/views/default/assets/mode/yaml/yaml.js create mode 100755 modules/files/views/default/assets/mode/z80/index.html create mode 100755 modules/files/views/default/assets/mode/z80/z80.js create mode 100755 modules/files/views/default/assets/src/GPL-LICENSE.txt create mode 100755 modules/files/views/default/assets/src/MIT-License.txt create mode 100755 modules/files/views/default/assets/src/jquery.dynatree.js create mode 100755 modules/files/views/default/assets/src/skin-vista/icons.gif create mode 100755 modules/files/views/default/assets/src/skin-vista/loading.gif create mode 100755 modules/files/views/default/assets/src/skin-vista/ui.dynatree.css create mode 100755 modules/files/views/default/assets/src/skin/icons-rtl.gif create mode 100755 modules/files/views/default/assets/src/skin/icons.gif create mode 100755 modules/files/views/default/assets/src/skin/loading.gif create mode 100755 modules/files/views/default/assets/src/skin/ui.dynatree.css create mode 100755 modules/files/views/default/assets/src/skin/vline-rtl.gif create mode 100755 modules/files/views/default/assets/src/skin/vline.gif create mode 100755 modules/files/views/default/assets/theme/ambiance-mobile.css create mode 100755 modules/files/views/default/assets/theme/ambiance.css create mode 100755 modules/files/views/default/assets/theme/blackboard.css create mode 100755 modules/files/views/default/assets/theme/cobalt.css create mode 100755 modules/files/views/default/assets/theme/eclipse.css create mode 100755 modules/files/views/default/assets/theme/elegant.css create mode 100755 modules/files/views/default/assets/theme/erlang-dark.css create mode 100755 modules/files/views/default/assets/theme/lesser-dark.css create mode 100755 modules/files/views/default/assets/theme/midnight.css create mode 100755 modules/files/views/default/assets/theme/monokai.css create mode 100755 modules/files/views/default/assets/theme/neat.css create mode 100755 modules/files/views/default/assets/theme/night.css create mode 100755 modules/files/views/default/assets/theme/rubyblue.css create mode 100755 modules/files/views/default/assets/theme/solarized.css create mode 100755 modules/files/views/default/assets/theme/twilight.css create mode 100755 modules/files/views/default/assets/theme/vibrant-ink.css create mode 100755 modules/files/views/default/assets/theme/xq-dark.css create mode 100755 modules/files/views/default/assets/theme/xq-light.css create mode 100755 modules/files/views/default/index.php diff --git a/config/modules/files.php b/config/modules/files.php new file mode 100644 index 0000000..d8300c6 --- /dev/null +++ b/config/modules/files.php @@ -0,0 +1,9 @@ + array( + 'class' => 'application.modules.files.FilesModule', + ), + 'import' => array(), + 'component' => array(), + 'rules' => array(), +); diff --git a/modules/files/FilesModule.php b/modules/files/FilesModule.php new file mode 100755 index 0000000..ff0995d --- /dev/null +++ b/modules/files/FilesModule.php @@ -0,0 +1,146 @@ + + *@version 1.0 + **/ + +class FilesModule extends YWebModule +{ + /** + * Категория модуля: + * + * @return string category + */ + public function getCategory() + { + return Yii::t('FilesModule.files', 'Юпи!'); + } + + /** + * Название модуля: + * + * @return string module name + */ + public function getName() + { + return Yii::t('FilesModule.files', 'Файловый редактор'); + } + + /** + * Описание модуля: + * + * @return string module description + */ + public function getDescription() + { + return Yii::t('FilesModule.files', 'Модуль для просмотра и редактирования файлов'); + } + + /** + * Автор модуля: + * + * @return string module author + */ + public function getAuthor() + { + return Yii::t('FilesModule.files', 'SergeyMiracle'); + } + + /** + * E-mail адрес автора модуля: + * + * @return string module author email + */ + public function getAuthorEmail() + { + return Yii::t('FilesModule.files', 'sergeymiracle@gmail.com'); + } + + /** + * Домашняя страница модуля: + * + * @return string module homepage + */ + public function getUrl() + { + return Yii::t('FilesModule.files', 'https://github.com/SergeyMiracle/Yupe-file-editor'); + } + + /** + * Иконка модуля: + * + * @return string module icon + */ + public function getIcon() + { + return "folder-open"; + } + + /** + * Версия модуля: + * + * @return string module version + */ + public function getVersion() + { + return Yii::t('FilesModule.files', '0.1'); + } + + /** + * Меню для "верхушки" (возможно с чайлдами) + * + * @return array меню для "верхушки" + **/ + public function getTopMenu() + { + return array( + array( + 'label' => Yii::t('FilesModule.files', 'Файловый редактор'), + 'url' => array('/files/show/index', 'file' => 'index'), + 'icon' => 'folder-open', + ), + ); + } + + /** + * Меню для сайдбара + * + * @return array меню для сайдбара + **/ + public function getLeftMenu() + { + return array( + array( + 'label' => Yii::t('FilesModule.files', 'Файловый редактор'), + 'url' => array('/files/show/index', 'file' => 'index'), + 'icon' => 'home', + ), + ); + } + + public function init() + { + parent::init(); + + $this->setImport(array( + 'files.models.*', + 'files.components.*', + )); + } + + public function beforeControllerAction($controller, $action) + { + if(parent::beforeControllerAction($controller, $action)) + { + // this method is called before any module controller action is performed + // you may place customized code here + return true; + } + else + return false; + } + +} diff --git a/modules/files/controllers/DefaultController.php b/modules/files/controllers/DefaultController.php new file mode 100755 index 0000000..d29d5b0 --- /dev/null +++ b/modules/files/controllers/DefaultController.php @@ -0,0 +1,69 @@ +render('index'); + } + + /* + *Функция возвращает json ответ для плагина dynatree + */ + public function actionInit($key) + { + $dir = $key; + if ($handle = opendir($dir)) { + $dirs = array(); + $files = array(); + while (false !== ($entry = readdir($handle))) { + + if ($entry{0} == '.') continue; + if (is_dir($dir.'/'.$entry)) { + /*Массив директорий*/ + $dirs[] = array('title'=>$entry, 'isFolder' => true, 'isLazy' => true, 'url' => $dir.'/'.$entry); + } else { + /*Массив файлов*/ + $files[] = array('title'=>$entry, 'url' => $dir.'/'.$entry); + } + } + } + sort($dirs); + sort($files); + $output = array_merge($dirs, $files); + if (Yii::app()->request->isAjaxRequest) + { + echo CJSON::encode($output); + Yii::app()->end(); + } + } + + /* Получаем контент файла*/ + public function actiongetFileContent($key) { + $fcontent = file_get_contents($key); + if (Yii::app()->request->isAjaxRequest) + { + /*избегаем повторной загрузки скриптов*/ + Yii::app()->clientScript->scriptMap['*.js'] = false; + Yii::app()->clientScript->scriptMap['*.css'] = false; + $this->renderPartial('_form', array('fcontent'=>$fcontent, 'path' => $key), false, true); + } + } + /*Сохраняем изменения в файл*/ + public function actionUpdateFile() + { if (Yii::app()->request->isAjaxRequest){ + $c = $_POST['codemirror']; + $file = $_POST['path']; + if(!$file) + { + return false; + Yii::app()->end(); + } else { + file_put_contents($file, $c); + Yii::app()->end(); + } + } + } + +} \ No newline at end of file diff --git a/modules/files/views/default/_form.php b/modules/files/views/default/_form.php new file mode 100755 index 0000000..37b7cba --- /dev/null +++ b/modules/files/views/default/_form.php @@ -0,0 +1,60 @@ + + + + + + + +beginWidget('CActiveForm', array( + 'id'=>'cd-form', + 'enableAjaxValidation'=>false, +)); ?> + + +
+ 'POST', + 'update' => '#codemirror', + 'success' => 'function(data) { + $("#flash").clearQueue().fadeIn(1000).delay(1000).fadeOut(4000); + }', + 'error' => 'function(data) { + $("#flash_error").clearQueue().fadeIn(1000).delay(1000).fadeOut(4000); + }', +), + array( + 'type' => 'submit', + 'id' => md5($path).time(), + 'name' => 'cd-form', + 'class' => 'btn btn-primary', +)); + +?> +endWidget(); ?> \ No newline at end of file diff --git a/modules/files/views/default/assets/addon/dialog/dialog.css b/modules/files/views/default/assets/addon/dialog/dialog.css new file mode 100755 index 0000000..2e7c0fc --- /dev/null +++ b/modules/files/views/default/assets/addon/dialog/dialog.css @@ -0,0 +1,32 @@ +.CodeMirror-dialog { + position: absolute; + left: 0; right: 0; + background: white; + z-index: 15; + padding: .1em .8em; + overflow: hidden; + color: #333; +} + +.CodeMirror-dialog-top { + border-bottom: 1px solid #eee; + top: 0; +} + +.CodeMirror-dialog-bottom { + border-top: 1px solid #eee; + bottom: 0; +} + +.CodeMirror-dialog input { + border: none; + outline: none; + background: transparent; + width: 20em; + color: inherit; + font-family: monospace; +} + +.CodeMirror-dialog button { + font-size: 70%; +} diff --git a/modules/files/views/default/assets/addon/dialog/dialog.js b/modules/files/views/default/assets/addon/dialog/dialog.js new file mode 100755 index 0000000..71e2287 --- /dev/null +++ b/modules/files/views/default/assets/addon/dialog/dialog.js @@ -0,0 +1,80 @@ +// Open simple dialogs on top of an editor. Relies on dialog.css. + +(function() { + function dialogDiv(cm, template, bottom) { + var wrap = cm.getWrapperElement(); + var dialog; + dialog = wrap.appendChild(document.createElement("div")); + if (bottom) { + dialog.className = "CodeMirror-dialog CodeMirror-dialog-bottom"; + } else { + dialog.className = "CodeMirror-dialog CodeMirror-dialog-top"; + } + dialog.innerHTML = template; + return dialog; + } + + CodeMirror.defineExtension("openDialog", function(template, callback, options) { + var dialog = dialogDiv(this, template, options && options.bottom); + var closed = false, me = this; + function close() { + if (closed) return; + closed = true; + dialog.parentNode.removeChild(dialog); + } + var inp = dialog.getElementsByTagName("input")[0], button; + if (inp) { + CodeMirror.on(inp, "keydown", function(e) { + if (options && options.onKeyDown && options.onKeyDown(e, inp.value, close)) { return; } + if (e.keyCode == 13 || e.keyCode == 27) { + CodeMirror.e_stop(e); + close(); + me.focus(); + if (e.keyCode == 13) callback(inp.value); + } + }); + if (options && options.onKeyUp) { + CodeMirror.on(inp, "keyup", function(e) {options.onKeyUp(e, inp.value, close);}); + } + if (options && options.value) inp.value = options.value; + inp.focus(); + CodeMirror.on(inp, "blur", close); + } else if (button = dialog.getElementsByTagName("button")[0]) { + CodeMirror.on(button, "click", function() { + close(); + me.focus(); + }); + button.focus(); + CodeMirror.on(button, "blur", close); + } + return close; + }); + + CodeMirror.defineExtension("openConfirm", function(template, callbacks, options) { + var dialog = dialogDiv(this, template, options && options.bottom); + var buttons = dialog.getElementsByTagName("button"); + var closed = false, me = this, blurring = 1; + function close() { + if (closed) return; + closed = true; + dialog.parentNode.removeChild(dialog); + me.focus(); + } + buttons[0].focus(); + for (var i = 0; i < buttons.length; ++i) { + var b = buttons[i]; + (function(callback) { + CodeMirror.on(b, "click", function(e) { + CodeMirror.e_preventDefault(e); + close(); + if (callback) callback(me); + }); + })(callbacks[i]); + CodeMirror.on(b, "blur", function() { + --blurring; + setTimeout(function() { if (blurring <= 0) close(); }, 200); + }); + CodeMirror.on(b, "focus", function() { ++blurring; }); + } + }); +})(); diff --git a/modules/files/views/default/assets/addon/display/placeholder.js b/modules/files/views/default/assets/addon/display/placeholder.js new file mode 100755 index 0000000..f85f2df --- /dev/null +++ b/modules/files/views/default/assets/addon/display/placeholder.js @@ -0,0 +1,54 @@ +(function() { + CodeMirror.defineOption("placeholder", "", function(cm, val, old) { + var prev = old && old != CodeMirror.Init; + if (val && !prev) { + cm.on("focus", onFocus); + cm.on("blur", onBlur); + cm.on("change", onChange); + onChange(cm); + } else if (!val && prev) { + cm.off("focus", onFocus); + cm.off("blur", onBlur); + cm.off("change", onChange); + clearPlaceholder(cm); + var wrapper = cm.getWrapperElement(); + wrapper.className = wrapper.className.replace(" CodeMirror-empty", ""); + } + + if (val && !cm.hasFocus()) onBlur(cm); + }); + + function clearPlaceholder(cm) { + if (cm._placeholder) { + cm._placeholder.parentNode.removeChild(cm._placeholder); + cm._placeholder = null; + } + } + function setPlaceholder(cm) { + clearPlaceholder(cm); + var elt = cm._placeholder = document.createElement("pre"); + elt.style.cssText = "height: 0; overflow: visible"; + elt.className = "CodeMirror-placeholder"; + elt.appendChild(document.createTextNode(cm.getOption("placeholder"))); + cm.display.lineSpace.insertBefore(elt, cm.display.lineSpace.firstChild); + } + + function onFocus(cm) { + clearPlaceholder(cm); + } + function onBlur(cm) { + if (isEmpty(cm)) setPlaceholder(cm); + } + function onChange(cm) { + var wrapper = cm.getWrapperElement(), empty = isEmpty(cm); + wrapper.className = wrapper.className.replace(" CodeMirror-empty", "") + (empty ? " CodeMirror-empty" : ""); + + if (cm.hasFocus()) return; + if (empty) setPlaceholder(cm); + else clearPlaceholder(cm); + } + + function isEmpty(cm) { + return (cm.lineCount() === 1) && (cm.getLine(0) === ""); + } +})(); diff --git a/modules/files/views/default/assets/addon/edit/closebrackets.js b/modules/files/views/default/assets/addon/edit/closebrackets.js new file mode 100755 index 0000000..43902ae --- /dev/null +++ b/modules/files/views/default/assets/addon/edit/closebrackets.js @@ -0,0 +1,54 @@ +(function() { + var DEFAULT_BRACKETS = "()[]{}''\"\""; + var SPACE_CHAR_REGEX = /\s/; + + CodeMirror.defineOption("autoCloseBrackets", false, function(cm, val, old) { + var wasOn = old && old != CodeMirror.Init; + if (val && !wasOn) + cm.addKeyMap(buildKeymap(typeof val == "string" ? val : DEFAULT_BRACKETS)); + else if (!val && wasOn) + cm.removeKeyMap("autoCloseBrackets"); + }); + + function buildKeymap(pairs) { + var map = { + name : "autoCloseBrackets", + Backspace: function(cm) { + if (cm.somethingSelected()) return CodeMirror.Pass; + var cur = cm.getCursor(), line = cm.getLine(cur.line); + if (cur.ch && cur.ch < line.length && + pairs.indexOf(line.slice(cur.ch - 1, cur.ch + 1)) % 2 == 0) + cm.replaceRange("", CodeMirror.Pos(cur.line, cur.ch - 1), CodeMirror.Pos(cur.line, cur.ch + 1)); + else + return CodeMirror.Pass; + } + }; + var closingBrackets = []; + for (var i = 0; i < pairs.length; i += 2) (function(left, right) { + if (left != right) closingBrackets.push(right); + function surround(cm) { + var selection = cm.getSelection(); + cm.replaceSelection(left + selection + right); + } + function maybeOverwrite(cm) { + var cur = cm.getCursor(), ahead = cm.getRange(cur, CodeMirror.Pos(cur.line, cur.ch + 1)); + if (ahead != right || cm.somethingSelected()) return CodeMirror.Pass; + else cm.execCommand("goCharRight"); + } + map["'" + left + "'"] = function(cm) { + if (left == "'" && cm.getTokenAt(cm.getCursor()).type == "comment") + return CodeMirror.Pass; + if (cm.somethingSelected()) return surround(cm); + if (left == right && maybeOverwrite(cm) != CodeMirror.Pass) return; + var cur = cm.getCursor(), ahead = CodeMirror.Pos(cur.line, cur.ch + 1); + var line = cm.getLine(cur.line), nextChar = line.charAt(cur.ch); + if (line.length == cur.ch || closingBrackets.indexOf(nextChar) >= 0 || SPACE_CHAR_REGEX.test(nextChar)) + cm.replaceSelection(left + right, {head: ahead, anchor: ahead}); + else + return CodeMirror.Pass; + }; + if (left != right) map["'" + right + "'"] = maybeOverwrite; + })(pairs.charAt(i), pairs.charAt(i + 1)); + return map; + } +})(); diff --git a/modules/files/views/default/assets/addon/edit/closetag.js b/modules/files/views/default/assets/addon/edit/closetag.js new file mode 100755 index 0000000..454dfea --- /dev/null +++ b/modules/files/views/default/assets/addon/edit/closetag.js @@ -0,0 +1,86 @@ +/** + * Tag-closer extension for CodeMirror. + * + * This extension adds an "autoCloseTags" option that can be set to + * either true to get the default behavior, or an object to further + * configure its behavior. + * + * These are supported options: + * + * `whenClosing` (default true) + * Whether to autoclose when the '/' of a closing tag is typed. + * `whenOpening` (default true) + * Whether to autoclose the tag when the final '>' of an opening + * tag is typed. + * `dontCloseTags` (default is empty tags for HTML, none for XML) + * An array of tag names that should not be autoclosed. + * `indentTags` (default is block tags for HTML, none for XML) + * An array of tag names that should, when opened, cause a + * blank line to be added inside the tag, and the blank line and + * closing line to be indented. + * + * See demos/closetag.html for a usage example. + */ + +(function() { + CodeMirror.defineOption("autoCloseTags", false, function(cm, val, old) { + if (val && (old == CodeMirror.Init || !old)) { + var map = {name: "autoCloseTags"}; + if (typeof val != "object" || val.whenClosing) + map["'/'"] = function(cm) { return autoCloseTag(cm, '/'); }; + if (typeof val != "object" || val.whenOpening) + map["'>'"] = function(cm) { return autoCloseTag(cm, '>'); }; + cm.addKeyMap(map); + } else if (!val && (old != CodeMirror.Init && old)) { + cm.removeKeyMap("autoCloseTags"); + } + }); + + var htmlDontClose = ["area", "base", "br", "col", "command", "embed", "hr", "img", "input", "keygen", "link", "meta", "param", + "source", "track", "wbr"]; + var htmlIndent = ["applet", "blockquote", "body", "button", "div", "dl", "fieldset", "form", "frameset", "h1", "h2", "h3", "h4", + "h5", "h6", "head", "html", "iframe", "layer", "legend", "object", "ol", "p", "select", "table", "ul"]; + + function autoCloseTag(cm, ch) { + var pos = cm.getCursor(), tok = cm.getTokenAt(pos); + var inner = CodeMirror.innerMode(cm.getMode(), tok.state), state = inner.state; + if (inner.mode.name != "xml") return CodeMirror.Pass; + + var opt = cm.getOption("autoCloseTags"), html = inner.mode.configuration == "html"; + var dontCloseTags = (typeof opt == "object" && opt.dontCloseTags) || (html && htmlDontClose); + var indentTags = (typeof opt == "object" && opt.indentTags) || (html && htmlIndent); + + if (ch == ">" && state.tagName) { + var tagName = state.tagName; + if (tok.end > pos.ch) tagName = tagName.slice(0, tagName.length - tok.end + pos.ch); + var lowerTagName = tagName.toLowerCase(); + // Don't process the '>' at the end of an end-tag or self-closing tag + if (tok.type == "tag" && state.type == "closeTag" || + tok.string.indexOf("/") == (tok.string.length - 1) || // match something like + dontCloseTags && indexOf(dontCloseTags, lowerTagName) > -1) + return CodeMirror.Pass; + + var doIndent = indentTags && indexOf(indentTags, lowerTagName) > -1; + var curPos = doIndent ? CodeMirror.Pos(pos.line + 1, 0) : CodeMirror.Pos(pos.line, pos.ch + 1); + cm.replaceSelection(">" + (doIndent ? "\n\n" : "") + "", + {head: curPos, anchor: curPos}); + if (doIndent) { + cm.indentLine(pos.line + 1); + cm.indentLine(pos.line + 2); + } + return; + } else if (ch == "/" && tok.string == "<") { + var tagName = state.context && state.context.tagName; + if (tagName) cm.replaceSelection("/" + tagName + ">", "end"); + return; + } + return CodeMirror.Pass; + } + + function indexOf(collection, elt) { + if (collection.indexOf) return collection.indexOf(elt); + for (var i = 0, e = collection.length; i < e; ++i) + if (collection[i] == elt) return i; + return -1; + } +})(); diff --git a/modules/files/views/default/assets/addon/edit/continuecomment.js b/modules/files/views/default/assets/addon/edit/continuecomment.js new file mode 100755 index 0000000..3080262 --- /dev/null +++ b/modules/files/views/default/assets/addon/edit/continuecomment.js @@ -0,0 +1,44 @@ +(function() { + var modes = ["clike", "css", "javascript"]; + for (var i = 0; i < modes.length; ++i) + CodeMirror.extendMode(modes[i], {blockCommentStart: "/*", + blockCommentEnd: "*/", + blockCommentContinue: " * "}); + + function continueComment(cm) { + var pos = cm.getCursor(), token = cm.getTokenAt(pos); + var mode = CodeMirror.innerMode(cm.getMode(), token.state).mode; + var space; + + if (token.type == "comment" && mode.blockCommentStart) { + var end = token.string.indexOf(mode.blockCommentEnd); + var full = cm.getRange(CodeMirror.Pos(pos.line, 0), CodeMirror.Pos(pos.line, token.end)), found; + if (end != -1 && end == token.string.length - mode.blockCommentEnd.length) { + // Comment ended, don't continue it + } else if (token.string.indexOf(mode.blockCommentStart) == 0) { + space = full.slice(0, token.start); + if (!/^\s*$/.test(space)) { + space = ""; + for (var i = 0; i < token.start; ++i) space += " "; + } + } else if ((found = full.indexOf(mode.blockCommentContinue)) != -1 && + found + mode.blockCommentContinue.length > token.start && + /^\s*$/.test(full.slice(0, found))) { + space = full.slice(0, found); + } + } + + if (space != null) + cm.replaceSelection("\n" + space + mode.blockCommentContinue, "end"); + else + return CodeMirror.Pass; + } + + CodeMirror.defineOption("continueComments", null, function(cm, val, prev) { + if (prev && prev != CodeMirror.Init) + cm.removeKeyMap("continueComment"); + var map = {name: "continueComment"}; + map[typeof val == "string" ? val : "Enter"] = continueComment; + cm.addKeyMap(map); + }); +})(); diff --git a/modules/files/views/default/assets/addon/edit/continuelist.js b/modules/files/views/default/assets/addon/edit/continuelist.js new file mode 100755 index 0000000..fb1fc38 --- /dev/null +++ b/modules/files/views/default/assets/addon/edit/continuelist.js @@ -0,0 +1,25 @@ +(function() { + 'use strict'; + + var listRE = /^(\s*)([*+-]|(\d+)\.)(\s*)/, + unorderedBullets = '*+-'; + + CodeMirror.commands.newlineAndIndentContinueMarkdownList = function(cm) { + var pos = cm.getCursor(), + inList = cm.getStateAfter(pos.line).list, + match; + + if (!inList || !(match = cm.getLine(pos.line).match(listRE))) { + cm.execCommand('newlineAndIndent'); + return; + } + + var indent = match[1], after = match[4]; + var bullet = unorderedBullets.indexOf(match[2]) >= 0 + ? match[2] + : (parseInt(match[3], 10) + 1) + '.'; + + cm.replaceSelection('\n' + indent + bullet + after, 'end'); + }; + +}()); diff --git a/modules/files/views/default/assets/addon/edit/matchbrackets.js b/modules/files/views/default/assets/addon/edit/matchbrackets.js new file mode 100755 index 0000000..e4ff914 --- /dev/null +++ b/modules/files/views/default/assets/addon/edit/matchbrackets.js @@ -0,0 +1,82 @@ +(function() { + var ie_lt8 = /MSIE \d/.test(navigator.userAgent) && + (document.documentMode == null || document.documentMode < 8); + + var Pos = CodeMirror.Pos; + + var matching = {"(": ")>", ")": "(<", "[": "]>", "]": "[<", "{": "}>", "}": "{<"}; + function findMatchingBracket(cm) { + var maxScanLen = cm.state._matchBrackets.maxScanLineLength || 10000; + + var cur = cm.getCursor(), line = cm.getLineHandle(cur.line), pos = cur.ch - 1; + var match = (pos >= 0 && matching[line.text.charAt(pos)]) || matching[line.text.charAt(++pos)]; + if (!match) return null; + var forward = match.charAt(1) == ">", d = forward ? 1 : -1; + var style = cm.getTokenAt(Pos(cur.line, pos + 1)).type; + + var stack = [line.text.charAt(pos)], re = /[(){}[\]]/; + function scan(line, lineNo, start) { + if (!line.text) return; + var pos = forward ? 0 : line.text.length - 1, end = forward ? line.text.length : -1; + if (line.text.length > maxScanLen) return null; + var checkTokenStyles = line.text.length < 1000; + if (start != null) pos = start + d; + for (; pos != end; pos += d) { + var ch = line.text.charAt(pos); + if (re.test(ch) && (!checkTokenStyles || cm.getTokenAt(Pos(lineNo, pos + 1)).type == style)) { + var match = matching[ch]; + if (match.charAt(1) == ">" == forward) stack.push(ch); + else if (stack.pop() != match.charAt(0)) return {pos: pos, match: false}; + else if (!stack.length) return {pos: pos, match: true}; + } + } + } + for (var i = cur.line, found, e = forward ? Math.min(i + 100, cm.lineCount()) : Math.max(-1, i - 100); i != e; i+=d) { + if (i == cur.line) found = scan(line, i, pos); + else found = scan(cm.getLineHandle(i), i); + if (found) break; + } + return {from: Pos(cur.line, pos), to: found && Pos(i, found.pos), match: found && found.match}; + } + + function matchBrackets(cm, autoclear) { + // Disable brace matching in long lines, since it'll cause hugely slow updates + var maxHighlightLen = cm.state._matchBrackets.maxHighlightLineLength || 1000; + var found = findMatchingBracket(cm); + if (!found || cm.getLine(found.from.line).length > maxHighlightLen || + found.to && cm.getLine(found.to.line).length > maxHighlightLen) + return; + + var style = found.match ? "CodeMirror-matchingbracket" : "CodeMirror-nonmatchingbracket"; + var one = cm.markText(found.from, Pos(found.from.line, found.from.ch + 1), {className: style}); + var two = found.to && cm.markText(found.to, Pos(found.to.line, found.to.ch + 1), {className: style}); + // Kludge to work around the IE bug from issue #1193, where text + // input stops going to the textare whever this fires. + if (ie_lt8 && cm.state.focused) cm.display.input.focus(); + var clear = function() { + cm.operation(function() { one.clear(); two && two.clear(); }); + }; + if (autoclear) setTimeout(clear, 800); + else return clear; + } + + var currentlyHighlighted = null; + function doMatchBrackets(cm) { + cm.operation(function() { + if (currentlyHighlighted) {currentlyHighlighted(); currentlyHighlighted = null;} + if (!cm.somethingSelected()) currentlyHighlighted = matchBrackets(cm, false); + }); + } + + CodeMirror.defineOption("matchBrackets", false, function(cm, val, old) { + if (old && old != CodeMirror.Init) + cm.off("cursorActivity", doMatchBrackets); + if (val) { + cm.state._matchBrackets = typeof val == "object" ? val : {}; + cm.on("cursorActivity", doMatchBrackets); + } + }); + + CodeMirror.defineExtension("matchBrackets", function() {matchBrackets(this, true);}); + CodeMirror.defineExtension("findMatchingBracket", function(){return findMatchingBracket(this);}); +})(); diff --git a/modules/files/views/default/assets/addon/fold/brace-fold.js b/modules/files/views/default/assets/addon/fold/brace-fold.js new file mode 100755 index 0000000..dc78883 --- /dev/null +++ b/modules/files/views/default/assets/addon/fold/brace-fold.js @@ -0,0 +1,31 @@ +CodeMirror.braceRangeFinder = function(cm, start) { + var line = start.line, lineText = cm.getLine(line); + var at = lineText.length, startChar, tokenType; + for (; at > 0;) { + var found = lineText.lastIndexOf("{", at); + if (found < start.ch) break; + tokenType = cm.getTokenAt(CodeMirror.Pos(line, found + 1)).type; + if (!/^(comment|string)/.test(tokenType)) { startChar = found; break; } + at = found - 1; + } + if (startChar == null || lineText.lastIndexOf("}") > startChar) return; + var count = 1, lastLine = cm.lineCount(), end, endCh; + outer: for (var i = line + 1; i < lastLine; ++i) { + var text = cm.getLine(i), pos = 0; + for (;;) { + var nextOpen = text.indexOf("{", pos), nextClose = text.indexOf("}", pos); + if (nextOpen < 0) nextOpen = text.length; + if (nextClose < 0) nextClose = text.length; + pos = Math.min(nextOpen, nextClose); + if (pos == text.length) break; + if (cm.getTokenAt(CodeMirror.Pos(i, pos + 1)).type == tokenType) { + if (pos == nextOpen) ++count; + else if (!--count) { end = i; endCh = pos; break outer; } + } + ++pos; + } + } + if (end == null || end == line + 1) return; + return {from: CodeMirror.Pos(line, startChar + 1), + to: CodeMirror.Pos(end, endCh)}; +}; diff --git a/modules/files/views/default/assets/addon/fold/foldcode.js b/modules/files/views/default/assets/addon/fold/foldcode.js new file mode 100755 index 0000000..b8b4b0d --- /dev/null +++ b/modules/files/views/default/assets/addon/fold/foldcode.js @@ -0,0 +1,32 @@ +CodeMirror.newFoldFunction = function(rangeFinder, widget) { + if (widget == null) widget = "\u2194"; + if (typeof widget == "string") { + var text = document.createTextNode(widget); + widget = document.createElement("span"); + widget.appendChild(text); + widget.className = "CodeMirror-foldmarker"; + } + + return function(cm, pos) { + if (typeof pos == "number") pos = CodeMirror.Pos(pos, 0); + var range = rangeFinder(cm, pos); + if (!range) return; + + var present = cm.findMarksAt(range.from), cleared = 0; + for (var i = 0; i < present.length; ++i) { + if (present[i].__isFold) { + ++cleared; + present[i].clear(); + } + } + if (cleared) return; + + var myWidget = widget.cloneNode(true); + CodeMirror.on(myWidget, "mousedown", function() {myRange.clear();}); + var myRange = cm.markText(range.from, range.to, { + replacedWith: myWidget, + clearOnEnter: true, + __isFold: true + }); + }; +}; diff --git a/modules/files/views/default/assets/addon/fold/indent-fold.js b/modules/files/views/default/assets/addon/fold/indent-fold.js new file mode 100755 index 0000000..94a0a1f --- /dev/null +++ b/modules/files/views/default/assets/addon/fold/indent-fold.js @@ -0,0 +1,11 @@ +CodeMirror.indentRangeFinder = function(cm, start) { + var tabSize = cm.getOption("tabSize"), firstLine = cm.getLine(start.line); + var myIndent = CodeMirror.countColumn(firstLine, null, tabSize); + for (var i = start.line + 1, end = cm.lineCount(); i < end; ++i) { + var curLine = cm.getLine(i); + if (CodeMirror.countColumn(curLine, null, tabSize) < myIndent && + CodeMirror.countColumn(cm.getLine(i-1), null, tabSize) > myIndent) + return {from: CodeMirror.Pos(start.line, firstLine.length), + to: CodeMirror.Pos(i, curLine.length)}; + } +}; diff --git a/modules/files/views/default/assets/addon/fold/xml-fold.js b/modules/files/views/default/assets/addon/fold/xml-fold.js new file mode 100755 index 0000000..79c524d --- /dev/null +++ b/modules/files/views/default/assets/addon/fold/xml-fold.js @@ -0,0 +1,64 @@ +CodeMirror.tagRangeFinder = (function() { + var nameStartChar = "A-Z_a-z\\u00C0-\\u00D6\\u00D8-\\u00F6\\u00F8-\\u02FF\\u0370-\\u037D\\u037F-\\u1FFF\\u200C-\\u200D\\u2070-\\u218F\\u2C00-\\u2FEF\\u3001-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFFD"; + var nameChar = nameStartChar + "\-\:\.0-9\\u00B7\\u0300-\\u036F\\u203F-\\u2040"; + var xmlTagStart = new RegExp("<(/?)([" + nameStartChar + "][" + nameChar + "]*)", "g"); + + return function(cm, start) { + var line = start.line, ch = start.ch, lineText = cm.getLine(line); + + function nextLine() { + if (line >= cm.lastLine()) return; + ch = 0; + lineText = cm.getLine(++line); + return true; + } + function toTagEnd() { + for (;;) { + var gt = lineText.indexOf(">", ch); + if (gt == -1) { if (nextLine()) continue; else return; } + var lastSlash = lineText.lastIndexOf("/", gt); + var selfClose = lastSlash > -1 && /^\s*$/.test(lineText.slice(lastSlash + 1, gt)); + ch = gt + 1; + return selfClose ? "selfClose" : "regular"; + } + } + function toNextTag() { + for (;;) { + xmlTagStart.lastIndex = ch; + var found = xmlTagStart.exec(lineText); + if (!found) { if (nextLine()) continue; else return; } + ch = found.index + found[0].length; + return found; + } + } + + var stack = [], startCh; + for (;;) { + var openTag = toNextTag(), end; + if (!openTag || line != start.line || !(end = toTagEnd())) return; + if (!openTag[1] && end != "selfClose") { + stack.push(openTag[2]); + startCh = ch; + break; + } + } + + for (;;) { + var next = toNextTag(), end, tagLine = line, tagCh = ch - (next ? next[0].length : 0); + if (!next || !(end = toTagEnd())) return; + if (end == "selfClose") continue; + if (next[1]) { // closing tag + for (var i = stack.length - 1; i >= 0; --i) if (stack[i] == next[2]) { + stack.length = i; + break; + } + if (!stack.length) return { + from: CodeMirror.Pos(start.line, startCh), + to: CodeMirror.Pos(tagLine, tagCh) + }; + } else { // opening tag + stack.push(next[2]); + } + } + }; +})(); diff --git a/modules/files/views/default/assets/addon/hint/html-hint.js b/modules/files/views/default/assets/addon/hint/html-hint.js new file mode 100755 index 0000000..8b5dc6f --- /dev/null +++ b/modules/files/views/default/assets/addon/hint/html-hint.js @@ -0,0 +1,582 @@ +(function () { + function htmlHint(editor, htmlStructure, getToken) { + var cur = editor.getCursor(); + var token = getToken(editor, cur); + var keywords = []; + var i = 0; + var j = 0; + var k = 0; + var from = {line: cur.line, ch: cur.ch}; + var to = {line: cur.line, ch: cur.ch}; + var flagClean = true; + + var text = editor.getRange({line: 0, ch: 0}, cur); + + var open = text.lastIndexOf('<'); + var close = text.lastIndexOf('>'); + var tokenString = token.string.replace("<",""); + + if(open > close) { + var last = editor.getRange({line: cur.line, ch: cur.ch - 1}, cur); + if(last == "<") { + for(i = 0; i < htmlStructure.length; i++) { + keywords.push(htmlStructure[i].tag); + } + from.ch = token.start + 1; + } else { + var counter = 0; + var found = function(token, type, position) { + counter++; + if(counter > 50) return; + if(token.type == type) { + return token; + } else { + position.ch = token.start; + var newToken = editor.getTokenAt(position); + return found(newToken, type, position); + } + }; + + var nodeToken = found(token, "tag", {line: cur.line, ch: cur.ch}); + var node = nodeToken.string.substring(1); + + if(token.type === null && token.string.trim() === "") { + for(i = 0; i < htmlStructure.length; i++) { + if(htmlStructure[i].tag == node) { + for(j = 0; j < htmlStructure[i].attr.length; j++) { + keywords.push(htmlStructure[i].attr[j].key + "=\"\" "); + } + + for(k = 0; k < globalAttributes.length; k++) { + keywords.push(globalAttributes[k].key + "=\"\" "); + } + } + } + } else if(token.type == "string") { + tokenString = tokenString.substring(1, tokenString.length - 1); + var attributeToken = found(token, "attribute", {line: cur.line, ch: cur.ch}); + var attribute = attributeToken.string; + + for(i = 0; i < htmlStructure.length; i++) { + if(htmlStructure[i].tag == node) { + for(j = 0; j < htmlStructure[i].attr.length; j++) { + if(htmlStructure[i].attr[j].key == attribute) { + for(k = 0; k < htmlStructure[i].attr[j].values.length; k++) { + keywords.push(htmlStructure[i].attr[j].values[k]); + } + } + } + + for(j = 0; j < globalAttributes.length; j++) { + if(globalAttributes[j].key == attribute) { + for(k = 0; k < globalAttributes[j].values.length; k++) { + keywords.push(globalAttributes[j].values[k]); + } + } + } + } + } + from.ch = token.start + 1; + } else if(token.type == "attribute") { + for(i = 0; i < htmlStructure.length; i++) { + if(htmlStructure[i].tag == node) { + for(j = 0; j < htmlStructure[i].attr.length; j++) { + keywords.push(htmlStructure[i].attr[j].key + "=\"\" "); + } + + for(k = 0; k < globalAttributes.length; k++) { + keywords.push(globalAttributes[k].key + "=\"\" "); + } + } + } + from.ch = token.start; + } else if(token.type == "tag") { + for(i = 0; i < htmlStructure.length; i++) { + keywords.push(htmlStructure[i].tag); + } + + from.ch = token.start + 1; + } + } + } else { + for(i = 0; i < htmlStructure.length; i++) { + keywords.push("<" + htmlStructure[i].tag); + } + + tokenString = ("<" + tokenString).trim(); + from.ch = token.start; + } + + if(flagClean === true && tokenString.trim() === "") { + flagClean = false; + } + + if(flagClean) { + keywords = cleanResults(tokenString, keywords); + } + + return {list: keywords, from: from, to: to}; + } + + + var cleanResults = function(text, keywords) { + var results = []; + var i = 0; + + for(i = 0; i < keywords.length; i++) { + if(keywords[i].substring(0, text.length) == text) { + results.push(keywords[i]); + } + } + + return results; + }; + + var htmlStructure = [ + {tag: '!DOCTYPE', attr: []}, + {tag: 'a', attr: [ + {key: 'href', values: ["#"]}, + {key: 'target', values: ["_blank","_self","_top","_parent"]}, + {key: 'ping', values: [""]}, + {key: 'media', values: ["#"]}, + {key: 'hreflang', values: ["en","es"]}, + {key: 'type', values: []} + ]}, + {tag: 'abbr', attr: []}, + {tag: 'acronym', attr: []}, + {tag: 'address', attr: []}, + {tag: 'applet', attr: []}, + {tag: 'area', attr: [ + {key: 'alt', values: [""]}, + {key: 'coords', values: ["rect: left, top, right, bottom","circle: center-x, center-y, radius","poly: x1, y1, x2, y2, ..."]}, + {key: 'shape', values: ["default","rect","circle","poly"]}, + {key: 'href', values: ["#"]}, + {key: 'target', values: ["#"]}, + {key: 'ping', values: []}, + {key: 'media', values: []}, + {key: 'hreflang', values: []}, + {key: 'type', values: []} + + ]}, + {tag: 'article', attr: []}, + {tag: 'aside', attr: []}, + {tag: 'audio', attr: [ + {key: 'src', values: []}, + {key: 'crossorigin', values: ["anonymous","use-credentials"]}, + {key: 'preload', values: ["none","metadata","auto"]}, + {key: 'autoplay', values: ["","autoplay"]}, + {key: 'mediagroup', values: []}, + {key: 'loop', values: ["","loop"]}, + {key: 'controls', values: ["","controls"]} + ]}, + {tag: 'b', attr: []}, + {tag: 'base', attr: [ + {key: 'href', values: ["#"]}, + {key: 'target', values: ["_blank","_self","_top","_parent"]} + ]}, + {tag: 'basefont', attr: []}, + {tag: 'bdi', attr: []}, + {tag: 'bdo', attr: []}, + {tag: 'big', attr: []}, + {tag: 'blockquote', attr: [ + {key: 'cite', values: ["http://"]} + ]}, + {tag: 'body', attr: []}, + {tag: 'br', attr: []}, + {tag: 'button', attr: [ + {key: 'autofocus', values: ["","autofocus"]}, + {key: 'disabled', values: ["","disabled"]}, + {key: 'form', values: []}, + {key: 'formaction', values: []}, + {key: 'formenctype', values: ["application/x-www-form-urlencoded","multipart/form-data","text/plain"]}, + {key: 'formmethod', values: ["get","post","put","delete"]}, + {key: 'formnovalidate', values: ["","novalidate"]}, + {key: 'formtarget', values: ["_blank","_self","_top","_parent"]}, + {key: 'name', values: []}, + {key: 'type', values: ["submit","reset","button"]}, + {key: 'value', values: []} + ]}, + {tag: 'canvas', attr: [ + {key: 'width', values: []}, + {key: 'height', values: []} + ]}, + {tag: 'caption', attr: []}, + {tag: 'center', attr: []}, + {tag: 'cite', attr: []}, + {tag: 'code', attr: []}, + {tag: 'col', attr: [ + {key: 'span', values: []} + ]}, + {tag: 'colgroup', attr: [ + {key: 'span', values: []} + ]}, + {tag: 'command', attr: [ + {key: 'type', values: ["command","checkbox","radio"]}, + {key: 'label', values: []}, + {key: 'icon', values: []}, + {key: 'disabled', values: ["","disabled"]}, + {key: 'checked', values: ["","checked"]}, + {key: 'radiogroup', values: []}, + {key: 'command', values: []}, + {key: 'title', values: []} + ]}, + {tag: 'data', attr: [ + {key: 'value', values: []} + ]}, + {tag: 'datagrid', attr: [ + {key: 'disabled', values: ["","disabled"]}, + {key: 'multiple', values: ["","multiple"]} + ]}, + {tag: 'datalist', attr: [ + {key: 'data', values: []} + ]}, + {tag: 'dd', attr: []}, + {tag: 'del', attr: [ + {key: 'cite', values: []}, + {key: 'datetime', values: []} + ]}, + {tag: 'details', attr: [ + {key: 'open', values: ["","open"]} + ]}, + {tag: 'dfn', attr: []}, + {tag: 'dir', attr: []}, + {tag: 'div', attr: [ + {key: 'id', values: []}, + {key: 'class', values: []}, + {key: 'style', values: []} + ]}, + {tag: 'dl', attr: []}, + {tag: 'dt', attr: []}, + {tag: 'em', attr: []}, + {tag: 'embed', attr: [ + {key: 'src', values: []}, + {key: 'type', values: []}, + {key: 'width', values: []}, + {key: 'height', values: []} + ]}, + {tag: 'eventsource', attr: [ + {key: 'src', values: []} + ]}, + {tag: 'fieldset', attr: [ + {key: 'disabled', values: ["","disabled"]}, + {key: 'form', values: []}, + {key: 'name', values: []} + ]}, + {tag: 'figcaption', attr: []}, + {tag: 'figure', attr: []}, + {tag: 'font', attr: []}, + {tag: 'footer', attr: []}, + {tag: 'form', attr: [ + {key: 'accept-charset', values: ["UNKNOWN","utf-8"]}, + {key: 'action', values: []}, + {key: 'autocomplete', values: ["on","off"]}, + {key: 'enctype', values: ["application/x-www-form-urlencoded","multipart/form-data","text/plain"]}, + {key: 'method', values: ["get","post","put","delete","dialog"]}, + {key: 'name', values: []}, + {key: 'novalidate', values: ["","novalidate"]}, + {key: 'target', values: ["_blank","_self","_top","_parent"]} + ]}, + {tag: 'frame', attr: []}, + {tag: 'frameset', attr: []}, + {tag: 'h1', attr: []}, + {tag: 'h2', attr: []}, + {tag: 'h3', attr: []}, + {tag: 'h4', attr: []}, + {tag: 'h5', attr: []}, + {tag: 'h6', attr: []}, + {tag: 'head', attr: []}, + {tag: 'header', attr: []}, + {tag: 'hgroup', attr: []}, + {tag: 'hr', attr: []}, + {tag: 'html', attr: [ + {key: 'manifest', values: []} + ]}, + {tag: 'i', attr: []}, + {tag: 'iframe', attr: [ + {key: 'src', values: []}, + {key: 'srcdoc', values: []}, + {key: 'name', values: []}, + {key: 'sandbox', values: ["allow-top-navigation","allow-same-origin","allow-forms","allow-scripts"]}, + {key: 'seamless', values: ["","seamless"]}, + {key: 'width', values: []}, + {key: 'height', values: []} + ]}, + {tag: 'img', attr: [ + {key: 'alt', values: []}, + {key: 'src', values: []}, + {key: 'crossorigin', values: ["anonymous","use-credentials"]}, + {key: 'ismap', values: []}, + {key: 'usemap', values: []}, + {key: 'width', values: []}, + {key: 'height', values: []} + ]}, + {tag: 'input', attr: [ + {key: 'accept', values: ["audio/*","video/*","image/*"]}, + {key: 'alt', values: []}, + {key: 'autocomplete', values: ["on","off"]}, + {key: 'autofocus', values: ["","autofocus"]}, + {key: 'checked', values: ["","checked"]}, + {key: 'disabled', values: ["","disabled"]}, + {key: 'dirname', values: []}, + {key: 'form', values: []}, + {key: 'formaction', values: []}, + {key: 'formenctype', values: ["application/x-www-form-urlencoded","multipart/form-data","text/plain"]}, + {key: 'formmethod', values: ["get","post","put","delete"]}, + {key: 'formnovalidate', values: ["","novalidate"]}, + {key: 'formtarget', values: ["_blank","_self","_top","_parent"]}, + {key: 'height', values: []}, + {key: 'list', values: []}, + {key: 'max', values: []}, + {key: 'maxlength', values: []}, + {key: 'min', values: []}, + {key: 'multiple', values: ["","multiple"]}, + {key: 'name', values: []}, + {key: 'pattern', values: []}, + {key: 'placeholder', values: []}, + {key: 'readonly', values: ["","readonly"]}, + {key: 'required', values: ["","required"]}, + {key: 'size', values: []}, + {key: 'src', values: []}, + {key: 'step', values: []}, + {key: 'type', values: [ + "hidden","text","search","tel","url","email","password","datetime","date","month","week","time","datetime-local", + "number","range","color","checkbox","radio","file","submit","image","reset","button" + ]}, + {key: 'value', values: []}, + {key: 'width', values: []} + ]}, + {tag: 'ins', attr: [ + {key: 'cite', values: []}, + {key: 'datetime', values: []} + ]}, + {tag: 'kbd', attr: []}, + {tag: 'keygen', attr: [ + {key: 'autofocus', values: ["","autofocus"]}, + {key: 'challenge', values: []}, + {key: 'disabled', values: ["","disabled"]}, + {key: 'form', values: []}, + {key: 'keytype', values: ["RSA"]}, + {key: 'name', values: []} + ]}, + {tag: 'label', attr: [ + {key: 'for', values: []}, + {key: 'form', values: []} + ]}, + {tag: 'legend', attr: []}, + {tag: 'li', attr: [ + {key: 'value', values: []} + ]}, + {tag: 'link', attr: [ + {key: 'href', values: []}, + {key: 'hreflang', values: ["en","es"]}, + {key: 'media', values: [ + "all","screen","print","embossed","braille","handheld","print","projection","screen","tty","tv","speech","3d-glasses", + "resolution [>][<][=] [X]dpi","resolution [>][<][=] [X]dpcm","device-aspect-ratio: 16/9","device-aspect-ratio: 4/3", + "device-aspect-ratio: 32/18","device-aspect-ratio: 1280/720","device-aspect-ratio: 2560/1440","orientation:portrait", + "orientation:landscape","device-height: [X]px","device-width: [X]px","-webkit-min-device-pixel-ratio: 2" + ]}, + {key: 'type', values: []}, + {key: 'sizes', values: ["all","16x16","16x16 32x32","16x16 32x32 64x64"]} + ]}, + {tag: 'map', attr: [ + {key: 'name', values: []} + ]}, + {tag: 'mark', attr: []}, + {tag: 'menu', attr: [ + {key: 'type', values: ["list","context","toolbar"]}, + {key: 'label', values: []} + ]}, + {tag: 'meta', attr: [ + {key: 'charset', attr: ["utf-8"]}, + {key: 'name', attr: ["viewport","application-name","author","description","generator","keywords"]}, + {key: 'content', attr: ["","width=device-width","initial-scale=1, maximum-scale=1, minimun-scale=1, user-scale=no"]}, + {key: 'http-equiv', attr: ["content-language","content-type","default-style","refresh"]} + ]}, + {tag: 'meter', attr: [ + {key: 'value', values: []}, + {key: 'min', values: []}, + {key: 'low', values: []}, + {key: 'high', values: []}, + {key: 'max', values: []}, + {key: 'optimum', values: []} + ]}, + {tag: 'nav', attr: []}, + {tag: 'noframes', attr: []}, + {tag: 'noscript', attr: []}, + {tag: 'object', attr: [ + {key: 'data', values: []}, + {key: 'type', values: []}, + {key: 'typemustmatch', values: ["","typemustmatch"]}, + {key: 'name', values: []}, + {key: 'usemap', values: []}, + {key: 'form', values: []}, + {key: 'width', values: []}, + {key: 'height', values: []} + ]}, + {tag: 'ol', attr: [ + {key: 'reversed', values: ["", "reversed"]}, + {key: 'start', values: []}, + {key: 'type', values: ["1","a","A","i","I"]} + ]}, + {tag: 'optgroup', attr: [ + {key: 'disabled', values: ["","disabled"]}, + {key: 'label', values: []} + ]}, + {tag: 'option', attr: [ + {key: 'disabled', values: ["", "disabled"]}, + {key: 'label', values: []}, + {key: 'selected', values: ["", "selected"]}, + {key: 'value', values: []} + ]}, + {tag: 'output', attr: [ + {key: 'for', values: []}, + {key: 'form', values: []}, + {key: 'name', values: []} + ]}, + {tag: 'p', attr: []}, + {tag: 'param', attr: [ + {key: 'name', values: []}, + {key: 'value', values: []} + ]}, + {tag: 'pre', attr: []}, + {tag: 'progress', attr: [ + {key: 'value', values: []}, + {key: 'max', values: []} + ]}, + {tag: 'q', attr: [ + {key: 'cite', values: []} + ]}, + {tag: 'rp', attr: []}, + {tag: 'rt', attr: []}, + {tag: 'ruby', attr: []}, + {tag: 's', attr: []}, + {tag: 'samp', attr: []}, + {tag: 'script', attr: [ + {key: 'type', values: ["text/javascript"]}, + {key: 'src', values: []}, + {key: 'async', values: ["","async"]}, + {key: 'defer', values: ["","defer"]}, + {key: 'charset', values: ["utf-8"]} + ]}, + {tag: 'section', attr: []}, + {tag: 'select', attr: [ + {key: 'autofocus', values: ["", "autofocus"]}, + {key: 'disabled', values: ["", "disabled"]}, + {key: 'form', values: []}, + {key: 'multiple', values: ["", "multiple"]}, + {key: 'name', values: []}, + {key: 'size', values: []} + ]}, + {tag: 'small', attr: []}, + {tag: 'source', attr: [ + {key: 'src', values: []}, + {key: 'type', values: []}, + {key: 'media', values: []} + ]}, + {tag: 'span', attr: []}, + {tag: 'strike', attr: []}, + {tag: 'strong', attr: []}, + {tag: 'style', attr: [ + {key: 'type', values: ["text/css"]}, + {key: 'media', values: ["all","braille","print","projection","screen","speech"]}, + {key: 'scoped', values: []} + ]}, + {tag: 'sub', attr: []}, + {tag: 'summary', attr: []}, + {tag: 'sup', attr: []}, + {tag: 'table', attr: [ + {key: 'border', values: []} + ]}, + {tag: 'tbody', attr: []}, + {tag: 'td', attr: [ + {key: 'colspan', values: []}, + {key: 'rowspan', values: []}, + {key: 'headers', values: []} + ]}, + {tag: 'textarea', attr: [ + {key: 'autofocus', values: ["","autofocus"]}, + {key: 'disabled', values: ["","disabled"]}, + {key: 'dirname', values: []}, + {key: 'form', values: []}, + {key: 'maxlength', values: []}, + {key: 'name', values: []}, + {key: 'placeholder', values: []}, + {key: 'readonly', values: ["","readonly"]}, + {key: 'required', values: ["","required"]}, + {key: 'rows', values: []}, + {key: 'cols', values: []}, + {key: 'wrap', values: ["soft","hard"]} + ]}, + {tag: 'tfoot', attr: []}, + {tag: 'th', attr: [ + {key: 'colspan', values: []}, + {key: 'rowspan', values: []}, + {key: 'headers', values: []}, + {key: 'scope', values: ["row","col","rowgroup","colgroup"]} + ]}, + {tag: 'thead', attr: []}, + {tag: 'time', attr: [ + {key: 'datetime', values: []} + ]}, + {tag: 'title', attr: []}, + {tag: 'tr', attr: []}, + {tag: 'track', attr: [ + {key: 'kind', values: ["subtitles","captions","descriptions","chapters","metadata"]}, + {key: 'src', values: []}, + {key: 'srclang', values: ["en","es"]}, + {key: 'label', values: []}, + {key: 'default', values: []} + ]}, + {tag: 'tt', attr: []}, + {tag: 'u', attr: []}, + {tag: 'ul', attr: []}, + {tag: 'var', attr: []}, + {tag: 'video', attr: [ + {key: "src", values: []}, + {key: "crossorigin", values: ["anonymous","use-credentials"]}, + {key: "poster", values: []}, + {key: "preload", values: ["auto","metadata","none"]}, + {key: "autoplay", values: ["","autoplay"]}, + {key: "mediagroup", values: ["movie"]}, + {key: "loop", values: ["","loop"]}, + {key: "muted", values: ["","muted"]}, + {key: "controls", values: ["","controls"]}, + {key: "width", values: []}, + {key: "height", values: []} + ]}, + {tag: 'wbr', attr: []} + ]; + + var globalAttributes = [ + {key: "accesskey", values: ["a","b","c","d","e","f","g","h","i","j","k","l","m","n","o","p","q","r","s","t","u","v","w","x","y","z","0","1","2","3","4","5","6","7","8","9"]}, + {key: "class", values: []}, + {key: "contenteditable", values: ["true", "false"]}, + {key: "contextmenu", values: []}, + {key: "dir", values: ["ltr","rtl","auto"]}, + {key: "draggable", values: ["true","false","auto"]}, + {key: "dropzone", values: ["copy","move","link","string:","file:"]}, + {key: "hidden", values: ["hidden"]}, + {key: "id", values: []}, + {key: "inert", values: ["inert"]}, + {key: "itemid", values: []}, + {key: "itemprop", values: []}, + {key: "itemref", values: []}, + {key: "itemscope", values: ["itemscope"]}, + {key: "itemtype", values: []}, + {key: "lang", values: ["en","es"]}, + {key: "spellcheck", values: ["true","false"]}, + {key: "style", values: []}, + {key: "tabindex", values: ["1","2","3","4","5","6","7","8","9"]}, + {key: "title", values: []}, + {key: "translate", values: ["yes","no"]}, + {key: "onclick", values: []}, + {key: 'rel', values: ["stylesheet","alternate","author","bookmark","help","license","next","nofollow","noreferrer","prefetch","prev","search","tag"]} + ]; + + CodeMirror.htmlHint = function(editor) { + if(String.prototype.trim == undefined) { + String.prototype.trim=function(){return this.replace(/^\s+|\s+$/g, '');}; + } + return htmlHint(editor, htmlStructure, function (e, cur) { return e.getTokenAt(cur); }); + }; +})(); diff --git a/modules/files/views/default/assets/addon/hint/javascript-hint.js b/modules/files/views/default/assets/addon/hint/javascript-hint.js new file mode 100755 index 0000000..b961c5a --- /dev/null +++ b/modules/files/views/default/assets/addon/hint/javascript-hint.js @@ -0,0 +1,142 @@ +(function () { + var Pos = CodeMirror.Pos; + + function forEach(arr, f) { + for (var i = 0, e = arr.length; i < e; ++i) f(arr[i]); + } + + function arrayContains(arr, item) { + if (!Array.prototype.indexOf) { + var i = arr.length; + while (i--) { + if (arr[i] === item) { + return true; + } + } + return false; + } + return arr.indexOf(item) != -1; + } + + function scriptHint(editor, keywords, getToken, options) { + // Find the token at the cursor + var cur = editor.getCursor(), token = getToken(editor, cur), tprop = token; + token.state = CodeMirror.innerMode(editor.getMode(), token.state).state; + + // If it's not a 'word-style' token, ignore the token. + if (!/^[\w$_]*$/.test(token.string)) { + token = tprop = {start: cur.ch, end: cur.ch, string: "", state: token.state, + type: token.string == "." ? "property" : null}; + } + // If it is a property, find out what it is a property of. + while (tprop.type == "property") { + tprop = getToken(editor, Pos(cur.line, tprop.start)); + if (tprop.string != ".") return; + tprop = getToken(editor, Pos(cur.line, tprop.start)); + if (tprop.string == ')') { + var level = 1; + do { + tprop = getToken(editor, Pos(cur.line, tprop.start)); + switch (tprop.string) { + case ')': level++; break; + case '(': level--; break; + default: break; + } + } while (level > 0); + tprop = getToken(editor, Pos(cur.line, tprop.start)); + if (tprop.type.indexOf("variable") === 0) + tprop.type = "function"; + else return; // no clue + } + if (!context) var context = []; + context.push(tprop); + } + return {list: getCompletions(token, context, keywords, options), + from: Pos(cur.line, token.start), + to: Pos(cur.line, token.end)}; + } + + CodeMirror.javascriptHint = function(editor, options) { + return scriptHint(editor, javascriptKeywords, + function (e, cur) {return e.getTokenAt(cur);}, + options); + }; + + function getCoffeeScriptToken(editor, cur) { + // This getToken, it is for coffeescript, imitates the behavior of + // getTokenAt method in javascript.js, that is, returning "property" + // type and treat "." as indepenent token. + var token = editor.getTokenAt(cur); + if (cur.ch == token.start + 1 && token.string.charAt(0) == '.') { + token.end = token.start; + token.string = '.'; + token.type = "property"; + } + else if (/^\.[\w$_]*$/.test(token.string)) { + token.type = "property"; + token.start++; + token.string = token.string.replace(/\./, ''); + } + return token; + } + + CodeMirror.coffeescriptHint = function(editor, options) { + return scriptHint(editor, coffeescriptKeywords, getCoffeeScriptToken, options); + }; + + var stringProps = ("charAt charCodeAt indexOf lastIndexOf substring substr slice trim trimLeft trimRight " + + "toUpperCase toLowerCase split concat match replace search").split(" "); + var arrayProps = ("length concat join splice push pop shift unshift slice reverse sort indexOf " + + "lastIndexOf every some filter forEach map reduce reduceRight ").split(" "); + var funcProps = "prototype apply call bind".split(" "); + var javascriptKeywords = ("break case catch continue debugger default delete do else false finally for function " + + "if in instanceof new null return switch throw true try typeof var void while with").split(" "); + var coffeescriptKeywords = ("and break catch class continue delete do else extends false finally for " + + "if in instanceof isnt new no not null of off on or return switch then throw true try typeof until void while with yes").split(" "); + + function getCompletions(token, context, keywords, options) { + var found = [], start = token.string; + function maybeAdd(str) { + if (str.indexOf(start) == 0 && !arrayContains(found, str)) found.push(str); + } + function gatherCompletions(obj) { + if (typeof obj == "string") forEach(stringProps, maybeAdd); + else if (obj instanceof Array) forEach(arrayProps, maybeAdd); + else if (obj instanceof Function) forEach(funcProps, maybeAdd); + for (var name in obj) maybeAdd(name); + } + + if (context) { + // If this is a property, see if it belongs to some object we can + // find in the current environment. + var obj = context.pop(), base; + if (obj.type.indexOf("variable") === 0) { + if (options && options.additionalContext) + base = options.additionalContext[obj.string]; + base = base || window[obj.string]; + } else if (obj.type == "string") { + base = ""; + } else if (obj.type == "atom") { + base = 1; + } else if (obj.type == "function") { + if (window.jQuery != null && (obj.string == '$' || obj.string == 'jQuery') && + (typeof window.jQuery == 'function')) + base = window.jQuery(); + else if (window._ != null && (obj.string == '_') && (typeof window._ == 'function')) + base = window._(); + } + while (base != null && context.length) + base = base[context.pop().string]; + if (base != null) gatherCompletions(base); + } + else { + // If not, just look in the window object and any local scope + // (reading into JS mode internals to get at the local and global variables) + for (var v = token.state.localVars; v; v = v.next) maybeAdd(v.name); + for (var v = token.state.globalVars; v; v = v.next) maybeAdd(v.name); + gatherCompletions(window); + forEach(keywords, maybeAdd); + } + return found; + } +})(); diff --git a/modules/files/views/default/assets/addon/hint/pig-hint.js b/modules/files/views/default/assets/addon/hint/pig-hint.js new file mode 100755 index 0000000..d831ccf --- /dev/null +++ b/modules/files/views/default/assets/addon/hint/pig-hint.js @@ -0,0 +1,117 @@ +(function () { + function forEach(arr, f) { + for (var i = 0, e = arr.length; i < e; ++i) f(arr[i]); + } + + function arrayContains(arr, item) { + if (!Array.prototype.indexOf) { + var i = arr.length; + while (i--) { + if (arr[i] === item) { + return true; + } + } + return false; + } + return arr.indexOf(item) != -1; + } + + function scriptHint(editor, _keywords, getToken) { + // Find the token at the cursor + var cur = editor.getCursor(), token = getToken(editor, cur), tprop = token; + // If it's not a 'word-style' token, ignore the token. + + if (!/^[\w$_]*$/.test(token.string)) { + token = tprop = {start: cur.ch, end: cur.ch, string: "", state: token.state, + className: token.string == ":" ? "pig-type" : null}; + } + + if (!context) var context = []; + context.push(tprop); + + var completionList = getCompletions(token, context); + completionList = completionList.sort(); + //prevent autocomplete for last word, instead show dropdown with one word + if(completionList.length == 1) { + completionList.push(" "); + } + + return {list: completionList, + from: CodeMirror.Pos(cur.line, token.start), + to: CodeMirror.Pos(cur.line, token.end)}; + } + + CodeMirror.pigHint = function(editor) { + return scriptHint(editor, pigKeywordsU, function (e, cur) {return e.getTokenAt(cur);}); + }; + + var pigKeywords = "VOID IMPORT RETURNS DEFINE LOAD FILTER FOREACH ORDER CUBE DISTINCT COGROUP " + + "JOIN CROSS UNION SPLIT INTO IF OTHERWISE ALL AS BY USING INNER OUTER ONSCHEMA PARALLEL " + + "PARTITION GROUP AND OR NOT GENERATE FLATTEN ASC DESC IS STREAM THROUGH STORE MAPREDUCE " + + "SHIP CACHE INPUT OUTPUT STDERROR STDIN STDOUT LIMIT SAMPLE LEFT RIGHT FULL EQ GT LT GTE LTE " + + "NEQ MATCHES TRUE FALSE"; + var pigKeywordsU = pigKeywords.split(" "); + var pigKeywordsL = pigKeywords.toLowerCase().split(" "); + + var pigTypes = "BOOLEAN INT LONG FLOAT DOUBLE CHARARRAY BYTEARRAY BAG TUPLE MAP"; + var pigTypesU = pigTypes.split(" "); + var pigTypesL = pigTypes.toLowerCase().split(" "); + + var pigBuiltins = "ABS ACOS ARITY ASIN ATAN AVG BAGSIZE BINSTORAGE BLOOM BUILDBLOOM CBRT CEIL " + + "CONCAT COR COS COSH COUNT COUNT_STAR COV CONSTANTSIZE CUBEDIMENSIONS DIFF DISTINCT DOUBLEABS " + + "DOUBLEAVG DOUBLEBASE DOUBLEMAX DOUBLEMIN DOUBLEROUND DOUBLESUM EXP FLOOR FLOATABS FLOATAVG " + + "FLOATMAX FLOATMIN FLOATROUND FLOATSUM GENERICINVOKER INDEXOF INTABS INTAVG INTMAX INTMIN " + + "INTSUM INVOKEFORDOUBLE INVOKEFORFLOAT INVOKEFORINT INVOKEFORLONG INVOKEFORSTRING INVOKER " + + "ISEMPTY JSONLOADER JSONMETADATA JSONSTORAGE LAST_INDEX_OF LCFIRST LOG LOG10 LOWER LONGABS " + + "LONGAVG LONGMAX LONGMIN LONGSUM MAX MIN MAPSIZE MONITOREDUDF NONDETERMINISTIC OUTPUTSCHEMA " + + "PIGSTORAGE PIGSTREAMING RANDOM REGEX_EXTRACT REGEX_EXTRACT_ALL REPLACE ROUND SIN SINH SIZE " + + "SQRT STRSPLIT SUBSTRING SUM STRINGCONCAT STRINGMAX STRINGMIN STRINGSIZE TAN TANH TOBAG " + + "TOKENIZE TOMAP TOP TOTUPLE TRIM TEXTLOADER TUPLESIZE UCFIRST UPPER UTF8STORAGECONVERTER"; + var pigBuiltinsU = pigBuiltins.split(" ").join("() ").split(" "); + var pigBuiltinsL = pigBuiltins.toLowerCase().split(" ").join("() ").split(" "); + var pigBuiltinsC = ("BagSize BinStorage Bloom BuildBloom ConstantSize CubeDimensions DoubleAbs " + + "DoubleAvg DoubleBase DoubleMax DoubleMin DoubleRound DoubleSum FloatAbs FloatAvg FloatMax " + + "FloatMin FloatRound FloatSum GenericInvoker IntAbs IntAvg IntMax IntMin IntSum " + + "InvokeForDouble InvokeForFloat InvokeForInt InvokeForLong InvokeForString Invoker " + + "IsEmpty JsonLoader JsonMetadata JsonStorage LongAbs LongAvg LongMax LongMin LongSum MapSize " + + "MonitoredUDF Nondeterministic OutputSchema PigStorage PigStreaming StringConcat StringMax " + + "StringMin StringSize TextLoader TupleSize Utf8StorageConverter").split(" ").join("() ").split(" "); + + function getCompletions(token, context) { + var found = [], start = token.string; + function maybeAdd(str) { + if (str.indexOf(start) == 0 && !arrayContains(found, str)) found.push(str); + } + + function gatherCompletions(obj) { + if(obj == ":") { + forEach(pigTypesL, maybeAdd); + } + else { + forEach(pigBuiltinsU, maybeAdd); + forEach(pigBuiltinsL, maybeAdd); + forEach(pigBuiltinsC, maybeAdd); + forEach(pigTypesU, maybeAdd); + forEach(pigTypesL, maybeAdd); + forEach(pigKeywordsU, maybeAdd); + forEach(pigKeywordsL, maybeAdd); + } + } + + if (context) { + // If this is a property, see if it belongs to some object we can + // find in the current environment. + var obj = context.pop(), base; + + if (obj.type == "variable") + base = obj.string; + else if(obj.type == "variable-3") + base = ":" + obj.string; + + while (base != null && context.length) + base = base[context.pop().string]; + if (base != null) gatherCompletions(base); + } + return found; + } +})(); diff --git a/modules/files/views/default/assets/addon/hint/python-hint.js b/modules/files/views/default/assets/addon/hint/python-hint.js new file mode 100755 index 0000000..60221b8 --- /dev/null +++ b/modules/files/views/default/assets/addon/hint/python-hint.js @@ -0,0 +1,93 @@ +(function () { + function forEach(arr, f) { + for (var i = 0, e = arr.length; i < e; ++i) f(arr[i]); + } + + function arrayContains(arr, item) { + if (!Array.prototype.indexOf) { + var i = arr.length; + while (i--) { + if (arr[i] === item) { + return true; + } + } + return false; + } + return arr.indexOf(item) != -1; + } + + function scriptHint(editor, _keywords, getToken) { + // Find the token at the cursor + var cur = editor.getCursor(), token = getToken(editor, cur), tprop = token; + // If it's not a 'word-style' token, ignore the token. + + if (!/^[\w$_]*$/.test(token.string)) { + token = tprop = {start: cur.ch, end: cur.ch, string: "", state: token.state, + className: token.string == ":" ? "python-type" : null}; + } + + if (!context) var context = []; + context.push(tprop); + + var completionList = getCompletions(token, context); + completionList = completionList.sort(); + //prevent autocomplete for last word, instead show dropdown with one word + if(completionList.length == 1) { + completionList.push(" "); + } + + return {list: completionList, + from: CodeMirror.Pos(cur.line, token.start), + to: CodeMirror.Pos(cur.line, token.end)}; + } + + CodeMirror.pythonHint = function(editor) { + return scriptHint(editor, pythonKeywordsU, function (e, cur) {return e.getTokenAt(cur);}); + }; + + var pythonKeywords = "and del from not while as elif global or with assert else if pass yield" ++ "break except import print class exec in raise continue finally is return def for lambda try"; + var pythonKeywordsL = pythonKeywords.split(" "); + var pythonKeywordsU = pythonKeywords.toUpperCase().split(" "); + + var pythonBuiltins = "abs divmod input open staticmethod all enumerate int ord str " ++ "any eval isinstance pow sum basestring execfile issubclass print super" ++ "bin file iter property tuple bool filter len range type" ++ "bytearray float list raw_input unichr callable format locals reduce unicode" ++ "chr frozenset long reload vars classmethod getattr map repr xrange" ++ "cmp globals max reversed zip compile hasattr memoryview round __import__" ++ "complex hash min set apply delattr help next setattr buffer" ++ "dict hex object slice coerce dir id oct sorted intern "; + var pythonBuiltinsL = pythonBuiltins.split(" ").join("() ").split(" "); + var pythonBuiltinsU = pythonBuiltins.toUpperCase().split(" ").join("() ").split(" "); + + function getCompletions(token, context) { + var found = [], start = token.string; + function maybeAdd(str) { + if (str.indexOf(start) == 0 && !arrayContains(found, str)) found.push(str); + } + + function gatherCompletions(_obj) { + forEach(pythonBuiltinsL, maybeAdd); + forEach(pythonBuiltinsU, maybeAdd); + forEach(pythonKeywordsL, maybeAdd); + forEach(pythonKeywordsU, maybeAdd); + } + + if (context) { + // If this is a property, see if it belongs to some object we can + // find in the current environment. + var obj = context.pop(), base; + + if (obj.type == "variable") + base = obj.string; + else if(obj.type == "variable-3") + base = ":" + obj.string; + + while (base != null && context.length) + base = base[context.pop().string]; + if (base != null) gatherCompletions(base); + } + return found; + } +})(); diff --git a/modules/files/views/default/assets/addon/hint/show-hint.css b/modules/files/views/default/assets/addon/hint/show-hint.css new file mode 100755 index 0000000..8a4ff05 --- /dev/null +++ b/modules/files/views/default/assets/addon/hint/show-hint.css @@ -0,0 +1,38 @@ +.CodeMirror-hints { + position: absolute; + z-index: 10; + overflow: hidden; + list-style: none; + + margin: 0; + padding: 2px; + + -webkit-box-shadow: 2px 3px 5px rgba(0,0,0,.2); + -moz-box-shadow: 2px 3px 5px rgba(0,0,0,.2); + box-shadow: 2px 3px 5px rgba(0,0,0,.2); + border-radius: 3px; + border: 1px solid silver; + + background: white; + font-size: 90%; + font-family: monospace; + + max-height: 20em; + overflow-y: auto; +} + +.CodeMirror-hint { + margin: 0; + padding: 0 4px; + border-radius: 2px; + max-width: 19em; + overflow: hidden; + white-space: pre; + color: black; + cursor: pointer; +} + +.CodeMirror-hint-active { + background: #08f; + color: white; +} diff --git a/modules/files/views/default/assets/addon/hint/show-hint.js b/modules/files/views/default/assets/addon/hint/show-hint.js new file mode 100755 index 0000000..2c54dcd --- /dev/null +++ b/modules/files/views/default/assets/addon/hint/show-hint.js @@ -0,0 +1,180 @@ +CodeMirror.showHint = function(cm, getHints, options) { + if (!options) options = {}; + var startCh = cm.getCursor().ch, continued = false; + var closeOn = options.closeCharacters || /[\s()\[\]{};:]/; + + function startHinting() { + // We want a single cursor position. + if (cm.somethingSelected()) return; + + if (options.async) + getHints(cm, showHints, options); + else + return showHints(getHints(cm, options)); + } + + function getText(completion) { + if (typeof completion == "string") return completion; + else return completion.text; + } + + function pickCompletion(cm, data, completion) { + if (completion.hint) completion.hint(cm, data, completion); + else cm.replaceRange(getText(completion), data.from, data.to); + } + + function showHints(data) { + if (!data || !data.list.length) return; + var completions = data.list; + // When there is only one completion, use it directly. + if (!continued && options.completeSingle !== false && completions.length == 1) { + pickCompletion(cm, data, completions[0]); + CodeMirror.signal(data, "close"); + return true; + } + + // Build the select widget + var hints = document.createElement("ul"), selectedHint = 0; + hints.className = "CodeMirror-hints"; + for (var i = 0; i < completions.length; ++i) { + var elt = hints.appendChild(document.createElement("li")), completion = completions[i]; + var className = "CodeMirror-hint" + (i ? "" : " CodeMirror-hint-active"); + if (completion.className != null) className = completion.className + " " + className; + elt.className = className; + if (completion.render) completion.render(elt, data, completion); + else elt.appendChild(document.createTextNode(completion.displayText || getText(completion))); + elt.hintId = i; + } + var pos = cm.cursorCoords(options.alignWithWord !== false ? data.from : null); + var left = pos.left, top = pos.bottom, below = true; + hints.style.left = left + "px"; + hints.style.top = top + "px"; + document.body.appendChild(hints); + CodeMirror.signal(data, "shown"); + + // If we're at the edge of the screen, then we want the menu to appear on the left of the cursor. + var winW = window.innerWidth || Math.max(document.body.offsetWidth, document.documentElement.offsetWidth); + var winH = window.innerHeight || Math.max(document.body.offsetHeight, document.documentElement.offsetHeight); + var box = hints.getBoundingClientRect(); + var overlapX = box.right - winW, overlapY = box.bottom - winH; + if (overlapX > 0) { + if (box.right - box.left > winW) { + hints.style.width = (winW - 5) + "px"; + overlapX -= (box.right - box.left) - winW; + } + hints.style.left = (left = pos.left - overlapX) + "px"; + } + if (overlapY > 0) { + var height = box.bottom - box.top; + if (box.top - (pos.bottom - pos.top) - height > 0) { + overlapY = height + (pos.bottom - pos.top); + below = false; + } else if (height > winH) { + hints.style.height = (winH - 5) + "px"; + overlapY -= height - winH; + } + hints.style.top = (top = pos.bottom - overlapY) + "px"; + } + + function changeActive(i) { + i = Math.max(0, Math.min(i, completions.length - 1)); + if (selectedHint == i) return; + var node = hints.childNodes[selectedHint]; + node.className = node.className.replace(" CodeMirror-hint-active", ""); + node = hints.childNodes[selectedHint = i]; + node.className += " CodeMirror-hint-active"; + if (node.offsetTop < hints.scrollTop) + hints.scrollTop = node.offsetTop - 3; + else if (node.offsetTop + node.offsetHeight > hints.scrollTop + hints.clientHeight) + hints.scrollTop = node.offsetTop + node.offsetHeight - hints.clientHeight + 3; + CodeMirror.signal(data, "select", completions[selectedHint], node); + } + + function screenAmount() { + return Math.floor(hints.clientHeight / hints.firstChild.offsetHeight) || 1; + } + + var ourMap, baseMap = { + Up: function() {changeActive(selectedHint - 1);}, + Down: function() {changeActive(selectedHint + 1);}, + PageUp: function() {changeActive(selectedHint - screenAmount());}, + PageDown: function() {changeActive(selectedHint + screenAmount());}, + Home: function() {changeActive(0);}, + End: function() {changeActive(completions.length - 1);}, + Enter: pick, + Tab: pick, + Esc: close + }; + if (options.customKeys) { + ourMap = {}; + for (var key in options.customKeys) if (options.customKeys.hasOwnProperty(key)) { + var val = options.customKeys[key]; + if (baseMap.hasOwnProperty(val)) val = baseMap[val]; + ourMap[key] = val; + } + } else ourMap = baseMap; + + cm.addKeyMap(ourMap); + cm.on("cursorActivity", cursorActivity); + var closingOnBlur; + function onBlur(){ closingOnBlur = setTimeout(close, 100); }; + function onFocus(){ clearTimeout(closingOnBlur); }; + cm.on("blur", onBlur); + cm.on("focus", onFocus); + var startScroll = cm.getScrollInfo(); + function onScroll() { + var curScroll = cm.getScrollInfo(), editor = cm.getWrapperElement().getBoundingClientRect(); + var newTop = top + startScroll.top - curScroll.top, point = newTop; + if (!below) point += hints.offsetHeight; + if (point <= editor.top || point >= editor.bottom) return close(); + hints.style.top = newTop + "px"; + hints.style.left = (left + startScroll.left - curScroll.left) + "px"; + } + cm.on("scroll", onScroll); + CodeMirror.on(hints, "dblclick", function(e) { + var t = e.target || e.srcElement; + if (t.hintId != null) {selectedHint = t.hintId; pick();} + }); + CodeMirror.on(hints, "click", function(e) { + var t = e.target || e.srcElement; + if (t.hintId != null) changeActive(t.hintId); + }); + CodeMirror.on(hints, "mousedown", function() { + setTimeout(function(){cm.focus();}, 20); + }); + + var done = false, once; + function close(willContinue) { + if (done) return; + done = true; + clearTimeout(once); + hints.parentNode.removeChild(hints); + cm.removeKeyMap(ourMap); + cm.off("cursorActivity", cursorActivity); + cm.off("blur", onBlur); + cm.off("focus", onFocus); + cm.off("scroll", onScroll); + if (willContinue !== true) CodeMirror.signal(data, "close"); + } + function pick() { + pickCompletion(cm, data, completions[selectedHint]); + close(); + } + var once, lastPos = cm.getCursor(), lastLen = cm.getLine(lastPos.line).length; + function cursorActivity() { + clearTimeout(once); + + var pos = cm.getCursor(), line = cm.getLine(pos.line); + if (pos.line != lastPos.line || line.length - pos.ch != lastLen - lastPos.ch || + pos.ch < startCh || cm.somethingSelected() || + (pos.ch && closeOn.test(line.charAt(pos.ch - 1)))) + close(); + else + once = setTimeout(function(){close(true); continued = true; startHinting();}, 70); + } + CodeMirror.signal(data, "select", completions[0], hints.firstChild); + return true; + } + + return startHinting(); +}; diff --git a/modules/files/views/default/assets/addon/hint/xml-hint.js b/modules/files/views/default/assets/addon/hint/xml-hint.js new file mode 100755 index 0000000..42eab6f --- /dev/null +++ b/modules/files/views/default/assets/addon/hint/xml-hint.js @@ -0,0 +1,118 @@ +(function() { + + CodeMirror.xmlHints = []; + + CodeMirror.xmlHint = function(cm) { + + var cursor = cm.getCursor(); + + if (cursor.ch > 0) { + + var text = cm.getRange(CodeMirror.Pos(0, 0), cursor); + var typed = ''; + var simbol = ''; + for(var i = text.length - 1; i >= 0; i--) { + if(text[i] == ' ' || text[i] == '<') { + simbol = text[i]; + break; + } + else { + typed = text[i] + typed; + } + } + + text = text.slice(0, text.length - typed.length); + + var path = getActiveElement(text) + simbol; + var hints = CodeMirror.xmlHints[path]; + + if(typeof hints === 'undefined') + hints = ['']; + else { + hints = hints.slice(0); + for (var i = hints.length - 1; i >= 0; i--) { + if(hints[i].indexOf(typed) != 0) + hints.splice(i, 1); + } + } + + return { + list: hints, + from: CodeMirror.Pos(cursor.line, cursor.ch - typed.length), + to: cursor + }; + } + }; + + var getActiveElement = function(text) { + + var element = ''; + + if(text.length >= 0) { + + var regex = new RegExp('<([^!?][^\\s/>]*)[\\s\\S]*?>', 'g'); + + var matches = []; + var match; + while ((match = regex.exec(text)) != null) { + matches.push({ + tag: match[1], + selfclose: (match[0].slice(match[0].length - 2) === '/>') + }); + } + + for (var i = matches.length - 1, skip = 0; i >= 0; i--) { + + var item = matches[i]; + + if (item.tag[0] == '/') + { + skip++; + } + else if (item.selfclose == false) + { + if (skip > 0) + { + skip--; + } + else + { + element = '<' + item.tag + '>' + element; + } + } + } + + element += getOpenTag(text); + } + + return element; + }; + + var getOpenTag = function(text) { + + var open = text.lastIndexOf('<'); + var close = text.lastIndexOf('>'); + + if (close < open) + { + text = text.slice(open); + + if(text != '<') { + + var space = text.indexOf(' '); + if(space < 0) + space = text.indexOf('\t'); + if(space < 0) + space = text.indexOf('\n'); + + if (space < 0) + space = text.length; + + return text.slice(0, space); + } + } + + return ''; + }; + +})(); diff --git a/modules/files/views/default/assets/addon/lint/javascript-lint.js b/modules/files/views/default/assets/addon/lint/javascript-lint.js new file mode 100755 index 0000000..9a815c8 --- /dev/null +++ b/modules/files/views/default/assets/addon/lint/javascript-lint.js @@ -0,0 +1,127 @@ +(function() { + + var bogus = [ "Dangerous comment" ]; + + var warnings = [ [ "Expected '{'", + "Statement body should be inside '{ }' braces." ] ]; + + var errors = [ "Missing semicolon", "Extra comma", "Missing property name", + "Unmatched ", " and instead saw", " is not defined", + "Unclosed string", "Stopping, unable to continue" ]; + + function validator(options, text) { + JSHINT(text, options); + var errors = JSHINT.data().errors, result = []; + if (errors) parseErrors(errors, result); + return result; + } + + CodeMirror.javascriptValidatorWithOptions = function(options) { + return function(text) { return validator(options, text); }; + }; + + CodeMirror.javascriptValidator = CodeMirror.javascriptValidatorWithOptions(null); + + function cleanup(error) { + // All problems are warnings by default + fixWith(error, warnings, "warning", true); + fixWith(error, errors, "error"); + + return isBogus(error) ? null : error; + } + + function fixWith(error, fixes, severity, force) { + var description, fix, find, replace, found; + + description = error.description; + + for ( var i = 0; i < fixes.length; i++) { + fix = fixes[i]; + find = (typeof fix === "string" ? fix : fix[0]); + replace = (typeof fix === "string" ? null : fix[1]); + found = description.indexOf(find) !== -1; + + if (force || found) { + error.severity = severity; + } + if (found && replace) { + error.description = replace; + } + } + } + + function isBogus(error) { + var description = error.description; + for ( var i = 0; i < bogus.length; i++) { + if (description.indexOf(bogus[i]) !== -1) { + return true; + } + } + return false; + } + + function parseErrors(errors, output) { + for ( var i = 0; i < errors.length; i++) { + var error = errors[i]; + if (error) { + var linetabpositions, index; + + linetabpositions = []; + + // This next block is to fix a problem in jshint. Jshint + // replaces + // all tabs with spaces then performs some checks. The error + // positions (character/space) are then reported incorrectly, + // not taking the replacement step into account. Here we look + // at the evidence line and try to adjust the character position + // to the correct value. + if (error.evidence) { + // Tab positions are computed once per line and cached + var tabpositions = linetabpositions[error.line]; + if (!tabpositions) { + var evidence = error.evidence; + tabpositions = []; + // ugggh phantomjs does not like this + // forEachChar(evidence, function(item, index) { + Array.prototype.forEach.call(evidence, function(item, + index) { + if (item === '\t') { + // First col is 1 (not 0) to match error + // positions + tabpositions.push(index + 1); + } + }); + linetabpositions[error.line] = tabpositions; + } + if (tabpositions.length > 0) { + var pos = error.character; + tabpositions.forEach(function(tabposition) { + if (pos > tabposition) pos -= 1; + }); + error.character = pos; + } + } + + var start = error.character - 1, end = start + 1; + if (error.evidence) { + index = error.evidence.substring(start).search(/.\b/); + if (index > -1) { + end += index; + } + } + + // Convert to format expected by validation service + error.description = error.reason;// + "(jshint)"; + error.start = error.character; + error.end = end; + error = cleanup(error); + + if (error) + output.push({message: error.description, + severity: error.severity, + from: CodeMirror.Pos(error.line - 1, start), + to: CodeMirror.Pos(error.line - 1, end)}); + } + } + } +})(); diff --git a/modules/files/views/default/assets/addon/lint/json-lint.js b/modules/files/views/default/assets/addon/lint/json-lint.js new file mode 100755 index 0000000..42b36ab --- /dev/null +++ b/modules/files/views/default/assets/addon/lint/json-lint.js @@ -0,0 +1,14 @@ +// Depends on jsonlint.js from https://github.com/zaach/jsonlint + +CodeMirror.jsonValidator = function(text) { + var found = []; + jsonlint.parseError = function(str, hash) { + var loc = hash.loc; + found.push({from: CodeMirror.Pos(loc.first_line - 1, loc.first_column), + to: CodeMirror.Pos(loc.last_line - 1, loc.last_column), + message: str}); + }; + try { jsonlint.parse(text); } + catch(e) {} + return found; +}; diff --git a/modules/files/views/default/assets/addon/lint/lint.css b/modules/files/views/default/assets/addon/lint/lint.css new file mode 100755 index 0000000..4fd72e7 --- /dev/null +++ b/modules/files/views/default/assets/addon/lint/lint.css @@ -0,0 +1,96 @@ +/* The lint marker gutter */ +.CodeMirror-lint-markers { + width: 16px; +} + +.CodeMirror-lint-tooltip { + background-color: infobackground; + border: 1px solid black; + border-radius: 4px 4px 4px 4px; + color: infotext; + font-family: monospace; + font-size: 10pt; + overflow: hidden; + padding: 2px 5px; + position: fixed; + white-space: pre; + z-index: 100; + max-width: 600px; + opacity: 0; + transition: opacity .4s; + -moz-transition: opacity .4s; + -webkit-transition: opacity .4s; + -o-transition: opacity .4s; + -ms-transition: opacity .4s; +} + +.CodeMirror-lint-span-error, .CodeMirror-lint-span-warning { + background-position: left bottom; + background-repeat: repeat-x; +} + +.CodeMirror-lint-span-error { + background-image: + url("data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAQAAAADCAYAAAC09K7GAAAAAXNSR0IArs4c6QAAAAZiS0dEAP8A/wD/oL2nkwAAAAlwSFlzAAALEwAACxMBAJqcGAAAAAd0SU1FB9sJDw4cOCW1/KIAAAAZdEVYdENvbW1lbnQAQ3JlYXRlZCB3aXRoIEdJTVBXgQ4XAAAAHElEQVQI12NggIL/DAz/GdA5/xkY/qPKMDAwAADLZwf5rvm+LQAAAABJRU5ErkJggg==") + ; +} + +.CodeMirror-lint-span-warning { + background-image: url("data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAQAAAADCAYAAAC09K7GAAAAAXNSR0IArs4c6QAAAAZiS0dEAP8A/wD/oL2nkwAAAAlwSFlzAAALEwAACxMBAJqcGAAAAAd0SU1FB9sJFhQXEbhTg7YAAAAZdEVYdENvbW1lbnQAQ3JlYXRlZCB3aXRoIEdJTVBXgQ4XAAAAMklEQVQI12NkgIIvJ3QXMjAwdDN+OaEbysDA4MPAwNDNwMCwiOHLCd1zX07o6kBVGQEAKBANtobskNMAAAAASUVORK5CYII="); +} + +.CodeMirror-lint-marker-error, .CodeMirror-lint-marker-warning { + background-position: center center; + background-repeat: no-repeat; + cursor: pointer; + display: inline-block; + height: 16px; + width: 16px; + vertical-align: middle; + position: relative; +} + +.CodeMirror-lint-message-error, .CodeMirror-lint-message-warning { + padding-left: 18px; + background-position: top left; + background-repeat: no-repeat; +} + +.CodeMirror-lint-marker-error, .CodeMirror-lint-message-error { + background-image: url("data:image/gif;base64,R0lGODlhEAAQANUAAPVvcvWHiPVucvRuc+ttcfV6f91KVN5LU99PV/FZY/JhaM4oN84pONE4Rd1ATfJLWutVYPRgbdxpcsgWKMgZKs4lNfE/UvE/U+artcpdSc5uXveimslHPuBhW/eJhfV5efaCgO2CgP+/v+PExP///////wAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAACH5BAEAACUALAAAAAAQABAAAAZ+wJJwSCwaScgkySgkjTQZTkYzWhadnE5oE+pwqkSshwQqkzxfa4kkQXxEpA9J9EFI1KQGQQBAigYCBA14ExEWF0gXihETeA0QD3AkD5QQg0NsDnAJmwkOd5gYFSQKpXAFDBhqaxgLBwQBBAapq00YEg0UDRKqTGtKSL7Cw8JBADs="); +} + +.CodeMirror-lint-marker-warning, .CodeMirror-lint-message-warning { + background-image: url("data:image/gif;base64,R0lGODlhEAAQANUAAP7bc//egf/ij/7ijv/jl/7kl//mnv7lnv/uwf7CTP7DTf7DT/7IW//Na/7Na//NbP7QdP/dmbltAIJNAF03AMSAJMSCLKqASa2DS6uBSquCSrGHTq6ETbCHT7WKUrKIUcCVXL+UXMOYX8GWXsSZYMiib6+ETbOIUcOXX86uhd3Muf///wAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAACH5BAEAACsALAAAAAAQABAAAAZowJVwSCwaj0ihikRSJYcoBEL0XKlGkcjImQQhJBREKFnyICoThKeE/AAW6AXgdPyUAgrLJBEo0YsbAQyDhAEdRRwDDw8OaA4NDQImRBgFEJdglxAEGEQZKQcHBqOkKRpFF6mqq1WtrUEAOw=="); +} + +.CodeMirror-lint-marker-multiple { + background-image: url("data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAcAAAAHCAYAAADEUlfTAAAAAXNSR0IArs4c6QAAAAZiS0dEAAAAAAAA+UO7fwAAAAlwSFlzAAALEwAACxMBAJqcGAAAAAd0SU1FB9sJEAQvB2JVdrAAAAAdaVRYdENvbW1lbnQAAAAAAENyZWF0ZWQgd2l0aCBHSU1QZC5lBwAAAD1JREFUCNdtjkESADAEAzemf69f66HMqGlOIhYiFRFRtSQBWAY7mzx+EDTL6sSgb1jTk7Q87rxyqe37fXsAa78gLyZnRgEAAAAASUVORK5CYII="); + background-repeat: no-repeat; + background-position: right bottom; + width: 100%; height: 100%; +} + +/* Styles for the overview ruler +.annotationOverview { + cursor: pointer; + border-radius: 2px; + left: 2px; + width: 8px; +} +.annotationOverview.error { + background-color: lightcoral; + border: 1px solid darkred; +} +.annotationOverview.warning { + background-color: Gold; + border: 1px solid black; +} + +.annotationHTML.overlay { + background-image: url("data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAcAAAAHCAYAAADEUlfTAAAAAXNSR0IArs4c6QAAAAZiS0dEAAAAAAAA+UO7fwAAAAlwSFlzAAALEwAACxMBAJqcGAAAAAd0SU1FB9sJEAQvB2JVdrAAAAAdaVRYdENvbW1lbnQAAAAAAENyZWF0ZWQgd2l0aCBHSU1QZC5lBwAAAD1JREFUCNdtjkESADAEAzemf69f66HMqGlOIhYiFRFRtSQBWAY7mzx+EDTL6sSgb1jTk7Q87rxyqe37fXsAa78gLyZnRgEAAAAASUVORK5CYII="); + background-position: right bottom; + position: relative; + top: -16px; +} +*/ \ No newline at end of file diff --git a/modules/files/views/default/assets/addon/lint/lint.js b/modules/files/views/default/assets/addon/lint/lint.js new file mode 100755 index 0000000..231eb2f --- /dev/null +++ b/modules/files/views/default/assets/addon/lint/lint.js @@ -0,0 +1,197 @@ +CodeMirror.validate = (function() { + var GUTTER_ID = "CodeMirror-lint-markers"; + var SEVERITIES = /^(?:error|warning)$/; + + function showTooltip(e, content) { + var tt = document.createElement("div"); + tt.className = "CodeMirror-lint-tooltip"; + tt.appendChild(content.cloneNode(true)); + document.body.appendChild(tt); + + function position(e) { + if (!tt.parentNode) return CodeMirror.off(document, "mousemove", position); + tt.style.top = Math.max(0, e.clientY - tt.offsetHeight - 5) + "px"; + tt.style.left = (e.clientX + 5) + "px"; + } + CodeMirror.on(document, "mousemove", position); + position(e); + if (tt.style.opacity != null) tt.style.opacity = 1; + return tt; + } + function rm(elt) { + if (elt.parentNode) elt.parentNode.removeChild(elt); + } + function hideTooltip(tt) { + if (!tt.parentNode) return; + if (tt.style.opacity == null) rm(tt); + tt.style.opacity = 0; + setTimeout(function() { rm(tt); }, 600); + } + + function showTooltipFor(e, content, node) { + var tooltip = showTooltip(e, content); + function hide() { + CodeMirror.off(node, "mouseout", hide); + if (tooltip) { hideTooltip(tooltip); tooltip = null; } + } + var poll = setInterval(function() { + if (tooltip) for (var n = node;; n = n.parentNode) { + if (n == document.body) return; + if (!n) { hide(); break; } + } + if (!tooltip) return clearInterval(poll); + }, 400); + CodeMirror.on(node, "mouseout", hide); + } + + function LintState(cm, options, hasGutter) { + this.marked = []; + this.options = options; + this.timeout = null; + this.hasGutter = hasGutter; + this.onMouseOver = function(e) { onMouseOver(cm, e); }; + } + + function parseOptions(options) { + if (options instanceof Function) return {getAnnotations: options}; + else if (!options || !options.getAnnotations) throw new Error("Required option 'getAnnotations' missing (lint addon)"); + return options; + } + + function clearMarks(cm) { + var state = cm._lintState; + if (state.hasGutter) cm.clearGutter(GUTTER_ID); + for (var i = 0; i < state.marked.length; ++i) + state.marked[i].clear(); + state.marked.length = 0; + } + + function makeMarker(labels, severity, multiple, tooltips) { + var marker = document.createElement("div"), inner = marker; + marker.className = "CodeMirror-lint-marker-" + severity; + if (multiple) { + inner = marker.appendChild(document.createElement("div")); + inner.className = "CodeMirror-lint-marker-multiple"; + } + + if (tooltips != false) CodeMirror.on(inner, "mouseover", function(e) { + showTooltipFor(e, labels, inner); + }); + + return marker; + } + + function getMaxSeverity(a, b) { + if (a == "error") return a; + else return b; + } + + function groupByLine(annotations) { + var lines = []; + for (var i = 0; i < annotations.length; ++i) { + var ann = annotations[i], line = ann.from.line; + (lines[line] || (lines[line] = [])).push(ann); + } + return lines; + } + + function annotationTooltip(ann) { + var severity = ann.severity; + if (!SEVERITIES.test(severity)) severity = "error"; + var tip = document.createElement("div"); + tip.className = "CodeMirror-lint-message-" + severity; + tip.appendChild(document.createTextNode(ann.message)); + return tip; + } + + function startLinting(cm) { + var state = cm._lintState, options = state.options; + if (options.async) + options.getAnnotations(cm, updateLinting, options); + else + updateLinting(cm, options.getAnnotations(cm.getValue())); + } + + function updateLinting(cm, annotationsNotSorted) { + clearMarks(cm); + var state = cm._lintState, options = state.options; + + var annotations = groupByLine(annotationsNotSorted); + + for (var line = 0; line < annotations.length; ++line) { + var anns = annotations[line]; + if (!anns) continue; + + var maxSeverity = null; + var tipLabel = state.hasGutter && document.createDocumentFragment(); + + for (var i = 0; i < anns.length; ++i) { + var ann = anns[i]; + var severity = ann.severity; + if (!SEVERITIES.test(severity)) severity = "error"; + maxSeverity = getMaxSeverity(maxSeverity, severity); + + if (options.formatAnnotation) ann = options.formatAnnotation(ann); + if (state.hasGutter) tipLabel.appendChild(annotationTooltip(ann)); + + if (ann.to) state.marked.push(cm.markText(ann.from, ann.to, { + className: "CodeMirror-lint-span-" + severity, + __annotation: ann + })); + } + + if (state.hasGutter) + cm.setGutterMarker(line, GUTTER_ID, makeMarker(tipLabel, maxSeverity, anns.length > 1, + state.options.tooltips)); + } + if (options.onUpdateLinting) options.onUpdateLinting(annotationsNotSorted, annotations, cm); + } + + function onChange(cm) { + var state = cm._lintState; + clearTimeout(state.timeout); + state.timeout = setTimeout(function(){startLinting(cm);}, state.options.delay || 500); + } + + function popupSpanTooltip(ann, e) { + var target = e.target || e.srcElement; + showTooltipFor(e, annotationTooltip(ann), target); + } + + // When the mouseover fires, the cursor might not actually be over + // the character itself yet. These pairs of x,y offsets are used to + // probe a few nearby points when no suitable marked range is found. + var nearby = [0, 0, 0, 5, 0, -5, 5, 0, -5, 0]; + + function onMouseOver(cm, e) { + if (!/\bCodeMirror-lint-span-/.test((e.target || e.srcElement).className)) return; + for (var i = 0; i < nearby.length; i += 2) { + var spans = cm.findMarksAt(cm.coordsChar({left: e.clientX + nearby[i], + top: e.clientY + nearby[i + 1]})); + for (var j = 0; j < spans.length; ++j) { + var span = spans[j], ann = span.__annotation; + if (ann) return popupSpanTooltip(ann, e); + } + } + } + + CodeMirror.defineOption("lintWith", false, function(cm, val, old) { + if (old && old != CodeMirror.Init) { + clearMarks(cm); + cm.off("change", onChange); + CodeMirror.off(cm.getWrapperElement(), "mouseover", cm._lintState.onMouseOver); + delete cm._lintState; + } + + if (val) { + var gutters = cm.getOption("gutters"), hasLintGutter = false; + for (var i = 0; i < gutters.length; ++i) if (gutters[i] == GUTTER_ID) hasLintGutter = true; + var state = cm._lintState = new LintState(cm, parseOptions(val), hasLintGutter); + cm.on("change", onChange); + if (state.options.tooltips != false) + CodeMirror.on(cm.getWrapperElement(), "mouseover", state.onMouseOver); + + startLinting(cm); + } + }); +})(); diff --git a/modules/files/views/default/assets/addon/mode/loadmode.js b/modules/files/views/default/assets/addon/mode/loadmode.js new file mode 100755 index 0000000..60fafbb --- /dev/null +++ b/modules/files/views/default/assets/addon/mode/loadmode.js @@ -0,0 +1,51 @@ +(function() { + if (!CodeMirror.modeURL) CodeMirror.modeURL = "../mode/%N/%N.js"; + + var loading = {}; + function splitCallback(cont, n) { + var countDown = n; + return function() { if (--countDown == 0) cont(); }; + } + function ensureDeps(mode, cont) { + var deps = CodeMirror.modes[mode].dependencies; + if (!deps) return cont(); + var missing = []; + for (var i = 0; i < deps.length; ++i) { + if (!CodeMirror.modes.hasOwnProperty(deps[i])) + missing.push(deps[i]); + } + if (!missing.length) return cont(); + var split = splitCallback(cont, missing.length); + for (var i = 0; i < missing.length; ++i) + CodeMirror.requireMode(missing[i], split); + } + + CodeMirror.requireMode = function(mode, cont) { + if (typeof mode != "string") mode = mode.name; + if (CodeMirror.modes.hasOwnProperty(mode)) return ensureDeps(mode, cont); + if (loading.hasOwnProperty(mode)) return loading[mode].push(cont); + + var script = document.createElement("script"); + script.src = CodeMirror.modeURL.replace(/%N/g, mode); + var others = document.getElementsByTagName("script")[0]; + others.parentNode.insertBefore(script, others); + var list = loading[mode] = [cont]; + var count = 0, poll = setInterval(function() { + if (++count > 100) return clearInterval(poll); + if (CodeMirror.modes.hasOwnProperty(mode)) { + clearInterval(poll); + loading[mode] = null; + ensureDeps(mode, function() { + for (var i = 0; i < list.length; ++i) list[i](); + }); + } + }, 200); + }; + + CodeMirror.autoLoadMode = function(instance, mode) { + if (!CodeMirror.modes.hasOwnProperty(mode)) + CodeMirror.requireMode(mode, function() { + instance.setOption("mode", instance.getOption("mode")); + }); + }; +}()); diff --git a/modules/files/views/default/assets/addon/mode/multiplex.js b/modules/files/views/default/assets/addon/mode/multiplex.js new file mode 100755 index 0000000..3ff3a92 --- /dev/null +++ b/modules/files/views/default/assets/addon/mode/multiplex.js @@ -0,0 +1,95 @@ +CodeMirror.multiplexingMode = function(outer /*, others */) { + // Others should be {open, close, mode [, delimStyle]} objects + var others = Array.prototype.slice.call(arguments, 1); + var n_others = others.length; + + function indexOf(string, pattern, from) { + if (typeof pattern == "string") return string.indexOf(pattern, from); + var m = pattern.exec(from ? string.slice(from) : string); + return m ? m.index + from : -1; + } + + return { + startState: function() { + return { + outer: CodeMirror.startState(outer), + innerActive: null, + inner: null + }; + }, + + copyState: function(state) { + return { + outer: CodeMirror.copyState(outer, state.outer), + innerActive: state.innerActive, + inner: state.innerActive && CodeMirror.copyState(state.innerActive.mode, state.inner) + }; + }, + + token: function(stream, state) { + if (!state.innerActive) { + var cutOff = Infinity, oldContent = stream.string; + for (var i = 0; i < n_others; ++i) { + var other = others[i]; + var found = indexOf(oldContent, other.open, stream.pos); + if (found == stream.pos) { + stream.match(other.open); + state.innerActive = other; + state.inner = CodeMirror.startState(other.mode, outer.indent ? outer.indent(state.outer, "") : 0); + return other.delimStyle; + } else if (found != -1 && found < cutOff) { + cutOff = found; + } + } + if (cutOff != Infinity) stream.string = oldContent.slice(0, cutOff); + var outerToken = outer.token(stream, state.outer); + if (cutOff != Infinity) stream.string = oldContent; + return outerToken; + } else { + var curInner = state.innerActive, oldContent = stream.string; + var found = indexOf(oldContent, curInner.close, stream.pos); + if (found == stream.pos) { + stream.match(curInner.close); + state.innerActive = state.inner = null; + return curInner.delimStyle; + } + if (found > -1) stream.string = oldContent.slice(0, found); + var innerToken = curInner.mode.token(stream, state.inner); + if (found > -1) stream.string = oldContent; + var cur = stream.current(), found = cur.indexOf(curInner.close); + if (found > -1) stream.backUp(cur.length - found); + return innerToken; + } + }, + + indent: function(state, textAfter) { + var mode = state.innerActive ? state.innerActive.mode : outer; + if (!mode.indent) return CodeMirror.Pass; + return mode.indent(state.innerActive ? state.inner : state.outer, textAfter); + }, + + blankLine: function(state) { + var mode = state.innerActive ? state.innerActive.mode : outer; + if (mode.blankLine) { + mode.blankLine(state.innerActive ? state.inner : state.outer); + } + if (!state.innerActive) { + for (var i = 0; i < n_others; ++i) { + var other = others[i]; + if (other.open === "\n") { + state.innerActive = other; + state.inner = CodeMirror.startState(other.mode, mode.indent ? mode.indent(state.outer, "") : 0); + } + } + } else if (state.innerActive.close === "\n") { + state.innerActive = state.inner = null; + } + }, + + electricChars: outer.electricChars, + + innerMode: function(state) { + return state.inner ? {state: state.inner, mode: state.innerActive.mode} : {state: state.outer, mode: outer}; + } + }; +}; diff --git a/modules/files/views/default/assets/addon/mode/overlay.js b/modules/files/views/default/assets/addon/mode/overlay.js new file mode 100755 index 0000000..b7928a7 --- /dev/null +++ b/modules/files/views/default/assets/addon/mode/overlay.js @@ -0,0 +1,59 @@ +// Utility function that allows modes to be combined. The mode given +// as the base argument takes care of most of the normal mode +// functionality, but a second (typically simple) mode is used, which +// can override the style of text. Both modes get to parse all of the +// text, but when both assign a non-null style to a piece of code, the +// overlay wins, unless the combine argument was true, in which case +// the styles are combined. + +// overlayParser is the old, deprecated name +CodeMirror.overlayMode = CodeMirror.overlayParser = function(base, overlay, combine) { + return { + startState: function() { + return { + base: CodeMirror.startState(base), + overlay: CodeMirror.startState(overlay), + basePos: 0, baseCur: null, + overlayPos: 0, overlayCur: null + }; + }, + copyState: function(state) { + return { + base: CodeMirror.copyState(base, state.base), + overlay: CodeMirror.copyState(overlay, state.overlay), + basePos: state.basePos, baseCur: null, + overlayPos: state.overlayPos, overlayCur: null + }; + }, + + token: function(stream, state) { + if (stream.start == state.basePos) { + state.baseCur = base.token(stream, state.base); + state.basePos = stream.pos; + } + if (stream.start == state.overlayPos) { + stream.pos = stream.start; + state.overlayCur = overlay.token(stream, state.overlay); + state.overlayPos = stream.pos; + } + stream.pos = Math.min(state.basePos, state.overlayPos); + if (stream.eol()) state.basePos = state.overlayPos = 0; + + if (state.overlayCur == null) return state.baseCur; + if (state.baseCur != null && combine) return state.baseCur + " " + state.overlayCur; + else return state.overlayCur; + }, + + indent: base.indent && function(state, textAfter) { + return base.indent(state.base, textAfter); + }, + electricChars: base.electricChars, + + innerMode: function(state) { return {state: state.base, mode: base}; }, + + blankLine: function(state) { + if (base.blankLine) base.blankLine(state.base); + if (overlay.blankLine) overlay.blankLine(state.overlay); + } + }; +}; diff --git a/modules/files/views/default/assets/addon/runmode/colorize.js b/modules/files/views/default/assets/addon/runmode/colorize.js new file mode 100755 index 0000000..62286d2 --- /dev/null +++ b/modules/files/views/default/assets/addon/runmode/colorize.js @@ -0,0 +1,29 @@ +CodeMirror.colorize = (function() { + + var isBlock = /^(p|li|div|h\\d|pre|blockquote|td)$/; + + function textContent(node, out) { + if (node.nodeType == 3) return out.push(node.nodeValue); + for (var ch = node.firstChild; ch; ch = ch.nextSibling) { + textContent(ch, out); + if (isBlock.test(node.nodeType)) out.push("\n"); + } + } + + return function(collection, defaultMode) { + if (!collection) collection = document.body.getElementsByTagName("pre"); + + for (var i = 0; i < collection.length; ++i) { + var node = collection[i]; + var mode = node.getAttribute("data-lang") || defaultMode; + if (!mode) continue; + + var text = []; + textContent(node, text); + node.innerHTML = ""; + CodeMirror.runMode(text.join(""), mode, node); + + node.className += " cm-s-default"; + } + }; +})(); diff --git a/modules/files/views/default/assets/addon/runmode/runmode-standalone.js b/modules/files/views/default/assets/addon/runmode/runmode-standalone.js new file mode 100755 index 0000000..7a9b82f --- /dev/null +++ b/modules/files/views/default/assets/addon/runmode/runmode-standalone.js @@ -0,0 +1,130 @@ +/* Just enough of CodeMirror to run runMode under node.js */ + +window.CodeMirror = {}; + +function splitLines(string){ return string.split(/\r?\n|\r/); }; + +function StringStream(string) { + this.pos = this.start = 0; + this.string = string; +} +StringStream.prototype = { + eol: function() {return this.pos >= this.string.length;}, + sol: function() {return this.pos == 0;}, + peek: function() {return this.string.charAt(this.pos) || null;}, + next: function() { + if (this.pos < this.string.length) + return this.string.charAt(this.pos++); + }, + eat: function(match) { + var ch = this.string.charAt(this.pos); + if (typeof match == "string") var ok = ch == match; + else var ok = ch && (match.test ? match.test(ch) : match(ch)); + if (ok) {++this.pos; return ch;} + }, + eatWhile: function(match) { + var start = this.pos; + while (this.eat(match)){} + return this.pos > start; + }, + eatSpace: function() { + var start = this.pos; + while (/[\s\u00a0]/.test(this.string.charAt(this.pos))) ++this.pos; + return this.pos > start; + }, + skipToEnd: function() {this.pos = this.string.length;}, + skipTo: function(ch) { + var found = this.string.indexOf(ch, this.pos); + if (found > -1) {this.pos = found; return true;} + }, + backUp: function(n) {this.pos -= n;}, + column: function() {return this.start;}, + indentation: function() {return 0;}, + match: function(pattern, consume, caseInsensitive) { + if (typeof pattern == "string") { + var cased = function(str) {return caseInsensitive ? str.toLowerCase() : str;}; + if (cased(this.string).indexOf(cased(pattern), this.pos) == this.pos) { + if (consume !== false) this.pos += pattern.length; + return true; + } + } else { + var match = this.string.slice(this.pos).match(pattern); + if (match && consume !== false) this.pos += match[0].length; + return match; + } + }, + current: function(){return this.string.slice(this.start, this.pos);} +}; +CodeMirror.StringStream = StringStream; + +CodeMirror.startState = function (mode, a1, a2) { + return mode.startState ? mode.startState(a1, a2) : true; +}; + +var modes = CodeMirror.modes = {}, mimeModes = CodeMirror.mimeModes = {}; +CodeMirror.defineMode = function (name, mode) { modes[name] = mode; }; +CodeMirror.defineMIME = function (mime, spec) { mimeModes[mime] = spec; }; +CodeMirror.getMode = function (options, spec) { + if (typeof spec == "string" && mimeModes.hasOwnProperty(spec)) + spec = mimeModes[spec]; + if (typeof spec == "string") + var mname = spec, config = {}; + else if (spec != null) + var mname = spec.name, config = spec; + var mfactory = modes[mname]; + if (!mfactory) throw new Error("Unknown mode: " + spec); + return mfactory(options, config || {}); +}; + +CodeMirror.runMode = function (string, modespec, callback, options) { + var mode = CodeMirror.getMode({ indentUnit: 2 }, modespec); + + if (callback.nodeType == 1) { + var tabSize = (options && options.tabSize) || 4; + var node = callback, col = 0; + node.innerHTML = ""; + callback = function (text, style) { + if (text == "\n") { + node.appendChild(document.createElement("br")); + col = 0; + return; + } + var content = ""; + // replace tabs + for (var pos = 0; ;) { + var idx = text.indexOf("\t", pos); + if (idx == -1) { + content += text.slice(pos); + col += text.length - pos; + break; + } else { + col += idx - pos; + content += text.slice(pos, idx); + var size = tabSize - col % tabSize; + col += size; + for (var i = 0; i < size; ++i) content += " "; + pos = idx + 1; + } + } + + if (style) { + var sp = node.appendChild(document.createElement("span")); + sp.className = "cm-" + style.replace(/ +/g, " cm-"); + sp.appendChild(document.createTextNode(content)); + } else { + node.appendChild(document.createTextNode(content)); + } + }; + } + + var lines = splitLines(string), state = CodeMirror.startState(mode); + for (var i = 0, e = lines.length; i < e; ++i) { + if (i) callback("\n"); + var stream = new CodeMirror.StringStream(lines[i]); + while (!stream.eol()) { + var style = mode.token(stream, state); + callback(stream.current(), style, i, stream.start); + stream.start = stream.pos; + } + } +}; diff --git a/modules/files/views/default/assets/addon/runmode/runmode.js b/modules/files/views/default/assets/addon/runmode/runmode.js new file mode 100755 index 0000000..3e1bed7 --- /dev/null +++ b/modules/files/views/default/assets/addon/runmode/runmode.js @@ -0,0 +1,52 @@ +CodeMirror.runMode = function(string, modespec, callback, options) { + var mode = CodeMirror.getMode(CodeMirror.defaults, modespec); + + if (callback.nodeType == 1) { + var tabSize = (options && options.tabSize) || CodeMirror.defaults.tabSize; + var node = callback, col = 0; + node.innerHTML = ""; + callback = function(text, style) { + if (text == "\n") { + node.appendChild(document.createElement("br")); + col = 0; + return; + } + var content = ""; + // replace tabs + for (var pos = 0;;) { + var idx = text.indexOf("\t", pos); + if (idx == -1) { + content += text.slice(pos); + col += text.length - pos; + break; + } else { + col += idx - pos; + content += text.slice(pos, idx); + var size = tabSize - col % tabSize; + col += size; + for (var i = 0; i < size; ++i) content += " "; + pos = idx + 1; + } + } + + if (style) { + var sp = node.appendChild(document.createElement("span")); + sp.className = "cm-" + style.replace(/ +/g, " cm-"); + sp.appendChild(document.createTextNode(content)); + } else { + node.appendChild(document.createTextNode(content)); + } + }; + } + + var lines = CodeMirror.splitLines(string), state = CodeMirror.startState(mode); + for (var i = 0, e = lines.length; i < e; ++i) { + if (i) callback("\n"); + var stream = new CodeMirror.StringStream(lines[i]); + while (!stream.eol()) { + var style = mode.token(stream, state); + callback(stream.current(), style, i, stream.start); + stream.start = stream.pos; + } + } +}; diff --git a/modules/files/views/default/assets/addon/runmode/runmode.node.js b/modules/files/views/default/assets/addon/runmode/runmode.node.js new file mode 100755 index 0000000..6449e77 --- /dev/null +++ b/modules/files/views/default/assets/addon/runmode/runmode.node.js @@ -0,0 +1,89 @@ +/* Just enough of CodeMirror to run runMode under node.js */ + +function splitLines(string){ return string.split(/\r?\n|\r/); }; + +function StringStream(string) { + this.pos = this.start = 0; + this.string = string; +} +StringStream.prototype = { + eol: function() {return this.pos >= this.string.length;}, + sol: function() {return this.pos == 0;}, + peek: function() {return this.string.charAt(this.pos) || null;}, + next: function() { + if (this.pos < this.string.length) + return this.string.charAt(this.pos++); + }, + eat: function(match) { + var ch = this.string.charAt(this.pos); + if (typeof match == "string") var ok = ch == match; + else var ok = ch && (match.test ? match.test(ch) : match(ch)); + if (ok) {++this.pos; return ch;} + }, + eatWhile: function(match) { + var start = this.pos; + while (this.eat(match)){} + return this.pos > start; + }, + eatSpace: function() { + var start = this.pos; + while (/[\s\u00a0]/.test(this.string.charAt(this.pos))) ++this.pos; + return this.pos > start; + }, + skipToEnd: function() {this.pos = this.string.length;}, + skipTo: function(ch) { + var found = this.string.indexOf(ch, this.pos); + if (found > -1) {this.pos = found; return true;} + }, + backUp: function(n) {this.pos -= n;}, + column: function() {return this.start;}, + indentation: function() {return 0;}, + match: function(pattern, consume, caseInsensitive) { + if (typeof pattern == "string") { + var cased = function(str) {return caseInsensitive ? str.toLowerCase() : str;}; + if (cased(this.string).indexOf(cased(pattern), this.pos) == this.pos) { + if (consume !== false) this.pos += pattern.length; + return true; + } + } else { + var match = this.string.slice(this.pos).match(pattern); + if (match && consume !== false) this.pos += match[0].length; + return match; + } + }, + current: function(){return this.string.slice(this.start, this.pos);} +}; +exports.StringStream = StringStream; + +exports.startState = function(mode, a1, a2) { + return mode.startState ? mode.startState(a1, a2) : true; +}; + +var modes = exports.modes = {}, mimeModes = exports.mimeModes = {}; +exports.defineMode = function(name, mode) { modes[name] = mode; }; +exports.defineMIME = function(mime, spec) { mimeModes[mime] = spec; }; +exports.getMode = function(options, spec) { + if (typeof spec == "string" && mimeModes.hasOwnProperty(spec)) + spec = mimeModes[spec]; + if (typeof spec == "string") + var mname = spec, config = {}; + else if (spec != null) + var mname = spec.name, config = spec; + var mfactory = modes[mname]; + if (!mfactory) throw new Error("Unknown mode: " + spec); + return mfactory(options, config || {}); +}; + +exports.runMode = function(string, modespec, callback) { + var mode = exports.getMode({indentUnit: 2}, modespec); + var lines = splitLines(string), state = exports.startState(mode); + for (var i = 0, e = lines.length; i < e; ++i) { + if (i) callback("\n"); + var stream = new exports.StringStream(lines[i]); + while (!stream.eol()) { + var style = mode.token(stream, state); + callback(stream.current(), style, i, stream.start); + stream.start = stream.pos; + } + } +}; diff --git a/modules/files/views/default/assets/addon/search/match-highlighter.js b/modules/files/views/default/assets/addon/search/match-highlighter.js new file mode 100755 index 0000000..14c1dab --- /dev/null +++ b/modules/files/views/default/assets/addon/search/match-highlighter.js @@ -0,0 +1,60 @@ +// Highlighting text that matches the selection +// +// Defines an option highlightSelectionMatches, which, when enabled, +// will style strings that match the selection throughout the +// document. +// +// The option can be set to true to simply enable it, or to a +// {minChars, style} object to explicitly configure it. minChars is +// the minimum amount of characters that should be selected for the +// behavior to occur, and style is the token style to apply to the +// matches. This will be prefixed by "cm-" to create an actual CSS +// class name. + +(function() { + var DEFAULT_MIN_CHARS = 2; + var DEFAULT_TOKEN_STYLE = "matchhighlight"; + + function State(options) { + this.minChars = typeof options == "object" && options.minChars || DEFAULT_MIN_CHARS; + this.style = typeof options == "object" && options.style || DEFAULT_TOKEN_STYLE; + this.overlay = null; + } + + CodeMirror.defineOption("highlightSelectionMatches", false, function(cm, val, old) { + var prev = old && old != CodeMirror.Init; + if (val && !prev) { + cm._matchHighlightState = new State(val); + cm.on("cursorActivity", highlightMatches); + } else if (!val && prev) { + var over = cm._matchHighlightState.overlay; + if (over) cm.removeOverlay(over); + cm._matchHighlightState = null; + cm.off("cursorActivity", highlightMatches); + } + }); + + function highlightMatches(cm) { + cm.operation(function() { + var state = cm._matchHighlightState; + if (state.overlay) { + cm.removeOverlay(state.overlay); + state.overlay = null; + } + + if (!cm.somethingSelected()) return; + var selection = cm.getSelection().replace(/^\s+|\s+$/g, ""); + if (selection.length < state.minChars) return; + + cm.addOverlay(state.overlay = makeOverlay(selection, state.style)); + }); + } + + function makeOverlay(query, style) { + return {token: function(stream) { + if (stream.match(query)) return style; + stream.next(); + stream.skipTo(query.charAt(0)) || stream.skipToEnd(); + }}; + } +})(); diff --git a/modules/files/views/default/assets/addon/search/search.js b/modules/files/views/default/assets/addon/search/search.js new file mode 100755 index 0000000..6331b86 --- /dev/null +++ b/modules/files/views/default/assets/addon/search/search.js @@ -0,0 +1,131 @@ +// Define search commands. Depends on dialog.js or another +// implementation of the openDialog method. + +// Replace works a little oddly -- it will do the replace on the next +// Ctrl-G (or whatever is bound to findNext) press. You prevent a +// replace by making sure the match is no longer selected when hitting +// Ctrl-G. + +(function() { + function searchOverlay(query) { + if (typeof query == "string") return {token: function(stream) { + if (stream.match(query)) return "searching"; + stream.next(); + stream.skipTo(query.charAt(0)) || stream.skipToEnd(); + }}; + return {token: function(stream) { + if (stream.match(query)) return "searching"; + while (!stream.eol()) { + stream.next(); + if (stream.match(query, false)) break; + } + }}; + } + + function SearchState() { + this.posFrom = this.posTo = this.query = null; + this.overlay = null; + } + function getSearchState(cm) { + return cm._searchState || (cm._searchState = new SearchState()); + } + function getSearchCursor(cm, query, pos) { + // Heuristic: if the query string is all lowercase, do a case insensitive search. + return cm.getSearchCursor(query, pos, typeof query == "string" && query == query.toLowerCase()); + } + function dialog(cm, text, shortText, f) { + if (cm.openDialog) cm.openDialog(text, f); + else f(prompt(shortText, "")); + } + function confirmDialog(cm, text, shortText, fs) { + if (cm.openConfirm) cm.openConfirm(text, fs); + else if (confirm(shortText)) fs[0](); + } + function parseQuery(query) { + var isRE = query.match(/^\/(.*)\/([a-z]*)$/); + return isRE ? new RegExp(isRE[1], isRE[2].indexOf("i") == -1 ? "" : "i") : query; + } + var queryDialog = + 'Search: (Use /re/ syntax for regexp search)'; + function doSearch(cm, rev) { + var state = getSearchState(cm); + if (state.query) return findNext(cm, rev); + dialog(cm, queryDialog, "Search for:", function(query) { + cm.operation(function() { + if (!query || state.query) return; + state.query = parseQuery(query); + cm.removeOverlay(state.overlay); + state.overlay = searchOverlay(query); + cm.addOverlay(state.overlay); + state.posFrom = state.posTo = cm.getCursor(); + findNext(cm, rev); + }); + }); + } + function findNext(cm, rev) {cm.operation(function() { + var state = getSearchState(cm); + var cursor = getSearchCursor(cm, state.query, rev ? state.posFrom : state.posTo); + if (!cursor.find(rev)) { + cursor = getSearchCursor(cm, state.query, rev ? CodeMirror.Pos(cm.lastLine()) : CodeMirror.Pos(cm.firstLine(), 0)); + if (!cursor.find(rev)) return; + } + cm.setSelection(cursor.from(), cursor.to()); + state.posFrom = cursor.from(); state.posTo = cursor.to(); + });} + function clearSearch(cm) {cm.operation(function() { + var state = getSearchState(cm); + if (!state.query) return; + state.query = null; + cm.removeOverlay(state.overlay); + });} + + var replaceQueryDialog = + 'Replace: (Use /re/ syntax for regexp search)'; + var replacementQueryDialog = 'With: '; + var doReplaceConfirm = "Replace? "; + function replace(cm, all) { + dialog(cm, replaceQueryDialog, "Replace:", function(query) { + if (!query) return; + query = parseQuery(query); + dialog(cm, replacementQueryDialog, "Replace with:", function(text) { + if (all) { + cm.operation(function() { + for (var cursor = getSearchCursor(cm, query); cursor.findNext();) { + if (typeof query != "string") { + var match = cm.getRange(cursor.from(), cursor.to()).match(query); + cursor.replace(text.replace(/\$(\d)/, function(_, i) {return match[i];})); + } else cursor.replace(text); + } + }); + } else { + clearSearch(cm); + var cursor = getSearchCursor(cm, query, cm.getCursor()); + var advance = function() { + var start = cursor.from(), match; + if (!(match = cursor.findNext())) { + cursor = getSearchCursor(cm, query); + if (!(match = cursor.findNext()) || + (start && cursor.from().line == start.line && cursor.from().ch == start.ch)) return; + } + cm.setSelection(cursor.from(), cursor.to()); + confirmDialog(cm, doReplaceConfirm, "Replace?", + [function() {doReplace(match);}, advance]); + }; + var doReplace = function(match) { + cursor.replace(typeof query == "string" ? text : + text.replace(/\$(\d)/, function(_, i) {return match[i];})); + advance(); + }; + advance(); + } + }); + }); + } + + CodeMirror.commands.find = function(cm) {clearSearch(cm); doSearch(cm);}; + CodeMirror.commands.findNext = doSearch; + CodeMirror.commands.findPrev = function(cm) {doSearch(cm, true);}; + CodeMirror.commands.clearSearch = clearSearch; + CodeMirror.commands.replace = replace; + CodeMirror.commands.replaceAll = function(cm) {replace(cm, true);}; +})(); diff --git a/modules/files/views/default/assets/addon/search/searchcursor.js b/modules/files/views/default/assets/addon/search/searchcursor.js new file mode 100755 index 0000000..a590e84 --- /dev/null +++ b/modules/files/views/default/assets/addon/search/searchcursor.js @@ -0,0 +1,133 @@ +(function(){ + var Pos = CodeMirror.Pos; + + function SearchCursor(doc, query, pos, caseFold) { + this.atOccurrence = false; this.doc = doc; + if (caseFold == null && typeof query == "string") caseFold = false; + + pos = pos ? doc.clipPos(pos) : Pos(0, 0); + this.pos = {from: pos, to: pos}; + + // The matches method is filled in based on the type of query. + // It takes a position and a direction, and returns an object + // describing the next occurrence of the query, or null if no + // more matches were found. + if (typeof query != "string") { // Regexp match + if (!query.global) query = new RegExp(query.source, query.ignoreCase ? "ig" : "g"); + this.matches = function(reverse, pos) { + if (reverse) { + query.lastIndex = 0; + var line = doc.getLine(pos.line).slice(0, pos.ch), cutOff = 0, match, start; + for (;;) { + query.lastIndex = cutOff; + var newMatch = query.exec(line); + if (!newMatch) break; + match = newMatch; + start = match.index; + cutOff = match.index + 1; + } + } else { + query.lastIndex = pos.ch; + var line = doc.getLine(pos.line), match = query.exec(line), + start = match && match.index; + } + if (match && match[0]) + return {from: Pos(pos.line, start), + to: Pos(pos.line, start + match[0].length), + match: match}; + }; + } else { // String query + if (caseFold) query = query.toLowerCase(); + var fold = caseFold ? function(str){return str.toLowerCase();} : function(str){return str;}; + var target = query.split("\n"); + // Different methods for single-line and multi-line queries + if (target.length == 1) { + if (!query.length) { + // Empty string would match anything and never progress, so + // we define it to match nothing instead. + this.matches = function() {}; + } else { + this.matches = function(reverse, pos) { + var line = fold(doc.getLine(pos.line)), len = query.length, match; + if (reverse ? (pos.ch >= len && (match = line.lastIndexOf(query, pos.ch - len)) != -1) + : (match = line.indexOf(query, pos.ch)) != -1) + return {from: Pos(pos.line, match), + to: Pos(pos.line, match + len)}; + }; + } + } else { + this.matches = function(reverse, pos) { + var ln = pos.line, idx = (reverse ? target.length - 1 : 0), match = target[idx], line = fold(doc.getLine(ln)); + var offsetA = (reverse ? line.indexOf(match) + match.length : line.lastIndexOf(match)); + if (reverse ? offsetA >= pos.ch || offsetA != match.length + : offsetA <= pos.ch || offsetA != line.length - match.length) + return; + for (;;) { + if (reverse ? !ln : ln == doc.lineCount() - 1) return; + line = fold(doc.getLine(ln += reverse ? -1 : 1)); + match = target[reverse ? --idx : ++idx]; + if (idx > 0 && idx < target.length - 1) { + if (line != match) return; + else continue; + } + var offsetB = (reverse ? line.lastIndexOf(match) : line.indexOf(match) + match.length); + if (reverse ? offsetB != line.length - match.length : offsetB != match.length) + return; + var start = Pos(pos.line, offsetA), end = Pos(ln, offsetB); + return {from: reverse ? end : start, to: reverse ? start : end}; + } + }; + } + } + } + + SearchCursor.prototype = { + findNext: function() {return this.find(false);}, + findPrevious: function() {return this.find(true);}, + + find: function(reverse) { + var self = this, pos = this.doc.clipPos(reverse ? this.pos.from : this.pos.to); + function savePosAndFail(line) { + var pos = Pos(line, 0); + self.pos = {from: pos, to: pos}; + self.atOccurrence = false; + return false; + } + + for (;;) { + if (this.pos = this.matches(reverse, pos)) { + if (!this.pos.from || !this.pos.to) { console.log(this.matches, this.pos); } + this.atOccurrence = true; + return this.pos.match || true; + } + if (reverse) { + if (!pos.line) return savePosAndFail(0); + pos = Pos(pos.line-1, this.doc.getLine(pos.line-1).length); + } + else { + var maxLine = this.doc.lineCount(); + if (pos.line == maxLine - 1) return savePosAndFail(maxLine); + pos = Pos(pos.line + 1, 0); + } + } + }, + + from: function() {if (this.atOccurrence) return this.pos.from;}, + to: function() {if (this.atOccurrence) return this.pos.to;}, + + replace: function(newText) { + if (!this.atOccurrence) return; + var lines = CodeMirror.splitLines(newText); + this.doc.replaceRange(lines, this.pos.from, this.pos.to); + this.pos.to = Pos(this.pos.from.line + lines.length - 1, + lines[lines.length - 1].length + (lines.length == 1 ? this.pos.from.ch : 0)); + } + }; + + CodeMirror.defineExtension("getSearchCursor", function(query, pos, caseFold) { + return new SearchCursor(this.doc, query, pos, caseFold); + }); + CodeMirror.defineDocExtension("getSearchCursor", function(query, pos, caseFold) { + return new SearchCursor(this, query, pos, caseFold); + }); +})(); diff --git a/modules/files/views/default/assets/addon/selection/active-line.js b/modules/files/views/default/assets/addon/selection/active-line.js new file mode 100755 index 0000000..211de0f --- /dev/null +++ b/modules/files/views/default/assets/addon/selection/active-line.js @@ -0,0 +1,39 @@ +// Because sometimes you need to style the cursor's line. +// +// Adds an option 'styleActiveLine' which, when enabled, gives the +// active line's wrapping
the CSS class "CodeMirror-activeline", +// and gives its background
the class "CodeMirror-activeline-background". + +(function() { + "use strict"; + var WRAP_CLASS = "CodeMirror-activeline"; + var BACK_CLASS = "CodeMirror-activeline-background"; + + CodeMirror.defineOption("styleActiveLine", false, function(cm, val, old) { + var prev = old && old != CodeMirror.Init; + if (val && !prev) { + updateActiveLine(cm); + cm.on("cursorActivity", updateActiveLine); + } else if (!val && prev) { + cm.off("cursorActivity", updateActiveLine); + clearActiveLine(cm); + delete cm._activeLine; + } + }); + + function clearActiveLine(cm) { + if ("_activeLine" in cm) { + cm.removeLineClass(cm._activeLine, "wrap", WRAP_CLASS); + cm.removeLineClass(cm._activeLine, "background", BACK_CLASS); + } + } + + function updateActiveLine(cm) { + var line = cm.getLineHandle(cm.getCursor().line); + if (cm._activeLine == line) return; + clearActiveLine(cm); + cm.addLineClass(line, "wrap", WRAP_CLASS); + cm.addLineClass(line, "background", BACK_CLASS); + cm._activeLine = line; + } +})(); diff --git a/modules/files/views/default/assets/addon/selection/mark-selection.js b/modules/files/views/default/assets/addon/selection/mark-selection.js new file mode 100755 index 0000000..d7ff30c --- /dev/null +++ b/modules/files/views/default/assets/addon/selection/mark-selection.js @@ -0,0 +1,34 @@ +// Because sometimes you need to mark the selected *text*. +// +// Adds an option 'styleSelectedText' which, when enabled, gives +// selected text the CSS class "CodeMirror-selectedtext". + +(function() { + "use strict"; + + CodeMirror.defineOption("styleSelectedText", false, function(cm, val, old) { + var prev = old && old != CodeMirror.Init; + if (val && !prev) { + updateSelectedText(cm); + cm.on("cursorActivity", updateSelectedText); + } else if (!val && prev) { + cm.off("cursorActivity", updateSelectedText); + clearSelectedText(cm); + delete cm._selectionMark; + } + }); + + function clearSelectedText(cm) { + if (cm._selectionMark) cm._selectionMark.clear(); + } + + function updateSelectedText(cm) { + clearSelectedText(cm); + + if (cm.somethingSelected()) + cm._selectionMark = cm.markText(cm.getCursor("start"), cm.getCursor("end"), + {className: "CodeMirror-selectedtext"}); + else + cm._selectionMark = null; + } +})(); diff --git a/modules/files/views/default/assets/jquery/README.txt b/modules/files/views/default/assets/jquery/README.txt new file mode 100755 index 0000000..4094d90 --- /dev/null +++ b/modules/files/views/default/assets/jquery/README.txt @@ -0,0 +1,27 @@ +This folder contains copies of the required jQuery libraries for use with +Dynatree 1.0 + +Currently using + +- jquery.js: + jQuery 1.7.1 + +- jquery-ui.custom.js: + jQuery UI 1.8.17 with all modules selected. + +- jquery.min.js and jquery-ui.custom.min.js: + Minified versions of the above + +Current versions are always available at + http://jqueryui.com/download + +Include the required libs like this: + + + + + +Alternatively the current libs may be we included from CDNs, for example + + + diff --git a/modules/files/views/default/assets/jquery/jquery-ui.custom.js b/modules/files/views/default/assets/jquery/jquery-ui.custom.js new file mode 100755 index 0000000..8dafccf --- /dev/null +++ b/modules/files/views/default/assets/jquery/jquery-ui.custom.js @@ -0,0 +1,11727 @@ +/*! + * jQuery UI 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.24", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + propAttr: $.fn.prop || $.fn.attr, + + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + //
+ value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +// support: jQuery <1.8 +if ( !$( "" ).outerWidth( 1 ).jquery ) { + $.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; + }); +} + +// selectors +function focusable( element, isTabIndexNotNaN ) { + var nodeName = element.nodeName.toLowerCase(); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || isTabIndexNotNaN + : isTabIndexNotNaN) + // the element and all of its ancestors must be visible + && visible( element ); +} + +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: $.expr.createPseudo ? + $.expr.createPseudo(function( dataName ) { + return function( elem ) { + return !!$.data( elem, dataName ); + }; + }) : + // support: jQuery <1.8 + function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + isTabIndexNaN = isNaN( tabIndex ); + return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + // access offsetHeight before setting the style to prevent a layout bug + // in IE 9 which causes the elemnt to continue to take up space even + // after it is removed from the DOM (#8026) + div.offsetHeight; + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + +// jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css +if ( !$.curCSS ) { + $.curCSS = $.css; +} + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); +/*! + * jQuery UI Widget 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + try { + $( this ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); +/*! + * jQuery UI Mouse 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var mouseHandled = false; +$( document ).mouseup( function( e ) { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + if ( this._mouseMoveDelegate ) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + } + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if( mouseHandled ) { return }; + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { + $.removeData(event.target, this.widgetName + '.preventClickEvent'); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); +/*! + * jQuery UI Position 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + support = {}, + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions if jQuery version doesn't support them (see #5280) + if ( !support.fractions ) { + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + } + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + if ( $.isFunction( options ) ) { + return this.each(function( i ) { + $( this ).offset( options.call( this, i, $( this ).offset() ) ); + }); + } + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +// jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css +if ( !$.curCSS ) { + $.curCSS = $.css; +} + +// fraction support test (older versions of jQuery don't support fractions) +(function () { + var body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ), + testElement, testElementParent, testElementStyle, offset, offsetTotal; + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( var i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;"; + + offset = $( div ).offset( function( _, offset ) { + return offset; + }).offset(); + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 ); + support.fractions = offsetTotal > 21 && offsetTotal < 22; +})(); + +}( jQuery )); +/*! + * jQuery UI Draggable 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + if ( o.iframeFix ) { + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('
') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + } + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + this.helper.addClass("ui-draggable-dragging"); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + + //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003) + if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event); + + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is no longer in the DOM don't bother to continue (see #8269) + var element = this.element[0], elementInDom = false; + while ( element && (element = element.parentNode) ) { + if (element == document ) { + elementInDom = true; + } + } + if ( !elementInDom && this.options.helper === "original" ) + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + _mouseUp: function(event) { + //Remove frame helpers + $("div.ui-draggable-iframeFix").each(function() { + this.parentNode.removeChild(this); + }); + + //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003) + if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event); + + return $.ui.mouse.prototype._mouseUp.call(this, event); + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0), + right: (parseInt(this.element.css("marginRight"),10) || 0), + bottom: (parseInt(this.element.css("marginBottom"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, + o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var c = $(o.containment); + var ce = c[0]; if(!ce) return; + var co = c.offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), + (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, + (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom + ]; + this.relative_container = c; + + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + var containment; + if(this.containment) { + if (this.relative_container){ + var co = this.relative_container.offset(); + containment = [ this.containment[0] + co.left, + this.containment[1] + co.top, + this.containment[2] + co.left, + this.containment[3] + co.top ]; + } + else { + containment = this.containment; + } + + if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top; + } + + if(o.grid) { + //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950) + var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; + pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; + pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.24" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); +/*! + * jQuery UI Droppable 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.mouse.js + * jquery.ui.draggable.js + */ +(function( $, undefined ) { + +$.widget("ui.droppable", { + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + }, + _create: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + + return this; + }, + + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.8.24" +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l <= x1 && x2 <= r + && t <= y1 && y2 <= b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = this._drop.call(this, event) || dropped; + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + dragStart: function( draggable, event ) { + //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003) + draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() { + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + }); + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + // find droppable parents with same scope + var scope = this.options.scope; + var parent = this.element.parents(':data(droppable)').filter(function () { + return $.data(this, 'droppable').options.scope === scope; + }); + + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + }, + dragStop: function( draggable, event ) { + draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" ); + //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003) + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + } +}; + +})(jQuery); +/*! + * jQuery UI Resizable 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('
').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('
'); + + // Apply zIndex to all handles - see #7960 + axis.css({ zIndex: o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + if (o.disabled) return; + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (o.disabled) return; + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + // Put this in the mouseDrag handler since the user can start pressing shift while resizing + this._updateVirtualBoundaries(event.shiftKey); + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateVirtualBoundaries: function(forceAspectRatio) { + var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b; + + b = { + minWidth: isNumber(o.minWidth) ? o.minWidth : 0, + maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity, + minHeight: isNumber(o.minHeight) ? o.minHeight : 0, + maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity + }; + + if(this._aspectRatio || forceAspectRatio) { + // We want to create an enclosing box whose aspect ration is the requested one + // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension + pMinWidth = b.minHeight * this.aspectRatio; + pMinHeight = b.minWidth / this.aspectRatio; + pMaxWidth = b.maxHeight * this.aspectRatio; + pMaxHeight = b.maxWidth / this.aspectRatio; + + if(pMinWidth > b.minWidth) b.minWidth = pMinWidth; + if(pMinHeight > b.minHeight) b.minHeight = pMinHeight; + if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth; + if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight; + } + this._vBoundaries = b; + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (isNumber(data.height)) data.width = (data.height * this.aspectRatio); + else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('
'); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.24" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10) + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); +/*! + * jQuery UI Selectable 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.addClass("ui-selectee"); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("
"); + }, + + destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + + return this; + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey && !event.ctrlKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + self._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if ((event.metaKey || event.ctrlKey) && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !event.ctrlKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +$.extend($.ui.selectable, { + version: "1.8.24" +}); + +})(jQuery); +/*! + * jQuery UI Sortable 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + widgetEventPrefix: "sort", + ready: false, + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are being displayed horizontally + this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + //We're ready to go + this.ready = true + + }, + + destroy: function() { + $.Widget.prototype.destroy.call( this ); + this.element + .removeClass("ui-sortable ui-sortable-disabled"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData(this.widgetName + "-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget() + [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + var that = this; + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, that.widgetName + '-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, that.widgetName + '-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + // Only put the placeholder inside the current Container, skip all + // items form other containers. This works because when moving + // an item from one container to another the + // currentContainer is switched before the placeholder is moved. + // + // Without this moving items in "sub-sortables" can cause the placeholder to jitter + // beetween the outer and inner container. + if (item.instance !== this.currentContainer) continue; + + if (itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp({ target: null }); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + if (this.placeholder) { + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = (this.options.axis === 'x') || $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = (this.options.axis === 'y') || $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(" + this.widgetName + "-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data(this.widgetName + '-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else if(this.currentContainer != this.containers[innermostIndex]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + var cur = this.containers[innermostIndex].floating ? this.items[j].item.offset().left : this.items[j].item.offset().top; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + this.direction = (cur - base > 0) ? 'down' : 'up'; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + + // Check if the items Container has Changed and trigger appropriate + // events. + if (this !== this.currentContainer) { + if(!noPropagation) { + delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.currentContainer)); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.currentContainer)); + } + } + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + originalPosition: self.originalPosition, + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +}); + +$.extend($.ui.sortable, { + version: "1.8.24" +}); + +})(jQuery); +/*! + * jQuery UI Accordion 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.accordion", { + options: { + active: 0, + animated: "slide", + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); + } + }, + + _create: function() { + var self = this, + options = self.options; + + self.running = 0; + + self.element + .addClass( "ui-accordion ui-widget ui-helper-reset" ) + // in lack of child-selectors in CSS + // we need to mark top-LIs in a UL-accordion for some IE-fix + .children( "li" ) + .addClass( "ui-accordion-li-fix" ); + + self.headers = self.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) + .bind( "mouseenter.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + }) + .bind( "mouseleave.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-hover" ); + }) + .bind( "focus.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-focus" ); + }) + .bind( "blur.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-focus" ); + }); + + self.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); + + if ( options.navigation ) { + var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); + if ( current.length ) { + var header = current.closest( ".ui-accordion-header" ); + if ( header.length ) { + // anchor within header + self.active = header; + } else { + // anchor within content + self.active = current.closest( ".ui-accordion-content" ).prev(); + } + } + } + + self.active = self._findActive( self.active || options.active ) + .addClass( "ui-state-default ui-state-active" ) + .toggleClass( "ui-corner-all" ) + .toggleClass( "ui-corner-top" ); + self.active.next().addClass( "ui-accordion-content-active" ); + + self._createIcons(); + self.resize(); + + // ARIA + self.element.attr( "role", "tablist" ); + + self.headers + .attr( "role", "tab" ) + .bind( "keydown.accordion", function( event ) { + return self._keydown( event ); + }) + .next() + .attr( "role", "tabpanel" ); + + self.headers + .not( self.active || "" ) + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .next() + .hide(); + + // make sure at least one header is in the tab order + if ( !self.active.length ) { + self.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + self.active + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }); + } + + // only need links in tab order for Safari + if ( !$.browser.safari ) { + self.headers.find( "a" ).attr( "tabIndex", -1 ); + } + + if ( options.event ) { + self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { + self._clickHandler.call( self, event, this ); + event.preventDefault(); + }); + } + }, + + _createIcons: function() { + var options = this.options; + if ( options.icons ) { + $( "" ) + .addClass( "ui-icon " + options.icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-icon" ) + .toggleClass(options.icons.header) + .toggleClass(options.icons.headerSelected); + this.element.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers.children( ".ui-icon" ).remove(); + this.element.removeClass( "ui-accordion-icons" ); + }, + + destroy: function() { + var options = this.options; + + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + this.headers + .unbind( ".accordion" ) + .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-selected" ) + .removeAttr( "tabIndex" ); + + this.headers.find( "a" ).removeAttr( "tabIndex" ); + this._destroyIcons(); + var contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); + if ( options.autoHeight || options.fillHeight ) { + contents.css( "height", "" ); + } + + return $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + + if ( key == "active" ) { + this.activate( value ); + } + if ( key == "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key == "disabled" ) { + this.headers.add(this.headers.next()) + [ value ? "addClass" : "removeClass" ]( + "ui-accordion-disabled ui-state-disabled" ); + } + }, + + _keydown: function( event ) { + if ( this.options.disabled || event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._clickHandler( { target: event.target }, event.target ); + event.preventDefault(); + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + return false; + } + + return true; + }, + + resize: function() { + var options = this.options, + maxHeight; + + if ( options.fillSpace ) { + if ( $.browser.msie ) { + var defOverflow = this.element.parent().css( "overflow" ); + this.element.parent().css( "overflow", "hidden"); + } + maxHeight = this.element.parent().height(); + if ($.browser.msie) { + this.element.parent().css( "overflow", defOverflow ); + } + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( options.autoHeight ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }) + .height( maxHeight ); + } + + return this; + }, + + activate: function( index ) { + // TODO this gets called on init, changing the option without an explicit call for that + this.options.active = index; + // call clickHandler with custom event + var active = this._findActive( index )[ 0 ]; + this._clickHandler( { target: active }, active ); + + return this; + }, + + _findActive: function( selector ) { + return selector + ? typeof selector === "number" + ? this.headers.filter( ":eq(" + selector + ")" ) + : this.headers.not( this.headers.not( selector ) ) + : selector === false + ? $( [] ) + : this.headers.filter( ":eq(0)" ); + }, + + // TODO isn't event.target enough? why the separate target argument? + _clickHandler: function( event, target ) { + var options = this.options; + if ( options.disabled ) { + return; + } + + // called only when using activate(false) to close all parts programmatically + if ( !event.target ) { + if ( !options.collapsible ) { + return; + } + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + this.active.next().addClass( "ui-accordion-content-active" ); + var toHide = this.active.next(), + data = { + options: options, + newHeader: $( [] ), + oldHeader: options.active, + newContent: $( [] ), + oldContent: toHide + }, + toShow = ( this.active = $( [] ) ); + this._toggle( toShow, toHide, data ); + return; + } + + // get the click target + var clicked = $( event.currentTarget || target ), + clickedIsActive = clicked[0] === this.active[0]; + + // TODO the option is changed, is that correct? + // TODO if it is correct, shouldn't that happen after determining that the click is valid? + options.active = options.collapsible && clickedIsActive ? + false : + this.headers.index( clicked ); + + // if animations are still active, or the active header is the target, ignore click + if ( this.running || ( !options.collapsible && clickedIsActive ) ) { + return; + } + + // find elements to show and hide + var active = this.active, + toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: options, + newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && options.collapsible ? $([]) : toShow, + oldContent: toHide + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $([]) : clicked; + this._toggle( toShow, toHide, data, clickedIsActive, down ); + + // switch classes + active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-state-default ui-corner-all" ) + .addClass( "ui-state-active ui-corner-top" ) + .children( ".ui-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.headerSelected ); + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + + return; + }, + + _toggle: function( toShow, toHide, data, clickedIsActive, down ) { + var self = this, + options = self.options; + + self.toShow = toShow; + self.toHide = toHide; + self.data = data; + + var complete = function() { + if ( !self ) { + return; + } + return self._completed.apply( self, arguments ); + }; + + // trigger changestart event + self._trigger( "changestart", null, self.data ); + + // count elements to animate + self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if ( options.animated ) { + var animOptions = {}; + + if ( options.collapsible && clickedIsActive ) { + animOptions = { + toShow: $( [] ), + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } + + if ( !options.proxied ) { + options.proxied = options.animated; + } + + if ( !options.proxiedDuration ) { + options.proxiedDuration = options.duration; + } + + options.animated = $.isFunction( options.proxied ) ? + options.proxied( animOptions ) : + options.proxied; + + options.duration = $.isFunction( options.proxiedDuration ) ? + options.proxiedDuration( animOptions ) : + options.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = options.duration, + easing = options.animated; + + if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { + easing = "slide"; + } + if ( !animations[ easing ] ) { + animations[ easing ] = function( options ) { + this.slide( options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[ easing ]( animOptions ); + } else { + if ( options.collapsible && clickedIsActive ) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete( true ); + } + + // TODO assert that the blur and focus triggers are really necessary, remove otherwise + toHide.prev() + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .blur(); + toShow.prev() + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }) + .focus(); + }, + + _completed: function( cancel ) { + this.running = cancel ? 0 : --this.running; + if ( this.running ) { + return; + } + + if ( this.options.clearStyle ) { + this.toShow.add( this.toHide ).css({ + height: "", + overflow: "" + }); + } + + // other classes are removed before the animation; this one needs to stay until completed + this.toHide.removeClass( "ui-accordion-content-active" ); + // Work around for rendering bug in IE (#5421) + if ( this.toHide.length ) { + this.toHide.parent()[0].className = this.toHide.parent()[0].className; + } + + this._trigger( "change", null, this.data ); + } +}); + +$.extend( $.ui.accordion, { + version: "1.8.24", + animations: { + slide: function( options, additions ) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions ); + if ( !options.toHide.size() ) { + options.toShow.animate({ + height: "show", + paddingTop: "show", + paddingBottom: "show" + }, options ); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({ + height: "hide", + paddingTop: "hide", + paddingBottom: "hide" + }, options ); + return; + } + var overflow = options.toShow.css( "overflow" ), + percentDone = 0, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( s.parent().width() + - parseFloat( s.css( "paddingLeft" ) ) + - parseFloat( s.css( "paddingRight" ) ) + - ( parseFloat( s.css( "borderLeftWidth" ) ) || 0 ) + - ( parseFloat( s.css( "borderRightWidth" ) ) || 0 ) ); + + $.each( fxAttrs, function( i, prop ) { + hideProps[ prop ] = "hide"; + + var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); + showProps[ prop ] = { + value: parts[ 1 ], + unit: parts[ 2 ] || "px" + }; + }); + options.toShow.css({ height: 0, overflow: "hidden" }).show(); + options.toHide + .filter( ":hidden" ) + .each( options.complete ) + .end() + .filter( ":visible" ) + .animate( hideProps, { + step: function( now, settings ) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if ( settings.prop == "height" ) { + percentDone = ( settings.end - settings.start === 0 ) ? 0 : + ( settings.now - settings.start ) / ( settings.end - settings.start ); + } + + options.toShow[ 0 ].style[ settings.prop ] = + ( percentDone * showProps[ settings.prop ].value ) + + showProps[ settings.prop ].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css( "height", "" ); + } + options.toShow.css({ + width: originalWidth, + overflow: overflow + }); + options.complete(); + } + }); + }, + bounceslide: function( options ) { + this.slide( options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + } + } +}); + +})( jQuery ); +/*! + * jQuery UI Autocomplete 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function( $, undefined ) { + +// used to prevent race conditions with remote data sources +var requestIndex = 0; + +$.widget( "ui.autocomplete", { + options: { + appendTo: "body", + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null + }, + + pending: 0, + + _create: function() { + var self = this, + doc = this.element[ 0 ].ownerDocument, + suppressKeyPress; + this.isMultiLine = this.element.is( "textarea" ); + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ) + // TODO verify these actually work as intended + .attr({ + role: "textbox", + "aria-autocomplete": "list", + "aria-haspopup": "true" + }) + .bind( "keydown.autocomplete", function( event ) { + if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) { + return; + } + + suppressKeyPress = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + self._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + self._move( "nextPage", event ); + break; + case keyCode.UP: + self._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + self._keyEvent( "next", event ); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( self.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + } + //passthrough - ENTER and TAB both select the current element + case keyCode.TAB: + if ( !self.menu.active ) { + return; + } + self.menu.select( event ); + break; + case keyCode.ESCAPE: + self.element.val( self.term ); + self.close( event ); + break; + default: + // keypress is triggered before the input value is changed + clearTimeout( self.searching ); + self.searching = setTimeout(function() { + // only search if the value has changed + if ( self.term != self.element.val() ) { + self.selectedItem = null; + self.search( null, event ); + } + }, self.options.delay ); + break; + } + }) + .bind( "keypress.autocomplete", function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + } + }) + .bind( "focus.autocomplete", function() { + if ( self.options.disabled ) { + return; + } + + self.selectedItem = null; + self.previous = self.element.val(); + }) + .bind( "blur.autocomplete", function( event ) { + if ( self.options.disabled ) { + return; + } + + clearTimeout( self.searching ); + // clicks on the menu (or a button to trigger a search) will cause a blur event + self.closing = setTimeout(function() { + self.close( event ); + self._change( event ); + }, 150 ); + }); + this._initSource(); + this.menu = $( "
    " ) + .addClass( "ui-autocomplete" ) + .appendTo( $( this.options.appendTo || "body", doc )[0] ) + // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) + .mousedown(function( event ) { + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = self.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + setTimeout(function() { + $( document ).one( 'mousedown', function( event ) { + if ( event.target !== self.element[ 0 ] && + event.target !== menuElement && + !$.ui.contains( menuElement, event.target ) ) { + self.close(); + } + }); + }, 1 ); + } + + // use another timeout to make sure the blur-event-handler on the input was already triggered + setTimeout(function() { + clearTimeout( self.closing ); + }, 13); + }) + .menu({ + focus: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ); + if ( false !== self._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( /^key/.test(event.originalEvent.type) ) { + self.element.val( item.value ); + } + } + }, + selected: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ), + previous = self.previous; + + // only trigger when focus was lost (click on menu) + if ( self.element[0] !== doc.activeElement ) { + self.element.focus(); + self.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + setTimeout(function() { + self.previous = previous; + self.selectedItem = item; + }, 1); + } + + if ( false !== self._trigger( "select", event, { item: item } ) ) { + self.element.val( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + self.term = self.element.val(); + + self.close( event ); + self.selectedItem = item; + }, + blur: function( event, ui ) { + // don't set the value of the text field if it's already correct + // this prevents moving the cursor unnecessarily + if ( self.menu.element.is(":visible") && + ( self.element.val() !== self.term ) ) { + self.element.val( self.term ); + } + } + }) + .zIndex( this.element.zIndex() + 1 ) + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .hide() + .data( "menu" ); + if ( $.fn.bgiframe ) { + this.menu.element.bgiframe(); + } + // turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + self.beforeunloadHandler = function() { + self.element.removeAttr( "autocomplete" ); + }; + $( window ).bind( "beforeunload", self.beforeunloadHandler ); + }, + + destroy: function() { + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-autocomplete" ) + .removeAttr( "aria-haspopup" ); + this.menu.element.remove(); + $( window ).unbind( "beforeunload", this.beforeunloadHandler ); + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] ) + } + if ( key === "disabled" && value && this.xhr ) { + this.xhr.abort(); + } + }, + + _initSource: function() { + var self = this, + array, + url; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter(array, request.term) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if ( self.xhr ) { + self.xhr.abort(); + } + self.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + success: function( data, status ) { + response( data ); + }, + error: function() { + response( [] ); + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + search: function( value, event ) { + value = value != null ? value : this.element.val(); + + // always save the actual value, not the one passed as an argument + this.term = this.element.val(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + clearTimeout( this.closing ); + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.pending++; + this.element.addClass( "ui-autocomplete-loading" ); + + this.source( { term: value }, this._response() ); + }, + + _response: function() { + var that = this, + index = ++requestIndex; + + return function( content ) { + if ( index === requestIndex ) { + that.__response( content ); + } + + that.pending--; + if ( !that.pending ) { + that.element.removeClass( "ui-autocomplete-loading" ); + } + }; + }, + + __response: function( content ) { + if ( !this.options.disabled && content && content.length ) { + content = this._normalize( content ); + this._suggest( content ); + this._trigger( "open" ); + } else { + this.close(); + } + }, + + close: function( event ) { + clearTimeout( this.closing ); + if ( this.menu.element.is(":visible") ) { + this.menu.element.hide(); + this.menu.deactivate(); + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function(item) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ); + this._renderMenu( ul, items ); + // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate + this.menu.deactivate(); + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); + + if ( this.options.autoFocus ) { + this.menu.next( new $.Event("mouseover") ); + } + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + // Firefox wraps long text (possibly a rounding bug) + // so we add 1px to avoid the wrapping (#7513) + ul.width( "" ).outerWidth() + 1, + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var self = this; + $.each( items, function( index, item ) { + self._renderItem( ul, item ); + }); + }, + + _renderItem: function( ul, item) { + return $( "
  • " ) + .data( "item.autocomplete", item ) + .append( $( "    " ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is(":visible") ) { + this.search( null, event ); + return; + } + if ( this.menu.first() && /^previous/.test(direction) || + this.menu.last() && /^next/.test(direction) ) { + this.element.val( this.term ); + this.menu.deactivate(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + }, + _keyEvent: function( keyEvent, event ) { + if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) { + this._move( keyEvent, event ); + + // prevents moving cursor to beginning/end of the text field in some browsers + event.preventDefault(); + } + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +}( jQuery )); + +/* + * jQuery UI Menu (not officially released) + * + * This widget isn't yet finished and the API is subject to change. We plan to finish + * it for the next release. You're welcome to give it a try anyway and give us feedback, + * as long as you're okay with migrating your code later on. We can help with that, too. + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.menu", { + _create: function() { + var self = this; + this.element + .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") + .attr({ + role: "listbox", + "aria-activedescendant": "ui-active-menuitem" + }) + .click(function( event ) { + if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + return; + } + // temporary + event.preventDefault(); + self.select( event ); + }); + this.refresh(); + }, + + refresh: function() { + var self = this; + + // don't refresh list items that are already adapted + var items = this.element.children("li:not(.ui-menu-item):has(a)") + .addClass("ui-menu-item") + .attr("role", "menuitem"); + + items.children("a") + .addClass("ui-corner-all") + .attr("tabindex", -1) + // mouseenter doesn't work with event delegation + .mouseenter(function( event ) { + self.activate( event, $(this).parent() ); + }) + .mouseleave(function() { + self.deactivate(); + }); + }, + + activate: function( event, item ) { + this.deactivate(); + if (this.hasScroll()) { + var offset = item.offset().top - this.element.offset().top, + scroll = this.element.scrollTop(), + elementHeight = this.element.height(); + if (offset < 0) { + this.element.scrollTop( scroll + offset); + } else if (offset >= elementHeight) { + this.element.scrollTop( scroll + offset - elementHeight + item.height()); + } + } + this.active = item.eq(0) + .children("a") + .addClass("ui-state-hover") + .attr("id", "ui-active-menuitem") + .end(); + this._trigger("focus", event, { item: item }); + }, + + deactivate: function() { + if (!this.active) { return; } + + this.active.children("a") + .removeClass("ui-state-hover") + .removeAttr("id"); + this._trigger("blur"); + this.active = null; + }, + + next: function(event) { + this.move("next", ".ui-menu-item:first", event); + }, + + previous: function(event) { + this.move("prev", ".ui-menu-item:last", event); + }, + + first: function() { + return this.active && !this.active.prevAll(".ui-menu-item").length; + }, + + last: function() { + return this.active && !this.active.nextAll(".ui-menu-item").length; + }, + + move: function(direction, edge, event) { + if (!this.active) { + this.activate(event, this.element.children(edge)); + return; + } + var next = this.active[direction + "All"](".ui-menu-item").eq(0); + if (next.length) { + this.activate(event, next); + } else { + this.activate(event, this.element.children(edge)); + } + }, + + // TODO merge with previousPage + nextPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.last()) { + this.activate(event, this.element.children(".ui-menu-item:first")); + return; + } + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base - height + $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:last"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.last() ? ":first" : ":last")); + } + }, + + // TODO merge with nextPage + previousPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.first()) { + this.activate(event, this.element.children(".ui-menu-item:last")); + return; + } + + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base + height - $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:first"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.first() ? ":last" : ":first")); + } + }, + + hasScroll: function() { + return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight"); + }, + + select: function( event ) { + this._trigger("selected", event, { item: this.active }); + } +}); + +}(jQuery)); +/*! + * jQuery UI Button 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var lastActive, startXPos, startYPos, clickDragged, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function() { + var buttons = $( this ).find( ":ui-button" ); + setTimeout(function() { + buttons.button( "refresh" ); + }, 1 ); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = !!this.element.propAttr( "disabled" ); + } else { + this.element.propAttr( "disabled", this.options.disabled ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave.button", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( hoverClass ); + }) + .bind( "click.button", function( event ) { + if ( options.disabled ) { + event.preventDefault(); + event.stopImmediatePropagation(); + } + }); + + this.element + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + self.buttonElement.addClass( focusClass ); + }) + .bind( "blur.button", function() { + self.buttonElement.removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change.button", function() { + if ( clickDragged ) { + return; + } + self.refresh(); + }); + // if mouse moves between mousedown and mouseup (drag) set clickDragged flag + // prevents issue where button state changes but checkbox/radio checked state + // does not in Firefox (see ticket #6970) + this.buttonElement + .bind( "mousedown.button", function( event ) { + if ( options.disabled ) { + return; + } + clickDragged = false; + startXPos = event.pageX; + startYPos = event.pageY; + }) + .bind( "mouseup.button", function( event ) { + if ( options.disabled ) { + return; + } + if ( startXPos !== event.pageX || startYPos !== event.pageY ) { + clickDragged = true; + } + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", "true" ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + this._resetButton(); + }, + + _determineButtonType: function() { + + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else if ( this.element.is(":radio") ) { + this.type = "radio"; + } else if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + var ancestor = this.element.parents().filter(":last"), + labelSelector = "label[for='" + this.element.attr("id") + "']"; + this.buttonElement = ancestor.find( labelSelector ); + if ( !this.buttonElement.length ) { + ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); + this.buttonElement = ancestor.filter( labelSelector ); + if ( !this.buttonElement.length ) { + this.buttonElement = ancestor.find( labelSelector ); + } + } + this.element.addClass( "ui-helper-hidden-accessible" ); + + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.propAttr( "disabled", true ); + } else { + this.element.propAttr( "disabled", false ); + } + return; + } + this._resetButton(); + }, + + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "", this.element[0].ownerDocument ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary, + buttonClasses = []; + + if ( icons.primary || icons.secondary ) { + if ( this.options.text ) { + buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); + } + + if ( icons.primary ) { + buttonElement.prepend( "" ); + } + + if ( icons.secondary ) { + buttonElement.append( "" ); + } + + if ( !this.options.text ) { + buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); + + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } + } + } else { + buttonClasses.push( "ui-button-text-only" ); + } + buttonElement.addClass( buttonClasses.join( " " ) ); + } +}); + +$.widget( "ui.buttonset", { + options: { + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + var rtl = this.element.css( "direction" ) === "rtl"; + + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( rtl ? "ui-corner-right" : "ui-corner-left" ) + .end() + .filter( ":last" ) + .addClass( rtl ? "ui-corner-left" : "ui-corner-right" ) + .end() + .end(); + }, + + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + + $.Widget.prototype.destroy.call( this ); + } +}); + +}( jQuery ) ); +/*! + * jQuery UI Dialog 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('
    ')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('
    ')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if ( options.modal ) { + uiDialog.bind( "keydown.ui-dialog", function( event ) { + if ( event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('
    ') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "
    " ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in button ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.24", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('
    ').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); +/*! + * jQuery UI Slider 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "", + handleCount = ( o.values && o.values.length ) || 1, + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } + + this.range = $( "
    " ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); + } + + for ( var i = existingHandles.length; i < handleCount; i += 1 ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + event.preventDefault(); + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.propAttr( "disabled", true ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.propAttr( "disabled", false ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.24" +}); + +}(jQuery)); +/*! + * jQuery UI Tabs 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "
    ", + remove: null, + select: null, + show: null, + spinner: "Loading…", + tabTemplate: "
  • #{label}
    • " + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on
  • + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.24" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery ); +/*! + * jQuery UI Datepicker 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * jquery.ui.core.js + */ +(function( $, undefined ) { + +$.extend($.ui, { datepicker: { version: "1.8.24" } }); + +var PROP_NAME = 'datepicker'; +var dpuuid = new Date().getTime(); +var instActive; + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + weekHeader: 'Wk', // Column header for week of the year + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: '' // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'fadeIn', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: 'c-10:c+10', // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'fast', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false, // True to size the input for the date format, false to leave as is + disabled: false // The initial disabled state + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = bindHover($('
    ')); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + //Keep track of the maximum number of rows displayed (see #7043) + maxRows: 4, + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) { + this.uuid += 1; + target.id = 'dp' + this.uuid; + } + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + bindHover($('
    ')))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + }, + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (inst.append) + inst.append.remove(); + if (appendText) { + inst.append = $('' + appendText + ''); + input[isRTL ? 'before' : 'after'](inst.append); + } + input.unbind('focus', this._showDatepicker); + if (inst.trigger) + inst.trigger.remove(); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else if ($.datepicker._datepickerShowing && $.datepicker._lastInput != input[0]) { + $.datepicker._hideDatepicker(); + $.datepicker._showDatepicker(input[0]); + } else + $.datepicker._showDatepicker(input[0]); + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + inst.input.attr('size', this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + //If disabled option is true, disable the datepicker before showing it (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements + // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height + inst.dpDiv.css( "display", "block" ); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $(''); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + removeAttr("disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + attr("disabled", "disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) + inst.settings.minDate = this._formatDate(inst, minDate); + if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) + inst.settings.maxDate = this._formatDate(inst, maxDate); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + var onSelect = $.datepicker._get(inst, 'onSelect'); + if (onSelect) { + var dateStr = $.datepicker._formatDate(inst); + + // trigger custom callback + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + } + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (err) { + $.datepicker.log(err); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + If false returned from beforeShow event handler do not show. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + if ( inst && $.datepicker._datepickerShowing ) { + $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] ); + } + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; + if(beforeShowSettings === false){ + //false + return; + } + extendRemove(inst.settings, beforeShowSettings); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + $.datepicker._datepickerShowing = true; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + var borders = $.datepicker._getBorders(inst.dpDiv); + instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + this._attachHandlers(inst); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()); + var viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop()); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + this._datepickerShowing = false; + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + + var $target = $(event.target), + inst = $.datepicker._getInst($target[0]); + + if ( ( ( $target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.closest("." + $.datepicker._triggerClass).length && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) || + ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst != inst ) ) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + var index = -1; + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index != -1) + return index + 1; + else + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (iValue < value.length){ + throw "Extra/unparsed characters found in date: " + value.substring(iValue); + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/00 + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Attach the onxxx handlers. These are declared statically so + * they work with static code transformers like Caja. + */ + _attachHandlers: function(inst) { + var stepMonths = this._get(inst, 'stepMonths'); + var id = '#' + inst.id.replace( /\\\\/g, "\\" ); + inst.dpDiv.find('[data-handler]').map(function () { + var handler = { + prev: function () { + window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, -stepMonths, 'M'); + }, + next: function () { + window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, +stepMonths, 'M'); + }, + hide: function () { + window['DP_jQuery_' + dpuuid].datepicker._hideDatepicker(); + }, + today: function () { + window['DP_jQuery_' + dpuuid].datepicker._gotoToday(id); + }, + selectDay: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectDay(id, +this.getAttribute('data-month'), +this.getAttribute('data-year'), this); + return false; + }, + selectMonth: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'M'); + return false; + }, + selectYear: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'Y'); + return false; + } + }; + $(this).bind(this.getAttribute('data-event'), handler[this.getAttribute('data-handler')]); + }); + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '' + prevText + '' : + (hideIfNoPrevNext ? '' : '' + prevText + '')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '' + nextText + '' : + (hideIfNoPrevNext ? '' : '' + nextText + '')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '' : ''); + var buttonPanel = (showButtonPanel) ? '
    ' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '' : '') + (isRTL ? '' : controls) + '
    ' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + this.maxRows = 4; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '
    '; + } + calender += '
    ' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '
    ' + + ''; + var thead = (showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '' + dayNamesMin[day] + ''; + } + calender += thead + ''; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += ''; + var tbody = (!showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += ''; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + ''; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '
    ' + this._get(inst, 'weekHeader') + '
    ' + + this._get(inst, 'calculateWeek')(printDate) + '' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '' + printDate.getDate() + '' : '' + printDate.getDate() + '')) + '
    ' + (isMultiMonth ? '
    ' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '
    ' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '
    '; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '' + monthNames[drawMonth] + ''; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += ''; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '' + drawYear + ''; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += ''; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '
    '; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; + return dpDiv.bind('mouseout', function(event) { + var elem = $( event.target ).closest( selector ); + if ( !elem.length ) { + return; + } + elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); + }) + .bind('mouseover', function(event) { + var elem = $( event.target ).closest( selector ); + if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || + !elem.length ) { + return; + } + elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + elem.addClass('ui-state-hover'); + if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); + if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.24"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); +/*! + * jQuery UI Progressbar 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "
    " ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggle( value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.24" +}); + +})( jQuery ); +/*! + * jQuery UI Effects 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +;jQuery.effects || (function($, undefined) { + +$.effects = {}; + + + +/******************************************************************************/ +/****************************** COLOR ANIMATIONS ******************************/ +/******************************************************************************/ + +// override the animation for color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', + 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], +function(i, attr) { + $.fx.step[attr] = function(fx) { + if (!fx.colorInit) { + fx.start = getColor(fx.elem, attr); + fx.end = getRGB(fx.end); + fx.colorInit = true; + } + + fx.elem.style[attr] = 'rgb(' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + // jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css + color = ($.curCSS || $.css)(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ + +var classAnimationActions = ['add', 'remove', 'toggle'], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +function getElementStyles() { + var style = document.defaultView + ? document.defaultView.getComputedStyle(this, null) + : this.currentStyle, + newStyle = {}, + key, + camelCase; + + // webkit enumerates style porperties + if (style && style.length && style[0] && style[style[0]]) { + var len = style.length; + while (len--) { + key = style[len]; + if (typeof style[key] == 'string') { + camelCase = key.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + newStyle[camelCase] = style[key]; + } + } + } else { + for (key in style) { + if (typeof style[key] === 'string') { + newStyle[key] = style[key]; + } + } + } + + return newStyle; +} + +function filterStyles(styles) { + var name, value; + for (name in styles) { + value = styles[name]; + if ( + // ignore null and undefined values + value == null || + // ignore functions (when does this occur?) + $.isFunction(value) || + // shorthand styles that need to be expanded + name in shorthandStyles || + // ignore scrollbars (break in IE) + (/scrollbar/).test(name) || + + // only colors or values that can be converted to numbers + (!(/color/i).test(name) && isNaN(parseFloat(value))) + ) { + delete styles[name]; + } + } + + return styles; +} + +function styleDifference(oldStyle, newStyle) { + var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 + name; + + for (name in newStyle) { + if (oldStyle[name] != newStyle[name]) { + diff[name] = newStyle[name]; + } + } + + return diff; +} + +$.effects.animateClass = function(value, duration, easing, callback) { + if ($.isFunction(easing)) { + callback = easing; + easing = null; + } + + return this.queue(function() { + var that = $(this), + originalStyleAttr = that.attr('style') || ' ', + originalStyle = filterStyles(getElementStyles.call(this)), + newStyle, + className = that.attr('class') || ""; + + $.each(classAnimationActions, function(i, action) { + if (value[action]) { + that[action + 'Class'](value[action]); + } + }); + newStyle = filterStyles(getElementStyles.call(this)); + that.attr('class', className); + + that.animate(styleDifference(originalStyle, newStyle), { + queue: false, + duration: duration, + easing: easing, + complete: function() { + $.each(classAnimationActions, function(i, action) { + if (value[action]) { that[action + 'Class'](value[action]); } + }); + // work around bug in IE by clearing the cssText before setting it + if (typeof that.attr('style') == 'object') { + that.attr('style').cssText = ''; + that.attr('style').cssText = originalStyleAttr; + } else { + that.attr('style', originalStyleAttr); + } + if (callback) { callback.apply(this, arguments); } + $.dequeue( this ); + } + }); + }); +}; + +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + + _removeClass: $.fn.removeClass, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + + _toggleClass: $.fn.toggleClass, + toggleClass: function(classNames, force, speed, easing, callback) { + if ( typeof force == "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter; + return this._toggleClass(classNames, force); + } else { + return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); + } + } else { + // without switch parameter; + return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + } + }, + + switchClass: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + } +}); + + + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +$.extend($.effects, { + version: "1.8.24", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + // if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + 'float': element.css('float') + }, + wrapper = $('
    ') + .addClass('ui-effects-wrapper') + .css({ + fontSize: '100%', + background: 'transparent', + border: 'none', + margin: 0, + padding: 0 + }), + active = document.activeElement; + + // support: Firefox + // Firefox incorrectly exposes anonymous content + // https://bugzilla.mozilla.org/show_bug.cgi?id=561664 + try { + active.id; + } catch( e ) { + active = document.body; + } + + element.wrap( wrapper ); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative' }); + } else { + $.extend(props, { + position: element.css('position'), + zIndex: element.css('z-index') + }); + $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { + props[pos] = element.css(pos); + if (isNaN(parseInt(props[pos], 10))) { + props[pos] = 'auto'; + } + }); + element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' }); + } + + return wrapper.css(props).show(); + }, + + removeWrapper: function(element) { + var parent, + active = document.activeElement; + + if (element.parent().is('.ui-effects-wrapper')) { + parent = element.parent().replaceWith(element); + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + return parent; + } + + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + var unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + } +}); + + +function _normalizeArguments(effect, options, speed, callback) { + // shift params for method overloading + if (typeof effect == 'object') { + callback = options; + speed = null; + options = effect; + effect = options.effect; + } + if ($.isFunction(options)) { + callback = options; + speed = null; + options = {}; + } + if (typeof options == 'number' || $.fx.speeds[options]) { + callback = speed; + speed = options; + options = {}; + } + if ($.isFunction(speed)) { + callback = speed; + speed = null; + } + + options = options || {}; + + speed = speed || options.duration; + speed = $.fx.off ? 0 : typeof speed == 'number' + ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + + callback = callback || options.complete; + + return [effect, options, speed, callback]; +} + +function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + if ( typeof speed === "string" && !$.effects[ speed ] ) { + return true; + } + + return false; +} + +$.fn.extend({ + effect: function(effect, options, speed, callback) { + var args = _normalizeArguments.apply(this, arguments), + // TODO: make effects take actual parameters instead of a hash + args2 = { + options: args[1], + duration: args[2], + callback: args[3] + }, + mode = args2.options.mode, + effectMethod = $.effects[effect]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args2.duration, args2.callback ); + } else { + return this.each(function() { + if ( args2.callback ) { + args2.callback.call( this ); + } + }); + } + } + + return effectMethod.call(this, args2); + }, + + _show: $.fn.show, + show: function(speed) { + if ( standardSpeed( speed ) ) { + return this._show.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'show'; + return this.effect.apply(this, args); + } + }, + + _hide: $.fn.hide, + hide: function(speed) { + if ( standardSpeed( speed ) ) { + return this._hide.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'hide'; + return this.effect.apply(this, args); + } + }, + + // jQuery core overloads toggle and creates _toggle + __toggle: $.fn.toggle, + toggle: function(speed) { + if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { + return this.__toggle.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'toggle'; + return this.effect.apply(this, args); + } + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + + + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +// based on easing equations from Robert Penner (http://www.robertpenner.com/easing) + +var baseEasings = {}; + +$.each( [ "Quad", "Cubic", "Quart", "Quint", "Expo" ], function( i, name ) { + baseEasings[ name ] = function( p ) { + return Math.pow( p, i + 2 ); + }; +}); + +$.extend( baseEasings, { + Sine: function ( p ) { + return 1 - Math.cos( p * Math.PI / 2 ); + }, + Circ: function ( p ) { + return 1 - Math.sqrt( 1 - p * p ); + }, + Elastic: function( p ) { + return p === 0 || p === 1 ? p : + -Math.pow( 2, 8 * (p - 1) ) * Math.sin( ( (p - 1) * 80 - 7.5 ) * Math.PI / 15 ); + }, + Back: function( p ) { + return p * p * ( 3 * p - 2 ); + }, + Bounce: function ( p ) { + var pow2, + bounce = 4; + + while ( p < ( ( pow2 = Math.pow( 2, --bounce ) ) - 1 ) / 11 ) {} + return 1 / Math.pow( 4, 3 - bounce ) - 7.5625 * Math.pow( ( pow2 * 3 - 2 ) / 22 - p, 2 ); + } +}); + +$.each( baseEasings, function( name, easeIn ) { + $.easing[ "easeIn" + name ] = easeIn; + $.easing[ "easeOut" + name ] = function( p ) { + return 1 - easeIn( 1 - p ); + }; + $.easing[ "easeInOut" + name ] = function( p ) { + return p < .5 ? + easeIn( p * 2 ) / 2 : + easeIn( p * -2 + 2 ) / -2 + 1; + }; +}); + +})(jQuery); +/*! + * jQuery UI Effects Blind 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Bounce 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight(true) / 3 : el.outerWidth(true) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Clip 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Drop 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight( true ) / 2 : el.outerWidth( true ) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Explode 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i
    • ') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Fade 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fade = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'); + + elem.animate({ opacity: mode }, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/*! + * jQuery UI Effects Fold 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Highlight 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.highlight = function(o) { + return this.queue(function() { + var elem = $(this), + props = ['backgroundImage', 'backgroundColor', 'opacity'], + mode = $.effects.setMode(elem, o.options.mode || 'show'), + animation = { + backgroundColor: elem.css('backgroundColor') + }; + + if (mode == 'hide') { + animation.opacity = 0; + } + + $.effects.save(elem, props); + elem + .show() + .css({ + backgroundImage: 'none', + backgroundColor: o.options.color || '#ffff99' + }) + .animate(animation, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (mode == 'hide' && elem.hide()); + $.effects.restore(elem, props); + (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/*! + * jQuery UI Effects Pulsate 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.pulsate = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'show'), + times = ((o.options.times || 5) * 2) - 1, + duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, + isVisible = elem.is(':visible'), + animateTo = 0; + + if (!isVisible) { + elem.css('opacity', 0).show(); + animateTo = 1; + } + + if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { + times--; + } + + for (var i = 0; i < times; i++) { + elem.animate({ opacity: animateTo }, duration, o.options.easing); + animateTo = (animateTo + 1) % 2; + } + + elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { + if (animateTo == 0) { + elem.hide(); + } + (o.callback && o.callback.apply(this, arguments)); + }); + + elem + .queue('fx', function() { elem.dequeue(); }) + .dequeue(); + }); +}; + +})(jQuery); +/*! + * jQuery UI Effects Scale 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.puff = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'), + percent = parseInt(o.options.percent, 10) || 150, + factor = percent / 100, + original = { height: elem.height(), width: elem.width() }; + + $.extend(o.options, { + fade: true, + mode: mode, + percent: mode == 'hide' ? percent : 100, + from: mode == 'hide' + ? original + : { + height: original.height * factor, + width: original.width * factor + } + }); + + elem.effect('scale', o.options, o.duration, o.callback); + elem.dequeue(); + }); +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity']; + var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + var child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if (el.to.opacity === 0) { + el.css('opacity', el.from.opacity); + } + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Shake 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Slide 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight( true ) : el.outerWidth( true )); + if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Transfer 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('
    ') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); diff --git a/modules/files/views/default/assets/jquery/jquery-ui.custom.min.js b/modules/files/views/default/assets/jquery/jquery-ui.custom.min.js new file mode 100755 index 0000000..793184e --- /dev/null +++ b/modules/files/views/default/assets/jquery/jquery-ui.custom.min.js @@ -0,0 +1,125 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.core.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){function c(b,c){var e=b.nodeName.toLowerCase();if("area"===e){var f=b.parentNode,g=f.name,h;return!b.href||!g||f.nodeName.toLowerCase()!=="map"?!1:(h=a("img[usemap=#"+g+"]")[0],!!h&&d(h))}return(/input|select|textarea|button|object/.test(e)?!b.disabled:"a"==e?b.href||c:c)&&d(b)}function d(b){return!a(b).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.ui=a.ui||{};if(a.ui.version)return;a.extend(a.ui,{version:"1.8.24",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}}),a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(b,c){return typeof b=="number"?this.each(function(){var d=this;setTimeout(function(){a(d).focus(),c&&c.call(d)},b)}):this._focus.apply(this,arguments)},scrollParent:function(){var b;return a.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?b=this.parents().filter(function(){return/(relative|absolute|fixed)/.test(a.curCSS(this,"position",1))&&/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0):b=this.parents().filter(function(){return/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0),/fixed/.test(this.css("position"))||!b.length?a(document):b},zIndex:function(c){if(c!==b)return this.css("zIndex",c);if(this.length){var d=a(this[0]),e,f;while(d.length&&d[0]!==document){e=d.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){f=parseInt(d.css("zIndex"),10);if(!isNaN(f)&&f!==0)return f}d=d.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}}),a("").outerWidth(1).jquery||a.each(["Width","Height"],function(c,d){function h(b,c,d,f){return a.each(e,function(){c-=parseFloat(a.curCSS(b,"padding"+this,!0))||0,d&&(c-=parseFloat(a.curCSS(b,"border"+this+"Width",!0))||0),f&&(c-=parseFloat(a.curCSS(b,"margin"+this,!0))||0)}),c}var e=d==="Width"?["Left","Right"]:["Top","Bottom"],f=d.toLowerCase(),g={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};a.fn["inner"+d]=function(c){return c===b?g["inner"+d].call(this):this.each(function(){a(this).css(f,h(this,c)+"px")})},a.fn["outer"+d]=function(b,c){return typeof b!="number"?g["outer"+d].call(this,b):this.each(function(){a(this).css(f,h(this,b,!0,c)+"px")})}}),a.extend(a.expr[":"],{data:a.expr.createPseudo?a.expr.createPseudo(function(b){return function(c){return!!a.data(c,b)}}):function(b,c,d){return!!a.data(b,d[3])},focusable:function(b){return c(b,!isNaN(a.attr(b,"tabindex")))},tabbable:function(b){var d=a.attr(b,"tabindex"),e=isNaN(d);return(e||d>=0)&&c(b,!e)}}),a(function(){var b=document.body,c=b.appendChild(c=document.createElement("div"));c.offsetHeight,a.extend(c.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0}),a.support.minHeight=c.offsetHeight===100,a.support.selectstart="onselectstart"in c,b.removeChild(c).style.display="none"}),a.curCSS||(a.curCSS=a.css),a.extend(a.ui,{plugin:{add:function(b,c,d){var e=a.ui[b].prototype;for(var f in d)e.plugins[f]=e.plugins[f]||[],e.plugins[f].push([c,d[f]])},call:function(a,b,c){var d=a.plugins[b];if(!d||!a.element[0].parentNode)return;for(var e=0;e0?!0:(b[d]=1,e=b[d]>0,b[d]=0,e)},isOverAxis:function(a,b,c){return a>b&&a=9||!!b.button?this._mouseStarted?(this._mouseDrag(b),b.preventDefault()):(this._mouseDistanceMet(b)&&this._mouseDelayMet(b)&&(this._mouseStarted=this._mouseStart(this._mouseDownEvent,b)!==!1,this._mouseStarted?this._mouseDrag(b):this._mouseUp(b)),!this._mouseStarted):this._mouseUp(b)},_mouseUp:function(b){return a(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate),this._mouseStarted&&(this._mouseStarted=!1,b.target==this._mouseDownEvent.target&&a.data(b.target,this.widgetName+".preventClickEvent",!0),this._mouseStop(b)),!1},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(a){return this.mouseDelayMet},_mouseStart:function(a){},_mouseDrag:function(a){},_mouseStop:function(a){},_mouseCapture:function(a){return!0}})})(jQuery);;/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.position.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.ui=a.ui||{};var c=/left|center|right/,d=/top|center|bottom/,e="center",f={},g=a.fn.position,h=a.fn.offset;a.fn.position=function(b){if(!b||!b.of)return g.apply(this,arguments);b=a.extend({},b);var h=a(b.of),i=h[0],j=(b.collision||"flip").split(" "),k=b.offset?b.offset.split(" "):[0,0],l,m,n;return i.nodeType===9?(l=h.width(),m=h.height(),n={top:0,left:0}):i.setTimeout?(l=h.width(),m=h.height(),n={top:h.scrollTop(),left:h.scrollLeft()}):i.preventDefault?(b.at="left top",l=m=0,n={top:b.of.pageY,left:b.of.pageX}):(l=h.outerWidth(),m=h.outerHeight(),n=h.offset()),a.each(["my","at"],function(){var a=(b[this]||"").split(" ");a.length===1&&(a=c.test(a[0])?a.concat([e]):d.test(a[0])?[e].concat(a):[e,e]),a[0]=c.test(a[0])?a[0]:e,a[1]=d.test(a[1])?a[1]:e,b[this]=a}),j.length===1&&(j[1]=j[0]),k[0]=parseInt(k[0],10)||0,k.length===1&&(k[1]=k[0]),k[1]=parseInt(k[1],10)||0,b.at[0]==="right"?n.left+=l:b.at[0]===e&&(n.left+=l/2),b.at[1]==="bottom"?n.top+=m:b.at[1]===e&&(n.top+=m/2),n.left+=k[0],n.top+=k[1],this.each(function(){var c=a(this),d=c.outerWidth(),g=c.outerHeight(),h=parseInt(a.curCSS(this,"marginLeft",!0))||0,i=parseInt(a.curCSS(this,"marginTop",!0))||0,o=d+h+(parseInt(a.curCSS(this,"marginRight",!0))||0),p=g+i+(parseInt(a.curCSS(this,"marginBottom",!0))||0),q=a.extend({},n),r;b.my[0]==="right"?q.left-=d:b.my[0]===e&&(q.left-=d/2),b.my[1]==="bottom"?q.top-=g:b.my[1]===e&&(q.top-=g/2),f.fractions||(q.left=Math.round(q.left),q.top=Math.round(q.top)),r={left:q.left-h,top:q.top-i},a.each(["left","top"],function(c,e){a.ui.position[j[c]]&&a.ui.position[j[c]][e](q,{targetWidth:l,targetHeight:m,elemWidth:d,elemHeight:g,collisionPosition:r,collisionWidth:o,collisionHeight:p,offset:k,my:b.my,at:b.at})}),a.fn.bgiframe&&c.bgiframe(),c.offset(a.extend(q,{using:b.using}))})},a.ui.position={fit:{left:function(b,c){var d=a(window),e=c.collisionPosition.left+c.collisionWidth-d.width()-d.scrollLeft();b.left=e>0?b.left-e:Math.max(b.left-c.collisionPosition.left,b.left)},top:function(b,c){var d=a(window),e=c.collisionPosition.top+c.collisionHeight-d.height()-d.scrollTop();b.top=e>0?b.top-e:Math.max(b.top-c.collisionPosition.top,b.top)}},flip:{left:function(b,c){if(c.at[0]===e)return;var d=a(window),f=c.collisionPosition.left+c.collisionWidth-d.width()-d.scrollLeft(),g=c.my[0]==="left"?-c.elemWidth:c.my[0]==="right"?c.elemWidth:0,h=c.at[0]==="left"?c.targetWidth:-c.targetWidth,i=-2*c.offset[0];b.left+=c.collisionPosition.left<0?g+h+i:f>0?g+h+i:0},top:function(b,c){if(c.at[1]===e)return;var d=a(window),f=c.collisionPosition.top+c.collisionHeight-d.height()-d.scrollTop(),g=c.my[1]==="top"?-c.elemHeight:c.my[1]==="bottom"?c.elemHeight:0,h=c.at[1]==="top"?c.targetHeight:-c.targetHeight,i=-2*c.offset[1];b.top+=c.collisionPosition.top<0?g+h+i:f>0?g+h+i:0}}},a.offset.setOffset||(a.offset.setOffset=function(b,c){/static/.test(a.curCSS(b,"position"))&&(b.style.position="relative");var d=a(b),e=d.offset(),f=parseInt(a.curCSS(b,"top",!0),10)||0,g=parseInt(a.curCSS(b,"left",!0),10)||0,h={top:c.top-e.top+f,left:c.left-e.left+g};"using"in c?c.using.call(b,h):d.css(h)},a.fn.offset=function(b){var c=this[0];return!c||!c.ownerDocument?null:b?a.isFunction(b)?this.each(function(c){a(this).offset(b.call(this,c,a(this).offset()))}):this.each(function(){a.offset.setOffset(this,b)}):h.call(this)}),a.curCSS||(a.curCSS=a.css),function(){var b=document.getElementsByTagName("body")[0],c=document.createElement("div"),d,e,g,h,i;d=document.createElement(b?"div":"body"),g={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"},b&&a.extend(g,{position:"absolute",left:"-1000px",top:"-1000px"});for(var j in g)d.style[j]=g[j];d.appendChild(c),e=b||document.documentElement,e.insertBefore(d,e.firstChild),c.style.cssText="position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;",h=a(c).offset(function(a,b){return b}).offset(),d.innerHTML="",e.removeChild(d),i=h.top+h.left+(b?2e3:0),f.fractions=i>21&&i<22}()})(jQuery);;/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.draggable.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.widget("ui.draggable",a.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:!0,appendTo:"parent",axis:!1,connectToSortable:!1,containment:!1,cursor:"auto",cursorAt:!1,grid:!1,handle:!1,helper:"original",iframeFix:!1,opacity:!1,refreshPositions:!1,revert:!1,revertDuration:500,scope:"default",scroll:!0,scrollSensitivity:20,scrollSpeed:20,snap:!1,snapMode:"both",snapTolerance:20,stack:!1,zIndex:!1},_create:function(){this.options.helper=="original"&&!/^(?:r|a|f)/.test(this.element.css("position"))&&(this.element[0].style.position="relative"),this.options.addClasses&&this.element.addClass("ui-draggable"),this.options.disabled&&this.element.addClass("ui-draggable-disabled"),this._mouseInit()},destroy:function(){if(!this.element.data("draggable"))return;return this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled"),this._mouseDestroy(),this},_mouseCapture:function(b){var c=this.options;return this.helper||c.disabled||a(b.target).is(".ui-resizable-handle")?!1:(this.handle=this._getHandle(b),this.handle?(c.iframeFix&&a(c.iframeFix===!0?"iframe":c.iframeFix).each(function(){a('
    ').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1e3}).css(a(this).offset()).appendTo("body")}),!0):!1)},_mouseStart:function(b){var c=this.options;return this.helper=this._createHelper(b),this.helper.addClass("ui-draggable-dragging"),this._cacheHelperProportions(),a.ui.ddmanager&&(a.ui.ddmanager.current=this),this._cacheMargins(),this.cssPosition=this.helper.css("position"),this.scrollParent=this.helper.scrollParent(),this.offset=this.positionAbs=this.element.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.originalPosition=this.position=this._generatePosition(b),this.originalPageX=b.pageX,this.originalPageY=b.pageY,c.cursorAt&&this._adjustOffsetFromHelper(c.cursorAt),c.containment&&this._setContainment(),this._trigger("start",b)===!1?(this._clear(),!1):(this._cacheHelperProportions(),a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b),this._mouseDrag(b,!0),a.ui.ddmanager&&a.ui.ddmanager.dragStart(this,b),!0)},_mouseDrag:function(b,c){this.position=this._generatePosition(b),this.positionAbs=this._convertPositionTo("absolute");if(!c){var d=this._uiHash();if(this._trigger("drag",b,d)===!1)return this._mouseUp({}),!1;this.position=d.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";return a.ui.ddmanager&&a.ui.ddmanager.drag(this,b),!1},_mouseStop:function(b){var c=!1;a.ui.ddmanager&&!this.options.dropBehaviour&&(c=a.ui.ddmanager.drop(this,b)),this.dropped&&(c=this.dropped,this.dropped=!1);var d=this.element[0],e=!1;while(d&&(d=d.parentNode))d==document&&(e=!0);if(!e&&this.options.helper==="original")return!1;if(this.options.revert=="invalid"&&!c||this.options.revert=="valid"&&c||this.options.revert===!0||a.isFunction(this.options.revert)&&this.options.revert.call(this.element,c)){var f=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){f._trigger("stop",b)!==!1&&f._clear()})}else this._trigger("stop",b)!==!1&&this._clear();return!1},_mouseUp:function(b){return a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)}),a.ui.ddmanager&&a.ui.ddmanager.dragStop(this,b),a.ui.mouse.prototype._mouseUp.call(this,b)},cancel:function(){return this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear(),this},_getHandle:function(b){var c=!this.options.handle||!a(this.options.handle,this.element).length?!0:!1;return a(this.options.handle,this.element).find("*").andSelf().each(function(){this==b.target&&(c=!0)}),c},_createHelper:function(b){var c=this.options,d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[b])):c.helper=="clone"?this.element.clone().removeAttr("id"):this.element;return d.parents("body").length||d.appendTo(c.appendTo=="parent"?this.element[0].parentNode:c.appendTo),d[0]!=this.element[0]&&!/(fixed|absolute)/.test(d.css("position"))&&d.css("position","absolute"),d},_adjustOffsetFromHelper:function(b){typeof b=="string"&&(b=b.split(" ")),a.isArray(b)&&(b={left:+b[0],top:+b[1]||0}),"left"in b&&(this.offset.click.left=b.left+this.margins.left),"right"in b&&(this.offset.click.left=this.helperProportions.width-b.right+this.margins.left),"top"in b&&(this.offset.click.top=b.top+this.margins.top),"bottom"in b&&(this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])&&(b.left+=this.scrollParent.scrollLeft(),b.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)b={top:0,left:0};return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var b=this.options;b.containment=="parent"&&(b.containment=this.helper[0].parentNode);if(b.containment=="document"||b.containment=="window")this.containment=[b.containment=="document"?0:a(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,b.containment=="document"?0:a(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,(b.containment=="document"?0:a(window).scrollLeft())+a(b.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(b.containment=="document"?0:a(window).scrollTop())+(a(b.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(b.containment)&&b.containment.constructor!=Array){var c=a(b.containment),d=c[0];if(!d)return;var e=c.offset(),f=a(d).css("overflow")!="hidden";this.containment=[(parseInt(a(d).css("borderLeftWidth"),10)||0)+(parseInt(a(d).css("paddingLeft"),10)||0),(parseInt(a(d).css("borderTopWidth"),10)||0)+(parseInt(a(d).css("paddingTop"),10)||0),(f?Math.max(d.scrollWidth,d.offsetWidth):d.offsetWidth)-(parseInt(a(d).css("borderLeftWidth"),10)||0)-(parseInt(a(d).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(f?Math.max(d.scrollHeight,d.offsetHeight):d.offsetHeight)-(parseInt(a(d).css("borderTopWidth"),10)||0)-(parseInt(a(d).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom],this.relative_container=c}else b.containment.constructor==Array&&(this.containment=b.containment)},_convertPositionTo:function(b,c){c||(c=this.position);var d=b=="absolute"?1:-1,e=this.options,f=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(b){var c=this.options,d=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(d[0].tagName),f=b.pageX,g=b.pageY;if(this.originalPosition){var h;if(this.containment){if(this.relative_container){var i=this.relative_container.offset();h=[this.containment[0]+i.left,this.containment[1]+i.top,this.containment[2]+i.left,this.containment[3]+i.top]}else h=this.containment;b.pageX-this.offset.click.lefth[2]&&(f=h[2]+this.offset.click.left),b.pageY-this.offset.click.top>h[3]&&(g=h[3]+this.offset.click.top)}if(c.grid){var j=c.grid[1]?this.originalPageY+Math.round((g-this.originalPageY)/c.grid[1])*c.grid[1]:this.originalPageY;g=h?j-this.offset.click.toph[3]?j-this.offset.click.toph[2]?k-this.offset.click.left=0;k--){var l=d.snapElements[k].left,m=l+d.snapElements[k].width,n=d.snapElements[k].top,o=n+d.snapElements[k].height;if(!(l-f=k&&g<=l||h>=k&&h<=l||gl)&&(e>=i&&e<=j||f>=i&&f<=j||ej);default:return!1}},a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(b,c){var d=a.ui.ddmanager.droppables[b.options.scope]||[],e=c?c.type:null,f=(b.currentItem||b.element).find(":data(droppable)").andSelf();g:for(var h=0;h
    ').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")})),this.element=this.element.parent().data("resizable",this.element.data("resizable")),this.elementIsWrapper=!0,this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")}),this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0}),this.originalResizeStyle=this.originalElement.css("resize"),this.originalElement.css("resize","none"),this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"})),this.originalElement.css({margin:this.originalElement.css("margin")}),this._proportionallyResize()),this.handles=c.handles||(a(".ui-resizable-handle",this.element).length?{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"}:"e,s,se");if(this.handles.constructor==String){this.handles=="all"&&(this.handles="n,e,s,w,se,sw,ne,nw");var d=this.handles.split(",");this.handles={};for(var e=0;e
    ');h.css({zIndex:c.zIndex}),"se"==f&&h.addClass("ui-icon ui-icon-gripsmall-diagonal-se"),this.handles[f]=".ui-resizable-"+f,this.element.append(h)}}this._renderAxis=function(b){b=b||this.element;for(var c in this.handles){this.handles[c].constructor==String&&(this.handles[c]=a(this.handles[c],this.element).show());if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var d=a(this.handles[c],this.element),e=0;e=/sw|ne|nw|se|n|s/.test(c)?d.outerHeight():d.outerWidth();var f=["padding",/ne|nw|n/.test(c)?"Top":/se|sw|s/.test(c)?"Bottom":/^e$/.test(c)?"Right":"Left"].join("");b.css(f,e),this._proportionallyResize()}if(!a(this.handles[c]).length)continue}},this._renderAxis(this.element),this._handles=a(".ui-resizable-handle",this.element).disableSelection(),this._handles.mouseover(function(){if(!b.resizing){if(this.className)var a=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=a&&a[1]?a[1]:"se"}}),c.autoHide&&(this._handles.hide(),a(this.element).addClass("ui-resizable-autohide").hover(function(){if(c.disabled)return;a(this).removeClass("ui-resizable-autohide"),b._handles.show()},function(){if(c.disabled)return;b.resizing||(a(this).addClass("ui-resizable-autohide"),b._handles.hide())})),this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(b){a(b).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var c=this.element;c.after(this.originalElement.css({position:c.css("position"),width:c.outerWidth(),height:c.outerHeight(),top:c.css("top"),left:c.css("left")})).remove()}return this.originalElement.css("resize",this.originalResizeStyle),b(this.originalElement),this},_mouseCapture:function(b){var c=!1;for(var d in this.handles)a(this.handles[d])[0]==b.target&&(c=!0);return!this.options.disabled&&c},_mouseStart:function(b){var d=this.options,e=this.element.position(),f=this.element;this.resizing=!0,this.documentScroll={top:a(document).scrollTop(),left:a(document).scrollLeft()},(f.is(".ui-draggable")||/absolute/.test(f.css("position")))&&f.css({position:"absolute",top:e.top,left:e.left}),this._renderProxy();var g=c(this.helper.css("left")),h=c(this.helper.css("top"));d.containment&&(g+=a(d.containment).scrollLeft()||0,h+=a(d.containment).scrollTop()||0),this.offset=this.helper.offset(),this.position={left:g,top:h},this.size=this._helper?{width:f.outerWidth(),height:f.outerHeight()}:{width:f.width(),height:f.height()},this.originalSize=this._helper?{width:f.outerWidth(),height:f.outerHeight()}:{width:f.width(),height:f.height()},this.originalPosition={left:g,top:h},this.sizeDiff={width:f.outerWidth()-f.width(),height:f.outerHeight()-f.height()},this.originalMousePosition={left:b.pageX,top:b.pageY},this.aspectRatio=typeof d.aspectRatio=="number"?d.aspectRatio:this.originalSize.width/this.originalSize.height||1;var i=a(".ui-resizable-"+this.axis).css("cursor");return a("body").css("cursor",i=="auto"?this.axis+"-resize":i),f.addClass("ui-resizable-resizing"),this._propagate("start",b),!0},_mouseDrag:function(b){var c=this.helper,d=this.options,e={},f=this,g=this.originalMousePosition,h=this.axis,i=b.pageX-g.left||0,j=b.pageY-g.top||0,k=this._change[h];if(!k)return!1;var l=k.apply(this,[b,i,j]),m=a.browser.msie&&a.browser.version<7,n=this.sizeDiff;this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)l=this._updateRatio(l,b);return l=this._respectSize(l,b),this._propagate("resize",b),c.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"}),!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize(),this._updateCache(l),this._trigger("resize",b,this.ui()),!1},_mouseStop:function(b){this.resizing=!1;var c=this.options,d=this;if(this._helper){var e=this._proportionallyResizeElements,f=e.length&&/textarea/i.test(e[0].nodeName),g=f&&a.ui.hasScroll(e[0],"left")?0:d.sizeDiff.height,h=f?0:d.sizeDiff.width,i={width:d.helper.width()-h,height:d.helper.height()-g},j=parseInt(d.element.css("left"),10)+(d.position.left-d.originalPosition.left)||null,k=parseInt(d.element.css("top"),10)+(d.position.top-d.originalPosition.top)||null;c.animate||this.element.css(a.extend(i,{top:k,left:j})),d.helper.height(d.size.height),d.helper.width(d.size.width),this._helper&&!c.animate&&this._proportionallyResize()}return a("body").css("cursor","auto"),this.element.removeClass("ui-resizable-resizing"),this._propagate("stop",b),this._helper&&this.helper.remove(),!1},_updateVirtualBoundaries:function(a){var b=this.options,c,e,f,g,h;h={minWidth:d(b.minWidth)?b.minWidth:0,maxWidth:d(b.maxWidth)?b.maxWidth:Infinity,minHeight:d(b.minHeight)?b.minHeight:0,maxHeight:d(b.maxHeight)?b.maxHeight:Infinity};if(this._aspectRatio||a)c=h.minHeight*this.aspectRatio,f=h.minWidth/this.aspectRatio,e=h.maxHeight*this.aspectRatio,g=h.maxWidth/this.aspectRatio,c>h.minWidth&&(h.minWidth=c),f>h.minHeight&&(h.minHeight=f),ea.width,k=d(a.height)&&e.minHeight&&e.minHeight>a.height;j&&(a.width=e.minWidth),k&&(a.height=e.minHeight),h&&(a.width=e.maxWidth),i&&(a.height=e.maxHeight);var l=this.originalPosition.left+this.originalSize.width,m=this.position.top+this.size.height,n=/sw|nw|w/.test(g),o=/nw|ne|n/.test(g);j&&n&&(a.left=l-e.minWidth),h&&n&&(a.left=l-e.maxWidth),k&&o&&(a.top=m-e.minHeight),i&&o&&(a.top=m-e.maxHeight);var p=!a.width&&!a.height;return p&&!a.left&&a.top?a.top=null:p&&!a.top&&a.left&&(a.left=null),a},_proportionallyResize:function(){var b=this.options;if(!this._proportionallyResizeElements.length)return;var c=this.helper||this.element;for(var d=0;d');var d=a.browser.msie&&a.browser.version<7,e=d?1:0,f=d?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+f,height:this.element.outerHeight()+f,position:"absolute",left:this.elementOffset.left-e+"px",top:this.elementOffset.top-e+"px",zIndex:++c.zIndex}),this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(a,b,c){return{width:this.originalSize.width+b}},w:function(a,b,c){var d=this.options,e=this.originalSize,f=this.originalPosition;return{left:f.left+b,width:e.width-b}},n:function(a,b,c){var d=this.options,e=this.originalSize,f=this.originalPosition;return{top:f.top+c,height:e.height-c}},s:function(a,b,c){return{height:this.originalSize.height+c}},se:function(b,c,d){return a.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,c,d]))},sw:function(b,c,d){return a.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,c,d]))},ne:function(b,c,d){return a.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,c,d]))},nw:function(b,c,d){return a.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,c,d]))}},_propagate:function(b,c){a.ui.plugin.call(this,b,[c,this.ui()]),b!="resize"&&this._trigger(b,c,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}),a.extend(a.ui.resizable,{version:"1.8.24"}),a.ui.plugin.add("resizable","alsoResize",{start:function(b,c){var d=a(this).data("resizable"),e=d.options,f=function(b){a(b).each(function(){var b=a(this);b.data("resizable-alsoresize",{width:parseInt(b.width(),10),height:parseInt(b.height(),10),left:parseInt(b.css("left"),10),top:parseInt(b.css("top"),10)})})};typeof e.alsoResize=="object"&&!e.alsoResize.parentNode?e.alsoResize.length?(e.alsoResize=e.alsoResize[0],f(e.alsoResize)):a.each(e.alsoResize,function(a){f(a)}):f(e.alsoResize)},resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.originalSize,g=d.originalPosition,h={height:d.size.height-f.height||0,width:d.size.width-f.width||0,top:d.position.top-g.top||0,left:d.position.left-g.left||0},i=function(b,d){a(b).each(function(){var b=a(this),e=a(this).data("resizable-alsoresize"),f={},g=d&&d.length?d:b.parents(c.originalElement[0]).length?["width","height"]:["width","height","top","left"];a.each(g,function(a,b){var c=(e[b]||0)+(h[b]||0);c&&c>=0&&(f[b]=c||null)}),b.css(f)})};typeof e.alsoResize=="object"&&!e.alsoResize.nodeType?a.each(e.alsoResize,function(a,b){i(a,b)}):i(e.alsoResize)},stop:function(b,c){a(this).removeData("resizable-alsoresize")}}),a.ui.plugin.add("resizable","animate",{stop:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d._proportionallyResizeElements,g=f.length&&/textarea/i.test(f[0].nodeName),h=g&&a.ui.hasScroll(f[0],"left")?0:d.sizeDiff.height,i=g?0:d.sizeDiff.width,j={width:d.size.width-i,height:d.size.height-h},k=parseInt(d.element.css("left"),10)+(d.position.left-d.originalPosition.left)||null,l=parseInt(d.element.css("top"),10)+(d.position.top-d.originalPosition.top)||null;d.element.animate(a.extend(j,l&&k?{top:l,left:k}:{}),{duration:e.animateDuration,easing:e.animateEasing,step:function(){var c={width:parseInt(d.element.css("width"),10),height:parseInt(d.element.css("height"),10),top:parseInt(d.element.css("top"),10),left:parseInt(d.element.css("left"),10)};f&&f.length&&a(f[0]).css({width:c.width,height:c.height}),d._updateCache(c),d._propagate("resize",b)}})}}),a.ui.plugin.add("resizable","containment",{start:function(b,d){var e=a(this).data("resizable"),f=e.options,g=e.element,h=f.containment,i=h instanceof a?h.get(0):/parent/.test(h)?g.parent().get(0):h;if(!i)return;e.containerElement=a(i);if(/document/.test(h)||h==document)e.containerOffset={left:0,top:0},e.containerPosition={left:0,top:0},e.parentData={element:a(document),left:0,top:0,width:a(document).width(),height:a(document).height()||document.body.parentNode.scrollHeight};else{var j=a(i),k=[];a(["Top","Right","Left","Bottom"]).each(function(a,b){k[a]=c(j.css("padding"+b))}),e.containerOffset=j.offset(),e.containerPosition=j.position(),e.containerSize={height:j.innerHeight()-k[3],width:j.innerWidth()-k[1]};var l=e.containerOffset,m=e.containerSize.height,n=e.containerSize.width,o=a.ui.hasScroll(i,"left")?i.scrollWidth:n,p=a.ui.hasScroll(i)?i.scrollHeight:m;e.parentData={element:i,left:l.left,top:l.top,width:o,height:p}}},resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.containerSize,g=d.containerOffset,h=d.size,i=d.position,j=d._aspectRatio||b.shiftKey,k={top:0,left:0},l=d.containerElement;l[0]!=document&&/static/.test(l.css("position"))&&(k=g),i.left<(d._helper?g.left:0)&&(d.size.width=d.size.width+(d._helper?d.position.left-g.left:d.position.left-k.left),j&&(d.size.height=d.size.width/d.aspectRatio),d.position.left=e.helper?g.left:0),i.top<(d._helper?g.top:0)&&(d.size.height=d.size.height+(d._helper?d.position.top-g.top:d.position.top),j&&(d.size.width=d.size.height*d.aspectRatio),d.position.top=d._helper?g.top:0),d.offset.left=d.parentData.left+d.position.left,d.offset.top=d.parentData.top+d.position.top;var m=Math.abs((d._helper?d.offset.left-k.left:d.offset.left-k.left)+d.sizeDiff.width),n=Math.abs((d._helper?d.offset.top-k.top:d.offset.top-g.top)+d.sizeDiff.height),o=d.containerElement.get(0)==d.element.parent().get(0),p=/relative|absolute/.test(d.containerElement.css("position"));o&&p&&(m-=d.parentData.left),m+d.size.width>=d.parentData.width&&(d.size.width=d.parentData.width-m,j&&(d.size.height=d.size.width/d.aspectRatio)),n+d.size.height>=d.parentData.height&&(d.size.height=d.parentData.height-n,j&&(d.size.width=d.size.height*d.aspectRatio))},stop:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.position,g=d.containerOffset,h=d.containerPosition,i=d.containerElement,j=a(d.helper),k=j.offset(),l=j.outerWidth()-d.sizeDiff.width,m=j.outerHeight()-d.sizeDiff.height;d._helper&&!e.animate&&/relative/.test(i.css("position"))&&a(this).css({left:k.left-h.left-g.left,width:l,height:m}),d._helper&&!e.animate&&/static/.test(i.css("position"))&&a(this).css({left:k.left-h.left-g.left,width:l,height:m})}}),a.ui.plugin.add("resizable","ghost",{start:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.size;d.ghost=d.originalElement.clone(),d.ghost.css({opacity:.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof e.ghost=="string"?e.ghost:""),d.ghost.appendTo(d.helper)},resize:function(b,c){var d=a(this).data("resizable"),e=d.options;d.ghost&&d.ghost.css({position:"relative",height:d.size.height,width:d.size.width})},stop:function(b,c){var d=a(this).data("resizable"),e=d.options;d.ghost&&d.helper&&d.helper.get(0).removeChild(d.ghost.get(0))}}),a.ui.plugin.add("resizable","grid",{resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.size,g=d.originalSize,h=d.originalPosition,i=d.axis,j=e._aspectRatio||b.shiftKey;e.grid=typeof e.grid=="number"?[e.grid,e.grid]:e.grid;var k=Math.round((f.width-g.width)/(e.grid[0]||1))*(e.grid[0]||1),l=Math.round((f.height-g.height)/(e.grid[1]||1))*(e.grid[1]||1);/^(se|s|e)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l):/^(ne)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l,d.position.top=h.top-l):/^(sw)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l,d.position.left=h.left-k):(d.size.width=g.width+k,d.size.height=g.height+l,d.position.top=h.top-l,d.position.left=h.left-k)}});var c=function(a){return parseInt(a,10)||0},d=function(a){return!isNaN(parseInt(a,10))}})(jQuery);;/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.selectable.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.widget("ui.selectable",a.ui.mouse,{options:{appendTo:"body",autoRefresh:!0,distance:0,filter:"*",tolerance:"touch"},_create:function(){var b=this;this.element.addClass("ui-selectable"),this.dragged=!1;var c;this.refresh=function(){c=a(b.options.filter,b.element[0]),c.addClass("ui-selectee"),c.each(function(){var b=a(this),c=b.offset();a.data(this,"selectable-item",{element:this,$element:b,left:c.left,top:c.top,right:c.left+b.outerWidth(),bottom:c.top+b.outerHeight(),startselected:!1,selected:b.hasClass("ui-selected"),selecting:b.hasClass("ui-selecting"),unselecting:b.hasClass("ui-unselecting")})})},this.refresh(),this.selectees=c.addClass("ui-selectee"),this._mouseInit(),this.helper=a("
    ")},destroy:function(){return this.selectees.removeClass("ui-selectee").removeData("selectable-item"),this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable"),this._mouseDestroy(),this},_mouseStart:function(b){var c=this;this.opos=[b.pageX,b.pageY];if(this.options.disabled)return;var d=this.options;this.selectees=a(d.filter,this.element[0]),this._trigger("start",b),a(d.appendTo).append(this.helper),this.helper.css({left:b.clientX,top:b.clientY,width:0,height:0}),d.autoRefresh&&this.refresh(),this.selectees.filter(".ui-selected").each(function(){var d=a.data(this,"selectable-item");d.startselected=!0,!b.metaKey&&!b.ctrlKey&&(d.$element.removeClass("ui-selected"),d.selected=!1,d.$element.addClass("ui-unselecting"),d.unselecting=!0,c._trigger("unselecting",b,{unselecting:d.element}))}),a(b.target).parents().andSelf().each(function(){var d=a.data(this,"selectable-item");if(d){var e=!b.metaKey&&!b.ctrlKey||!d.$element.hasClass("ui-selected");return d.$element.removeClass(e?"ui-unselecting":"ui-selected").addClass(e?"ui-selecting":"ui-unselecting"),d.unselecting=!e,d.selecting=e,d.selected=e,e?c._trigger("selecting",b,{selecting:d.element}):c._trigger("unselecting",b,{unselecting:d.element}),!1}})},_mouseDrag:function(b){var c=this;this.dragged=!0;if(this.options.disabled)return;var d=this.options,e=this.opos[0],f=this.opos[1],g=b.pageX,h=b.pageY;if(e>g){var i=g;g=e,e=i}if(f>h){var i=h;h=f,f=i}return this.helper.css({left:e,top:f,width:g-e,height:h-f}),this.selectees.each(function(){var i=a.data(this,"selectable-item");if(!i||i.element==c.element[0])return;var j=!1;d.tolerance=="touch"?j=!(i.left>g||i.righth||i.bottome&&i.rightf&&i.bottom *",opacity:!1,placeholder:!1,revert:!1,scroll:!0,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1e3},_create:function(){var a=this.options;this.containerCache={},this.element.addClass("ui-sortable"),this.refresh(),this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):!1,this.offset=this.element.offset(),this._mouseInit(),this.ready=!0},destroy:function(){a.Widget.prototype.destroy.call(this),this.element.removeClass("ui-sortable ui-sortable-disabled"),this._mouseDestroy();for(var b=this.items.length-1;b>=0;b--)this.items[b].item.removeData(this.widgetName+"-item");return this},_setOption:function(b,c){b==="disabled"?(this.options[b]=c,this.widget()[c?"addClass":"removeClass"]("ui-sortable-disabled")):a.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(b,c){var d=this;if(this.reverting)return!1;if(this.options.disabled||this.options.type=="static")return!1;this._refreshItems(b);var e=null,f=this,g=a(b.target).parents().each(function(){if(a.data(this,d.widgetName+"-item")==f)return e=a(this),!1});a.data(b.target,d.widgetName+"-item")==f&&(e=a(b.target));if(!e)return!1;if(this.options.handle&&!c){var h=!1;a(this.options.handle,e).find("*").andSelf().each(function(){this==b.target&&(h=!0)});if(!h)return!1}return this.currentItem=e,this._removeCurrentsFromItems(),!0},_mouseStart:function(b,c,d){var e=this.options,f=this;this.currentContainer=this,this.refreshPositions(),this.helper=this._createHelper(b),this._cacheHelperProportions(),this._cacheMargins(),this.scrollParent=this.helper.scrollParent(),this.offset=this.currentItem.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.helper.css("position","absolute"),this.cssPosition=this.helper.css("position"),this.originalPosition=this._generatePosition(b),this.originalPageX=b.pageX,this.originalPageY=b.pageY,e.cursorAt&&this._adjustOffsetFromHelper(e.cursorAt),this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]},this.helper[0]!=this.currentItem[0]&&this.currentItem.hide(),this._createPlaceholder(),e.containment&&this._setContainment(),e.cursor&&(a("body").css("cursor")&&(this._storedCursor=a("body").css("cursor")),a("body").css("cursor",e.cursor)),e.opacity&&(this.helper.css("opacity")&&(this._storedOpacity=this.helper.css("opacity")),this.helper.css("opacity",e.opacity)),e.zIndex&&(this.helper.css("zIndex")&&(this._storedZIndex=this.helper.css("zIndex")),this.helper.css("zIndex",e.zIndex)),this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"&&(this.overflowOffset=this.scrollParent.offset()),this._trigger("start",b,this._uiHash()),this._preserveHelperProportions||this._cacheHelperProportions();if(!d)for(var g=this.containers.length-1;g>=0;g--)this.containers[g]._trigger("activate",b,f._uiHash(this));return a.ui.ddmanager&&(a.ui.ddmanager.current=this),a.ui.ddmanager&&!e.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b),this.dragging=!0,this.helper.addClass("ui-sortable-helper"),this._mouseDrag(b),!0},_mouseDrag:function(b){this.position=this._generatePosition(b),this.positionAbs=this._convertPositionTo("absolute"),this.lastPositionAbs||(this.lastPositionAbs=this.positionAbs);if(this.options.scroll){var c=this.options,d=!1;this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"?(this.overflowOffset.top+this.scrollParent[0].offsetHeight-b.pageY=0;e--){var f=this.items[e],g=f.item[0],h=this._intersectsWithPointer(f);if(!h)continue;if(f.instance!==this.currentContainer)continue;if(g!=this.currentItem[0]&&this.placeholder[h==1?"next":"prev"]()[0]!=g&&!a.ui.contains(this.placeholder[0],g)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0],g):!0)){this.direction=h==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(f))this._rearrange(b,f);else break;this._trigger("change",b,this._uiHash());break}}return this._contactContainers(b),a.ui.ddmanager&&a.ui.ddmanager.drag(this,b),this._trigger("sort",b,this._uiHash()),this.lastPositionAbs=this.positionAbs,!1},_mouseStop:function(b,c){if(!b)return;a.ui.ddmanager&&!this.options.dropBehaviour&&a.ui.ddmanager.drop(this,b);if(this.options.revert){var d=this,e=d.placeholder.offset();d.reverting=!0,a(this.helper).animate({left:e.left-this.offset.parent.left-d.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:e.top-this.offset.parent.top-d.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){d._clear(b)})}else this._clear(b,c);return!1},cancel:function(){var b=this;if(this.dragging){this._mouseUp({target:null}),this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("deactivate",null,b._uiHash(this)),this.containers[c].containerCache.over&&(this.containers[c]._trigger("out",null,b._uiHash(this)),this.containers[c].containerCache.over=0)}return this.placeholder&&(this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]),this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove(),a.extend(this,{helper:null,dragging:!1,reverting:!1,_noFinalSort:null}),this.domPosition.prev?a(this.domPosition.prev).after(this.currentItem):a(this.domPosition.parent).prepend(this.currentItem)),this},serialize:function(b){var c=this._getItemsAsjQuery(b&&b.connected),d=[];return b=b||{},a(c).each(function(){var c=(a(b.item||this).attr(b.attribute||"id")||"").match(b.expression||/(.+)[-=_](.+)/);c&&d.push((b.key||c[1]+"[]")+"="+(b.key&&b.expression?c[1]:c[2]))}),!d.length&&b.key&&d.push(b.key+"="),d.join("&")},toArray:function(b){var c=this._getItemsAsjQuery(b&&b.connected),d=[];return b=b||{},c.each(function(){d.push(a(b.item||this).attr(b.attribute||"id")||"")}),d},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,d=this.positionAbs.top,e=d+this.helperProportions.height,f=a.left,g=f+a.width,h=a.top,i=h+a.height,j=this.offset.click.top,k=this.offset.click.left,l=d+j>h&&d+jf&&b+ka[this.floating?"width":"height"]?l:f0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){return this._refreshItems(a),this.refreshPositions(),this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(b){var c=this,d=[],e=[],f=this._connectWith();if(f&&b)for(var g=f.length-1;g>=0;g--){var h=a(f[g]);for(var i=h.length-1;i>=0;i--){var j=a.data(h[i],this.widgetName);j&&j!=this&&!j.options.disabled&&e.push([a.isFunction(j.options.items)?j.options.items.call(j.element):a(j.options.items,j.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),j])}}e.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(var g=e.length-1;g>=0;g--)e[g][0].each(function(){d.push(this)});return a(d)},_removeCurrentsFromItems:function(){var a=this.currentItem.find(":data("+this.widgetName+"-item)");for(var b=0;b=0;g--){var h=a(f[g]);for(var i=h.length-1;i>=0;i--){var j=a.data(h[i],this.widgetName);j&&j!=this&&!j.options.disabled&&(e.push([a.isFunction(j.options.items)?j.options.items.call(j.element[0],b,{item:this.currentItem}):a(j.options.items,j.element),j]),this.containers.push(j))}}for(var g=e.length-1;g>=0;g--){var k=e[g][1],l=e[g][0];for(var i=0,m=l.length;i=0;c--){var d=this.items[c];if(d.instance!=this.currentContainer&&this.currentContainer&&d.item[0]!=this.currentItem[0])continue;var e=this.options.toleranceElement?a(this.options.toleranceElement,d.item):d.item;b||(d.width=e.outerWidth(),d.height=e.outerHeight());var f=e.offset();d.left=f.left,d.top=f.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(var c=this.containers.length-1;c>=0;c--){var f=this.containers[c].element.offset();this.containers[c].containerCache.left=f.left,this.containers[c].containerCache.top=f.top,this.containers[c].containerCache.width=this.containers[c].element.outerWidth(),this.containers[c].containerCache.height=this.containers[c].element.outerHeight()}return this},_createPlaceholder:function(b){var c=b||this,d=c.options;if(!d.placeholder||d.placeholder.constructor==String){var e=d.placeholder;d.placeholder={element:function(){var b=a(document.createElement(c.currentItem[0].nodeName)).addClass(e||c.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];return e||(b.style.visibility="hidden"),b},update:function(a,b){if(e&&!d.forcePlaceholderSize)return;b.height()||b.height(c.currentItem.innerHeight()-parseInt(c.currentItem.css("paddingTop")||0,10)-parseInt(c.currentItem.css("paddingBottom")||0,10)),b.width()||b.width(c.currentItem.innerWidth()-parseInt(c.currentItem.css("paddingLeft")||0,10)-parseInt(c.currentItem.css("paddingRight")||0,10))}}}c.placeholder=a(d.placeholder.element.call(c.element,c.currentItem)),c.currentItem.after(c.placeholder),d.placeholder.update(c,c.placeholder)},_contactContainers:function(b){var c=null,d=null;for(var e=this.containers.length-1;e>=0;e--){if(a.ui.contains(this.currentItem[0],this.containers[e].element[0]))continue;if(this._intersectsWith(this.containers[e].containerCache)){if(c&&a.ui.contains(this.containers[e].element[0],c.element[0]))continue;c=this.containers[e],d=e}else this.containers[e].containerCache.over&&(this.containers[e]._trigger("out",b,this._uiHash(this)),this.containers[e].containerCache.over=0)}if(!c)return;if(this.containers.length===1)this.containers[d]._trigger("over",b,this._uiHash(this)),this.containers[d].containerCache.over=1;else if(this.currentContainer!=this.containers[d]){var f=1e4,g=null,h=this.positionAbs[this.containers[d].floating?"left":"top"];for(var i=this.items.length-1;i>=0;i--){if(!a.ui.contains(this.containers[d].element[0],this.items[i].item[0]))continue;var j=this.containers[d].floating?this.items[i].item.offset().left:this.items[i].item.offset().top;Math.abs(j-h)0?"down":"up")}if(!g&&!this.options.dropOnEmpty)return;this.currentContainer=this.containers[d],g?this._rearrange(b,g,null,!0):this._rearrange(b,null,this.containers[d].element,!0),this._trigger("change",b,this._uiHash()),this.containers[d]._trigger("change",b,this._uiHash(this)),this.options.placeholder.update(this.currentContainer,this.placeholder),this.containers[d]._trigger("over",b,this._uiHash(this)),this.containers[d].containerCache.over=1}},_createHelper:function(b){var c=this.options,d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[b,this.currentItem])):c.helper=="clone"?this.currentItem.clone():this.currentItem;return d.parents("body").length||a(c.appendTo!="parent"?c.appendTo:this.currentItem[0].parentNode)[0].appendChild(d[0]),d[0]==this.currentItem[0]&&(this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")}),(d[0].style.width==""||c.forceHelperSize)&&d.width(this.currentItem.width()),(d[0].style.height==""||c.forceHelperSize)&&d.height(this.currentItem.height()),d},_adjustOffsetFromHelper:function(b){typeof b=="string"&&(b=b.split(" ")),a.isArray(b)&&(b={left:+b[0],top:+b[1]||0}),"left"in b&&(this.offset.click.left=b.left+this.margins.left),"right"in b&&(this.offset.click.left=this.helperProportions.width-b.right+this.margins.left),"top"in b&&(this.offset.click.top=b.top+this.margins.top),"bottom"in b&&(this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])&&(b.left+=this.scrollParent.scrollLeft(),b.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)b={top:0,left:0};return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var b=this.options;b.containment=="parent"&&(b.containment=this.helper[0].parentNode);if(b.containment=="document"||b.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(b.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(b.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(b.containment)){var c=a(b.containment)[0],d=a(b.containment).offset(),e=a(c).css("overflow")!="hidden";this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(e?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(e?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(b,c){c||(c=this.position);var d=b=="absolute"?1:-1,e=this.options,f=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(b){var c=this.options,d=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(d[0].tagName);this.cssPosition=="relative"&&(this.scrollParent[0]==document||this.scrollParent[0]==this.offsetParent[0])&&(this.offset.relative=this._getRelativeOffset());var f=b.pageX,g=b.pageY;if(this.originalPosition){this.containment&&(b.pageX-this.offset.click.leftthis.containment[2]&&(f=this.containment[2]+this.offset.click.left),b.pageY-this.offset.click.top>this.containment[3]&&(g=this.containment[3]+this.offset.click.top));if(c.grid){var h=this.originalPageY+Math.round((g-this.originalPageY)/c.grid[1])*c.grid[1];g=this.containment?h-this.offset.click.topthis.containment[3]?h-this.offset.click.topthis.containment[2]?i-this.offset.click.left=0;f--)c||d.push(function(a){return function(b){a._trigger("deactivate",b,this._uiHash(this))}}.call(this,this.containers[f])),this.containers[f].containerCache.over&&(d.push(function(a){return function(b){a._trigger("out",b,this._uiHash(this))}}.call(this,this.containers[f])),this.containers[f].containerCache.over=0);this._storedCursor&&a("body").css("cursor",this._storedCursor),this._storedOpacity&&this.helper.css("opacity",this._storedOpacity),this._storedZIndex&&this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex),this.dragging=!1;if(this.cancelHelperRemoval){if(!c){this._trigger("beforeStop",b,this._uiHash());for(var f=0;f li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:!1,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var b=this,c=b.options;b.running=0,b.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"),b.headers=b.element.find(c.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){if(c.disabled)return;a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){if(c.disabled)return;a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){if(c.disabled)return;a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){if(c.disabled)return;a(this).removeClass("ui-state-focus")}),b.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");if(c.navigation){var d=b.element.find("a").filter(c.navigationFilter).eq(0);if(d.length){var e=d.closest(".ui-accordion-header");e.length?b.active=e:b.active=d.closest(".ui-accordion-content").prev()}}b.active=b._findActive(b.active||c.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top"),b.active.next().addClass("ui-accordion-content-active"),b._createIcons(),b.resize(),b.element.attr("role","tablist"),b.headers.attr("role","tab").bind("keydown.accordion",function(a){return b._keydown(a)}).next().attr("role","tabpanel"),b.headers.not(b.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide(),b.active.length?b.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):b.headers.eq(0).attr("tabIndex",0),a.browser.safari||b.headers.find("a").attr("tabIndex",-1),c.event&&b.headers.bind(c.event.split(" ").join(".accordion ")+".accordion",function(a){b._clickHandler.call(b,a,this),a.preventDefault()})},_createIcons:function(){var b=this.options;b.icons&&(a("").addClass("ui-icon "+b.icons.header).prependTo(this.headers),this.active.children(".ui-icon").toggleClass(b.icons.header).toggleClass(b.icons.headerSelected),this.element.addClass("ui-accordion-icons"))},_destroyIcons:function(){this.headers.children(".ui-icon").remove(),this.element.removeClass("ui-accordion-icons")},destroy:function(){var b=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role"),this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"),this.headers.find("a").removeAttr("tabIndex"),this._destroyIcons();var c=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");return(b.autoHeight||b.fillHeight)&&c.css("height",""),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments),b=="active"&&this.activate(c),b=="icons"&&(this._destroyIcons(),c&&this._createIcons()),b=="disabled"&&this.headers.add(this.headers.next())[c?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(b){if(this.options.disabled||b.altKey||b.ctrlKey)return;var c=a.ui.keyCode,d=this.headers.length,e=this.headers.index(b.target),f=!1;switch(b.keyCode){case c.RIGHT:case c.DOWN:f=this.headers[(e+1)%d];break;case c.LEFT:case c.UP:f=this.headers[(e-1+d)%d];break;case c.SPACE:case c.ENTER:this._clickHandler({target:b.target},b.target),b.preventDefault()}return f?(a(b.target).attr("tabIndex",-1),a(f).attr("tabIndex",0),f.focus(),!1):!0},resize:function(){var b=this.options,c;if(b.fillSpace){if(a.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}c=this.element.parent().height(),a.browser.msie&&this.element.parent().css("overflow",d),this.headers.each(function(){c-=a(this).outerHeight(!0)}),this.headers.next().each(function(){a(this).height(Math.max(0,c-a(this).innerHeight()+a(this).height()))}).css("overflow","auto")}else b.autoHeight&&(c=0,this.headers.next().each(function(){c=Math.max(c,a(this).height("").height())}).height(c));return this},activate:function(a){this.options.active=a;var b=this._findActive(a)[0];return this._clickHandler({target:b},b),this},_findActive:function(b){return b?typeof b=="number"?this.headers.filter(":eq("+b+")"):this.headers.not(this.headers.not(b)):b===!1?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(b,c){var d=this.options;if(d.disabled)return;if(!b.target){if(!d.collapsible)return;this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header),this.active.next().addClass("ui-accordion-content-active");var e=this.active.next(),f={options:d,newHeader:a([]),oldHeader:d.active,newContent:a([]),oldContent:e},g=this.active=a([]);this._toggle(g,e,f);return}var h=a(b.currentTarget||c),i=h[0]===this.active[0];d.active=d.collapsible&&i?!1:this.headers.index(h);if(this.running||!d.collapsible&&i)return;var j=this.active,g=h.next(),e=this.active.next(),f={options:d,newHeader:i&&d.collapsible?a([]):h,oldHeader:this.active,newContent:i&&d.collapsible?a([]):g,oldContent:e},k=this.headers.index(this.active[0])>this.headers.index(h[0]);this.active=i?a([]):h,this._toggle(g,e,f,i,k),j.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header),i||(h.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected),h.next().addClass("ui-accordion-content-active"));return},_toggle:function(b,c,d,e,f){var g=this,h=g.options;g.toShow=b,g.toHide=c,g.data=d;var i=function(){if(!g)return;return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data),g.running=c.size()===0?b.size():c.size();if(h.animated){var j={};h.collapsible&&e?j={toShow:a([]),toHide:c,complete:i,down:f,autoHeight:h.autoHeight||h.fillSpace}:j={toShow:b,toHide:c,complete:i,down:f,autoHeight:h.autoHeight||h.fillSpace},h.proxied||(h.proxied=h.animated),h.proxiedDuration||(h.proxiedDuration=h.duration),h.animated=a.isFunction(h.proxied)?h.proxied(j):h.proxied,h.duration=a.isFunction(h.proxiedDuration)?h.proxiedDuration(j):h.proxiedDuration;var k=a.ui.accordion.animations,l=h.duration,m=h.animated;m&&!k[m]&&!a.easing[m]&&(m="slide"),k[m]||(k[m]=function(a){this.slide(a,{easing:m,duration:l||700})}),k[m](j)}else h.collapsible&&e?b.toggle():(c.hide(),b.show()),i(!0);c.prev().attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).blur(),b.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(this.running)return;this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""}),this.toHide.removeClass("ui-accordion-content-active"),this.toHide.length&&(this.toHide.parent()[0].className=this.toHide.parent()[0].className),this._trigger("change",null,this.data)}}),a.extend(a.ui.accordion,{version:"1.8.24",animations:{slide:function(b,c){b=a.extend({easing:"swing",duration:300},b,c);if(!b.toHide.size()){b.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},b);return}if(!b.toShow.size()){b.toHide.animate({height:"hide",paddingTop:"hide",paddingBottom:"hide"},b);return}var d=b.toShow.css("overflow"),e=0,f={},g={},h=["height","paddingTop","paddingBottom"],i,j=b.toShow;i=j[0].style.width,j.width(j.parent().width()-parseFloat(j.css("paddingLeft"))-parseFloat(j.css("paddingRight"))-(parseFloat(j.css("borderLeftWidth"))||0)-(parseFloat(j.css("borderRightWidth"))||0)),a.each(h,function(c,d){g[d]="hide";var e=(""+a.css(b.toShow[0],d)).match(/^([\d+-.]+)(.*)$/);f[d]={value:e[1],unit:e[2]||"px"}}),b.toShow.css({height:0,overflow:"hidden"}).show(),b.toHide.filter(":hidden").each(b.complete).end().filter(":visible").animate(g,{step:function(a,c){c.prop=="height"&&(e=c.end-c.start===0?0:(c.now-c.start)/(c.end-c.start)),b.toShow[0].style[c.prop]=e*f[c.prop].value+f[c.prop].unit},duration:b.duration,easing:b.easing,complete:function(){b.autoHeight||b.toShow.css("height",""),b.toShow.css({width:i,overflow:d}),b.complete()}})},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1e3:200})}}})})(jQuery);;/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.autocomplete.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){var c=0;a.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:!1,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var b=this,c=this.element[0].ownerDocument,d;this.isMultiLine=this.element.is("textarea"),this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(b.options.disabled||b.element.propAttr("readOnly"))return;d=!1;var e=a.ui.keyCode;switch(c.keyCode){case e.PAGE_UP:b._move("previousPage",c);break;case e.PAGE_DOWN:b._move("nextPage",c);break;case e.UP:b._keyEvent("previous",c);break;case e.DOWN:b._keyEvent("next",c);break;case e.ENTER:case e.NUMPAD_ENTER:b.menu.active&&(d=!0,c.preventDefault());case e.TAB:if(!b.menu.active)return;b.menu.select(c);break;case e.ESCAPE:b.element.val(b.term),b.close(c);break;default:clearTimeout(b.searching),b.searching=setTimeout(function(){b.term!=b.element.val()&&(b.selectedItem=null,b.search(null,c))},b.options.delay)}}).bind("keypress.autocomplete",function(a){d&&(d=!1,a.preventDefault())}).bind("focus.autocomplete",function(){if(b.options.disabled)return;b.selectedItem=null,b.previous=b.element.val()}).bind("blur.autocomplete",function(a){if(b.options.disabled)return;clearTimeout(b.searching),b.closing=setTimeout(function(){b.close(a),b._change(a)},150)}),this._initSource(),this.menu=a("
      ").addClass("ui-autocomplete").appendTo(a(this.options.appendTo||"body",c)[0]).mousedown(function(c){var d=b.menu.element[0];a(c.target).closest(".ui-menu-item").length||setTimeout(function(){a(document).one("mousedown",function(c){c.target!==b.element[0]&&c.target!==d&&!a.ui.contains(d,c.target)&&b.close()})},1),setTimeout(function(){clearTimeout(b.closing)},13)}).menu({focus:function(a,c){var d=c.item.data("item.autocomplete");!1!==b._trigger("focus",a,{item:d})&&/^key/.test(a.originalEvent.type)&&b.element.val(d.value)},selected:function(a,d){var e=d.item.data("item.autocomplete"),f=b.previous;b.element[0]!==c.activeElement&&(b.element.focus(),b.previous=f,setTimeout(function(){b.previous=f,b.selectedItem=e},1)),!1!==b._trigger("select",a,{item:e})&&b.element.val(e.value),b.term=b.element.val(),b.close(a),b.selectedItem=e},blur:function(a,c){b.menu.element.is(":visible")&&b.element.val()!==b.term&&b.element.val(b.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"),a.fn.bgiframe&&this.menu.element.bgiframe(),b.beforeunloadHandler=function(){b.element.removeAttr("autocomplete")},a(window).bind("beforeunload",b.beforeunloadHandler)},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup"),this.menu.element.remove(),a(window).unbind("beforeunload",this.beforeunloadHandler),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments),b==="source"&&this._initSource(),b==="appendTo"&&this.menu.element.appendTo(a(c||"body",this.element[0].ownerDocument)[0]),b==="disabled"&&c&&this.xhr&&this.xhr.abort()},_initSource:function(){var b=this,c,d;a.isArray(this.options.source)?(c=this.options.source,this.source=function(b,d){d(a.ui.autocomplete.filter(c,b.term))}):typeof this.options.source=="string"?(d=this.options.source,this.source=function(c,e){b.xhr&&b.xhr.abort(),b.xhr=a.ajax({url:d,data:c,dataType:"json",success:function(a,b){e(a)},error:function(){e([])}})}):this.source=this.options.source},search:function(a,b){a=a!=null?a:this.element.val(),this.term=this.element.val();if(a.length").data("item.autocomplete",c).append(a("      ").text(c.label)).appendTo(b)},_move:function(a,b){if(!this.menu.element.is(":visible")){this.search(null,b);return}if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term),this.menu.deactivate();return}this.menu[a](b)},widget:function(){return this.menu.element},_keyEvent:function(a,b){if(!this.isMultiLine||this.menu.element.is(":visible"))this._move(a,b),b.preventDefault()}}),a.extend(a.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(b,c){var d=new RegExp(a.ui.autocomplete.escapeRegex(c),"i");return a.grep(b,function(a){return d.test(a.label||a.value||a)})}})})(jQuery),function(a){a.widget("ui.menu",{_create:function(){var b=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(c){if(!a(c.target).closest(".ui-menu-item a").length)return;c.preventDefault(),b.select(c)}),this.refresh()},refresh:function(){var b=this,c=this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem");c.children("a").addClass("ui-corner-all").attr("tabindex",-1).mouseenter(function(c){b.activate(c,a(this).parent())}).mouseleave(function(){b.deactivate()})},activate:function(a,b){this.deactivate();if(this.hasScroll()){var c=b.offset().top-this.element.offset().top,d=this.element.scrollTop(),e=this.element.height();c<0?this.element.scrollTop(d+c):c>=e&&this.element.scrollTop(d+c-e+b.height())}this.active=b.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end(),this._trigger("focus",a,{item:b})},deactivate:function(){if(!this.active)return;this.active.children("a").removeClass("ui-state-hover").removeAttr("id"),this._trigger("blur"),this.active=null},next:function(a){this.move("next",".ui-menu-item:first",a)},previous:function(a){this.move("prev",".ui-menu-item:last",a)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(a,b,c){if(!this.active){this.activate(c,this.element.children(b));return}var d=this.active[a+"All"](".ui-menu-item").eq(0);d.length?this.activate(c,d):this.activate(c,this.element.children(b))},nextPage:function(b){if(this.hasScroll()){if(!this.active||this.last()){this.activate(b,this.element.children(".ui-menu-item:first"));return}var c=this.active.offset().top,d=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var b=a(this).offset().top-c-d+a(this).height();return b<10&&b>-10});e.length||(e=this.element.children(".ui-menu-item:last")),this.activate(b,e)}else this.activate(b,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(b){if(this.hasScroll()){if(!this.active||this.first()){this.activate(b,this.element.children(".ui-menu-item:last"));return}var c=this.active.offset().top,d=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var b=a(this).offset().top-c+d-a(this).height();return b<10&&b>-10});e.length||(e=this.element.children(".ui-menu-item:first")),this.activate(b,e)}else this.activate(b,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()",this.element[0].ownerDocument).addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,e=d.primary&&d.secondary,f=[];d.primary||d.secondary?(this.options.text&&f.push("ui-button-text-icon"+(e?"s":d.primary?"-primary":"-secondary")),d.primary&&b.prepend(""),d.secondary&&b.append(""),this.options.text||(f.push(e?"ui-button-icons-only":"ui-button-icon-only"),this.hasTitle||b.attr("title",c))):f.push("ui-button-text-only"),b.addClass(f.join(" "))}}),a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c),a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var b=this.element.css("direction")==="rtl";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(b?"ui-corner-right":"ui-corner-left").end().filter(":last").addClass(b?"ui-corner-left":"ui-corner-right").end().end()},destroy:function(){this.element.removeClass("ui-buttonset"),this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"),a.Widget.prototype.destroy.call(this)}})})(jQuery);;/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.dialog.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){var c="ui-dialog ui-widget ui-widget-content ui-corner-all ",d={buttons:!0,height:!0,maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0,width:!0},e={maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0};a.widget("ui.dialog",{options:{autoOpen:!0,buttons:{},closeOnEscape:!0,closeText:"close",dialogClass:"",draggable:!0,hide:null,height:"auto",maxHeight:!1,maxWidth:!1,minHeight:150,minWidth:150,modal:!1,position:{my:"center",at:"center",collision:"fit",using:function(b){var c=a(this).css(b).offset().top;c<0&&a(this).css("top",b.top-c)}},resizable:!0,show:null,stack:!0,title:"",width:300,zIndex:1e3},_create:function(){this.originalTitle=this.element.attr("title"),typeof this.originalTitle!="string"&&(this.originalTitle=""),this.options.title=this.options.title||this.originalTitle;var b=this,d=b.options,e=d.title||" ",f=a.ui.dialog.getTitleId(b.element),g=(b.uiDialog=a("
      ")).appendTo(document.body).hide().addClass(c+d.dialogClass).css({zIndex:d.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(c){d.closeOnEscape&&!c.isDefaultPrevented()&&c.keyCode&&c.keyCode===a.ui.keyCode.ESCAPE&&(b.close(c),c.preventDefault())}).attr({role:"dialog","aria-labelledby":f}).mousedown(function(a){b.moveToTop(!1,a)}),h=b.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g),i=(b.uiDialogTitlebar=a("
      ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),j=a('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){j.addClass("ui-state-hover")},function(){j.removeClass("ui-state-hover")}).focus(function(){j.addClass("ui-state-focus")}).blur(function(){j.removeClass("ui-state-focus")}).click(function(a){return b.close(a),!1}).appendTo(i),k=(b.uiDialogTitlebarCloseText=a("")).addClass("ui-icon ui-icon-closethick").text(d.closeText).appendTo(j),l=a("").addClass("ui-dialog-title").attr("id",f).html(e).prependTo(i);a.isFunction(d.beforeclose)&&!a.isFunction(d.beforeClose)&&(d.beforeClose=d.beforeclose),i.find("*").add(i).disableSelection(),d.draggable&&a.fn.draggable&&b._makeDraggable(),d.resizable&&a.fn.resizable&&b._makeResizable(),b._createButtons(d.buttons),b._isOpen=!1,a.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;return a.overlay&&a.overlay.destroy(),a.uiDialog.hide(),a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"),a.uiDialog.remove(),a.originalTitle&&a.element.attr("title",a.originalTitle),a},widget:function(){return this.uiDialog},close:function(b){var c=this,d,e;if(!1===c._trigger("beforeClose",b))return;return c.overlay&&c.overlay.destroy(),c.uiDialog.unbind("keypress.ui-dialog"),c._isOpen=!1,c.options.hide?c.uiDialog.hide(c.options.hide,function(){c._trigger("close",b)}):(c.uiDialog.hide(),c._trigger("close",b)),a.ui.dialog.overlay.resize(),c.options.modal&&(d=0,a(".ui-dialog").each(function(){this!==c.uiDialog[0]&&(e=a(this).css("z-index"),isNaN(e)||(d=Math.max(d,e)))}),a.ui.dialog.maxZ=d),c},isOpen:function(){return this._isOpen},moveToTop:function(b,c){var d=this,e=d.options,f;return e.modal&&!b||!e.stack&&!e.modal?d._trigger("focus",c):(e.zIndex>a.ui.dialog.maxZ&&(a.ui.dialog.maxZ=e.zIndex),d.overlay&&(a.ui.dialog.maxZ+=1,d.overlay.$el.css("z-index",a.ui.dialog.overlay.maxZ=a.ui.dialog.maxZ)),f={scrollTop:d.element.scrollTop(),scrollLeft:d.element.scrollLeft()},a.ui.dialog.maxZ+=1,d.uiDialog.css("z-index",a.ui.dialog.maxZ),d.element.attr(f),d._trigger("focus",c),d)},open:function(){if(this._isOpen)return;var b=this,c=b.options,d=b.uiDialog;return b.overlay=c.modal?new a.ui.dialog.overlay(b):null,b._size(),b._position(c.position),d.show(c.show),b.moveToTop(!0),c.modal&&d.bind("keydown.ui-dialog",function(b){if(b.keyCode!==a.ui.keyCode.TAB)return;var c=a(":tabbable",this),d=c.filter(":first"),e=c.filter(":last");if(b.target===e[0]&&!b.shiftKey)return d.focus(1),!1;if(b.target===d[0]&&b.shiftKey)return e.focus(1),!1}),a(b.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus(),b._isOpen=!0,b._trigger("open"),b},_createButtons:function(b){var c=this,d=!1,e=a("
      ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),f=a("
      ").addClass("ui-dialog-buttonset").appendTo(e);c.uiDialog.find(".ui-dialog-buttonpane").remove(),typeof b=="object"&&b!==null&&a.each(b,function(){return!(d=!0)}),d&&(a.each(b,function(b,d){d=a.isFunction(d)?{click:d,text:b}:d;var e=a('').click(function(){d.click.apply(c.element[0],arguments)}).appendTo(f);a.each(d,function(a,b){if(a==="click")return;a in e?e[a](b):e.attr(a,b)}),a.fn.button&&e.button()}),e.appendTo(c.uiDialog))},_makeDraggable:function(){function f(a){return{position:a.position,offset:a.offset}}var b=this,c=b.options,d=a(document),e;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(d,g){e=c.height==="auto"?"auto":a(this).height(),a(this).height(a(this).height()).addClass("ui-dialog-dragging"),b._trigger("dragStart",d,f(g))},drag:function(a,c){b._trigger("drag",a,f(c))},stop:function(g,h){c.position=[h.position.left-d.scrollLeft(),h.position.top-d.scrollTop()],a(this).removeClass("ui-dialog-dragging").height(e),b._trigger("dragStop",g,f(h)),a.ui.dialog.overlay.resize()}})},_makeResizable:function(c){function h(a){return{originalPosition:a.originalPosition,originalSize:a.originalSize,position:a.position,size:a.size}}c=c===b?this.options.resizable:c;var d=this,e=d.options,f=d.uiDialog.css("position"),g=typeof c=="string"?c:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:g,start:function(b,c){a(this).addClass("ui-dialog-resizing"),d._trigger("resizeStart",b,h(c))},resize:function(a,b){d._trigger("resize",a,h(b))},stop:function(b,c){a(this).removeClass("ui-dialog-resizing"),e.height=a(this).height(),e.width=a(this).width(),d._trigger("resizeStop",b,h(c)),a.ui.dialog.overlay.resize()}}).css("position",f).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(b){var c=[],d=[0,0],e;if(b){if(typeof b=="string"||typeof b=="object"&&"0"in b)c=b.split?b.split(" "):[b[0],b[1]],c.length===1&&(c[1]=c[0]),a.each(["left","top"],function(a,b){+c[a]===c[a]&&(d[a]=c[a],c[a]=b)}),b={my:c.join(" "),at:c.join(" "),offset:d.join(" ")};b=a.extend({},a.ui.dialog.prototype.options.position,b)}else b=a.ui.dialog.prototype.options.position;e=this.uiDialog.is(":visible"),e||this.uiDialog.show(),this.uiDialog.css({top:0,left:0}).position(a.extend({of:window},b)),e||this.uiDialog.hide()},_setOptions:function(b){var c=this,f={},g=!1;a.each(b,function(a,b){c._setOption(a,b),a in d&&(g=!0),a in e&&(f[a]=b)}),g&&this._size(),this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",f)},_setOption:function(b,d){var e=this,f=e.uiDialog;switch(b){case"beforeclose":b="beforeClose";break;case"buttons":e._createButtons(d);break;case"closeText":e.uiDialogTitlebarCloseText.text(""+d);break;case"dialogClass":f.removeClass(e.options.dialogClass).addClass(c+d);break;case"disabled":d?f.addClass("ui-dialog-disabled"):f.removeClass("ui-dialog-disabled");break;case"draggable":var g=f.is(":data(draggable)");g&&!d&&f.draggable("destroy"),!g&&d&&e._makeDraggable();break;case"position":e._position(d);break;case"resizable":var h=f.is(":data(resizable)");h&&!d&&f.resizable("destroy"),h&&typeof d=="string"&&f.resizable("option","handles",d),!h&&d!==!1&&e._makeResizable(d);break;case"title":a(".ui-dialog-title",e.uiDialogTitlebar).html(""+(d||" "))}a.Widget.prototype._setOption.apply(e,arguments)},_size:function(){var b=this.options,c,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0}),b.minWidth>b.width&&(b.width=b.minWidth),c=this.uiDialog.css({height:"auto",width:b.width}).height(),d=Math.max(0,b.minHeight-c);if(b.height==="auto")if(a.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();var f=this.element.css("height","auto").height();e||this.uiDialog.hide(),this.element.height(Math.max(f,d))}else this.element.height(Math.max(b.height-c,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}}),a.extend(a.ui.dialog,{version:"1.8.24",uuid:0,maxZ:0,getTitleId:function(a){var b=a.attr("id");return b||(this.uuid+=1,b=this.uuid),"ui-dialog-title-"+b},overlay:function(b){this.$el=a.ui.dialog.overlay.create(b)}}),a.extend(a.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:a.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(b){this.instances.length===0&&(setTimeout(function(){a.ui.dialog.overlay.instances.length&&a(document).bind(a.ui.dialog.overlay.events,function(b){if(a(b.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});return a.fn.bgiframe&&c.bgiframe(),this.instances.push(c),c},destroy:function(b){var c=a.inArray(b,this.instances);c!=-1&&this.oldInstances.push(this.instances.splice(c,1)[0]),this.instances.length===0&&a([document,window]).unbind(".dialog-overlay"),b.remove();var d=0;a.each(this.instances,function(){d=Math.max(d,this.css("z-index"))}),this.maxZ=d},height:function(){var b,c;return a.browser.msie&&a.browser.version<7?(b=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight),c=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight),b").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(d.range==="min"||d.range==="max"?" ui-slider-range-"+d.range:"")));for(var i=e.length;ic&&(f=c,g=a(this),i=b)}),c.range===!0&&this.values(1)===c.min&&(i+=1,g=a(this.handles[i])),j=this._start(b,i),j===!1?!1:(this._mouseSliding=!0,h._handleIndex=i,g.addClass("ui-state-active").focus(),k=g.offset(),l=!a(b.target).parents().andSelf().is(".ui-slider-handle"),this._clickOffset=l?{left:0,top:0}:{left:b.pageX-k.left-g.width()/2,top:b.pageY-k.top-g.height()/2-(parseInt(g.css("borderTopWidth"),10)||0)-(parseInt(g.css("borderBottomWidth"),10)||0)+(parseInt(g.css("marginTop"),10)||0)},this.handles.hasClass("ui-state-hover")||this._slide(b,i,e),this._animateOff=!0,!0))},_mouseStart:function(a){return!0},_mouseDrag:function(a){var b={x:a.pageX,y:a.pageY},c=this._normValueFromMouse(b);return this._slide(a,this._handleIndex,c),!1},_mouseStop:function(a){return this.handles.removeClass("ui-state-active"),this._mouseSliding=!1,this._stop(a,this._handleIndex),this._change(a,this._handleIndex),this._handleIndex=null,this._clickOffset=null,this._animateOff=!1,!1},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b,c,d,e,f;return this.orientation==="horizontal"?(b=this.elementSize.width,c=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)):(b=this.elementSize.height,c=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)),d=c/b,d>1&&(d=1),d<0&&(d=0),this.orientation==="vertical"&&(d=1-d),e=this._valueMax()-this._valueMin(),f=this._valueMin()+d*e,this._trimAlignValue(f)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};return this.options.values&&this.options.values.length&&(c.value=this.values(b),c.values=this.values()),this._trigger("start",a,c)},_slide:function(a,b,c){var d,e,f;this.options.values&&this.options.values.length?(d=this.values(b?0:1),this.options.values.length===2&&this.options.range===!0&&(b===0&&c>d||b===1&&c1){this.options.values[b]=this._trimAlignValue(c),this._refreshValue(),this._change(null,b);return}if(!arguments.length)return this._values();if(!a.isArray(arguments[0]))return this.options.values&&this.options.values.length?this._values(b):this.value();d=this.options.values,e=arguments[0];for(f=0;f=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b,d=a-c;return Math.abs(c)*2>=b&&(d+=c>0?b:-b),parseFloat(d.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var b=this.options.range,c=this.options,d=this,e=this._animateOff?!1:c.animate,f,g={},h,i,j,k;this.options.values&&this.options.values.length?this.handles.each(function(b,i){f=(d.values(b)-d._valueMin())/(d._valueMax()-d._valueMin())*100,g[d.orientation==="horizontal"?"left":"bottom"]=f+"%",a(this).stop(1,1)[e?"animate":"css"](g,c.animate),d.options.range===!0&&(d.orientation==="horizontal"?(b===0&&d.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},c.animate),b===1&&d.range[e?"animate":"css"]({width:f-h+"%"},{queue:!1,duration:c.animate})):(b===0&&d.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},c.animate),b===1&&d.range[e?"animate":"css"]({height:f-h+"%"},{queue:!1,duration:c.animate}))),h=f}):(i=this.value(),j=this._valueMin(),k=this._valueMax(),f=k!==j?(i-j)/(k-j)*100:0,g[d.orientation==="horizontal"?"left":"bottom"]=f+"%",this.handle.stop(1,1)[e?"animate":"css"](g,c.animate),b==="min"&&this.orientation==="horizontal"&&this.range.stop(1,1)[e?"animate":"css"]({width:f+"%"},c.animate),b==="max"&&this.orientation==="horizontal"&&this.range[e?"animate":"css"]({width:100-f+"%"},{queue:!1,duration:c.animate}),b==="min"&&this.orientation==="vertical"&&this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},c.animate),b==="max"&&this.orientation==="vertical"&&this.range[e?"animate":"css"]({height:100-f+"%"},{queue:!1,duration:c.animate}))}}),a.extend(a.ui.slider,{version:"1.8.24"})})(jQuery);;/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.tabs.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){function e(){return++c}function f(){return++d}var c=0,d=0;a.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:!1,cookie:null,collapsible:!1,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
      ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
    • #{label}
      • "},_create:function(){this._tabify(!0)},_setOption:function(a,b){if(a=="selected"){if(this.options.collapsible&&b==this.options.selected)return;this.select(b)}else this.options[a]=b,this._tabify()},_tabId:function(a){return a.title&&a.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+e()},_sanitizeSelector:function(a){return a.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+f());return a.cookie.apply(null,[b].concat(a.makeArray(arguments)))},_ui:function(a,b){return{tab:a,panel:b,index:this.anchors.index(a)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=a(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(c){function m(b,c){b.css("display",""),!a.support.opacity&&c.opacity&&b[0].style.removeAttribute("filter")}var d=this,e=this.options,f=/^#.+/;this.list=this.element.find("ol,ul").eq(0),this.lis=a(" > li:has(a[href])",this.list),this.anchors=this.lis.map(function(){return a("a",this)[0]}),this.panels=a([]),this.anchors.each(function(b,c){var g=a(c).attr("href"),h=g.split("#")[0],i;h&&(h===location.toString().split("#")[0]||(i=a("base")[0])&&h===i.href)&&(g=c.hash,c.href=g);if(f.test(g))d.panels=d.panels.add(d.element.find(d._sanitizeSelector(g)));else if(g&&g!=="#"){a.data(c,"href.tabs",g),a.data(c,"load.tabs",g.replace(/#.*$/,""));var j=d._tabId(c);c.href="#"+j;var k=d.element.find("#"+j);k.length||(k=a(e.panelTemplate).attr("id",j).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(d.panels[b-1]||d.list),k.data("destroy.tabs",!0)),d.panels=d.panels.add(k)}else e.disabled.push(b)}),c?(this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"),this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all"),this.lis.addClass("ui-state-default ui-corner-top"),this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom"),e.selected===b?(location.hash&&this.anchors.each(function(a,b){if(b.hash==location.hash)return e.selected=a,!1}),typeof e.selected!="number"&&e.cookie&&(e.selected=parseInt(d._cookie(),10)),typeof e.selected!="number"&&this.lis.filter(".ui-tabs-selected").length&&(e.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))),e.selected=e.selected||(this.lis.length?0:-1)):e.selected===null&&(e.selected=-1),e.selected=e.selected>=0&&this.anchors[e.selected]||e.selected<0?e.selected:0,e.disabled=a.unique(e.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(a,b){return d.lis.index(a)}))).sort(),a.inArray(e.selected,e.disabled)!=-1&&e.disabled.splice(a.inArray(e.selected,e.disabled),1),this.panels.addClass("ui-tabs-hide"),this.lis.removeClass("ui-tabs-selected ui-state-active"),e.selected>=0&&this.anchors.length&&(d.element.find(d._sanitizeSelector(d.anchors[e.selected].hash)).removeClass("ui-tabs-hide"),this.lis.eq(e.selected).addClass("ui-tabs-selected ui-state-active"),d.element.queue("tabs",function(){d._trigger("show",null,d._ui(d.anchors[e.selected],d.element.find(d._sanitizeSelector(d.anchors[e.selected].hash))[0]))}),this.load(e.selected)),a(window).bind("unload",function(){d.lis.add(d.anchors).unbind(".tabs"),d.lis=d.anchors=d.panels=null})):e.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")),this.element[e.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible"),e.cookie&&this._cookie(e.selected,e.cookie);for(var g=0,h;h=this.lis[g];g++)a(h)[a.inArray(g,e.disabled)!=-1&&!a(h).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");e.cache===!1&&this.anchors.removeData("cache.tabs"),this.lis.add(this.anchors).unbind(".tabs");if(e.event!=="mouseover"){var i=function(a,b){b.is(":not(.ui-state-disabled)")&&b.addClass("ui-state-"+a)},j=function(a,b){b.removeClass("ui-state-"+a)};this.lis.bind("mouseover.tabs",function(){i("hover",a(this))}),this.lis.bind("mouseout.tabs",function(){j("hover",a(this))}),this.anchors.bind("focus.tabs",function(){i("focus",a(this).closest("li"))}),this.anchors.bind("blur.tabs",function(){j("focus",a(this).closest("li"))})}var k,l;e.fx&&(a.isArray(e.fx)?(k=e.fx[0],l=e.fx[1]):k=l=e.fx);var n=l?function(b,c){a(b).closest("li").addClass("ui-tabs-selected ui-state-active"),c.hide().removeClass("ui-tabs-hide").animate(l,l.duration||"normal",function(){m(c,l),d._trigger("show",null,d._ui(b,c[0]))})}:function(b,c){a(b).closest("li").addClass("ui-tabs-selected ui-state-active"),c.removeClass("ui-tabs-hide"),d._trigger("show",null,d._ui(b,c[0]))},o=k?function(a,b){b.animate(k,k.duration||"normal",function(){d.lis.removeClass("ui-tabs-selected ui-state-active"),b.addClass("ui-tabs-hide"),m(b,k),d.element.dequeue("tabs")})}:function(a,b,c){d.lis.removeClass("ui-tabs-selected ui-state-active"),b.addClass("ui-tabs-hide"),d.element.dequeue("tabs")};this.anchors.bind(e.event+".tabs",function(){var b=this,c=a(b).closest("li"),f=d.panels.filter(":not(.ui-tabs-hide)"),g=d.element.find(d._sanitizeSelector(b.hash));if(c.hasClass("ui-tabs-selected")&&!e.collapsible||c.hasClass("ui-state-disabled")||c.hasClass("ui-state-processing")||d.panels.filter(":animated").length||d._trigger("select",null,d._ui(this,g[0]))===!1)return this.blur(),!1;e.selected=d.anchors.index(this),d.abort();if(e.collapsible){if(c.hasClass("ui-tabs-selected"))return e.selected=-1,e.cookie&&d._cookie(e.selected,e.cookie),d.element.queue("tabs",function(){o(b,f)}).dequeue("tabs"),this.blur(),!1;if(!f.length)return e.cookie&&d._cookie(e.selected,e.cookie),d.element.queue("tabs",function(){n(b,g)}),d.load(d.anchors.index(this)),this.blur(),!1}e.cookie&&d._cookie(e.selected,e.cookie);if(g.length)f.length&&d.element.queue("tabs",function(){o(b,f)}),d.element.queue("tabs",function(){n(b,g)}),d.load(d.anchors.index(this));else throw"jQuery UI Tabs: Mismatching fragment identifier.";a.browser.msie&&this.blur()}),this.anchors.bind("click.tabs",function(){return!1})},_getIndex:function(a){return typeof a=="string"&&(a=this.anchors.index(this.anchors.filter("[href$='"+a+"']"))),a},destroy:function(){var b=this.options;return this.abort(),this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs"),this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all"),this.anchors.each(function(){var b=a.data(this,"href.tabs");b&&(this.href=b);var c=a(this).unbind(".tabs");a.each(["href","load","cache"],function(a,b){c.removeData(b+".tabs")})}),this.lis.unbind(".tabs").add(this.panels).each(function(){a.data(this,"destroy.tabs")?a(this).remove():a(this).removeClass(["ui-state-default","ui-corner-top","ui-tabs-selected","ui-state-active","ui-state-hover","ui-state-focus","ui-state-disabled","ui-tabs-panel","ui-widget-content","ui-corner-bottom","ui-tabs-hide"].join(" "))}),b.cookie&&this._cookie(null,b.cookie),this},add:function(c,d,e){e===b&&(e=this.anchors.length);var f=this,g=this.options,h=a(g.tabTemplate.replace(/#\{href\}/g,c).replace(/#\{label\}/g,d)),i=c.indexOf("#")?this._tabId(a("a",h)[0]):c.replace("#","");h.addClass("ui-state-default ui-corner-top").data("destroy.tabs",!0);var j=f.element.find("#"+i);return j.length||(j=a(g.panelTemplate).attr("id",i).data("destroy.tabs",!0)),j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide"),e>=this.lis.length?(h.appendTo(this.list),j.appendTo(this.list[0].parentNode)):(h.insertBefore(this.lis[e]),j.insertBefore(this.panels[e])),g.disabled=a.map(g.disabled,function(a,b){return a>=e?++a:a}),this._tabify(),this.anchors.length==1&&(g.selected=0,h.addClass("ui-tabs-selected ui-state-active"),j.removeClass("ui-tabs-hide"),this.element.queue("tabs",function(){f._trigger("show",null,f._ui(f.anchors[0],f.panels[0]))}),this.load(0)),this._trigger("add",null,this._ui(this.anchors[e],this.panels[e])),this},remove:function(b){b=this._getIndex(b);var c=this.options,d=this.lis.eq(b).remove(),e=this.panels.eq(b).remove();return d.hasClass("ui-tabs-selected")&&this.anchors.length>1&&this.select(b+(b+1=b?--a:a}),this._tabify(),this._trigger("remove",null,this._ui(d.find("a")[0],e[0])),this},enable:function(b){b=this._getIndex(b);var c=this.options;if(a.inArray(b,c.disabled)==-1)return;return this.lis.eq(b).removeClass("ui-state-disabled"),c.disabled=a.grep(c.disabled,function(a,c){return a!=b}),this._trigger("enable",null,this._ui(this.anchors[b],this.panels[b])),this},disable:function(a){a=this._getIndex(a);var b=this,c=this.options;return a!=c.selected&&(this.lis.eq(a).addClass("ui-state-disabled"),c.disabled.push(a),c.disabled.sort(),this._trigger("disable",null,this._ui(this.anchors[a],this.panels[a]))),this},select:function(a){a=this._getIndex(a);if(a==-1)if(this.options.collapsible&&this.options.selected!=-1)a=this.options.selected;else return this;return this.anchors.eq(a).trigger(this.options.event+".tabs"),this},load:function(b){b=this._getIndex(b);var c=this,d=this.options,e=this.anchors.eq(b)[0],f=a.data(e,"load.tabs");this.abort();if(!f||this.element.queue("tabs").length!==0&&a.data(e,"cache.tabs")){this.element.dequeue("tabs");return}this.lis.eq(b).addClass("ui-state-processing");if(d.spinner){var g=a("span",e);g.data("label.tabs",g.html()).html(d.spinner)}return this.xhr=a.ajax(a.extend({},d.ajaxOptions,{url:f,success:function(f,g){c.element.find(c._sanitizeSelector(e.hash)).html(f),c._cleanup(),d.cache&&a.data(e,"cache.tabs",!0),c._trigger("load",null,c._ui(c.anchors[b],c.panels[b]));try{d.ajaxOptions.success(f,g)}catch(h){}},error:function(a,f,g){c._cleanup(),c._trigger("load",null,c._ui(c.anchors[b],c.panels[b]));try{d.ajaxOptions.error(a,f,b,e)}catch(g){}}})),c.element.dequeue("tabs"),this},abort:function(){return this.element.queue([]),this.panels.stop(!1,!0),this.element.queue("tabs",this.element.queue("tabs").splice(-2,2)),this.xhr&&(this.xhr.abort(),delete this.xhr),this._cleanup(),this},url:function(a,b){return this.anchors.eq(a).removeData("cache.tabs").data("load.tabs",b),this},length:function(){return this.anchors.length}}),a.extend(a.ui.tabs,{version:"1.8.24"}),a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(a,b){var c=this,d=this.options,e=c._rotate||(c._rotate=function(b){clearTimeout(c.rotation),c.rotation=setTimeout(function(){var a=d.selected;c.select(++a'))}function bindHover(a){var b="button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";return a.bind("mouseout",function(a){var c=$(a.target).closest(b);if(!c.length)return;c.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(c){var d=$(c.target).closest(b);if($.datepicker._isDisabledDatepicker(instActive.inline?a.parent()[0]:instActive.input[0])||!d.length)return;d.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"),d.addClass("ui-state-hover"),d.hasClass("ui-datepicker-prev")&&d.addClass("ui-datepicker-prev-hover"),d.hasClass("ui-datepicker-next")&&d.addClass("ui-datepicker-next-hover")})}function extendRemove(a,b){$.extend(a,b);for(var c in b)if(b[c]==null||b[c]==undefined)a[c]=b[c];return a}function isArray(a){return a&&($.browser.safari&&typeof a=="object"&&a.length||a.constructor&&a.constructor.toString().match(/\Array\(\)/))}$.extend($.ui,{datepicker:{version:"1.8.24"}});var PROP_NAME="datepicker",dpuuid=(new Date).getTime(),instActive;$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){return extendRemove(this._defaults,a||{}),this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase(),inline=nodeName=="div"||nodeName=="span";target.id||(this.uuid+=1,target.id="dp"+this.uuid);var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{}),nodeName=="input"?this._connectDatepicker(target,inst):inline&&this._inlineDatepicker(target,inst)},_newInst:function(a,b){var c=a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1");return{id:c,input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:b?bindHover($('
      ')):this.dpDiv}},_connectDatepicker:function(a,b){var c=$(a);b.append=$([]),b.trigger=$([]);if(c.hasClass(this.markerClassName))return;this._attachments(c,b),c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(a,c,d){b.settings[c]=d}).bind("getData.datepicker",function(a,c){return this._get(b,c)}),this._autoSize(b),$.data(a,PROP_NAME,b),b.settings.disabled&&this._disableDatepicker(a)},_attachments:function(a,b){var c=this._get(b,"appendText"),d=this._get(b,"isRTL");b.append&&b.append.remove(),c&&(b.append=$(''+c+""),a[d?"before":"after"](b.append)),a.unbind("focus",this._showDatepicker),b.trigger&&b.trigger.remove();var e=this._get(b,"showOn");(e=="focus"||e=="both")&&a.focus(this._showDatepicker);if(e=="button"||e=="both"){var f=this._get(b,"buttonText"),g=this._get(b,"buttonImage");b.trigger=$(this._get(b,"buttonImageOnly")?$("").addClass(this._triggerClass).attr({src:g,alt:f,title:f}):$('').addClass(this._triggerClass).html(g==""?f:$("").attr({src:g,alt:f,title:f}))),a[d?"before":"after"](b.trigger),b.trigger.click(function(){return $.datepicker._datepickerShowing&&$.datepicker._lastInput==a[0]?$.datepicker._hideDatepicker():$.datepicker._datepickerShowing&&$.datepicker._lastInput!=a[0]?($.datepicker._hideDatepicker(),$.datepicker._showDatepicker(a[0])):$.datepicker._showDatepicker(a[0]),!1})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var d=function(a){var b=0,c=0;for(var d=0;db&&(b=a[d].length,c=d);return c};b.setMonth(d(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort"))),b.setDate(d(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=$(a);if(c.hasClass(this.markerClassName))return;c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(a,c,d){b.settings[c]=d}).bind("getData.datepicker",function(a,c){return this._get(b,c)}),$.data(a,PROP_NAME,b),this._setDate(b,this._getDefaultDate(b),!0),this._updateDatepicker(b),this._updateAlternate(b),b.settings.disabled&&this._disableDatepicker(a),b.dpDiv.css("display","block")},_dialogDatepicker:function(a,b,c,d,e){var f=this._dialogInst;if(!f){this.uuid+=1;var g="dp"+this.uuid;this._dialogInput=$(''),this._dialogInput.keydown(this._doKeyDown),$("body").append(this._dialogInput),f=this._dialogInst=this._newInst(this._dialogInput,!1),f.settings={},$.data(this._dialogInput[0],PROP_NAME,f)}extendRemove(f.settings,d||{}),b=b&&b.constructor==Date?this._formatDate(f,b):b,this._dialogInput.val(b),this._pos=e?e.length?e:[e.pageX,e.pageY]:null;if(!this._pos){var h=document.documentElement.clientWidth,i=document.documentElement.clientHeight,j=document.documentElement.scrollLeft||document.body.scrollLeft,k=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[h/2-100+j,i/2-150+k]}return this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px"),f.settings.onSelect=c,this._inDialog=!0,this.dpDiv.addClass(this._dialogClass),this._showDatepicker(this._dialogInput[0]),$.blockUI&&$.blockUI(this.dpDiv),$.data(this._dialogInput[0],PROP_NAME,f),this},_destroyDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();$.removeData(a,PROP_NAME),d=="input"?(c.append.remove(),c.trigger.remove(),b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)):(d=="div"||d=="span")&&b.removeClass(this.markerClassName).empty()},_enableDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();if(d=="input")a.disabled=!1,c.trigger.filter("button").each(function(){this.disabled=!1}).end().filter("img").css({opacity:"1.0",cursor:""});else if(d=="div"||d=="span"){var e=b.children("."+this._inlineClass);e.children().removeClass("ui-state-disabled"),e.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=$.map(this._disabledInputs,function(b){return b==a?null:b})},_disableDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();if(d=="input")a.disabled=!0,c.trigger.filter("button").each(function(){this.disabled=!0}).end().filter("img").css({opacity:"0.5",cursor:"default"});else if(d=="div"||d=="span"){var e=b.children("."+this._inlineClass);e.children().addClass("ui-state-disabled"),e.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=$.map(this._disabledInputs,function(b){return b==a?null:b}),this._disabledInputs[this._disabledInputs.length]=a},_isDisabledDatepicker:function(a){if(!a)return!1;for(var b=0;b-1}},_doKeyUp:function(a){var b=$.datepicker._getInst(a.target);if(b.input.val()!=b.lastVal)try{var c=$.datepicker.parseDate($.datepicker._get(b,"dateFormat"),b.input?b.input.val():null,$.datepicker._getFormatConfig(b));c&&($.datepicker._setDateFromField(b),$.datepicker._updateAlternate(b),$.datepicker._updateDatepicker(b))}catch(d){$.datepicker.log(d)}return!0},_showDatepicker:function(a){a=a.target||a,a.nodeName.toLowerCase()!="input"&&(a=$("input",a.parentNode)[0]);if($.datepicker._isDisabledDatepicker(a)||$.datepicker._lastInput==a)return;var b=$.datepicker._getInst(a);$.datepicker._curInst&&$.datepicker._curInst!=b&&($.datepicker._curInst.dpDiv.stop(!0,!0),b&&$.datepicker._datepickerShowing&&$.datepicker._hideDatepicker($.datepicker._curInst.input[0]));var c=$.datepicker._get(b,"beforeShow"),d=c?c.apply(a,[a,b]):{};if(d===!1)return;extendRemove(b.settings,d),b.lastVal=null,$.datepicker._lastInput=a,$.datepicker._setDateFromField(b),$.datepicker._inDialog&&(a.value=""),$.datepicker._pos||($.datepicker._pos=$.datepicker._findPos(a),$.datepicker._pos[1]+=a.offsetHeight);var e=!1;$(a).parents().each(function(){return e|=$(this).css("position")=="fixed",!e}),e&&$.browser.opera&&($.datepicker._pos[0]-=document.documentElement.scrollLeft,$.datepicker._pos[1]-=document.documentElement.scrollTop);var f={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null,b.dpDiv.empty(),b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"}),$.datepicker._updateDatepicker(b),f=$.datepicker._checkOffset(b,f,e),b.dpDiv.css({position:$.datepicker._inDialog&&$.blockUI?"static":e?"fixed":"absolute",display:"none",left:f.left+"px",top:f.top+"px"});if(!b.inline){var g=$.datepicker._get(b,"showAnim"),h=$.datepicker._get(b,"duration"),i=function(){var a=b.dpDiv.find("iframe.ui-datepicker-cover");if(!!a.length){var c=$.datepicker._getBorders(b.dpDiv);a.css({left:-c[0],top:-c[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex($(a).zIndex()+1),$.datepicker._datepickerShowing=!0,$.effects&&$.effects[g]?b.dpDiv.show(g,$.datepicker._get(b,"showOptions"),h,i):b.dpDiv[g||"show"](g?h:null,i),(!g||!h)&&i(),b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus(),$.datepicker._curInst=b}},_updateDatepicker:function(a){var b=this;b.maxRows=4;var c=$.datepicker._getBorders(a.dpDiv);instActive=a,a.dpDiv.empty().append(this._generateHTML(a)),this._attachHandlers(a);var d=a.dpDiv.find("iframe.ui-datepicker-cover");!d.length||d.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}),a.dpDiv.find("."+this._dayOverClass+" a").mouseover();var e=this._getNumberOfMonths(a),f=e[1],g=17;a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(""),f>1&&a.dpDiv.addClass("ui-datepicker-multi-"+f).css("width",g*f+"em"),a.dpDiv[(e[0]!=1||e[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi"),a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl"),a==$.datepicker._curInst&&$.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var h=a.yearshtml;setTimeout(function(){h===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml),h=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(a){return{thin:1,medium:2,thick:3}[a]||a};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var d=a.dpDiv.outerWidth(),e=a.dpDiv.outerHeight(),f=a.input?a.input.outerWidth():0,g=a.input?a.input.outerHeight():0,h=document.documentElement.clientWidth+(c?0:$(document).scrollLeft()),i=document.documentElement.clientHeight+(c?0:$(document).scrollTop());return b.left-=this._get(a,"isRTL")?d-f:0,b.left-=c&&b.left==a.input.offset().left?$(document).scrollLeft():0,b.top-=c&&b.top==a.input.offset().top+g?$(document).scrollTop():0,b.left-=Math.min(b.left,b.left+d>h&&h>d?Math.abs(b.left+d-h):0),b.top-=Math.min(b.top,b.top+e>i&&i>e?Math.abs(e+g):0),b},_findPos:function(a){var b=this._getInst(a),c=this._get(b,"isRTL");while(a&&(a.type=="hidden"||a.nodeType!=1||$.expr.filters.hidden(a)))a=a[c?"previousSibling":"nextSibling"];var d=$(a).offset();return[d.left,d.top]},_hideDatepicker:function(a){var b=this._curInst;if(!b||a&&b!=$.data(a,PROP_NAME))return;if(this._datepickerShowing){var c=this._get(b,"showAnim"),d=this._get(b,"duration"),e=function(){$.datepicker._tidyDialog(b)};$.effects&&$.effects[c]?b.dpDiv.hide(c,$.datepicker._get(b,"showOptions"),d,e):b.dpDiv[c=="slideDown"?"slideUp":c=="fadeIn"?"fadeOut":"hide"](c?d:null,e),c||e(),this._datepickerShowing=!1;var f=this._get(b,"onClose");f&&f.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]),this._lastInput=null,this._inDialog&&(this._dialogInput.css({position:"absolute",left:"0",top:"-100px"}),$.blockUI&&($.unblockUI(),$("body").append(this.dpDiv))),this._inDialog=!1}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(!$.datepicker._curInst)return;var b=$(a.target),c=$.datepicker._getInst(b[0]);(b[0].id!=$.datepicker._mainDivId&&b.parents("#"+$.datepicker._mainDivId).length==0&&!b.hasClass($.datepicker.markerClassName)&&!b.closest("."+$.datepicker._triggerClass).length&&$.datepicker._datepickerShowing&&(!$.datepicker._inDialog||!$.blockUI)||b.hasClass($.datepicker.markerClassName)&&$.datepicker._curInst!=c)&&$.datepicker._hideDatepicker()},_adjustDate:function(a,b,c){var d=$(a),e=this._getInst(d[0]);if(this._isDisabledDatepicker(d[0]))return;this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c),this._updateDatepicker(e)},_gotoToday:function(a){var b=$(a),c=this._getInst(b[0]);if(this._get(c,"gotoCurrent")&&c.currentDay)c.selectedDay=c.currentDay,c.drawMonth=c.selectedMonth=c.currentMonth,c.drawYear=c.selectedYear=c.currentYear;else{var d=new Date;c.selectedDay=d.getDate(),c.drawMonth=c.selectedMonth=d.getMonth(),c.drawYear=c.selectedYear=d.getFullYear()}this._notifyChange(c),this._adjustDate(b)},_selectMonthYear:function(a,b,c){var d=$(a),e=this._getInst(d[0]);e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10),this._notifyChange(e),this._adjustDate(d)},_selectDay:function(a,b,c,d){var e=$(a);if($(d).hasClass(this._unselectableClass)||this._isDisabledDatepicker(e[0]))return;var f=this._getInst(e[0]);f.selectedDay=f.currentDay=$("a",d).html(),f.selectedMonth=f.currentMonth=b,f.selectedYear=f.currentYear=c,this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))},_clearDate:function(a){var b=$(a),c=this._getInst(b[0]);this._selectDate(b,"")},_selectDate:function(a,b){var c=$(a),d=this._getInst(c[0]);b=b!=null?b:this._formatDate(d),d.input&&d.input.val(b),this._updateAlternate(d);var e=this._get(d,"onSelect");e?e.apply(d.input?d.input[0]:null,[b,d]):d.input&&d.input.trigger("change"),d.inline?this._updateDatepicker(d):(this._hideDatepicker(),this._lastInput=d.input[0],typeof d.input[0]!="object"&&d.input.focus(),this._lastInput=null)},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),d=this._getDate(a),e=this.formatDate(c,d,this._getFormatConfig(a));$(b).each(function(){$(this).val(e)})}},noWeekends:function(a){var b=a.getDay();return[b>0&&b<6,""]},iso8601Week:function(a){var b=new Date(a.getTime());b.setDate(b.getDate()+4-(b.getDay()||7));var c=b.getTime();return b.setMonth(0),b.setDate(1),Math.floor(Math.round((c-b)/864e5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var d=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;d=typeof d!="string"?d:(new Date).getFullYear()%100+parseInt(d,10);var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,g=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,h=(c?c.monthNames:null)||this._defaults.monthNames,i=-1,j=-1,k=-1,l=-1,m=!1,n=function(b){var c=s+1-1){j=1,k=l;do{var u=this._getDaysInMonth(i,j-1);if(k<=u)break;j++,k-=u}while(!0)}var t=this._daylightSavingAdjust(new Date(i,j-1,k));if(t.getFullYear()!=i||t.getMonth()+1!=j||t.getDate()!=k)throw"Invalid date";return t},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1e7,formatDate:function(a,b,c){if(!b)return"";var d=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,e=(c?c.dayNames:null)||this._defaults.dayNames,f=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,h=function(b){var c=m+112?a.getHours()+2:0),a):null},_setDate:function(a,b,c){var d=!b,e=a.selectedMonth,f=a.selectedYear,g=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=g.getDate(),a.drawMonth=a.selectedMonth=a.currentMonth=g.getMonth(),a.drawYear=a.selectedYear=a.currentYear=g.getFullYear(),(e!=a.selectedMonth||f!=a.selectedYear)&&!c&&this._notifyChange(a),this._adjustInstDate(a),a.input&&a.input.val(d?"":this._formatDate(a))},_getDate:function(a){var b=!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return b},_attachHandlers:function(a){var b=this._get(a,"stepMonths"),c="#"+a.id.replace(/\\\\/g,"\\");a.dpDiv.find("[data-handler]").map(function(){var a={prev:function(){window["DP_jQuery_"+dpuuid].datepicker._adjustDate(c,-b,"M")},next:function(){window["DP_jQuery_"+dpuuid].datepicker._adjustDate(c,+b,"M")},hide:function(){window["DP_jQuery_"+dpuuid].datepicker._hideDatepicker()},today:function(){window["DP_jQuery_"+dpuuid].datepicker._gotoToday(c)},selectDay:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectDay(c,+this.getAttribute("data-month"),+this.getAttribute("data-year"),this),!1},selectMonth:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectMonthYear(c,this,"M"),!1},selectYear:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectMonthYear(c,this,"Y"),!1}};$(this).bind(this.getAttribute("data-event"),a[this.getAttribute("data-handler")])})},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),d=this._get(a,"showButtonPanel"),e=this._get(a,"hideIfNoPrevNext"),f=this._get(a,"navigationAsDateFormat"),g=this._getNumberOfMonths(a),h=this._get(a,"showCurrentAtPos"),i=this._get(a,"stepMonths"),j=g[0]!=1||g[1]!=1,k=this._daylightSavingAdjust(a.currentDay?new Date(a.currentYear,a.currentMonth,a.currentDay):new Date(9999,9,9)),l=this._getMinMaxDate(a,"min"),m=this._getMinMaxDate(a,"max"),n=a.drawMonth-h,o=a.drawYear;n<0&&(n+=12,o--);if(m){var p=this._daylightSavingAdjust(new Date(m.getFullYear(),m.getMonth()-g[0]*g[1]+1,m.getDate()));p=l&&pp)n--,n<0&&(n=11,o--)}a.drawMonth=n,a.drawYear=o;var q=this._get(a,"prevText");q=f?this.formatDate(q,this._daylightSavingAdjust(new Date(o,n-i,1)),this._getFormatConfig(a)):q;var r=this._canAdjustMonth(a,-1,o,n)?''+q+"":e?"":''+q+"",s=this._get(a,"nextText");s=f?this.formatDate(s,this._daylightSavingAdjust(new Date(o,n+i,1)),this._getFormatConfig(a)):s;var t=this._canAdjustMonth(a,1,o,n)?''+s+"":e?"":''+s+"",u=this._get(a,"currentText"),v=this._get(a,"gotoCurrent")&&a.currentDay?k:b;u=f?this.formatDate(u,v,this._getFormatConfig(a)):u;var w=a.inline?"":'",x=d?'
      '+(c?w:"")+(this._isInRange(a,v)?'":"")+(c?"":w)+"
      ":"",y=parseInt(this._get(a,"firstDay"),10);y=isNaN(y)?0:y;var z=this._get(a,"showWeek"),A=this._get(a,"dayNames"),B=this._get(a,"dayNamesShort"),C=this._get(a,"dayNamesMin"),D=this._get(a,"monthNames"),E=this._get(a,"monthNamesShort"),F=this._get(a,"beforeShowDay"),G=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths"),I=this._get(a,"calculateWeek")||this.iso8601Week,J=this._getDefaultDate(a),K="";for(var L=0;L1)switch(N){case 0:Q+=" ui-datepicker-group-first",P=" ui-corner-"+(c?"right":"left");break;case g[1]-1:Q+=" ui-datepicker-group-last",P=" ui-corner-"+(c?"left":"right");break;default:Q+=" ui-datepicker-group-middle",P=""}Q+='">'}Q+='
      '+(/all|left/.test(P)&&L==0?c?t:r:"")+(/all|right/.test(P)&&L==0?c?r:t:"")+this._generateMonthYearHeader(a,n,o,l,m,L>0||N>0,D,E)+'
      '+"";var R=z?'":"";for(var S=0;S<7;S++){var T=(S+y)%7;R+="=5?' class="ui-datepicker-week-end"':"")+">"+''+C[T]+""}Q+=R+"";var U=this._getDaysInMonth(o,n);o==a.selectedYear&&n==a.selectedMonth&&(a.selectedDay=Math.min(a.selectedDay,U));var V=(this._getFirstDayOfMonth(o,n)-y+7)%7,W=Math.ceil((V+U)/7),X=j?this.maxRows>W?this.maxRows:W:W;this.maxRows=X;var Y=this._daylightSavingAdjust(new Date(o,n,1-V));for(var Z=0;Z";var _=z?'":"";for(var S=0;S<7;S++){var ba=F?F.apply(a.input?a.input[0]:null,[Y]):[!0,""],bb=Y.getMonth()!=n,bc=bb&&!H||!ba[0]||l&&Ym;_+='",Y.setDate(Y.getDate()+1),Y=this._daylightSavingAdjust(Y)}Q+=_+""}n++,n>11&&(n=0,o++),Q+="
      '+this._get(a,"weekHeader")+"
      '+this._get(a,"calculateWeek")(Y)+""+(bb&&!G?" ":bc?''+Y.getDate()+"":''+Y.getDate()+"")+"
      "+(j?""+(g[0]>0&&N==g[1]-1?'
      ':""):""),M+=Q}K+=M}return K+=x+($.browser.msie&&parseInt($.browser.version,10)<7&&!a.inline?'':""),a._keyEvent=!1,K},_generateMonthYearHeader:function(a,b,c,d,e,f,g,h){var i=this._get(a,"changeMonth"),j=this._get(a,"changeYear"),k=this._get(a,"showMonthAfterYear"),l='
      ',m="";if(f||!i)m+=''+g[b]+"";else{var n=d&&d.getFullYear()==c,o=e&&e.getFullYear()==c;m+='"}k||(l+=m+(f||!i||!j?" ":""));if(!a.yearshtml){a.yearshtml="";if(f||!j)l+=''+c+"";else{var q=this._get(a,"yearRange").split(":"),r=(new Date).getFullYear(),s=function(a){var b=a.match(/c[+-].*/)?c+parseInt(a.substring(1),10):a.match(/[+-].*/)?r+parseInt(a,10):parseInt(a,10);return isNaN(b)?r:b},t=s(q[0]),u=Math.max(t,s(q[1]||""));t=d?Math.max(t,d.getFullYear()):t,u=e?Math.min(u,e.getFullYear()):u,a.yearshtml+='",l+=a.yearshtml,a.yearshtml=null}}return l+=this._get(a,"yearSuffix"),k&&(l+=(f||!i||!j?" ":"")+m),l+="
      ",l},_adjustInstDate:function(a,b,c){var d=a.drawYear+(c=="Y"?b:0),e=a.drawMonth+(c=="M"?b:0),f=Math.min(a.selectedDay,this._getDaysInMonth(d,e))+(c=="D"?b:0),g=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(d,e,f)));a.selectedDay=g.getDate(),a.drawMonth=a.selectedMonth=g.getMonth(),a.drawYear=a.selectedYear=g.getFullYear(),(c=="M"||c=="Y")&&this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max"),e=c&&bd?d:e,e},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");b&&b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){var b=this._get(a,"numberOfMonths");return b==null?[1,1]:typeof b=="number"?[1,b]:b},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,d){var e=this._getNumberOfMonths(a),f=this._daylightSavingAdjust(new Date(c,d+(b<0?b:e[0]*e[1]),1));return b<0&&f.setDate(this._getDaysInMonth(f.getFullYear(),f.getMonth())),this._isInRange(a,f)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!d||b.getTime()<=d.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");return b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10),{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,d){b||(a.currentDay=a.selectedDay,a.currentMonth=a.selectedMonth,a.currentYear=a.selectedYear);var e=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(d,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),e,this._getFormatConfig(a))}}),$.fn.datepicker=function(a){if(!this.length)return this;$.datepicker.initialized||($(document).mousedown($.datepicker._checkExternalClick).find("body").append($.datepicker.dpDiv),$.datepicker.initialized=!0);var b=Array.prototype.slice.call(arguments,1);return typeof a!="string"||a!="isDisabled"&&a!="getDate"&&a!="widget"?a=="option"&&arguments.length==2&&typeof arguments[1]=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b)):this.each(function(){typeof a=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this].concat(b)):$.datepicker._attachDatepicker(this,a)}):$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b))},$.datepicker=new Datepicker,$.datepicker.initialized=!1,$.datepicker.uuid=(new Date).getTime(),$.datepicker.version="1.8.24",window["DP_jQuery_"+dpuuid]=$})(jQuery);;/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.progressbar.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()}),this.valueDiv=a("
      ").appendTo(this.element),this.oldValue=this._value(),this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"),this.valueDiv.remove(),a.Widget.prototype.destroy.apply(this,arguments)},value:function(a){return a===b?this._value():(this._setOption("value",a),this)},_setOption:function(b,c){b==="value"&&(this.options.value=c,this._refreshValue(),this._value()===this.options.max&&this._trigger("complete")),a.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;return typeof a!="number"&&(a=0),Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*this._value()/this.options.max},_refreshValue:function(){var a=this.value(),b=this._percentage();this.oldValue!==a&&(this.oldValue=a,this._trigger("change")),this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(b.toFixed(0)+"%"),this.element.attr("aria-valuenow",a)}}),a.extend(a.ui.progressbar,{version:"1.8.24"})})(jQuery);;/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.core.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +jQuery.effects||function(a,b){function c(b){var c;return b&&b.constructor==Array&&b.length==3?b:(c=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(b))?[parseInt(c[1],10),parseInt(c[2],10),parseInt(c[3],10)]:(c=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(b))?[parseFloat(c[1])*2.55,parseFloat(c[2])*2.55,parseFloat(c[3])*2.55]:(c=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(b))?[parseInt(c[1],16),parseInt(c[2],16),parseInt(c[3],16)]:(c=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(b))?[parseInt(c[1]+c[1],16),parseInt(c[2]+c[2],16),parseInt(c[3]+c[3],16)]:(c=/rgba\(0, 0, 0, 0\)/.exec(b))?e.transparent:e[a.trim(b).toLowerCase()]}function d(b,d){var e;do{e=(a.curCSS||a.css)(b,d);if(e!=""&&e!="transparent"||a.nodeName(b,"body"))break;d="backgroundColor"}while(b=b.parentNode);return c(e)}function h(){var a=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,b={},c,d;if(a&&a.length&&a[0]&&a[a[0]]){var e=a.length;while(e--)c=a[e],typeof a[c]=="string"&&(d=c.replace(/\-(\w)/g,function(a,b){return b.toUpperCase()}),b[d]=a[c])}else for(c in a)typeof a[c]=="string"&&(b[c]=a[c]);return b}function i(b){var c,d;for(c in b)d=b[c],(d==null||a.isFunction(d)||c in g||/scrollbar/.test(c)||!/color/i.test(c)&&isNaN(parseFloat(d)))&&delete b[c];return b}function j(a,b){var c={_:0},d;for(d in b)a[d]!=b[d]&&(c[d]=b[d]);return c}function k(b,c,d,e){typeof b=="object"&&(e=c,d=null,c=b,b=c.effect),a.isFunction(c)&&(e=c,d=null,c={});if(typeof c=="number"||a.fx.speeds[c])e=d,d=c,c={};return a.isFunction(d)&&(e=d,d=null),c=c||{},d=d||c.duration,d=a.fx.off?0:typeof d=="number"?d:d in a.fx.speeds?a.fx.speeds[d]:a.fx.speeds._default,e=e||c.complete,[b,c,d,e]}function l(b){return!b||typeof b=="number"||a.fx.speeds[b]?!0:typeof b=="string"&&!a.effects[b]?!0:!1}a.effects={},a.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","borderColor","color","outlineColor"],function(b,e){a.fx.step[e]=function(a){a.colorInit||(a.start=d(a.elem,e),a.end=c(a.end),a.colorInit=!0),a.elem.style[e]="rgb("+Math.max(Math.min(parseInt(a.pos*(a.end[0]-a.start[0])+a.start[0],10),255),0)+","+Math.max(Math.min(parseInt(a.pos*(a.end[1]-a.start[1])+a.start[1],10),255),0)+","+Math.max(Math.min(parseInt(a.pos*(a.end[2]-a.start[2])+a.start[2],10),255),0)+")"}});var e={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},f=["add","remove","toggle"],g={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};a.effects.animateClass=function(b,c,d,e){return a.isFunction(d)&&(e=d,d=null),this.queue(function(){var g=a(this),k=g.attr("style")||" ",l=i(h.call(this)),m,n=g.attr("class")||"";a.each(f,function(a,c){b[c]&&g[c+"Class"](b[c])}),m=i(h.call(this)),g.attr("class",n),g.animate(j(l,m),{queue:!1,duration:c,easing:d,complete:function(){a.each(f,function(a,c){b[c]&&g[c+"Class"](b[c])}),typeof g.attr("style")=="object"?(g.attr("style").cssText="",g.attr("style").cssText=k):g.attr("style",k),e&&e.apply(this,arguments),a.dequeue(this)}})})},a.fn.extend({_addClass:a.fn.addClass,addClass:function(b,c,d,e){return c?a.effects.animateClass.apply(this,[{add:b},c,d,e]):this._addClass(b)},_removeClass:a.fn.removeClass,removeClass:function(b,c,d,e){return c?a.effects.animateClass.apply(this,[{remove:b},c,d,e]):this._removeClass(b)},_toggleClass:a.fn.toggleClass,toggleClass:function(c,d,e,f,g){return typeof d=="boolean"||d===b?e?a.effects.animateClass.apply(this,[d?{add:c}:{remove:c},e,f,g]):this._toggleClass(c,d):a.effects.animateClass.apply(this,[{toggle:c},d,e,f])},switchClass:function(b,c,d,e,f){return a.effects.animateClass.apply(this,[{add:c,remove:b},d,e,f])}}),a.extend(a.effects,{version:"1.8.24",save:function(a,b){for(var c=0;c").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}),e=document.activeElement;try{e.id}catch(f){e=document.body}return b.wrap(d),(b[0]===e||a.contains(b[0],e))&&a(e).focus(),d=b.parent(),b.css("position")=="static"?(d.css({position:"relative"}),b.css({position:"relative"})):(a.extend(c,{position:b.css("position"),zIndex:b.css("z-index")}),a.each(["top","left","bottom","right"],function(a,d){c[d]=b.css(d),isNaN(parseInt(c[d],10))&&(c[d]="auto")}),b.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})),d.css(c).show()},removeWrapper:function(b){var c,d=document.activeElement;return b.parent().is(".ui-effects-wrapper")?(c=b.parent().replaceWith(b),(b[0]===d||a.contains(b[0],d))&&a(d).focus(),c):b},setTransition:function(b,c,d,e){return e=e||{},a.each(c,function(a,c){var f=b.cssUnit(c);f[0]>0&&(e[c]=f[0]*d+f[1])}),e}}),a.fn.extend({effect:function(b,c,d,e){var f=k.apply(this,arguments),g={options:f[1],duration:f[2],callback:f[3]},h=g.options.mode,i=a.effects[b];return a.fx.off||!i?h?this[h](g.duration,g.callback):this.each(function(){g.callback&&g.callback.call(this)}):i.call(this,g)},_show:a.fn.show,show:function(a){if(l(a))return this._show.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="show",this.effect.apply(this,b)},_hide:a.fn.hide,hide:function(a){if(l(a))return this._hide.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="hide",this.effect.apply(this,b)},__toggle:a.fn.toggle,toggle:function(b){if(l(b)||typeof b=="boolean"||a.isFunction(b))return this.__toggle.apply(this,arguments);var c=k.apply(this,arguments);return c[1].mode="toggle",this.effect.apply(this,c)},cssUnit:function(b){var c=this.css(b),d=[];return a.each(["em","px","%","pt"],function(a,b){c.indexOf(b)>0&&(d=[parseFloat(c),b])}),d}});var m={};a.each(["Quad","Cubic","Quart","Quint","Expo"],function(a,b){m[b]=function(b){return Math.pow(b,a+2)}}),a.extend(m,{Sine:function(a){return 1-Math.cos(a*Math.PI/2)},Circ:function(a){return 1-Math.sqrt(1-a*a)},Elastic:function(a){return a===0||a===1?a:-Math.pow(2,8*(a-1))*Math.sin(((a-1)*80-7.5)*Math.PI/15)},Back:function(a){return a*a*(3*a-2)},Bounce:function(a){var b,c=4;while(a<((b=Math.pow(2,--c))-1)/11);return 1/Math.pow(4,3-c)-7.5625*Math.pow((b*3-2)/22-a,2)}}),a.each(m,function(b,c){a.easing["easeIn"+b]=c,a.easing["easeOut"+b]=function(a){return 1-c(1-a)},a.easing["easeInOut"+b]=function(a){return a<.5?c(a*2)/2:c(a*-2+2)/-2+1}})}(jQuery);;/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.blind.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.blind=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.direction||"vertical";a.effects.save(c,d),c.show();var g=a.effects.createWrapper(c).css({overflow:"hidden"}),h=f=="vertical"?"height":"width",i=f=="vertical"?g.height():g.width();e=="show"&&g.css(h,0);var j={};j[h]=e=="show"?i:0,g.animate(j,b.duration,b.options.easing,function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}})(jQuery);;/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.bounce.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.bounce=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"effect"),f=b.options.direction||"up",g=b.options.distance||20,h=b.options.times||5,i=b.duration||250;/show|hide/.test(e)&&d.push("opacity"),a.effects.save(c,d),c.show(),a.effects.createWrapper(c);var j=f=="up"||f=="down"?"top":"left",k=f=="up"||f=="left"?"pos":"neg",g=b.options.distance||(j=="top"?c.outerHeight(!0)/3:c.outerWidth(!0)/3);e=="show"&&c.css("opacity",0).css(j,k=="pos"?-g:g),e=="hide"&&(g=g/(h*2)),e!="hide"&&h--;if(e=="show"){var l={opacity:1};l[j]=(k=="pos"?"+=":"-=")+g,c.animate(l,i/2,b.options.easing),g=g/2,h--}for(var m=0;m").css({position:"absolute",visibility:"visible",left:-j*(g/d),top:-i*(h/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:g/d,height:h/c,left:f.left+j*(g/d)+(b.options.mode=="show"?(j-Math.floor(d/2))*(g/d):0),top:f.top+i*(h/c)+(b.options.mode=="show"?(i-Math.floor(c/2))*(h/c):0),opacity:b.options.mode=="show"?0:1}).animate({left:f.left+j*(g/d)+(b.options.mode=="show"?0:(j-Math.floor(d/2))*(g/d)),top:f.top+i*(h/c)+(b.options.mode=="show"?0:(i-Math.floor(c/2))*(h/c)),opacity:b.options.mode=="show"?1:0},b.duration||500);setTimeout(function(){b.options.mode=="show"?e.css({visibility:"visible"}):e.css({visibility:"visible"}).hide(),b.callback&&b.callback.apply(e[0]),e.dequeue(),a("div.ui-effects-explode").remove()},b.duration||500)})}})(jQuery);;/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.fade.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.fade=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"hide");c.animate({opacity:d},{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}})(jQuery);;/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.fold.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.fold=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.size||15,g=!!b.options.horizFirst,h=b.duration?b.duration/2:a.fx.speeds._default/2;a.effects.save(c,d),c.show();var i=a.effects.createWrapper(c).css({overflow:"hidden"}),j=e=="show"!=g,k=j?["width","height"]:["height","width"],l=j?[i.width(),i.height()]:[i.height(),i.width()],m=/([0-9]+)%/.exec(f);m&&(f=parseInt(m[1],10)/100*l[e=="hide"?0:1]),e=="show"&&i.css(g?{height:0,width:f}:{height:f,width:0});var n={},p={};n[k[0]]=e=="show"?l[0]:f,p[k[1]]=e=="show"?l[1]:0,i.animate(n,h,b.options.easing).animate(p,h,b.options.easing,function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}})(jQuery);;/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.highlight.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.highlight=function(b){return this.queue(function(){var c=a(this),d=["backgroundImage","backgroundColor","opacity"],e=a.effects.setMode(c,b.options.mode||"show"),f={backgroundColor:c.css("backgroundColor")};e=="hide"&&(f.opacity=0),a.effects.save(c,d),c.show().css({backgroundImage:"none",backgroundColor:b.options.color||"#ffff99"}).animate(f,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){e=="hide"&&c.hide(),a.effects.restore(c,d),e=="show"&&!a.support.opacity&&this.style.removeAttribute("filter"),b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}})(jQuery);;/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.pulsate.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.pulsate=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"show"),e=(b.options.times||5)*2-1,f=b.duration?b.duration/2:a.fx.speeds._default/2,g=c.is(":visible"),h=0;g||(c.css("opacity",0).show(),h=1),(d=="hide"&&g||d=="show"&&!g)&&e--;for(var i=0;i').appendTo(document.body).addClass(b.options.className).css({top:g.top,left:g.left,height:c.innerHeight(),width:c.innerWidth(),position:"absolute"}).animate(f,b.duration,b.options.easing,function(){h.remove(),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}})(jQuery);; \ No newline at end of file diff --git a/modules/files/views/default/assets/jquery/jquery.cookie.js b/modules/files/views/default/assets/jquery/jquery.cookie.js new file mode 100755 index 0000000..a80bfa2 --- /dev/null +++ b/modules/files/views/default/assets/jquery/jquery.cookie.js @@ -0,0 +1,97 @@ +/** + * Cookie plugin + * + * Copyright (c) 2006 Klaus Hartl (stilbuero.de) + * Dual licensed under the MIT and GPL licenses: + * http://www.opensource.org/licenses/mit-license.php + * http://www.gnu.org/licenses/gpl.html + * + */ + +/** + * Create a cookie with the given name and value and other optional parameters. + * + * @example $.cookie('the_cookie', 'the_value'); + * @desc Set the value of a cookie. + * @example $.cookie('the_cookie', 'the_value', { expires: 7, path: '/', domain: 'jquery.com', secure: true }); + * @desc Create a cookie with all available options. + * @example $.cookie('the_cookie', 'the_value'); + * @desc Create a session cookie. + * @example $.cookie('the_cookie', null); + * @desc Delete a cookie by passing null as value. Keep in mind that you have to use the same path and domain + * used when the cookie was set. + * + * @param String name The name of the cookie. + * @param String value The value of the cookie. + * @param Object options An object literal containing key/value pairs to provide optional cookie attributes. + * @option Number|Date expires Either an integer specifying the expiration date from now on in days or a Date object. + * If a negative value is specified (e.g. a date in the past), the cookie will be deleted. + * If set to null or omitted, the cookie will be a session cookie and will not be retained + * when the the browser exits. + * @option String path The value of the path atribute of the cookie (default: path of page that created the cookie). + * @option String domain The value of the domain attribute of the cookie (default: domain of page that created the cookie). + * @option Boolean secure If true, the secure attribute of the cookie will be set and the cookie transmission will + * require a secure protocol (like HTTPS). + * @type undefined + * + * @name $.cookie + * @cat Plugins/Cookie + * @author Klaus Hartl/klaus.hartl@stilbuero.de + */ + +/** + * Get the value of a cookie with the given name. + * + * @example $.cookie('the_cookie'); + * @desc Get the value of a cookie. + * + * @param String name The name of the cookie. + * @return The value of the cookie. + * @type String + * + * @name $.cookie + * @cat Plugins/Cookie + * @author Klaus Hartl/klaus.hartl@stilbuero.de + */ +jQuery.cookie = function(name, value, options) { + if (typeof value != 'undefined') { // name and value given, set cookie + options = options || {}; + if (value === null) { + value = ''; + options = $.extend({}, options); // clone object since it's unexpected behavior if the expired property were changed + options.expires = -1; + } + var expires = ''; + if (options.expires && (typeof options.expires == 'number' || options.expires.toUTCString)) { + var date; + if (typeof options.expires == 'number') { + date = new Date(); + date.setTime(date.getTime() + (options.expires * 24 * 60 * 60 * 1000)); + } else { + date = options.expires; + } + expires = '; expires=' + date.toUTCString(); // use expires attribute, max-age is not supported by IE + } + // NOTE Needed to parenthesize options.path and options.domain + // in the following expressions, otherwise they evaluate to undefined + // in the packed version for some reason... + var path = options.path ? '; path=' + (options.path) : ''; + var domain = options.domain ? '; domain=' + (options.domain) : ''; + var secure = options.secure ? '; secure' : ''; + document.cookie = [name, '=', encodeURIComponent(value), expires, path, domain, secure].join(''); + } else { // only name given, get cookie + var cookieValue = null; + if (document.cookie && document.cookie != '') { + var cookies = document.cookie.split(';'); + for (var i = 0; i < cookies.length; i++) { + var cookie = jQuery.trim(cookies[i]); + // Does this cookie string begin with the name we want? + if (cookie.substring(0, name.length + 1) == (name + '=')) { + cookieValue = decodeURIComponent(cookie.substring(name.length + 1)); + break; + } + } + } + return cookieValue; + } +}; \ No newline at end of file diff --git a/modules/files/views/default/assets/jquery/jquery.js b/modules/files/views/default/assets/jquery/jquery.js new file mode 100755 index 0000000..d4f3bb3 --- /dev/null +++ b/modules/files/views/default/assets/jquery/jquery.js @@ -0,0 +1,9440 @@ +/*! + * jQuery JavaScript Library v1.8.2 + * http://jquery.com/ + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * + * Copyright 2012 jQuery Foundation and other contributors + * Released under the MIT license + * http://jquery.org/license + * + * Date: Thu Sep 20 2012 21:13:05 GMT-0400 (Eastern Daylight Time) + */ +(function( window, undefined ) { +var + // A central reference to the root jQuery(document) + rootjQuery, + + // The deferred used on DOM ready + readyList, + + // Use the correct document accordingly with window argument (sandbox) + document = window.document, + location = window.location, + navigator = window.navigator, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // Save a reference to some core methods + core_push = Array.prototype.push, + core_slice = Array.prototype.slice, + core_indexOf = Array.prototype.indexOf, + core_toString = Object.prototype.toString, + core_hasOwn = Object.prototype.hasOwnProperty, + core_trim = String.prototype.trim, + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, + + // Used for matching numbers + core_pnum = /[\-+]?(?:\d*\.|)\d+(?:[eE][\-+]?\d+|)/.source, + + // Used for detecting and trimming whitespace + core_rnotwhite = /\S/, + core_rspace = /\s+/, + + // Make sure we trim BOM and NBSP (here's looking at you, Safari 5.0 and IE) + rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + rquickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>|)$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + rvalidescape = /\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g, + rvalidtokens = /"[^"\\\r\n]*"|true|false|null|-?(?:\d\d*\.|)\d+(?:[eE][\-+]?\d+|)/g, + + // Matches dashed string for camelizing + rmsPrefix = /^-ms-/, + rdashAlpha = /-([\da-z])/gi, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return ( letter + "" ).toUpperCase(); + }, + + // The ready event handler and self cleanup method + DOMContentLoaded = function() { + if ( document.addEventListener ) { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + } else if ( document.readyState === "complete" ) { + // we're here because readyState === "complete" in oldIE + // which is good enough for us to call the dom ready! + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + doc = ( context && context.nodeType ? context.ownerDocument || context : document ); + + // scripts is true for back-compat + selector = jQuery.parseHTML( match[1], doc, true ); + if ( rsingleTag.test( match[1] ) && jQuery.isPlainObject( context ) ) { + this.attr.call( selector, context, true ); + } + + return jQuery.merge( this, selector ); + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || rootjQuery ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if ( selector.selector !== undefined ) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.8.2", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return core_slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + ( this.selector ? " " : "" ) + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Add the callback + jQuery.ready.promise().done( fn ); + + return this; + }, + + eq: function( i ) { + i = +i; + return i === -1 ? + this.slice( i ) : + this.slice( i, i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( core_slice.apply( this, arguments ), + "slice", core_slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: core_push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger("ready").off("ready"); + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + isWindow: function( obj ) { + return obj != null && obj == obj.window; + }, + + isNumeric: function( obj ) { + return !isNaN( parseFloat(obj) ) && isFinite( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ core_toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + try { + // Not own constructor property must be Object + if ( obj.constructor && + !core_hasOwn.call(obj, "constructor") && + !core_hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + } catch ( e ) { + // IE8,9 Will throw exceptions on certain host objects #9897 + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || core_hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + var name; + for ( name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw new Error( msg ); + }, + + // data: string of html + // context (optional): If specified, the fragment will be created in this context, defaults to document + // scripts (optional): If true, will include scripts passed in the html string + parseHTML: function( data, context, scripts ) { + var parsed; + if ( !data || typeof data !== "string" ) { + return null; + } + if ( typeof context === "boolean" ) { + scripts = context; + context = 0; + } + context = context || document; + + // Single tag + if ( (parsed = rsingleTag.exec( data )) ) { + return [ context.createElement( parsed[1] ) ]; + } + + parsed = jQuery.buildFragment( [ data ], context, scripts ? null : [] ); + return jQuery.merge( [], + (parsed.cacheable ? jQuery.clone( parsed.fragment ) : parsed.fragment).childNodes ); + }, + + parseJSON: function( data ) { + if ( !data || typeof data !== "string") { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Attempt to parse using the native JSON parser first + if ( window.JSON && window.JSON.parse ) { + return window.JSON.parse( data ); + } + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test( data.replace( rvalidescape, "@" ) + .replace( rvalidtokens, "]" ) + .replace( rvalidbraces, "")) ) { + + return ( new Function( "return " + data ) )(); + + } + jQuery.error( "Invalid JSON: " + data ); + }, + + // Cross-browser xml parsing + parseXML: function( data ) { + var xml, tmp; + if ( !data || typeof data !== "string" ) { + return null; + } + try { + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + } catch( e ) { + xml = undefined; + } + if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + // Workarounds based on findings by Jim Driscoll + // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context + globalEval: function( data ) { + if ( data && core_rnotwhite.test( data ) ) { + // We use execScript on Internet Explorer + // We use an anonymous function so that context is window + // rather than jQuery in Firefox + ( window.execScript || function( data ) { + window[ "eval" ].call( window, data ); + } )( data ); + } + }, + + // Convert dashed to camelCase; used by the css and data modules + // Microsoft forgot to hump their vendor prefix (#9572) + camelCase: function( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + }, + + // args is for internal usage only + each: function( obj, callback, args ) { + var name, + i = 0, + length = obj.length, + isObj = length === undefined || jQuery.isFunction( obj ); + + if ( args ) { + if ( isObj ) { + for ( name in obj ) { + if ( callback.apply( obj[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( obj[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in obj ) { + if ( callback.call( obj[ name ], name, obj[ name ] ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.call( obj[ i ], i, obj[ i++ ] ) === false ) { + break; + } + } + } + } + + return obj; + }, + + // Use native String.trim function wherever possible + trim: core_trim && !core_trim.call("\uFEFF\xA0") ? + function( text ) { + return text == null ? + "" : + core_trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + ( text + "" ).replace( rtrim, "" ); + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var type, + ret = results || []; + + if ( arr != null ) { + // The window, strings (and functions) also have 'length' + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + type = jQuery.type( arr ); + + if ( arr.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( arr ) ) { + core_push.call( ret, arr ); + } else { + jQuery.merge( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + var len; + + if ( arr ) { + if ( core_indexOf ) { + return core_indexOf.call( arr, elem, i ); + } + + len = arr.length; + i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0; + + for ( ; i < len; i++ ) { + // Skip accessing in sparse arrays + if ( i in arr && arr[ i ] === elem ) { + return i; + } + } + } + + return -1; + }, + + merge: function( first, second ) { + var l = second.length, + i = first.length, + j = 0; + + if ( typeof l === "number" ) { + for ( ; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var retVal, + ret = [], + i = 0, + length = elems.length; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, key, + ret = [], + i = 0, + length = elems.length, + // jquery objects are treated as arrays + isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( key in elems ) { + value = callback( elems[ key ], key, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + var tmp, args, proxy; + + if ( typeof context === "string" ) { + tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + args = core_slice.call( arguments, 2 ); + proxy = function() { + return fn.apply( context, args.concat( core_slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || jQuery.guid++; + + return proxy; + }, + + // Multifunctional method to get and set values of a collection + // The value/s can optionally be executed if it's a function + access: function( elems, fn, key, value, chainable, emptyGet, pass ) { + var exec, + bulk = key == null, + i = 0, + length = elems.length; + + // Sets many values + if ( key && typeof key === "object" ) { + for ( i in key ) { + jQuery.access( elems, fn, i, key[i], 1, emptyGet, value ); + } + chainable = 1; + + // Sets one value + } else if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = pass === undefined && jQuery.isFunction( value ); + + if ( bulk ) { + // Bulk operations only iterate when executing function values + if ( exec ) { + exec = fn; + fn = function( elem, key, value ) { + return exec.call( jQuery( elem ), value ); + }; + + // Otherwise they run against the entire set + } else { + fn.call( elems, value ); + fn = null; + } + } + + if ( fn ) { + for (; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + } + + chainable = 1; + } + + return chainable ? + elems : + + // Gets + bulk ? + fn.call( elems ) : + length ? fn( elems[0], key ) : emptyGet; + }, + + now: function() { + return ( new Date() ).getTime(); + } +}); + +jQuery.ready.promise = function( obj ) { + if ( !readyList ) { + + readyList = jQuery.Deferred(); + + // Catch cases where $(document).ready() is called after the browser event has already occurred. + // we once tried to use readyState "interactive" here, but it caused issues like the one + // discovered by ChrisS here: http://bugs.jquery.com/ticket/12282#comment:15 + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + setTimeout( jQuery.ready, 1 ); + + // Standards-based browsers support DOMContentLoaded + } else if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else { + // Ensure firing before onload, maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", DOMContentLoaded ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var top = false; + + try { + top = window.frameElement == null && document.documentElement; + } catch(e) {} + + if ( top && top.doScroll ) { + (function doScrollCheck() { + if ( !jQuery.isReady ) { + + try { + // Use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + top.doScroll("left"); + } catch(e) { + return setTimeout( doScrollCheck, 50 ); + } + + // and execute any waiting functions + jQuery.ready(); + } + })(); + } + } + } + return readyList.promise( obj ); +}; + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); +// String to Object options format cache +var optionsCache = {}; + +// Convert String-formatted options into Object-formatted ones and store in cache +function createOptions( options ) { + var object = optionsCache[ options ] = {}; + jQuery.each( options.split( core_rspace ), function( _, flag ) { + object[ flag ] = true; + }); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + ( optionsCache[ options ] || createOptions( options ) ) : + jQuery.extend( {}, options ); + + var // Last fire value (for non-forgettable lists) + memory, + // Flag to know if list was already fired + fired, + // Flag to know if list is currently firing + firing, + // First callback to fire (used internally by add and fireWith) + firingStart, + // End of the loop when firing + firingLength, + // Index of currently firing callback (modified by remove if needed) + firingIndex, + // Actual callback list + list = [], + // Stack of fire calls for repeatable lists + stack = !options.once && [], + // Fire callbacks + fire = function( data ) { + memory = options.memory && data; + fired = true; + firingIndex = firingStart || 0; + firingStart = 0; + firingLength = list.length; + firing = true; + for ( ; list && firingIndex < firingLength; firingIndex++ ) { + if ( list[ firingIndex ].apply( data[ 0 ], data[ 1 ] ) === false && options.stopOnFalse ) { + memory = false; // To prevent further calls using add + break; + } + } + firing = false; + if ( list ) { + if ( stack ) { + if ( stack.length ) { + fire( stack.shift() ); + } + } else if ( memory ) { + list = []; + } else { + self.disable(); + } + } + }, + // Actual Callbacks object + self = { + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + // First, we save the current length + var start = list.length; + (function add( args ) { + jQuery.each( args, function( _, arg ) { + var type = jQuery.type( arg ); + if ( type === "function" && ( !options.unique || !self.has( arg ) ) ) { + list.push( arg ); + } else if ( arg && arg.length && type !== "string" ) { + // Inspect recursively + add( arg ); + } + }); + })( arguments ); + // Do we need to add the callbacks to the + // current firing batch? + if ( firing ) { + firingLength = list.length; + // With memory, if we're not firing then + // we should call right away + } else if ( memory ) { + firingStart = start; + fire( memory ); + } + } + return this; + }, + // Remove a callback from the list + remove: function() { + if ( list ) { + jQuery.each( arguments, function( _, arg ) { + var index; + while( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + // Handle firing indexes + if ( firing ) { + if ( index <= firingLength ) { + firingLength--; + } + if ( index <= firingIndex ) { + firingIndex--; + } + } + } + }); + } + return this; + }, + // Control if a given callback is in the list + has: function( fn ) { + return jQuery.inArray( fn, list ) > -1; + }, + // Remove all callbacks from the list + empty: function() { + list = []; + return this; + }, + // Have the list do nothing anymore + disable: function() { + list = stack = memory = undefined; + return this; + }, + // Is it disabled? + disabled: function() { + return !list; + }, + // Lock the list in its current state + lock: function() { + stack = undefined; + if ( !memory ) { + self.disable(); + } + return this; + }, + // Is it locked? + locked: function() { + return !stack; + }, + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + if ( list && ( !fired || stack ) ) { + if ( firing ) { + stack.push( args ); + } else { + fire( args ); + } + } + return this; + }, + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; +jQuery.extend({ + + Deferred: function( func ) { + var tuples = [ + // action, add listener, listener list, final state + [ "resolve", "done", jQuery.Callbacks("once memory"), "resolved" ], + [ "reject", "fail", jQuery.Callbacks("once memory"), "rejected" ], + [ "notify", "progress", jQuery.Callbacks("memory") ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + then: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + return jQuery.Deferred(function( newDefer ) { + jQuery.each( tuples, function( i, tuple ) { + var action = tuple[ 0 ], + fn = fns[ i ]; + // deferred[ done | fail | progress ] for forwarding actions to newDefer + deferred[ tuple[1] ]( jQuery.isFunction( fn ) ? + function() { + var returned = fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise() + .done( newDefer.resolve ) + .fail( newDefer.reject ) + .progress( newDefer.notify ); + } else { + newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); + } + } : + newDefer[ action ] + ); + }); + fns = null; + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Keep pipe for back-compat + promise.pipe = promise.then; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 3 ]; + + // promise[ done | fail | progress ] = list.add + promise[ tuple[1] ] = list.add; + + // Handle state + if ( stateString ) { + list.add(function() { + // state = [ resolved | rejected ] + state = stateString; + + // [ reject_list | resolve_list ].disable; progress_list.lock + }, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock ); + } + + // deferred[ resolve | reject | notify ] = list.fire + deferred[ tuple[0] ] = list.fire; + deferred[ tuple[0] + "With" ] = list.fireWith; + }); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( subordinate /* , ..., subordinateN */ ) { + var i = 0, + resolveValues = core_slice.call( arguments ), + length = resolveValues.length, + + // the count of uncompleted subordinates + remaining = length !== 1 || ( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0, + + // the master Deferred. If resolveValues consist of only a single Deferred, just use that. + deferred = remaining === 1 ? subordinate : jQuery.Deferred(), + + // Update function for both resolve and progress values + updateFunc = function( i, contexts, values ) { + return function( value ) { + contexts[ i ] = this; + values[ i ] = arguments.length > 1 ? core_slice.call( arguments ) : value; + if( values === progressValues ) { + deferred.notifyWith( contexts, values ); + } else if ( !( --remaining ) ) { + deferred.resolveWith( contexts, values ); + } + }; + }, + + progressValues, progressContexts, resolveContexts; + + // add listeners to Deferred subordinates; treat others as resolved + if ( length > 1 ) { + progressValues = new Array( length ); + progressContexts = new Array( length ); + resolveContexts = new Array( length ); + for ( ; i < length; i++ ) { + if ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) { + resolveValues[ i ].promise() + .done( updateFunc( i, resolveContexts, resolveValues ) ) + .fail( deferred.reject ) + .progress( updateFunc( i, progressContexts, progressValues ) ); + } else { + --remaining; + } + } + } + + // if we're not waiting on anything, resolve the master + if ( !remaining ) { + deferred.resolveWith( resolveContexts, resolveValues ); + } + + return deferred.promise(); + } +}); +jQuery.support = (function() { + + var support, + all, + a, + select, + opt, + input, + fragment, + eventName, + i, + isSupported, + clickFn, + div = document.createElement("div"); + + // Preliminary tests + div.setAttribute( "className", "t" ); + div.innerHTML = "
      a"; + + all = div.getElementsByTagName("*"); + a = div.getElementsByTagName("a")[ 0 ]; + a.style.cssText = "top:1px;float:left;opacity:.5"; + + // Can't get basic test support + if ( !all || !all.length ) { + return {}; + } + + // First batch of supports tests + select = document.createElement("select"); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName("input")[ 0 ]; + + support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: ( div.firstChild.nodeType === 3 ), + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText instead) + style: /top/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: ( a.getAttribute("href") === "/a" ), + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.5/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: ( input.value === "on" ), + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // Tests for enctype support on a form(#6743) + enctype: !!document.createElement("form").enctype, + + // Makes sure cloning an html5 element does not cause problems + // Where outerHTML is undefined, this still works + html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav>", + + // jQuery.support.boxModel DEPRECATED in 1.8 since we don't support Quirks Mode + boxModel: ( document.compatMode === "CSS1Compat" ), + + // Will be defined later + submitBubbles: true, + changeBubbles: true, + focusinBubbles: false, + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true, + boxSizingReliable: true, + pixelPosition: false + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { + div.attachEvent( "onclick", clickFn = function() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + support.noCloneEvent = false; + }); + div.cloneNode( true ).fireEvent("onclick"); + div.detachEvent( "onclick", clickFn ); + } + + // Check if a radio maintains its value + // after being appended to the DOM + input = document.createElement("input"); + input.value = "t"; + input.setAttribute( "type", "radio" ); + support.radioValue = input.value === "t"; + + input.setAttribute( "checked", "checked" ); + + // #11217 - WebKit loses check when the name is after the checked attribute + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + fragment = document.createDocumentFragment(); + fragment.appendChild( div.lastChild ); + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + fragment.removeChild( input ); + fragment.appendChild( div ); + + // Technique from Juriy Zaytsev + // http://perfectionkills.com/detecting-event-support-without-browser-sniffing/ + // We only care about the case where non-standard event systems + // are used, namely in IE. Short-circuiting here helps us to + // avoid an eval call (in setAttribute) which can cause CSP + // to go haywire. See: https://developer.mozilla.org/en/Security/CSP + if ( div.attachEvent ) { + for ( i in { + submit: true, + change: true, + focusin: true + }) { + eventName = "on" + i; + isSupported = ( eventName in div ); + if ( !isSupported ) { + div.setAttribute( eventName, "return;" ); + isSupported = ( typeof div[ eventName ] === "function" ); + } + support[ i + "Bubbles" ] = isSupported; + } + } + + // Run tests that need a body at doc ready + jQuery(function() { + var container, div, tds, marginDiv, + divReset = "padding:0;margin:0;border:0;display:block;overflow:hidden;", + body = document.getElementsByTagName("body")[0]; + + if ( !body ) { + // Return for frameset docs that don't have a body + return; + } + + container = document.createElement("div"); + container.style.cssText = "visibility:hidden;border:0;width:0;height:0;position:static;top:0;margin-top:1px"; + body.insertBefore( container, body.firstChild ); + + // Construct the test element + div = document.createElement("div"); + container.appendChild( div ); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + div.innerHTML = "
      t
      "; + tds = div.getElementsByTagName("td"); + tds[ 0 ].style.cssText = "padding:0;margin:0;border:0;display:none"; + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE <= 8 fail this test) + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + + // Check box-sizing and margin behavior + div.innerHTML = ""; + div.style.cssText = "box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;"; + support.boxSizing = ( div.offsetWidth === 4 ); + support.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== 1 ); + + // NOTE: To any future maintainer, we've window.getComputedStyle + // because jsdom on node.js will break without it. + if ( window.getComputedStyle ) { + support.pixelPosition = ( window.getComputedStyle( div, null ) || {} ).top !== "1%"; + support.boxSizingReliable = ( window.getComputedStyle( div, null ) || { width: "4px" } ).width === "4px"; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. For more + // info see bug #3333 + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + marginDiv = document.createElement("div"); + marginDiv.style.cssText = div.style.cssText = divReset; + marginDiv.style.marginRight = marginDiv.style.width = "0"; + div.style.width = "1px"; + div.appendChild( marginDiv ); + support.reliableMarginRight = + !parseFloat( ( window.getComputedStyle( marginDiv, null ) || {} ).marginRight ); + } + + if ( typeof div.style.zoom !== "undefined" ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.innerHTML = ""; + div.style.cssText = divReset + "width:1px;padding:1px;display:inline;zoom:1"; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 ); + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = "block"; + div.style.overflow = "visible"; + div.innerHTML = "
      "; + div.firstChild.style.width = "5px"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 3 ); + + container.style.zoom = 1; + } + + // Null elements to avoid leaks in IE + body.removeChild( container ); + container = div = tds = marginDiv = null; + }); + + // Null elements to avoid leaks in IE + fragment.removeChild( div ); + all = a = select = opt = input = fragment = div = null; + + return support; +})(); +var rbrace = /(?:\{[\s\S]*\}|\[[\s\S]*\])$/, + rmultiDash = /([A-Z])/g; + +jQuery.extend({ + cache: {}, + + deletedIds: [], + + // Remove at next major release (1.9/2.0) + uuid: 0, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, ret, + internalKey = jQuery.expando, + getByName = typeof name === "string", + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || !cache[id] || (!pvt && !cache[id].data)) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ internalKey ] = id = jQuery.deletedIds.pop() || jQuery.guid++; + } else { + id = internalKey; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // Avoids exposing jQuery metadata on plain JS objects when the object + // is serialized using JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ] = jQuery.extend( cache[ id ], name ); + } else { + cache[ id ].data = jQuery.extend( cache[ id ].data, name ); + } + } + + thisCache = cache[ id ]; + + // jQuery data() is stored in a separate object inside the object's internal data + // cache in order to avoid key collisions between internal data and user-defined + // data. + if ( !pvt ) { + if ( !thisCache.data ) { + thisCache.data = {}; + } + + thisCache = thisCache.data; + } + + if ( data !== undefined ) { + thisCache[ jQuery.camelCase( name ) ] = data; + } + + // Check for both converted-to-camel and non-converted data property names + // If a data property was specified + if ( getByName ) { + + // First Try to find as-is property data + ret = thisCache[ name ]; + + // Test for null|undefined property data + if ( ret == null ) { + + // Try to find the camelCased property + ret = thisCache[ jQuery.camelCase( name ) ]; + } + } else { + ret = thisCache; + } + + return ret; + }, + + removeData: function( elem, name, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, i, l, + + isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + id = isNode ? elem[ jQuery.expando ] : jQuery.expando; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + + thisCache = pvt ? cache[ id ] : cache[ id ].data; + + if ( thisCache ) { + + // Support array or space separated string names for data keys + if ( !jQuery.isArray( name ) ) { + + // try the string as a key before any manipulation + if ( name in thisCache ) { + name = [ name ]; + } else { + + // split the camel cased version by spaces unless a key with the spaces exists + name = jQuery.camelCase( name ); + if ( name in thisCache ) { + name = [ name ]; + } else { + name = name.split(" "); + } + } + } + + for ( i = 0, l = name.length; i < l; i++ ) { + delete thisCache[ name[i] ]; + } + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( !pvt ) { + delete cache[ id ].data; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject( cache[ id ] ) ) { + return; + } + } + + // Destroy the cache + if ( isNode ) { + jQuery.cleanData( [ elem ], true ); + + // Use delete when supported for expandos or `cache` is not a window per isWindow (#10080) + } else if ( jQuery.support.deleteExpando || cache != cache.window ) { + delete cache[ id ]; + + // When all else fails, null + } else { + cache[ id ] = null; + } + }, + + // For internal use only. + _data: function( elem, name, data ) { + return jQuery.data( elem, name, data, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + var noData = elem.nodeName && jQuery.noData[ elem.nodeName.toLowerCase() ]; + + // nodes accept data unless otherwise specified; rejection can be conditional + return !noData || noData !== true && elem.getAttribute("classid") === noData; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var parts, part, attr, name, l, + elem = this[0], + i = 0, + data = null; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = jQuery.data( elem ); + + if ( elem.nodeType === 1 && !jQuery._data( elem, "parsedAttrs" ) ) { + attr = elem.attributes; + for ( l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( !name.indexOf( "data-" ) ) { + name = jQuery.camelCase( name.substring(5) ); + + dataAttr( elem, name, data[ name ] ); + } + } + jQuery._data( elem, "parsedAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + parts = key.split( ".", 2 ); + parts[1] = parts[1] ? "." + parts[1] : ""; + part = parts[1] + "!"; + + return jQuery.access( this, function( value ) { + + if ( value === undefined ) { + data = this.triggerHandler( "getData" + part, [ parts[0] ] ); + + // Try to fetch any internally stored data first + if ( data === undefined && elem ) { + data = jQuery.data( elem, key ); + data = dataAttr( elem, key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + } + + parts[1] = value; + this.each(function() { + var self = jQuery( this ); + + self.triggerHandler( "setData" + part, parts ); + jQuery.data( this, key, value ); + self.triggerHandler( "changeData" + part, parts ); + }); + }, null, value, arguments.length > 1, null, false ); + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + + var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + // Only convert to a number if it doesn't change the string + +data + "" === data ? +data : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// checks a cache object for emptiness +function isEmptyDataObject( obj ) { + var name; + for ( name in obj ) { + + // if the public data object is empty, the private is still empty + if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) { + continue; + } + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} +jQuery.extend({ + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = jQuery._data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || jQuery.isArray(data) ) { + queue = jQuery._data( elem, type, jQuery.makeArray(data) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // not intended for public consumption - generates a queueHooks object, or returns the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return jQuery._data( elem, key ) || jQuery._data( elem, key, { + empty: jQuery.Callbacks("once memory").add(function() { + jQuery.removeData( elem, type + "queue", true ); + jQuery.removeData( elem, key, true ); + }) + }); + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[0], type ); + } + + return data === undefined ? + this : + this.each(function() { + var queue = jQuery.queue( this, type, data ); + + // ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = setTimeout( next, time ); + hooks.stop = function() { + clearTimeout( timeout ); + }; + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while( i-- ) { + tmp = jQuery._data( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +}); +var nodeHook, boolHook, fixSpecified, + rclass = /[\t\r\n]/g, + rreturn = /\r/g, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea|)$/i, + rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, + getSetAttribute = jQuery.support.getSetAttribute; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classNames, i, l, elem, + setClass, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call(this, j, this.className) ); + }); + } + + if ( value && typeof value === "string" ) { + classNames = value.split( core_rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className && classNames.length === 1 ) { + elem.className = value; + + } else { + setClass = " " + elem.className + " "; + + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + if ( setClass.indexOf( " " + classNames[ c ] + " " ) < 0 ) { + setClass += classNames[ c ] + " "; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var removes, className, elem, c, cl, i, l; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call(this, j, this.className) ); + }); + } + if ( (value && typeof value === "string") || value === undefined ) { + removes = ( value || "" ).split( core_rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + if ( elem.nodeType === 1 && elem.className ) { + + className = (" " + elem.className + " ").replace( rclass, " " ); + + // loop over each item in the removal list + for ( c = 0, cl = removes.length; c < cl; c++ ) { + // Remove until there is nothing to remove, + while ( className.indexOf(" " + removes[ c ] + " ") >= 0 ) { + className = className.replace( " " + removes[ c ] + " " , " " ); + } + } + elem.className = value ? jQuery.trim( className ) : ""; + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( core_rspace ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space separated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " ", + i = 0, + l = this.length; + for ( ; i < l; i++ ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) >= 0 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, isFunction, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return; + } + + isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var val, + self = jQuery(this); + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, i, max, option, + index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + i = one ? index : 0; + max = one ? index + 1 : options.length; + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + // Fixes Bug #2551 -- select.val() broken in IE after form.reset() + if ( one && !values.length && options.length ) { + return jQuery( options[ index ] ).val(); + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + // Unused in 1.8, left in so attrFn-stabbers won't die; remove in 1.9 + attrFn: {}, + + attr: function( elem, name, value, pass ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( pass && jQuery.isFunction( jQuery.fn[ name ] ) ) { + return jQuery( elem )[ name ]( value ); + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // All attributes are lowercase + // Grab necessary hook if one is defined + if ( notxml ) { + name = name.toLowerCase(); + hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + + } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, value + "" ); + return value; + } + + } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret === null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, value ) { + var propName, attrNames, name, isBool, + i = 0; + + if ( value && elem.nodeType === 1 ) { + + attrNames = value.split( core_rspace ); + + for ( ; i < attrNames.length; i++ ) { + name = attrNames[ i ]; + + if ( name ) { + propName = jQuery.propFix[ name ] || name; + isBool = rboolean.test( name ); + + // See #9699 for explanation of this approach (setting first, then removal) + // Do not do this for boolean attributes (see #10870) + if ( !isBool ) { + jQuery.attr( elem, name, "" ); + } + elem.removeAttribute( getSetAttribute ? name : propName ); + + // Set corresponding property to false for boolean attributes + if ( isBool && propName in elem ) { + elem[ propName ] = false; + } + } + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to it's default in case type is set after value + // This is for element creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + }, + // Use the value property for back compat + // Use the nodeHook for button elements in IE6/7 (#1954) + value: { + get: function( elem, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.get( elem, name ); + } + return name in elem ? + elem.value : + null; + }, + set: function( elem, value, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.set( elem, value, name ); + } + // Does not return so that setAttribute is also used + elem.value = value; + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return ( elem[ name ] = value ); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } +}); + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + // Align boolean attributes with corresponding properties + // Fall back to attribute presence where some booleans are not supported + var attrNode, + property = jQuery.prop( elem, name ); + return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + var propName; + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + // value is true since we know at this point it's type boolean and not false + // Set boolean attributes to the same name and set the DOM property + propName = jQuery.propFix[ name ] || name; + if ( propName in elem ) { + // Only set the IDL specifically if it already exists on the element + elem[ propName ] = true; + } + + elem.setAttribute( name, name.toLowerCase() ); + } + return name; + } +}; + +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !getSetAttribute ) { + + fixSpecified = { + name: true, + id: true, + coords: true + }; + + // Use this for any attribute in IE6/7 + // This fixes almost every IE6/7 issue + nodeHook = jQuery.valHooks.button = { + get: function( elem, name ) { + var ret; + ret = elem.getAttributeNode( name ); + return ret && ( fixSpecified[ name ] ? ret.value !== "" : ret.specified ) ? + ret.value : + undefined; + }, + set: function( elem, value, name ) { + // Set the existing or create a new attribute node + var ret = elem.getAttributeNode( name ); + if ( !ret ) { + ret = document.createAttribute( name ); + elem.setAttributeNode( ret ); + } + return ( ret.value = value + "" ); + } + }; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each([ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } + } + }); + }); + + // Set contenteditable to false on removals(#10429) + // Setting to empty string throws an error as an invalid value + jQuery.attrHooks.contenteditable = { + get: nodeHook.get, + set: function( elem, value, name ) { + if ( value === "" ) { + value = "false"; + } + nodeHook.set( elem, value, name ); + } + }; +} + + +// Some attributes require a special call on IE +if ( !jQuery.support.hrefNormalized ) { + jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + get: function( elem ) { + var ret = elem.getAttribute( name, 2 ); + return ret === null ? undefined : ret; + } + }); + }); +} + +if ( !jQuery.support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { + // Return undefined in the case of empty string + // Normalize to lowercase since IE uppercases css property names + return elem.style.cssText.toLowerCase() || undefined; + }, + set: function( elem, value ) { + return ( elem.style.cssText = value + "" ); + } + }; +} + +// Safari mis-reports the default selected property of an option +// Accessing the parent's selectedIndex property fixes it +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + return null; + } + }); +} + +// IE6/7 call enctype encoding +if ( !jQuery.support.enctype ) { + jQuery.propFix.enctype = "encoding"; +} + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); + } + } + }); +}); +var rformElems = /^(?:textarea|input|select)$/i, + rtypenamespace = /^([^\.]*|)(?:\.(.+)|)$/, + rhoverHack = /(?:^|\s)hover(\.\S+|)\b/, + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|contextmenu)|click/, + rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + hoverHack = function( events ) { + return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" ); + }; + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + add: function( elem, types, handler, data, selector ) { + + var elemData, eventHandle, events, + t, tns, type, namespaces, handleObj, + handleObjIn, handlers, special; + + // Don't attach events to noData or text/comment nodes (allow plain objects tho) + if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + events = elemData.events; + if ( !events ) { + elemData.events = events = {}; + } + eventHandle = elemData.handle; + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : + undefined; + }; + // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events + eventHandle.elem = elem; + } + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = jQuery.trim( hoverHack(types) ).split( " " ); + for ( t = 0; t < types.length; t++ ) { + + tns = rtypenamespace.exec( types[t] ) || []; + type = tns[1]; + namespaces = ( tns[2] || "" ).split( "." ).sort(); + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend({ + type: type, + origType: tns[1], + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join(".") + }, handleObjIn ); + + // Init the event handler queue if we're the first + handlers = events[ type ]; + if ( !handlers ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener/attachEvent if the special events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var t, tns, type, origType, namespaces, origCount, + j, events, special, eventType, handleObj, + elemData = jQuery.hasData( elem ) && jQuery._data( elem ); + + if ( !elemData || !(events = elemData.events) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = jQuery.trim( hoverHack( types || "" ) ).split(" "); + for ( t = 0; t < types.length; t++ ) { + tns = rtypenamespace.exec( types[t] ) || []; + type = origType = tns[1]; + namespaces = tns[2]; + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector? special.delegateType : special.bindType ) || type; + eventType = events[ type ] || []; + origCount = eventType.length; + namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.|)") + "(\\.|$)") : null; + + // Remove matching events + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !namespaces || namespaces.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) { + eventType.splice( j--, 1 ); + + if ( handleObj.selector ) { + eventType.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( eventType.length === 0 && origCount !== eventType.length ) { + if ( !special.teardown || special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + delete elemData.handle; + + // removeData also checks for emptiness and clears the expando if empty + // so use it instead of delete + jQuery.removeData( elem, "events", true ); + } + }, + + // Events that are safe to short-circuit if no handlers are attached. + // Native DOM events should not be added, they may have inline handlers. + customEvent: { + "getData": true, + "setData": true, + "changeData": true + }, + + trigger: function( event, data, elem, onlyHandlers ) { + // Don't do events on text and comment nodes + if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) { + return; + } + + // Event object or event type + var cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType, + type = event.type || event, + namespaces = []; + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "!" ) >= 0 ) { + // Exclusive events trigger only for the exact event (no namespaces) + type = type.slice(0, -1); + exclusive = true; + } + + if ( type.indexOf( "." ) >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { + // No jQuery handlers for this event type, and it can't have inline handlers + return; + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.isTrigger = true; + event.exclusive = exclusive; + event.namespace = namespaces.join( "." ); + event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") : null; + ontype = type.indexOf( ":" ) < 0 ? "on" + type : ""; + + // Handle a global trigger + if ( !elem ) { + + // TODO: Stop taunting the data cache; remove global events and always attach to document + cache = jQuery.cache; + for ( i in cache ) { + if ( cache[ i ].events && cache[ i ].events[ type ] ) { + jQuery.event.trigger( event, data, cache[ i ].handle.elem, true ); + } + } + return; + } + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data != null ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + eventPath = [[ elem, special.bindType || type ]]; + if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode; + for ( old = elem; cur; cur = cur.parentNode ) { + eventPath.push([ cur, bubbleType ]); + old = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( old === (elem.ownerDocument || document) ) { + eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]); + } + } + + // Fire handlers on the event path + for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) { + + cur = eventPath[i][0]; + event.type = eventPath[i][1]; + + handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + // Note that this is a bare JS function and not a jQuery handler + handle = ontype && cur[ ontype ]; + if ( handle && jQuery.acceptData( cur ) && handle.apply && handle.apply( cur, data ) === false ) { + event.preventDefault(); + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Can't use an .isFunction() check here because IE6/7 fails that test. + // Don't do default actions on window, that's where global variables be (#6170) + // IE<9 dies on focus/blur to hidden element (#1486) + if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + elem[ type ](); + jQuery.event.triggered = undefined; + + if ( old ) { + elem[ ontype ] = old; + } + } + } + } + + return event.result; + }, + + dispatch: function( event ) { + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( event || window.event ); + + var i, j, cur, ret, selMatch, matched, matches, handleObj, sel, related, + handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []), + delegateCount = handlers.delegateCount, + args = core_slice.call( arguments ), + run_all = !event.exclusive && !event.namespace, + special = jQuery.event.special[ event.type ] || {}, + handlerQueue = []; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[0] = event; + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers that should run if there are delegated events + // Avoid non-left-click bubbling in Firefox (#3861) + if ( delegateCount && !(event.button && event.type === "click") ) { + + for ( cur = event.target; cur != this; cur = cur.parentNode || this ) { + + // Don't process clicks (ONLY) on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.disabled !== true || event.type !== "click" ) { + selMatch = {}; + matches = []; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + sel = handleObj.selector; + + if ( selMatch[ sel ] === undefined ) { + selMatch[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) >= 0 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( selMatch[ sel ] ) { + matches.push( handleObj ); + } + } + if ( matches.length ) { + handlerQueue.push({ elem: cur, matches: matches }); + } + } + } + } + + // Add the remaining (directly-bound) handlers + if ( handlers.length > delegateCount ) { + handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) }); + } + + // Run delegates first; they may want to stop propagation beneath us + for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) { + matched = handlerQueue[ i ]; + event.currentTarget = matched.elem; + + for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) { + handleObj = matched.matches[ j ]; + + // Triggered event must either 1) be non-exclusive and have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). + if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) { + + event.data = handleObj.data; + event.handleObj = handleObj; + + ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler ) + .apply( matched.elem, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + // Includes some event props shared by KeyEvent and MouseEvent + // *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 *** + props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), + + fixHooks: {}, + + keyHooks: { + props: "char charCode key keyCode".split(" "), + filter: function( event, original ) { + + // Add which for key events + if ( event.which == null ) { + event.which = original.charCode != null ? original.charCode : original.keyCode; + } + + return event; + } + }, + + mouseHooks: { + props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "), + filter: function( event, original ) { + var eventDoc, doc, body, + button = original.button, + fromElement = original.fromElement; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && original.clientX != null ) { + eventDoc = event.target.ownerDocument || document; + doc = eventDoc.documentElement; + body = eventDoc.body; + + event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); + event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && fromElement ) { + event.relatedTarget = fromElement === event.target ? original.toElement : fromElement; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && button !== undefined ) { + event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) ); + } + + return event; + } + }, + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // Create a writable copy of the event object and normalize some properties + var i, prop, + originalEvent = event, + fixHook = jQuery.event.fixHooks[ event.type ] || {}, + copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; + + event = jQuery.Event( originalEvent ); + + for ( i = copy.length; i; ) { + prop = copy[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary (#1925, IE 6/7/8 & Safari2) + if ( !event.target ) { + event.target = originalEvent.srcElement || document; + } + + // Target should not be a text node (#504, Safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // For mouse/key events, metaKey==false if it's undefined (#3368, #11328; IE6/7/8) + event.metaKey = !!event.metaKey; + + return fixHook.filter? fixHook.filter( event, originalEvent ) : event; + }, + + special: { + load: { + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + + focus: { + delegateType: "focusin" + }, + blur: { + delegateType: "focusout" + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + }, + + simulate: function( type, elem, event, bubble ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + var e = jQuery.extend( + new jQuery.Event(), + event, + { type: type, + isSimulated: true, + originalEvent: {} + } + ); + if ( bubble ) { + jQuery.event.trigger( e, null, elem ); + } else { + jQuery.event.dispatch.call( elem, e ); + } + if ( e.isDefaultPrevented() ) { + event.preventDefault(); + } + } +}; + +// Some plugins are using, but it's undocumented/deprecated and will be removed. +// The 1.7 special event interface should provide all the hooks needed now. +jQuery.event.handle = jQuery.event.dispatch; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + var name = "on" + type; + + if ( elem.detachEvent ) { + + // #8545, #7054, preventing memory leaks for custom events in IE6-8 – + // detachEvent needed property on element, by name of that event, to properly expose it to GC + if ( typeof elem[ name ] === "undefined" ) { + elem[ name ] = null; + } + + elem.detachEvent( name, handle ); + } + }; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !(this instanceof jQuery.Event) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Create mouseenter/leave events using mouseover/out and event-time checks +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj, + selector = handleObj.selector; + + // For mousenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || (related !== target && !jQuery.contains( target, related )) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +}); + +// IE submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Lazy-add a submit handler when a descendant form may potentially be submitted + jQuery.event.add( this, "click._submit keypress._submit", function( e ) { + // Node name check avoids a VML-related crash in IE (#9807) + var elem = e.target, + form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined; + if ( form && !jQuery._data( form, "_submit_attached" ) ) { + jQuery.event.add( form, "submit._submit", function( event ) { + event._submit_bubble = true; + }); + jQuery._data( form, "_submit_attached", true ); + } + }); + // return undefined since we don't need an event listener + }, + + postDispatch: function( event ) { + // If form was submitted by the user, bubble the event up the tree + if ( event._submit_bubble ) { + delete event._submit_bubble; + if ( this.parentNode && !event.isTrigger ) { + jQuery.event.simulate( "submit", this.parentNode, event, true ); + } + } + }, + + teardown: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Remove delegated handlers; cleanData eventually reaps submit handlers attached above + jQuery.event.remove( this, "._submit" ); + } + }; +} + +// IE change delegation and checkbox/radio fix +if ( !jQuery.support.changeBubbles ) { + + jQuery.event.special.change = { + + setup: function() { + + if ( rformElems.test( this.nodeName ) ) { + // IE doesn't fire change on a check/radio until blur; trigger it on click + // after a propertychange. Eat the blur-change in special.change.handle. + // This still fires onchange a second time for check/radio after blur. + if ( this.type === "checkbox" || this.type === "radio" ) { + jQuery.event.add( this, "propertychange._change", function( event ) { + if ( event.originalEvent.propertyName === "checked" ) { + this._just_changed = true; + } + }); + jQuery.event.add( this, "click._change", function( event ) { + if ( this._just_changed && !event.isTrigger ) { + this._just_changed = false; + } + // Allow triggered, simulated change events (#11500) + jQuery.event.simulate( "change", this, event, true ); + }); + } + return false; + } + // Delegated event; lazy-add a change handler on descendant inputs + jQuery.event.add( this, "beforeactivate._change", function( e ) { + var elem = e.target; + + if ( rformElems.test( elem.nodeName ) && !jQuery._data( elem, "_change_attached" ) ) { + jQuery.event.add( elem, "change._change", function( event ) { + if ( this.parentNode && !event.isSimulated && !event.isTrigger ) { + jQuery.event.simulate( "change", this.parentNode, event, true ); + } + }); + jQuery._data( elem, "_change_attached", true ); + } + }); + }, + + handle: function( event ) { + var elem = event.target; + + // Swallow native change events from checkbox/radio, we already triggered them above + if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) { + return event.handleObj.handler.apply( this, arguments ); + } + }, + + teardown: function() { + jQuery.event.remove( this, "._change" ); + + return !rformElems.test( this.nodeName ); + } + }; +} + +// Create "bubbling" focus and blur events +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0, + handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + }); +} + +jQuery.fn.extend({ + + on: function( types, selector, data, fn, /*INTERNAL*/ one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { // && selector != null + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + this.on( type, selector, data, types[ type ], one ); + } + return this; + } + + if ( data == null && fn == null ) { + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return this; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return this.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + }); + }, + one: function( types, selector, data, fn ) { + return this.on( types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each(function() { + jQuery.event.remove( this, types, fn, selector ); + }); + }, + + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + live: function( types, data, fn ) { + jQuery( this.context ).on( types, this.selector, data, fn ); + return this; + }, + die: function( types, fn ) { + jQuery( this.context ).off( types, this.selector || "**", fn ); + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.on( types, selector, data, fn ); + }, + undelegate: function( selector, types, fn ) { + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length === 1 ? this.off( selector, "**" ) : this.off( types, selector || "**", fn ); + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + guid = fn.guid || jQuery.guid++, + i = 0, + toggler = function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + }; + + // link all the functions, so any of them can unbind this click handler + toggler.guid = guid; + while ( i < args.length ) { + args[ i++ ].guid = guid; + } + + return this.click( toggler ); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.on( name, null, data, fn ) : + this.trigger( name ); + }; + + if ( rkeyEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks; + } + + if ( rmouseEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks; + } +}); +/*! + * Sizzle CSS Selector Engine + * Copyright 2012 jQuery Foundation and other contributors + * Released under the MIT license + * http://sizzlejs.com/ + */ +(function( window, undefined ) { + +var cachedruns, + assertGetIdNotName, + Expr, + getText, + isXML, + contains, + compile, + sortOrder, + hasDuplicate, + outermostContext, + + baseHasDuplicate = true, + strundefined = "undefined", + + expando = ( "sizcache" + Math.random() ).replace( ".", "" ), + + Token = String, + document = window.document, + docElem = document.documentElement, + dirruns = 0, + done = 0, + pop = [].pop, + push = [].push, + slice = [].slice, + // Use a stripped-down indexOf if a native one is unavailable + indexOf = [].indexOf || function( elem ) { + var i = 0, + len = this.length; + for ( ; i < len; i++ ) { + if ( this[i] === elem ) { + return i; + } + } + return -1; + }, + + // Augment a function for special use by Sizzle + markFunction = function( fn, value ) { + fn[ expando ] = value == null || value; + return fn; + }, + + createCache = function() { + var cache = {}, + keys = []; + + return markFunction(function( key, value ) { + // Only keep the most recent entries + if ( keys.push( key ) > Expr.cacheLength ) { + delete cache[ keys.shift() ]; + } + + return (cache[ key ] = value); + }, cache ); + }, + + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + + // Regex + + // Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + // http://www.w3.org/TR/css3-syntax/#characters + characterEncoding = "(?:\\\\.|[-\\w]|[^\\x00-\\xa0])+", + + // Loosely modeled on CSS identifier characters + // An unquoted value should be a CSS identifier (http://www.w3.org/TR/css3-selectors/#attribute-selectors) + // Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier + identifier = characterEncoding.replace( "w", "w#" ), + + // Acceptable operators http://www.w3.org/TR/selectors/#attribute-selectors + operators = "([*^$|!~]?=)", + attributes = "\\[" + whitespace + "*(" + characterEncoding + ")" + whitespace + + "*(?:" + operators + whitespace + "*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|(" + identifier + ")|)|)" + whitespace + "*\\]", + + // Prefer arguments not in parens/brackets, + // then attribute selectors and non-pseudos (denoted by :), + // then anything else + // These preferences are here to reduce the number of selectors + // needing tokenize in the PSEUDO preFilter + pseudos = ":(" + characterEncoding + ")(?:\\((?:(['\"])((?:\\\\.|[^\\\\])*?)\\2|([^()[\\]]*|(?:(?:" + attributes + ")|[^:]|\\\\.)*|.*))\\)|)", + + // For matchExpr.POS and matchExpr.needsContext + pos = ":(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace + + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rcombinators = new RegExp( "^" + whitespace + "*([\\x20\\t\\r\\n\\f>+~])" + whitespace + "*" ), + rpseudo = new RegExp( pseudos ), + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w\-]+)|(\w+)|\.([\w\-]+))$/, + + rnot = /^:not/, + rsibling = /[\x20\t\r\n\f]*[+~]/, + rendsWithNot = /:not\($/, + + rheader = /h\d/i, + rinputs = /input|select|textarea|button/i, + + rbackslash = /\\(?!\\)/g, + + matchExpr = { + "ID": new RegExp( "^#(" + characterEncoding + ")" ), + "CLASS": new RegExp( "^\\.(" + characterEncoding + ")" ), + "NAME": new RegExp( "^\\[name=['\"]?(" + characterEncoding + ")['\"]?\\]" ), + "TAG": new RegExp( "^(" + characterEncoding.replace( "w", "w*" ) + ")" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "POS": new RegExp( pos, "i" ), + "CHILD": new RegExp( "^:(only|nth|first|last)-child(?:\\(" + whitespace + + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace + + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + // For use in libraries implementing .is() + "needsContext": new RegExp( "^" + whitespace + "*[>+~]|" + pos, "i" ) + }, + + // Support + + // Used for testing something on an element + assert = function( fn ) { + var div = document.createElement("div"); + + try { + return fn( div ); + } catch (e) { + return false; + } finally { + // release memory in IE + div = null; + } + }, + + // Check if getElementsByTagName("*") returns only elements + assertTagNameNoComments = assert(function( div ) { + div.appendChild( document.createComment("") ); + return !div.getElementsByTagName("*").length; + }), + + // Check if getAttribute returns normalized href attributes + assertHrefNotNormalized = assert(function( div ) { + div.innerHTML = ""; + return div.firstChild && typeof div.firstChild.getAttribute !== strundefined && + div.firstChild.getAttribute("href") === "#"; + }), + + // Check if attributes should be retrieved by attribute nodes + assertAttributes = assert(function( div ) { + div.innerHTML = ""; + var type = typeof div.lastChild.getAttribute("multiple"); + // IE8 returns a string for some attributes even when not present + return type !== "boolean" && type !== "string"; + }), + + // Check if getElementsByClassName can be trusted + assertUsableClassName = assert(function( div ) { + // Opera can't find a second classname (in 9.6) + div.innerHTML = ""; + if ( !div.getElementsByClassName || !div.getElementsByClassName("e").length ) { + return false; + } + + // Safari 3.2 caches class attributes and doesn't catch changes + div.lastChild.className = "e"; + return div.getElementsByClassName("e").length === 2; + }), + + // Check if getElementById returns elements by name + // Check if getElementsByName privileges form controls or returns elements by ID + assertUsableName = assert(function( div ) { + // Inject content + div.id = expando + 0; + div.innerHTML = "
      "; + docElem.insertBefore( div, docElem.firstChild ); + + // Test + var pass = document.getElementsByName && + // buggy browsers will return fewer than the correct 2 + document.getElementsByName( expando ).length === 2 + + // buggy browsers will return more than the correct 0 + document.getElementsByName( expando + 0 ).length; + assertGetIdNotName = !document.getElementById( expando ); + + // Cleanup + docElem.removeChild( div ); + + return pass; + }); + +// If slice is not available, provide a backup +try { + slice.call( docElem.childNodes, 0 )[0].nodeType; +} catch ( e ) { + slice = function( i ) { + var elem, + results = []; + for ( ; (elem = this[i]); i++ ) { + results.push( elem ); + } + return results; + }; +} + +function Sizzle( selector, context, results, seed ) { + results = results || []; + context = context || document; + var match, elem, xml, m, + nodeType = context.nodeType; + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + if ( nodeType !== 1 && nodeType !== 9 ) { + return []; + } + + xml = isXML( context ); + + if ( !xml && !seed ) { + if ( (match = rquickExpr.exec( selector )) ) { + // Speed-up: Sizzle("#ID") + if ( (m = match[1]) ) { + if ( nodeType === 9 ) { + elem = context.getElementById( m ); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE, Opera, and Webkit return items + // by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + } else { + // Context is not a document + if ( context.ownerDocument && (elem = context.ownerDocument.getElementById( m )) && + contains( context, elem ) && elem.id === m ) { + results.push( elem ); + return results; + } + } + + // Speed-up: Sizzle("TAG") + } else if ( match[2] ) { + push.apply( results, slice.call(context.getElementsByTagName( selector ), 0) ); + return results; + + // Speed-up: Sizzle(".CLASS") + } else if ( (m = match[3]) && assertUsableClassName && context.getElementsByClassName ) { + push.apply( results, slice.call(context.getElementsByClassName( m ), 0) ); + return results; + } + } + } + + // All others + return select( selector.replace( rtrim, "$1" ), context, results, seed, xml ); +} + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + return Sizzle( expr, null, null, [ elem ] ).length > 0; +}; + +// Returns a function to use in pseudos for input types +function createInputPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; +} + +// Returns a function to use in pseudos for buttons +function createButtonPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && elem.type === type; + }; +} + +// Returns a function to use in pseudos for positionals +function createPositionalPseudo( fn ) { + return markFunction(function( argument ) { + argument = +argument; + return markFunction(function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ (j = matchIndexes[i]) ] ) { + seed[j] = !(matches[j] = seed[j]); + } + } + }); + }); +} + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( nodeType ) { + if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + // Use textContent for elements + // innerText usage removed for consistency of new lines (see #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + // Do not include comment or processing instruction nodes + } else { + + // If no nodeType, this is expected to be an array + for ( ; (node = elem[i]); i++ ) { + // Do not traverse comment nodes + ret += getText( node ); + } + } + return ret; +}; + +isXML = Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = elem && (elem.ownerDocument || elem).documentElement; + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +// Element contains another +contains = Sizzle.contains = docElem.contains ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && adown.contains && adown.contains(bup) ); + } : + docElem.compareDocumentPosition ? + function( a, b ) { + return b && !!( a.compareDocumentPosition( b ) & 16 ); + } : + function( a, b ) { + while ( (b = b.parentNode) ) { + if ( b === a ) { + return true; + } + } + return false; + }; + +Sizzle.attr = function( elem, name ) { + var val, + xml = isXML( elem ); + + if ( !xml ) { + name = name.toLowerCase(); + } + if ( (val = Expr.attrHandle[ name ]) ) { + return val( elem ); + } + if ( xml || assertAttributes ) { + return elem.getAttribute( name ); + } + val = elem.getAttributeNode( name ); + return val ? + typeof elem[ name ] === "boolean" ? + elem[ name ] ? name : null : + val.specified ? val.value : null : + null; +}; + +Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + // IE6/7 return a modified href + attrHandle: assertHrefNotNormalized ? + {} : + { + "href": function( elem ) { + return elem.getAttribute( "href", 2 ); + }, + "type": function( elem ) { + return elem.getAttribute("type"); + } + }, + + find: { + "ID": assertGetIdNotName ? + function( id, context, xml ) { + if ( typeof context.getElementById !== strundefined && !xml ) { + var m = context.getElementById( id ); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + } : + function( id, context, xml ) { + if ( typeof context.getElementById !== strundefined && !xml ) { + var m = context.getElementById( id ); + + return m ? + m.id === id || typeof m.getAttributeNode !== strundefined && m.getAttributeNode("id").value === id ? + [m] : + undefined : + []; + } + }, + + "TAG": assertTagNameNoComments ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== strundefined ) { + return context.getElementsByTagName( tag ); + } + } : + function( tag, context ) { + var results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + var elem, + tmp = [], + i = 0; + + for ( ; (elem = results[i]); i++ ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + }, + + "NAME": assertUsableName && function( tag, context ) { + if ( typeof context.getElementsByName !== strundefined ) { + return context.getElementsByName( name ); + } + }, + + "CLASS": assertUsableClassName && function( className, context, xml ) { + if ( typeof context.getElementsByClassName !== strundefined && !xml ) { + return context.getElementsByClassName( className ); + } + } + }, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[1] = match[1].replace( rbackslash, "" ); + + // Move the given value to match[3] whether quoted or unquoted + match[3] = ( match[4] || match[5] || "" ).replace( rbackslash, "" ); + + if ( match[2] === "~=" ) { + match[3] = " " + match[3] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 3 xn-component of xn+y argument ([+-]?\d*n|) + 4 sign of xn-component + 5 x of xn-component + 6 sign of y-component + 7 y of y-component + */ + match[1] = match[1].toLowerCase(); + + if ( match[1] === "nth" ) { + // nth-child requires argument + if ( !match[2] ) { + Sizzle.error( match[0] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[3] = +( match[3] ? match[4] + (match[5] || 1) : 2 * ( match[2] === "even" || match[2] === "odd" ) ); + match[4] = +( ( match[6] + match[7] ) || match[2] === "odd" ); + + // other types prohibit arguments + } else if ( match[2] ) { + Sizzle.error( match[0] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var unquoted, excess; + if ( matchExpr["CHILD"].test( match[0] ) ) { + return null; + } + + if ( match[3] ) { + match[2] = match[3]; + } else if ( (unquoted = match[4]) ) { + // Only check arguments that contain a pseudo + if ( rpseudo.test(unquoted) && + // Get excess from tokenize (recursively) + (excess = tokenize( unquoted, true )) && + // advance to the next closing parenthesis + (excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) { + + // excess is a negative index + unquoted = unquoted.slice( 0, excess ); + match[0] = match[0].slice( 0, excess ); + } + match[2] = unquoted; + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + "ID": assertGetIdNotName ? + function( id ) { + id = id.replace( rbackslash, "" ); + return function( elem ) { + return elem.getAttribute("id") === id; + }; + } : + function( id ) { + id = id.replace( rbackslash, "" ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== strundefined && elem.getAttributeNode("id"); + return node && node.value === id; + }; + }, + + "TAG": function( nodeName ) { + if ( nodeName === "*" ) { + return function() { return true; }; + } + nodeName = nodeName.replace( rbackslash, "" ).toLowerCase(); + + return function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ expando ][ className ]; + if ( !pattern ) { + pattern = classCache( className, new RegExp("(^|" + whitespace + ")" + className + "(" + whitespace + "|$)") ); + } + return function( elem ) { + return pattern.test( elem.className || (typeof elem.getAttribute !== strundefined && elem.getAttribute("class")) || "" ); + }; + }, + + "ATTR": function( name, operator, check ) { + return function( elem, context ) { + var result = Sizzle.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf( check ) === 0 : + operator === "*=" ? check && result.indexOf( check ) > -1 : + operator === "$=" ? check && result.substr( result.length - check.length ) === check : + operator === "~=" ? ( " " + result + " " ).indexOf( check ) > -1 : + operator === "|=" ? result === check || result.substr( 0, check.length + 1 ) === check + "-" : + false; + }; + }, + + "CHILD": function( type, argument, first, last ) { + + if ( type === "nth" ) { + return function( elem ) { + var node, diff, + parent = elem.parentNode; + + if ( first === 1 && last === 0 ) { + return true; + } + + if ( parent ) { + diff = 0; + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + diff++; + if ( elem === node ) { + break; + } + } + } + } + + // Incorporate the offset (or cast to NaN), then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + }; + } + + return function( elem ) { + var node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + /* falls through */ + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + } + }; + }, + + "PSEUDO": function( pseudo, argument ) { + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + Sizzle.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction(function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf.call( seed, matched[i] ); + seed[ idx ] = !( matches[ idx ] = matched[i] ); + } + }) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + "not": markFunction(function( selector ) { + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrim, "$1" ) ); + + return matcher[ expando ] ? + markFunction(function( seed, matches, context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( (elem = unmatched[i]) ) { + seed[i] = !(matches[i] = elem); + } + } + }) : + function( elem, context, xml ) { + input[0] = elem; + matcher( input, null, xml, results ); + return !results.pop(); + }; + }), + + "has": markFunction(function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + }), + + "contains": markFunction(function( text ) { + return function( elem ) { + return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1; + }; + }), + + "enabled": function( elem ) { + return elem.disabled === false; + }, + + "disabled": function( elem ) { + return elem.disabled === true; + }, + + "checked": function( elem ) { + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected); + }, + + "selected": function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + "parent": function( elem ) { + return !Expr.pseudos["empty"]( elem ); + }, + + "empty": function( elem ) { + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is only affected by element nodes and content nodes(including text(3), cdata(4)), + // not comment, processing instructions, or others + // Thanks to Diego Perini for the nodeName shortcut + // Greater than "@" means alpha characters (specifically not starting with "#" or "?") + var nodeType; + elem = elem.firstChild; + while ( elem ) { + if ( elem.nodeName > "@" || (nodeType = elem.nodeType) === 3 || nodeType === 4 ) { + return false; + } + elem = elem.nextSibling; + } + return true; + }, + + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "text": function( elem ) { + var type, attr; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && + (type = elem.type) === "text" && + ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === type ); + }, + + // Input types + "radio": createInputPseudo("radio"), + "checkbox": createInputPseudo("checkbox"), + "file": createInputPseudo("file"), + "password": createInputPseudo("password"), + "image": createInputPseudo("image"), + + "submit": createButtonPseudo("submit"), + "reset": createButtonPseudo("reset"), + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "focus": function( elem ) { + var doc = elem.ownerDocument; + return elem === doc.activeElement && (!doc.hasFocus || doc.hasFocus()) && !!(elem.type || elem.href); + }, + + "active": function( elem ) { + return elem === elem.ownerDocument.activeElement; + }, + + // Positional types + "first": createPositionalPseudo(function( matchIndexes, length, argument ) { + return [ 0 ]; + }), + + "last": createPositionalPseudo(function( matchIndexes, length, argument ) { + return [ length - 1 ]; + }), + + "eq": createPositionalPseudo(function( matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + }), + + "even": createPositionalPseudo(function( matchIndexes, length, argument ) { + for ( var i = 0; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "odd": createPositionalPseudo(function( matchIndexes, length, argument ) { + for ( var i = 1; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "lt": createPositionalPseudo(function( matchIndexes, length, argument ) { + for ( var i = argument < 0 ? argument + length : argument; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "gt": createPositionalPseudo(function( matchIndexes, length, argument ) { + for ( var i = argument < 0 ? argument + length : argument; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }) + } +}; + +function siblingCheck( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; +} + +sortOrder = docElem.compareDocumentPosition ? + function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + return ( !a.compareDocumentPosition || !b.compareDocumentPosition ? + a.compareDocumentPosition : + a.compareDocumentPosition(b) & 4 + ) ? -1 : 1; + } : + function( a, b ) { + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Fallback to using sourceIndex (in IE) if it's available on both nodes + } else if ( a.sourceIndex && b.sourceIndex ) { + return a.sourceIndex - b.sourceIndex; + } + + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // If the nodes are siblings (or identical) we can do a quick check + if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + +// Always assume the presence of duplicates if sort doesn't +// pass them to our comparison function (as in Google Chrome). +[0, 0].sort( sortOrder ); +baseHasDuplicate = !hasDuplicate; + +// Document sorting and removing duplicates +Sizzle.uniqueSort = function( results ) { + var elem, + i = 1; + + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( ; (elem = results[i]); i++ ) { + if ( elem === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + + return results; +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +function tokenize( selector, parseOnly ) { + var matched, match, tokens, type, soFar, groups, preFilters, + cached = tokenCache[ expando ][ selector ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || (match = rcomma.exec( soFar )) ) { + if ( match ) { + soFar = soFar.slice( match[0].length ); + } + groups.push( tokens = [] ); + } + + matched = false; + + // Combinators + if ( (match = rcombinators.exec( soFar )) ) { + tokens.push( matched = new Token( match.shift() ) ); + soFar = soFar.slice( matched.length ); + + // Cast descendant combinators to space + matched.type = match[0].replace( rtrim, " " ); + } + + // Filters + for ( type in Expr.filter ) { + if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] || + // The last two arguments here are (context, xml) for backCompat + (match = preFilters[ type ]( match, document, true ))) ) { + + tokens.push( matched = new Token( match.shift() ) ); + soFar = soFar.slice( matched.length ); + matched.type = type; + matched.matches = match; + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error( selector ) : + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + checkNonElements = base && combinator.dir === "parentNode", + doneName = done++; + + return combinator.first ? + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( (elem = elem[ dir ]) ) { + if ( checkNonElements || elem.nodeType === 1 ) { + return matcher( elem, context, xml ); + } + } + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + // We can't set arbitrary data on XML nodes, so they don't benefit from dir caching + if ( !xml ) { + var cache, + dirkey = dirruns + " " + doneName + " ", + cachedkey = dirkey + cachedruns; + while ( (elem = elem[ dir ]) ) { + if ( checkNonElements || elem.nodeType === 1 ) { + if ( (cache = elem[ expando ]) === cachedkey ) { + return elem.sizset; + } else if ( typeof cache === "string" && cache.indexOf(dirkey) === 0 ) { + if ( elem.sizset ) { + return elem; + } + } else { + elem[ expando ] = cachedkey; + if ( matcher( elem, context, xml ) ) { + elem.sizset = true; + return elem; + } + elem.sizset = false; + } + } + } + } else { + while ( (elem = elem[ dir ]) ) { + if ( checkNonElements || elem.nodeType === 1 ) { + if ( matcher( elem, context, xml ) ) { + return elem; + } + } + } + } + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[i]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[0]; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( (elem = unmatched[i]) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction(function( seed, results, context, xml ) { + // Positional selectors apply to seed elements, so it is invalid to follow them with relative ones + if ( seed && postFinder ) { + return; + } + + var i, elem, postFilterIn, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [], seed ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems, + + matcherOut = matcher ? + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if ( matcher ) { + matcher( matcherIn, matcherOut, context, xml ); + } + + // Apply postFilter + if ( postFilter ) { + postFilterIn = condense( matcherOut, postMap ); + postFilter( postFilterIn, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = postFilterIn.length; + while ( i-- ) { + if ( (elem = postFilterIn[i]) ) { + matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem); + } + } + } + + // Keep seed and results synchronized + if ( seed ) { + // Ignore postFinder because it can't coexist with seed + i = preFilter && matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) ) { + seed[ preMap[i] ] = !(results[ preMap[i] ] = elem); + } + } + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + }); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[0].type ], + implicitRelative = leadingRelative || Expr.relative[" "], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf.call( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + return ( !leadingRelative && ( xml || context !== outermostContext ) ) || ( + (checkContext = context).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + } ]; + + for ( ; i < len; i++ ) { + if ( (matcher = Expr.relative[ tokens[i].type ]) ) { + matchers = [ addCombinator( elementMatcher( matchers ), matcher ) ]; + } else { + // The concatenated values are (context, xml) for backCompat + matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[j].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && tokens.slice( 0, i - 1 ).join("").replace( rtrim, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( (tokens = tokens.slice( j )) ), + j < len && tokens.join("") + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + var bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, expandContext ) { + var elem, j, matcher, + setMatched = [], + matchedCount = 0, + i = "0", + unmatched = seed && [], + outermost = expandContext != null, + contextBackup = outermostContext, + // We must always have either seed elements or context + elems = seed || byElement && Expr.find["TAG"]( "*", expandContext && context.parentNode || context ), + // Nested matchers should use non-integer dirruns + dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.E); + + if ( outermost ) { + outermostContext = context !== document && context; + cachedruns = superMatcher.el; + } + + // Add elements passing elementMatchers directly to results + for ( ; (elem = elems[i]) != null; i++ ) { + if ( byElement && elem ) { + for ( j = 0; (matcher = elementMatchers[j]); j++ ) { + if ( matcher( elem, context, xml ) ) { + results.push( elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + cachedruns = ++superMatcher.el; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + // They will have gone through all possible matchers + if ( (elem = !matcher && elem) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // Apply set filters to unmatched elements + matchedCount += i; + if ( bySet && i !== matchedCount ) { + for ( j = 0; (matcher = setMatchers[j]); j++ ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !(unmatched[i] || setMatched[i]) ) { + setMatched[i] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + Sizzle.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + superMatcher.el = 0; + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +compile = Sizzle.compile = function( selector, group /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ expando ][ selector ]; + + if ( !cached ) { + // Generate a function of recursive functions that can be used to check each element + if ( !group ) { + group = tokenize( selector ); + } + i = group.length; + while ( i-- ) { + cached = matcherFromTokens( group[i] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) ); + } + return cached; +}; + +function multipleContexts( selector, contexts, results, seed ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[i], results, seed ); + } + return results; +} + +function select( selector, context, results, seed, xml ) { + var i, tokens, token, type, find, + match = tokenize( selector ), + j = match.length; + + if ( !seed ) { + // Try to minimize operations if there is only one group + if ( match.length === 1 ) { + + // Take a shortcut and set the context if the root selector is an ID + tokens = match[0] = match[0].slice( 0 ); + if ( tokens.length > 2 && (token = tokens[0]).type === "ID" && + context.nodeType === 9 && !xml && + Expr.relative[ tokens[1].type ] ) { + + context = Expr.find["ID"]( token.matches[0].replace( rbackslash, "" ), context, xml )[0]; + if ( !context ) { + return results; + } + + selector = selector.slice( tokens.shift().length ); + } + + // Fetch a seed set for right-to-left matching + for ( i = matchExpr["POS"].test( selector ) ? -1 : tokens.length - 1; i >= 0; i-- ) { + token = tokens[i]; + + // Abort if we hit a combinator + if ( Expr.relative[ (type = token.type) ] ) { + break; + } + if ( (find = Expr.find[ type ]) ) { + // Search, expanding context for leading sibling combinators + if ( (seed = find( + token.matches[0].replace( rbackslash, "" ), + rsibling.test( tokens[0].type ) && context.parentNode || context, + xml + )) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && tokens.join(""); + if ( !selector ) { + push.apply( results, slice.call( seed, 0 ) ); + return results; + } + + break; + } + } + } + } + } + + // Compile and execute a filtering function + // Provide `match` to avoid retokenization if we modified the selector above + compile( selector, match )( + seed, + context, + xml, + results, + rsibling.test( selector ) + ); + return results; +} + +if ( document.querySelectorAll ) { + (function() { + var disconnectedMatch, + oldSelect = select, + rescape = /'|\\/g, + rattributeQuotes = /\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g, + + // qSa(:focus) reports false when true (Chrome 21), + // A support test would require too much code (would include document ready) + rbuggyQSA = [":focus"], + + // matchesSelector(:focus) reports false when true (Chrome 21), + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + // A support test would require too much code (would include document ready) + // just skip matchesSelector for :active + rbuggyMatches = [ ":active", ":focus" ], + matches = docElem.matchesSelector || + docElem.mozMatchesSelector || + docElem.webkitMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector; + + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert(function( div ) { + // Select is set to empty string on purpose + // This is to test IE's treatment of not explictly + // setting a boolean content attribute, + // since its presence should be enough + // http://bugs.jquery.com/ticket/12359 + div.innerHTML = ""; + + // IE8 - Some boolean attributes are not treated correctly + if ( !div.querySelectorAll("[selected]").length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:checked|disabled|ismap|multiple|readonly|selected|value)" ); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here (do not put tests after this one) + if ( !div.querySelectorAll(":checked").length ) { + rbuggyQSA.push(":checked"); + } + }); + + assert(function( div ) { + + // Opera 10-12/IE9 - ^= $= *= and empty values + // Should not select anything + div.innerHTML = "

      "; + if ( div.querySelectorAll("[test^='']").length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:\"\"|'')" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here (do not put tests after this one) + div.innerHTML = ""; + if ( !div.querySelectorAll(":enabled").length ) { + rbuggyQSA.push(":enabled", ":disabled"); + } + }); + + // rbuggyQSA always contains :focus, so no need for a length check + rbuggyQSA = /* rbuggyQSA.length && */ new RegExp( rbuggyQSA.join("|") ); + + select = function( selector, context, results, seed, xml ) { + // Only use querySelectorAll when not filtering, + // when this is not xml, + // and when no QSA bugs apply + if ( !seed && !xml && (!rbuggyQSA || !rbuggyQSA.test( selector )) ) { + var groups, i, + old = true, + nid = expando, + newContext = context, + newSelector = context.nodeType === 9 && selector; + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + groups = tokenize( selector ); + + if ( (old = context.getAttribute("id")) ) { + nid = old.replace( rescape, "\\$&" ); + } else { + context.setAttribute( "id", nid ); + } + nid = "[id='" + nid + "'] "; + + i = groups.length; + while ( i-- ) { + groups[i] = nid + groups[i].join(""); + } + newContext = rsibling.test( selector ) && context.parentNode || context; + newSelector = groups.join(","); + } + + if ( newSelector ) { + try { + push.apply( results, slice.call( newContext.querySelectorAll( + newSelector + ), 0 ) ); + return results; + } catch(qsaError) { + } finally { + if ( !old ) { + context.removeAttribute("id"); + } + } + } + } + + return oldSelect( selector, context, results, seed, xml ); + }; + + if ( matches ) { + assert(function( div ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + disconnectedMatch = matches.call( div, "div" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + try { + matches.call( div, "[test!='']:sizzle" ); + rbuggyMatches.push( "!=", pseudos ); + } catch ( e ) {} + }); + + // rbuggyMatches always contains :active and :focus, so no need for a length check + rbuggyMatches = /* rbuggyMatches.length && */ new RegExp( rbuggyMatches.join("|") ); + + Sizzle.matchesSelector = function( elem, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace( rattributeQuotes, "='$1']" ); + + // rbuggyMatches always contains :active, so no need for an existence check + if ( !isXML( elem ) && !rbuggyMatches.test( expr ) && (!rbuggyQSA || !rbuggyQSA.test( expr )) ) { + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch(e) {} + } + + return Sizzle( expr, null, null, [ elem ] ).length > 0; + }; + } + })(); +} + +// Deprecated +Expr.pseudos["nth"] = Expr.pseudos["eq"]; + +// Back-compat +function setFilters() {} +Expr.filters = setFilters.prototype = Expr.pseudos; +Expr.setFilters = new setFilters(); + +// Override sizzle attribute retrieval +Sizzle.attr = jQuery.attr; +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.pseudos; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})( window ); +var runtil = /Until$/, + rparentsprev = /^(?:parents|prev(?:Until|All))/, + isSimple = /^.[^:#\[\.,]*$/, + rneedsContext = jQuery.expr.match.needsContext, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var i, l, length, n, r, ret, + self = this; + + if ( typeof selector !== "string" ) { + return jQuery( selector ).filter(function() { + for ( i = 0, l = self.length; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }); + } + + ret = this.pushStack( "", "find", selector ); + + for ( i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( n = length; n < ret.length; n++ ) { + for ( r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var i, + targets = jQuery( target, this ), + len = targets.length; + + return this.filter(function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && ( + typeof selector === "string" ? + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + rneedsContext.test( selector ) ? + jQuery( selector, this.context ).index( this[0] ) >= 0 : + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + ret = [], + pos = rneedsContext.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( ; i < l; i++ ) { + cur = this[i]; + + while ( cur && cur.ownerDocument && cur !== context && cur.nodeType !== 11 ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + } + cur = cur.parentNode; + } + } + + ret = ret.length > 1 ? jQuery.unique( ret ) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; + } + + // index in selector + if ( typeof elem === "string" ) { + return jQuery.inArray( this[0], jQuery( elem ) ); + } + + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter(selector) + ); + } +}); + +jQuery.fn.andSelf = jQuery.fn.addBack; + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +function sibling( cur, dir ) { + do { + cur = cur[ dir ]; + } while ( cur && cur.nodeType !== 1 ); + + return cur; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( this.length > 1 && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, core_slice.call( arguments ).join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return ( elem === qualifier ) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep; + }); +} +function createSafeFragment( document ) { + var list = nodeNames.split( "|" ), + safeFrag = document.createDocumentFragment(); + + if ( safeFrag.createElement ) { + while ( list.length ) { + safeFrag.createElement( + list.pop() + ); + } + } + return safeFrag; +} + +var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" + + "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video", + rinlinejQuery = / jQuery\d+="(?:null|\d+)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi, + rtagName = /<([\w:]+)/, + rtbody = /]", "i"), + rcheckableType = /^(?:checkbox|radio)$/, + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + rscriptType = /\/(java|ecma)script/i, + rcleanScript = /^\s*\s*$/g, + wrapMap = { + option: [ 1, "" ], + legend: [ 1, "
      ", "
      " ], + thead: [ 1, "", "
      " ], + tr: [ 2, "", "
      " ], + td: [ 3, "", "
      " ], + col: [ 2, "", "
      " ], + area: [ 1, "", "" ], + _default: [ 0, "", "" ] + }, + safeFragment = createSafeFragment( document ), + fragmentDiv = safeFragment.appendChild( document.createElement("div") ); + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE6-8 can't serialize link, script, style, or any html5 (NoScope) tags, +// unless wrapped in a div with non-breaking characters in front of it. +if ( !jQuery.support.htmlSerialize ) { + wrapMap._default = [ 1, "X
      ", "
      " ]; +} + +jQuery.fn.extend({ + text: function( value ) { + return jQuery.access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().append( ( this[0] && this[0].ownerDocument || document ).createTextNode( value ) ); + }, null, value, arguments.length ); + }, + + wrapAll: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapAll( html.call(this, i) ); + }); + } + + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + + if ( this[0].parentNode ) { + wrap.insertBefore( this[0] ); + } + + wrap.map(function() { + var elem = this; + + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } + + return elem; + }).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapInner( html.call(this, i) ); + }); + } + + return this.each(function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + }); + }, + + wrap: function( html ) { + var isFunction = jQuery.isFunction( html ); + + return this.each(function(i) { + jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html ); + }); + }, + + unwrap: function() { + return this.parent().each(function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + }).end(); + }, + + append: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 ) { + this.appendChild( elem ); + } + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 ) { + this.insertBefore( elem, this.firstChild ); + } + }); + }, + + before: function() { + if ( !isDisconnected( this[0] ) ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this ); + }); + } + + if ( arguments.length ) { + var set = jQuery.clean( arguments ); + return this.pushStack( jQuery.merge( set, this ), "before", this.selector ); + } + }, + + after: function() { + if ( !isDisconnected( this[0] ) ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + } + + if ( arguments.length ) { + var set = jQuery.clean( arguments ); + return this.pushStack( jQuery.merge( this, set ), "after", this.selector ); + } + }, + + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + var elem, + i = 0; + + for ( ; (elem = this[i]) != null; i++ ) { + if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { + if ( !keepData && elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + jQuery.cleanData( [ elem ] ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + } + } + + return this; + }, + + empty: function() { + var elem, + i = 0; + + for ( ; (elem = this[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function () { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + }); + }, + + html: function( value ) { + return jQuery.access( this, function( value ) { + var elem = this[0] || {}, + i = 0, + l = this.length; + + if ( value === undefined ) { + return elem.nodeType === 1 ? + elem.innerHTML.replace( rinlinejQuery, "" ) : + undefined; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + ( jQuery.support.htmlSerialize || !rnoshimcache.test( value ) ) && + ( jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value ) ) && + !wrapMap[ ( rtagName.exec( value ) || ["", ""] )[1].toLowerCase() ] ) { + + value = value.replace( rxhtmlTag, "<$1>" ); + + try { + for (; i < l; i++ ) { + // Remove element nodes and prevent memory leaks + elem = this[i] || {}; + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName( "*" ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch(e) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function( value ) { + if ( !isDisconnected( this[0] ) ) { + // Make sure that the elements are removed from the DOM before they are inserted + // this can help fix replacing a parent with child elements + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this), old = self.html(); + self.replaceWith( value.call( this, i, old ) ); + }); + } + + if ( typeof value !== "string" ) { + value = jQuery( value ).detach(); + } + + return this.each(function() { + var next = this.nextSibling, + parent = this.parentNode; + + jQuery( this ).remove(); + + if ( next ) { + jQuery(next).before( value ); + } else { + jQuery(parent).append( value ); + } + }); + } + + return this.length ? + this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) : + this; + }, + + detach: function( selector ) { + return this.remove( selector, true ); + }, + + domManip: function( args, table, callback ) { + + // Flatten any nested arrays + args = [].concat.apply( [], args ); + + var results, first, fragment, iNoClone, + i = 0, + value = args[0], + scripts = [], + l = this.length; + + // We can't cloneNode fragments that contain checked, in WebKit + if ( !jQuery.support.checkClone && l > 1 && typeof value === "string" && rchecked.test( value ) ) { + return this.each(function() { + jQuery(this).domManip( args, table, callback ); + }); + } + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + args[0] = value.call( this, i, table ? self.html() : undefined ); + self.domManip( args, table, callback ); + }); + } + + if ( this[0] ) { + results = jQuery.buildFragment( args, this, scripts ); + fragment = results.fragment; + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + if ( first ) { + table = table && jQuery.nodeName( first, "tr" ); + + // Use the original fragment for the last item instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + // Fragments from the fragment cache must always be cloned and never used in place. + for ( iNoClone = results.cacheable || l - 1; i < l; i++ ) { + callback.call( + table && jQuery.nodeName( this[i], "table" ) ? + findOrAppend( this[i], "tbody" ) : + this[i], + i === iNoClone ? + fragment : + jQuery.clone( fragment, true, true ) + ); + } + } + + // Fix #11809: Avoid leaking memory + fragment = first = null; + + if ( scripts.length ) { + jQuery.each( scripts, function( i, elem ) { + if ( elem.src ) { + if ( jQuery.ajax ) { + jQuery.ajax({ + url: elem.src, + type: "GET", + dataType: "script", + async: false, + global: false, + "throws": true + }); + } else { + jQuery.error("no ajax"); + } + } else { + jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "" ) ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + }); + } + } + + return this; + } +}); + +function findOrAppend( elem, tag ) { + return elem.getElementsByTagName( tag )[0] || elem.appendChild( elem.ownerDocument.createElement( tag ) ); +} + +function cloneCopyEvent( src, dest ) { + + if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { + return; + } + + var type, i, l, + oldData = jQuery._data( src ), + curData = jQuery._data( dest, oldData ), + events = oldData.events; + + if ( events ) { + delete curData.handle; + curData.events = {}; + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + + // make the cloned public data object a copy from the original + if ( curData.data ) { + curData.data = jQuery.extend( {}, curData.data ); + } +} + +function cloneFixAttributes( src, dest ) { + var nodeName; + + // We do not need to do anything for non-Elements + if ( dest.nodeType !== 1 ) { + return; + } + + // clearAttributes removes the attributes, which we don't want, + // but also removes the attachEvent events, which we *do* want + if ( dest.clearAttributes ) { + dest.clearAttributes(); + } + + // mergeAttributes, in contrast, only merges back on the + // original attributes, not the events + if ( dest.mergeAttributes ) { + dest.mergeAttributes( src ); + } + + nodeName = dest.nodeName.toLowerCase(); + + if ( nodeName === "object" ) { + // IE6-10 improperly clones children of object elements using classid. + // IE10 throws NoModificationAllowedError if parent is null, #12132. + if ( dest.parentNode ) { + dest.outerHTML = src.outerHTML; + } + + // This path appears unavoidable for IE9. When cloning an object + // element in IE9, the outerHTML strategy above is not sufficient. + // If the src has innerHTML and the destination does not, + // copy the src.innerHTML into the dest.innerHTML. #10324 + if ( jQuery.support.html5Clone && (src.innerHTML && !jQuery.trim(dest.innerHTML)) ) { + dest.innerHTML = src.innerHTML; + } + + } else if ( nodeName === "input" && rcheckableType.test( src.type ) ) { + // IE6-8 fails to persist the checked state of a cloned checkbox + // or radio button. Worse, IE6-7 fail to give the cloned element + // a checked appearance if the defaultChecked value isn't also set + + dest.defaultChecked = dest.checked = src.checked; + + // IE6-7 get confused and end up setting the value of a cloned + // checkbox/radio button to an empty string instead of "on" + if ( dest.value !== src.value ) { + dest.value = src.value; + } + + // IE6-8 fails to return the selected option to the default selected + // state when cloning options + } else if ( nodeName === "option" ) { + dest.selected = src.defaultSelected; + + // IE6-8 fails to set the defaultValue to the correct value when + // cloning other types of input fields + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + + // IE blanks contents when cloning scripts + } else if ( nodeName === "script" && dest.text !== src.text ) { + dest.text = src.text; + } + + // Event data gets referenced instead of copied if the expando + // gets copied too + dest.removeAttribute( jQuery.expando ); +} + +jQuery.buildFragment = function( args, context, scripts ) { + var fragment, cacheable, cachehit, + first = args[ 0 ]; + + // Set context from what may come in as undefined or a jQuery collection or a node + // Updated to fix #12266 where accessing context[0] could throw an exception in IE9/10 & + // also doubles as fix for #8950 where plain objects caused createDocumentFragment exception + context = context || document; + context = !context.nodeType && context[0] || context; + context = context.ownerDocument || context; + + // Only cache "small" (1/2 KB) HTML strings that are associated with the main document + // Cloning options loses the selected state, so don't cache them + // IE 6 doesn't like it when you put or elements in a fragment + // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache + // Lastly, IE6,7,8 will not correctly reuse cached fragments that were created from unknown elems #10501 + if ( args.length === 1 && typeof first === "string" && first.length < 512 && context === document && + first.charAt(0) === "<" && !rnocache.test( first ) && + (jQuery.support.checkClone || !rchecked.test( first )) && + (jQuery.support.html5Clone || !rnoshimcache.test( first )) ) { + + // Mark cacheable and look for a hit + cacheable = true; + fragment = jQuery.fragments[ first ]; + cachehit = fragment !== undefined; + } + + if ( !fragment ) { + fragment = context.createDocumentFragment(); + jQuery.clean( args, context, fragment, scripts ); + + // Update the cache, but only store false + // unless this is a second parsing of the same content + if ( cacheable ) { + jQuery.fragments[ first ] = cachehit && fragment; + } + } + + return { fragment: fragment, cacheable: cacheable }; +}; + +jQuery.fragments = {}; + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + i = 0, + ret = [], + insert = jQuery( selector ), + l = insert.length, + parent = this.length === 1 && this[0].parentNode; + + if ( (parent == null || parent && parent.nodeType === 11 && parent.childNodes.length === 1) && l === 1 ) { + insert[ original ]( this[0] ); + return this; + } else { + for ( ; i < l; i++ ) { + elems = ( i > 0 ? this.clone(true) : this ).get(); + jQuery( insert[i] )[ original ]( elems ); + ret = ret.concat( elems ); + } + + return this.pushStack( ret, name, insert.selector ); + } + }; +}); + +function getAll( elem ) { + if ( typeof elem.getElementsByTagName !== "undefined" ) { + return elem.getElementsByTagName( "*" ); + + } else if ( typeof elem.querySelectorAll !== "undefined" ) { + return elem.querySelectorAll( "*" ); + + } else { + return []; + } +} + +// Used in clean, fixes the defaultChecked property +function fixDefaultChecked( elem ) { + if ( rcheckableType.test( elem.type ) ) { + elem.defaultChecked = elem.checked; + } +} + +jQuery.extend({ + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var srcElements, + destElements, + i, + clone; + + if ( jQuery.support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test( "<" + elem.nodeName + ">" ) ) { + clone = elem.cloneNode( true ); + + // IE<=8 does not properly clone detached, unknown element nodes + } else { + fragmentDiv.innerHTML = elem.outerHTML; + fragmentDiv.removeChild( clone = fragmentDiv.firstChild ); + } + + if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) && + (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) { + // IE copies events bound via attachEvent when using cloneNode. + // Calling detachEvent on the clone will also remove the events + // from the original. In order to get around this, we use some + // proprietary methods to clear the events. Thanks to MooTools + // guys for this hotness. + + cloneFixAttributes( elem, clone ); + + // Using Sizzle here is crazy slow, so we use getElementsByTagName instead + srcElements = getAll( elem ); + destElements = getAll( clone ); + + // Weird iteration because IE will replace the length property + // with an element if you are cloning the body and one of the + // elements on the page has a name or id of "length" + for ( i = 0; srcElements[i]; ++i ) { + // Ensure that the destination node is not null; Fixes #9587 + if ( destElements[i] ) { + cloneFixAttributes( srcElements[i], destElements[i] ); + } + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + cloneCopyEvent( elem, clone ); + + if ( deepDataAndEvents ) { + srcElements = getAll( elem ); + destElements = getAll( clone ); + + for ( i = 0; srcElements[i]; ++i ) { + cloneCopyEvent( srcElements[i], destElements[i] ); + } + } + } + + srcElements = destElements = null; + + // Return the cloned set + return clone; + }, + + clean: function( elems, context, fragment, scripts ) { + var i, j, elem, tag, wrap, depth, div, hasBody, tbody, len, handleScript, jsTags, + safe = context === document && safeFragment, + ret = []; + + // Ensure that context is a document + if ( !context || typeof context.createDocumentFragment === "undefined" ) { + context = document; + } + + // Use the already-created safe fragment if context permits + for ( i = 0; (elem = elems[i]) != null; i++ ) { + if ( typeof elem === "number" ) { + elem += ""; + } + + if ( !elem ) { + continue; + } + + // Convert html string into DOM nodes + if ( typeof elem === "string" ) { + if ( !rhtml.test( elem ) ) { + elem = context.createTextNode( elem ); + } else { + // Ensure a safe container in which to render the html + safe = safe || createSafeFragment( context ); + div = context.createElement("div"); + safe.appendChild( div ); + + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(rxhtmlTag, "<$1>"); + + // Go to html and back, then peel off extra wrappers + tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + depth = wrap[0]; + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( depth-- ) { + div = div.lastChild; + } + + // Remove IE's autoinserted from table fragments + if ( !jQuery.support.tbody ) { + + // String was a , *may* have spurious + hasBody = rtbody.test(elem); + tbody = tag === "table" && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare or + wrap[1] === "
      " && !hasBody ? + div.childNodes : + []; + + for ( j = tbody.length - 1; j >= 0 ; --j ) { + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + } + } + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); + } + + elem = div.childNodes; + + // Take out of fragment container (we need a fresh div each time) + div.parentNode.removeChild( div ); + } + } + + if ( elem.nodeType ) { + ret.push( elem ); + } else { + jQuery.merge( ret, elem ); + } + } + + // Fix #11356: Clear elements from safeFragment + if ( div ) { + elem = div = safe = null; + } + + // Reset defaultChecked for any radios and checkboxes + // about to be appended to the DOM in IE 6/7 (#8060) + if ( !jQuery.support.appendChecked ) { + for ( i = 0; (elem = ret[i]) != null; i++ ) { + if ( jQuery.nodeName( elem, "input" ) ) { + fixDefaultChecked( elem ); + } else if ( typeof elem.getElementsByTagName !== "undefined" ) { + jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked ); + } + } + } + + // Append elements to a provided document fragment + if ( fragment ) { + // Special handling of each script element + handleScript = function( elem ) { + // Check if we consider it executable + if ( !elem.type || rscriptType.test( elem.type ) ) { + // Detach the script and store it in the scripts array (if provided) or the fragment + // Return truthy to indicate that it has been handled + return scripts ? + scripts.push( elem.parentNode ? elem.parentNode.removeChild( elem ) : elem ) : + fragment.appendChild( elem ); + } + }; + + for ( i = 0; (elem = ret[i]) != null; i++ ) { + // Check if we're done after handling an executable script + if ( !( jQuery.nodeName( elem, "script" ) && handleScript( elem ) ) ) { + // Append to fragment and handle embedded scripts + fragment.appendChild( elem ); + if ( typeof elem.getElementsByTagName !== "undefined" ) { + // handleScript alters the DOM, so use jQuery.merge to ensure snapshot iteration + jsTags = jQuery.grep( jQuery.merge( [], elem.getElementsByTagName("script") ), handleScript ); + + // Splice the scripts into ret after their former ancestor and advance our index beyond them + ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) ); + i += jsTags.length; + } + } + } + } + + return ret; + }, + + cleanData: function( elems, /* internal */ acceptData ) { + var data, id, elem, type, + i = 0, + internalKey = jQuery.expando, + cache = jQuery.cache, + deleteExpando = jQuery.support.deleteExpando, + special = jQuery.event.special; + + for ( ; (elem = elems[i]) != null; i++ ) { + + if ( acceptData || jQuery.acceptData( elem ) ) { + + id = elem[ internalKey ]; + data = id && cache[ id ]; + + if ( data ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Remove cache only if it was not already removed by jQuery.event.remove + if ( cache[ id ] ) { + + delete cache[ id ]; + + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( deleteExpando ) { + delete elem[ internalKey ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( internalKey ); + + } else { + elem[ internalKey ] = null; + } + + jQuery.deletedIds.push( id ); + } + } + } + } + } +}); +// Limit scope pollution from any deprecated API +(function() { + +var matched, browser; + +// Use of jQuery.browser is frowned upon. +// More details: http://api.jquery.com/jQuery.browser +// jQuery.uaMatch maintained for back-compat +jQuery.uaMatch = function( ua ) { + ua = ua.toLowerCase(); + + var match = /(chrome)[ \/]([\w.]+)/.exec( ua ) || + /(webkit)[ \/]([\w.]+)/.exec( ua ) || + /(opera)(?:.*version|)[ \/]([\w.]+)/.exec( ua ) || + /(msie) ([\w.]+)/.exec( ua ) || + ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec( ua ) || + []; + + return { + browser: match[ 1 ] || "", + version: match[ 2 ] || "0" + }; +}; + +matched = jQuery.uaMatch( navigator.userAgent ); +browser = {}; + +if ( matched.browser ) { + browser[ matched.browser ] = true; + browser.version = matched.version; +} + +// Chrome is Webkit, but Webkit is also Safari. +if ( browser.chrome ) { + browser.webkit = true; +} else if ( browser.webkit ) { + browser.safari = true; +} + +jQuery.browser = browser; + +jQuery.sub = function() { + function jQuerySub( selector, context ) { + return new jQuerySub.fn.init( selector, context ); + } + jQuery.extend( true, jQuerySub, this ); + jQuerySub.superclass = this; + jQuerySub.fn = jQuerySub.prototype = this(); + jQuerySub.fn.constructor = jQuerySub; + jQuerySub.sub = this.sub; + jQuerySub.fn.init = function init( selector, context ) { + if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { + context = jQuerySub( context ); + } + + return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); + }; + jQuerySub.fn.init.prototype = jQuerySub.fn; + var rootjQuerySub = jQuerySub(document); + return jQuerySub; +}; + +})(); +var curCSS, iframe, iframeDoc, + ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity=([^)]*)/, + rposition = /^(top|right|bottom|left)$/, + // swappable if display is none or starts with table except "table", "table-cell", or "table-caption" + // see here for display values: https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + rmargin = /^margin/, + rnumsplit = new RegExp( "^(" + core_pnum + ")(.*)$", "i" ), + rnumnonpx = new RegExp( "^(" + core_pnum + ")(?!px)[a-z%]+$", "i" ), + rrelNum = new RegExp( "^([-+])=(" + core_pnum + ")", "i" ), + elemdisplay = {}, + + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: 0, + fontWeight: 400 + }, + + cssExpand = [ "Top", "Right", "Bottom", "Left" ], + cssPrefixes = [ "Webkit", "O", "Moz", "ms" ], + + eventsToggle = jQuery.fn.toggle; + +// return a css property mapped to a potentially vendor prefixed property +function vendorPropName( style, name ) { + + // shortcut for names that are not vendor prefixed + if ( name in style ) { + return name; + } + + // check for vendor prefixed names + var capName = name.charAt(0).toUpperCase() + name.slice(1), + origName = name, + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in style ) { + return name; + } + } + + return origName; +} + +function isHidden( elem, el ) { + elem = el || elem; + return jQuery.css( elem, "display" ) === "none" || !jQuery.contains( elem.ownerDocument, elem ); +} + +function showHide( elements, show ) { + var elem, display, + values = [], + index = 0, + length = elements.length; + + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + values[ index ] = jQuery._data( elem, "olddisplay" ); + if ( show ) { + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !values[ index ] && elem.style.display === "none" ) { + elem.style.display = ""; + } + + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( elem.style.display === "" && isHidden( elem ) ) { + values[ index ] = jQuery._data( elem, "olddisplay", css_defaultDisplay(elem.nodeName) ); + } + } else { + display = curCSS( elem, "display" ); + + if ( !values[ index ] && display !== "none" ) { + jQuery._data( elem, "olddisplay", display ); + } + } + } + + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( index = 0; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + if ( !show || elem.style.display === "none" || elem.style.display === "" ) { + elem.style.display = show ? values[ index ] || "" : "none"; + } + } + + return elements; +} + +jQuery.fn.extend({ + css: function( name, value ) { + return jQuery.access( this, function( elem, name, value ) { + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + }, + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state, fn2 ) { + var bool = typeof state === "boolean"; + + if ( jQuery.isFunction( state ) && jQuery.isFunction( fn2 ) ) { + return eventsToggle.apply( this, arguments ); + } + + return this.each(function() { + if ( bool ? state : isHidden( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + }); + } +}); + +jQuery.extend({ + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + + } + } + } + }, + + // Exclude the following css properties to add px + cssNumber: { + "fillOpacity": true, + "fontWeight": true, + "lineHeight": true, + "opacity": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { + // normalize float css property + "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" + }, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = jQuery.camelCase( name ), + style = elem.style; + + name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( style, origName ) ); + + // gets hook for the prefixed version + // followed by the unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // convert relative number strings (+= or -=) to relative numbers. #7345 + if ( type === "string" && (ret = rrelNum.exec( value )) ) { + value = ( ret[1] + 1 ) * ret[2] + parseFloat( jQuery.css( elem, name ) ); + // Fixes bug #9237 + type = "number"; + } + + // Make sure that NaN and null values aren't set. See: #7116 + if ( value == null || type === "number" && isNaN( value ) ) { + return; + } + + // If a number was passed in, add 'px' to the (except for certain CSS properties) + if ( type === "number" && !jQuery.cssNumber[ origName ] ) { + value += "px"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value, extra )) !== undefined ) { + // Wrapped to prevent IE from throwing errors when 'invalid' values are provided + // Fixes bug #5509 + try { + style[ name ] = value; + } catch(e) {} + } + + } else { + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, numeric, extra ) { + var val, num, hooks, + origName = jQuery.camelCase( name ); + + // Make sure that we're working with the right name + name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( elem.style, origName ) ); + + // gets hook for the prefixed version + // followed by the unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name ); + } + + //convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Return, converting to number if forced or a qualifier was provided and val looks numeric + if ( numeric || extra !== undefined ) { + num = parseFloat( val ); + return numeric || jQuery.isNumeric( num ) ? num || 0 : val; + } + return val; + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; + } +}); + +// NOTE: To any future maintainer, we've window.getComputedStyle +// because jsdom on node.js will break without it. +if ( window.getComputedStyle ) { + curCSS = function( elem, name ) { + var ret, width, minWidth, maxWidth, + computed = window.getComputedStyle( elem, null ), + style = elem.style; + + if ( computed ) { + + ret = computed[ name ]; + if ( ret === "" && !jQuery.contains( elem.ownerDocument, elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Chrome < 17 and Safari 5.0 uses "computed value" instead of "used value" for margin-right + // Safari 5.1.7 (at least) returns percentage for a larger set of values, but width seems to be reliably pixels + // this is against the CSSOM draft spec: http://dev.w3.org/csswg/cssom/#resolved-values + if ( rnumnonpx.test( ret ) && rmargin.test( name ) ) { + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret; + }; +} else if ( document.documentElement.currentStyle ) { + curCSS = function( elem, name ) { + var left, rsLeft, + ret = elem.currentStyle && elem.currentStyle[ name ], + style = elem.style; + + // Avoid setting ret to empty string here + // so we don't default to auto + if ( ret == null && style && style[ name ] ) { + ret = style[ name ]; + } + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + // but not position css attributes, as those are proportional to the parent element instead + // and we can't measure the parent instead because it might trigger a "stacking dolls" problem + if ( rnumnonpx.test( ret ) && !rposition.test( name ) ) { + + // Remember the original values + left = style.left; + rsLeft = elem.runtimeStyle && elem.runtimeStyle.left; + + // Put in the new values to get a computed value out + if ( rsLeft ) { + elem.runtimeStyle.left = elem.currentStyle.left; + } + style.left = name === "fontSize" ? "1em" : ret; + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + if ( rsLeft ) { + elem.runtimeStyle.left = rsLeft; + } + } + + return ret === "" ? "auto" : ret; + }; +} + +function setPositiveNumber( elem, value, subtract ) { + var matches = rnumsplit.exec( value ); + return matches ? + Math.max( 0, matches[ 1 ] - ( subtract || 0 ) ) + ( matches[ 2 ] || "px" ) : + value; +} + +function augmentWidthOrHeight( elem, name, extra, isBorderBox ) { + var i = extra === ( isBorderBox ? "border" : "content" ) ? + // If we already have the right measurement, avoid augmentation + 4 : + // Otherwise initialize for horizontal or vertical properties + name === "width" ? 1 : 0, + + val = 0; + + for ( ; i < 4; i += 2 ) { + // both box models exclude margin, so add it if we want it + if ( extra === "margin" ) { + // we use jQuery.css instead of curCSS here + // because of the reliableMarginRight CSS hook! + val += jQuery.css( elem, extra + cssExpand[ i ], true ); + } + + // From this point on we use curCSS for maximum performance (relevant in animations) + if ( isBorderBox ) { + // border-box includes padding, so remove it if we want content + if ( extra === "content" ) { + val -= parseFloat( curCSS( elem, "padding" + cssExpand[ i ] ) ) || 0; + } + + // at this point, extra isn't border nor margin, so remove border + if ( extra !== "margin" ) { + val -= parseFloat( curCSS( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0; + } + } else { + // at this point, extra isn't content, so add padding + val += parseFloat( curCSS( elem, "padding" + cssExpand[ i ] ) ) || 0; + + // at this point, extra isn't content nor padding, so add border + if ( extra !== "padding" ) { + val += parseFloat( curCSS( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0; + } + } + } + + return val; +} + +function getWidthOrHeight( elem, name, extra ) { + + // Start with offset property, which is equivalent to the border-box value + var val = name === "width" ? elem.offsetWidth : elem.offsetHeight, + valueIsBorderBox = true, + isBorderBox = jQuery.support.boxSizing && jQuery.css( elem, "boxSizing" ) === "border-box"; + + // some non-html elements return undefined for offsetWidth, so check for null/undefined + // svg - https://bugzilla.mozilla.org/show_bug.cgi?id=649285 + // MathML - https://bugzilla.mozilla.org/show_bug.cgi?id=491668 + if ( val <= 0 || val == null ) { + // Fall back to computed then uncomputed css if necessary + val = curCSS( elem, name ); + if ( val < 0 || val == null ) { + val = elem.style[ name ]; + } + + // Computed unit is not pixels. Stop here and return. + if ( rnumnonpx.test(val) ) { + return val; + } + + // we need the check for style in case a browser which returns unreliable values + // for getComputedStyle silently falls back to the reliable elem.style + valueIsBorderBox = isBorderBox && ( jQuery.support.boxSizingReliable || val === elem.style[ name ] ); + + // Normalize "", auto, and prepare for extra + val = parseFloat( val ) || 0; + } + + // use the active box-sizing model to add/subtract irrelevant styles + return ( val + + augmentWidthOrHeight( + elem, + name, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox + ) + ) + "px"; +} + + +// Try to determine the default display value of an element +function css_defaultDisplay( nodeName ) { + if ( elemdisplay[ nodeName ] ) { + return elemdisplay[ nodeName ]; + } + + var elem = jQuery( "<" + nodeName + ">" ).appendTo( document.body ), + display = elem.css("display"); + elem.remove(); + + // If the simple way fails, + // get element's real default display by attaching it to a temp iframe + if ( display === "none" || display === "" ) { + // Use the already-created iframe if possible + iframe = document.body.appendChild( + iframe || jQuery.extend( document.createElement("iframe"), { + frameBorder: 0, + width: 0, + height: 0 + }) + ); + + // Create a cacheable copy of the iframe document on first call. + // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML + // document to it; WebKit & Firefox won't allow reusing the iframe document. + if ( !iframeDoc || !iframe.createElement ) { + iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document; + iframeDoc.write(""); + iframeDoc.close(); + } + + elem = iframeDoc.body.appendChild( iframeDoc.createElement(nodeName) ); + + display = curCSS( elem, "display" ); + document.body.removeChild( iframe ); + } + + // Store the correct default display + elemdisplay[ nodeName ] = display; + + return display; +} + +jQuery.each([ "height", "width" ], function( i, name ) { + jQuery.cssHooks[ name ] = { + get: function( elem, computed, extra ) { + if ( computed ) { + // certain elements can have dimension info if we invisibly show them + // however, it must have a current display style that would benefit from this + if ( elem.offsetWidth === 0 && rdisplayswap.test( curCSS( elem, "display" ) ) ) { + return jQuery.swap( elem, cssShow, function() { + return getWidthOrHeight( elem, name, extra ); + }); + } else { + return getWidthOrHeight( elem, name, extra ); + } + } + }, + + set: function( elem, value, extra ) { + return setPositiveNumber( elem, value, extra ? + augmentWidthOrHeight( + elem, + name, + extra, + jQuery.support.boxSizing && jQuery.css( elem, "boxSizing" ) === "border-box" + ) : 0 + ); + } + }; +}); + +if ( !jQuery.support.opacity ) { + jQuery.cssHooks.opacity = { + get: function( elem, computed ) { + // IE uses filters for opacity + return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ? + ( 0.01 * parseFloat( RegExp.$1 ) ) + "" : + computed ? "1" : ""; + }, + + set: function( elem, value ) { + var style = elem.style, + currentStyle = elem.currentStyle, + opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "", + filter = currentStyle && currentStyle.filter || style.filter || ""; + + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + style.zoom = 1; + + // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652 + if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" && + style.removeAttribute ) { + + // Setting style.filter to null, "" & " " still leave "filter:" in the cssText + // if "filter:" is present at all, clearType is disabled, we want to avoid this + // style.removeAttribute is IE Only, but so apparently is this code path... + style.removeAttribute( "filter" ); + + // if there there is no filter style applied in a css rule, we are done + if ( currentStyle && !currentStyle.filter ) { + return; + } + } + + // otherwise, set new filter values + style.filter = ralpha.test( filter ) ? + filter.replace( ralpha, opacity ) : + filter + " " + opacity; + } + }; +} + +// These hooks cannot be added until DOM ready because the support test +// for it is not run until after DOM ready +jQuery(function() { + if ( !jQuery.support.reliableMarginRight ) { + jQuery.cssHooks.marginRight = { + get: function( elem, computed ) { + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + // Work around by temporarily setting element display to inline-block + return jQuery.swap( elem, { "display": "inline-block" }, function() { + if ( computed ) { + return curCSS( elem, "marginRight" ); + } + }); + } + }; + } + + // Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084 + // getComputedStyle returns percent when specified for top/left/bottom/right + // rather than make the css module depend on the offset module, we just check for it here + if ( !jQuery.support.pixelPosition && jQuery.fn.position ) { + jQuery.each( [ "top", "left" ], function( i, prop ) { + jQuery.cssHooks[ prop ] = { + get: function( elem, computed ) { + if ( computed ) { + var ret = curCSS( elem, prop ); + // if curCSS returns percentage, fallback to offset + return rnumnonpx.test( ret ) ? jQuery( elem ).position()[ prop ] + "px" : ret; + } + } + }; + }); + } + +}); + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.hidden = function( elem ) { + return ( elem.offsetWidth === 0 && elem.offsetHeight === 0 ) || (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || curCSS( elem, "display" )) === "none"); + }; + + jQuery.expr.filters.visible = function( elem ) { + return !jQuery.expr.filters.hidden( elem ); + }; +} + +// These hooks are used by animate to expand properties +jQuery.each({ + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i, + + // assumes a single number if not a string + parts = typeof value === "string" ? value.split(" ") : [ value ], + expanded = {}; + + for ( i = 0; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } + + return expanded; + } + }; + + if ( !rmargin.test( prefix ) ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +}); +var r20 = /%20/g, + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + rselectTextarea = /^(?:select|textarea)/i; + +jQuery.fn.extend({ + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map(function(){ + return this.elements ? jQuery.makeArray( this.elements ) : this; + }) + .filter(function(){ + return this.name && !this.disabled && + ( this.checked || rselectTextarea.test( this.nodeName ) || + rinput.test( this.type ) ); + }) + .map(function( i, elem ){ + var val = jQuery( this ).val(); + + return val == null ? + null : + jQuery.isArray( val ) ? + jQuery.map( val, function( val, i ){ + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }) : + { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }).get(); + } +}); + +//Serialize an array of form elements or a set of +//key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, value ) { + // If value is a function, invoke it and return its value + value = jQuery.isFunction( value ) ? value() : ( value == null ? "" : value ); + s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value ); + }; + + // Set traditional to true for jQuery <= 1.3.2 behavior. + if ( traditional === undefined ) { + traditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + }); + + } else { + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ).replace( r20, "+" ); +}; + +function buildParams( prefix, obj, traditional, add ) { + var name; + + if ( jQuery.isArray( obj ) ) { + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + // If array item is non-scalar (array or object), encode its + // numeric index to resolve deserialization ambiguity issues. + // Note that rack (as of 1.0.0) can't currently deserialize + // nested arrays properly, and attempting to do so may cause + // a server error. Possible fixes are to modify rack's + // deserialization algorithm or to provide an option or flag + // to force array serialization to be shallow. + buildParams( prefix + "[" + ( typeof v === "object" ? i : "" ) + "]", v, traditional, add ); + } + }); + + } else if ( !traditional && jQuery.type( obj ) === "object" ) { + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + // Serialize scalar item. + add( prefix, obj ); + } +} +var + // Document location + ajaxLocParts, + ajaxLocation, + + rhash = /#.*$/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + rquery = /\?/, + rscript = /)<[^<]*)*<\/script>/gi, + rts = /([?&])_=[^&]*/, + rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/, + + // Keep a copy of the old load method + _load = jQuery.fn.load, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = ["*/"] + ["*"]; + +// #8138, IE may throw an exception when accessing +// a field from window.location if document.domain has been set +try { + ajaxLocation = location.href; +} catch( e ) { + // Use the href attribute of an A element + // since IE will modify it given document.location + ajaxLocation = document.createElement( "a" ); + ajaxLocation.href = ""; + ajaxLocation = ajaxLocation.href; +} + +// Segment location into parts +ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || []; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, list, placeBefore, + dataTypes = dataTypeExpression.toLowerCase().split( core_rspace ), + i = 0, + length = dataTypes.length; + + if ( jQuery.isFunction( func ) ) { + // For each dataType in the dataTypeExpression + for ( ; i < length; i++ ) { + dataType = dataTypes[ i ]; + // We control if we're asked to add before + // any existing element + placeBefore = /^\+/.test( dataType ); + if ( placeBefore ) { + dataType = dataType.substr( 1 ) || "*"; + } + list = structure[ dataType ] = structure[ dataType ] || []; + // then we add to the structure accordingly + list[ placeBefore ? "unshift" : "push" ]( func ); + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR, + dataType /* internal */, inspected /* internal */ ) { + + dataType = dataType || options.dataTypes[ 0 ]; + inspected = inspected || {}; + + inspected[ dataType ] = true; + + var selection, + list = structure[ dataType ], + i = 0, + length = list ? list.length : 0, + executeOnly = ( structure === prefilters ); + + for ( ; i < length && ( executeOnly || !selection ); i++ ) { + selection = list[ i ]( options, originalOptions, jqXHR ); + // If we got redirected to another dataType + // we try there if executing only and not done already + if ( typeof selection === "string" ) { + if ( !executeOnly || inspected[ selection ] ) { + selection = undefined; + } else { + options.dataTypes.unshift( selection ); + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, selection, inspected ); + } + } + } + // If we're only executing or nothing was selected + // we try the catchall dataType if not done already + if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) { + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, "*", inspected ); + } + // unnecessary when only executing (prefilters) + // but it'll be ignored by the caller in that case + return selection; +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } +} + +jQuery.fn.load = function( url, params, callback ) { + if ( typeof url !== "string" && _load ) { + return _load.apply( this, arguments ); + } + + // Don't do a request if no elements are being requested + if ( !this.length ) { + return this; + } + + var selector, type, response, + self = this, + off = url.indexOf(" "); + + if ( off >= 0 ) { + selector = url.slice( off, url.length ); + url = url.slice( 0, off ); + } + + // If it's a function + if ( jQuery.isFunction( params ) ) { + + // We assume that it's the callback + callback = params; + params = undefined; + + // Otherwise, build a param string + } else if ( params && typeof params === "object" ) { + type = "POST"; + } + + // Request the remote document + jQuery.ajax({ + url: url, + + // if "type" variable is undefined, then "GET" method will be used + type: type, + dataType: "html", + data: params, + complete: function( jqXHR, status ) { + if ( callback ) { + self.each( callback, response || [ jqXHR.responseText, status, jqXHR ] ); + } + } + }).done(function( responseText ) { + + // Save response for use in complete callback + response = arguments; + + // See if a selector was specified + self.html( selector ? + + // Create a dummy div to hold the results + jQuery("
      ") + + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append( responseText.replace( rscript, "" ) ) + + // Locate the specified elements + .find( selector ) : + + // If not, just inject the full result + responseText ); + + }); + + return this; +}; + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){ + jQuery.fn[ o ] = function( f ){ + return this.on( o, f ); + }; +}); + +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + // shift arguments if data argument was omitted + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + return jQuery.ajax({ + type: method, + url: url, + data: data, + success: callback, + dataType: type + }); + }; +}); + +jQuery.extend({ + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + if ( settings ) { + // Building a settings object + ajaxExtend( target, jQuery.ajaxSettings ); + } else { + // Extending ajaxSettings + settings = target; + target = jQuery.ajaxSettings; + } + ajaxExtend( target, settings ); + return target; + }, + + ajaxSettings: { + url: ajaxLocation, + isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ), + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + processData: true, + async: true, + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + text: "text/plain", + json: "application/json, text/javascript", + "*": allTypes + }, + + contents: { + xml: /xml/, + html: /html/, + json: /json/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText" + }, + + // List of data converters + // 1) key format is "source_type destination_type" (a single space in-between) + // 2) the catchall symbol "*" can be used for source_type + converters: { + + // Convert anything to text + "* text": window.String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": jQuery.parseJSON, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + context: true, + url: true + } + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var // ifModified key + ifModifiedKey, + // Response headers + responseHeadersString, + responseHeaders, + // transport + transport, + // timeout handle + timeoutTimer, + // Cross-domain detection vars + parts, + // To know if global events are to be dispatched + fireGlobals, + // Loop variable + i, + // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + // Callbacks context + callbackContext = s.context || s, + // Context for global events + // It's the callbackContext if one was provided in the options + // and if it's a DOM node or a jQuery collection + globalEventContext = callbackContext !== s && + ( callbackContext.nodeType || callbackContext instanceof jQuery ) ? + jQuery( callbackContext ) : jQuery.event, + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + // Status-dependent callbacks + statusCode = s.statusCode || {}, + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + // The jqXHR state + state = 0, + // Default abort message + strAbort = "canceled", + // Fake xhr + jqXHR = { + + readyState: 0, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( !state ) { + var lname = name.toLowerCase(); + name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Raw string + getAllResponseHeaders: function() { + return state === 2 ? responseHeadersString : null; + }, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( state === 2 ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[1].toLowerCase() ] = match[ 2 ]; + } + } + match = responseHeaders[ key.toLowerCase() ]; + } + return match === undefined ? null : match; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( !state ) { + s.mimeType = type; + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + statusText = statusText || strAbort; + if ( transport ) { + transport.abort( statusText ); + } + done( 0, statusText ); + return this; + } + }; + + // Callback for when everything is done + // It is defined here because jslint complains if it is declared + // at the end of the function (which would be more logical and readable) + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Called once + if ( state === 2 ) { + return; + } + + // State is "done" now + state = 2; + + // Clear timeout if it exists + if ( timeoutTimer ) { + clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); + } + + // If successful, handle type chaining + if ( status >= 200 && status < 300 || status === 304 ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + + modified = jqXHR.getResponseHeader("Last-Modified"); + if ( modified ) { + jQuery.lastModified[ ifModifiedKey ] = modified; + } + modified = jqXHR.getResponseHeader("Etag"); + if ( modified ) { + jQuery.etag[ ifModifiedKey ] = modified; + } + } + + // If not modified + if ( status === 304 ) { + + statusText = "notmodified"; + isSuccess = true; + + // If we have data + } else { + + isSuccess = ajaxConvert( s, response ); + statusText = isSuccess.state; + success = isSuccess.data; + error = isSuccess.error; + isSuccess = !error; + } + } else { + // We extract error from statusText + // then normalize statusText and status for non-aborts + error = statusText; + if ( !statusText || status ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = ( nativeStatusText || statusText ) + ""; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ), + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + // Attach deferreds + deferred.promise( jqXHR ); + jqXHR.success = jqXHR.done; + jqXHR.error = jqXHR.fail; + jqXHR.complete = completeDeferred.add; + + // Status-dependent callbacks + jqXHR.statusCode = function( map ) { + if ( map ) { + var tmp; + if ( state < 2 ) { + for ( tmp in map ) { + statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ]; + } + } else { + tmp = map[ jqXHR.status ]; + jqXHR.always( tmp ); + } + } + return this; + }; + + // Remove hash character (#7531: and string promotion) + // Add protocol if not provided (#5866: IE7 issue with protocol-less urls) + // We also use the url parameter if available + s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" ); + + // Extract dataTypes list + s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( core_rspace ); + + // A cross-domain request is in order when we have a protocol:host:port mismatch + if ( s.crossDomain == null ) { + parts = rurl.exec( s.url.toLowerCase() ) || false; + s.crossDomain = parts && ( parts.join(":") + ( parts[ 3 ] ? "" : parts[ 1 ] === "http:" ? 80 : 443 ) ) !== + ( ajaxLocParts.join(":") + ( ajaxLocParts[ 3 ] ? "" : ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ); + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefilter, stop there + if ( state === 2 ) { + return jqXHR; + } + + // We can fire global events as of now if asked to + fireGlobals = s.global; + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // If data is available, append data to url + if ( s.data ) { + s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data; + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Get ifModifiedKey before adding the anti-cache parameter + ifModifiedKey = s.url; + + // Add anti-cache in url if needed + if ( s.cache === false ) { + + var ts = jQuery.now(), + // try replacing _= if it is there + ret = s.url.replace( rts, "$1_=" + ts ); + + // if nothing was replaced, add timestamp to the end + s.url = ret + ( ( ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + ifModifiedKey = ifModifiedKey || s.url; + if ( jQuery.lastModified[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] ); + } + if ( jQuery.etag[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] ); + } + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ? + s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) { + // Abort if not done already and return + return jqXHR.abort(); + + } + + // aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + for ( i in { success: 1, error: 1, complete: 1 } ) { + jqXHR[ i ]( s[ i ] ); + } + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = setTimeout( function(){ + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + state = 1; + transport.send( requestHeaders, done ); + } catch (e) { + // Propagate exception as error if not done + if ( state < 2 ) { + done( -1, e ); + // Simply rethrow otherwise + } else { + throw e; + } + } + } + + return jqXHR; + }, + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {} + +}); + +/* Handles responses to an ajax request: + * - sets all responseXXX fields accordingly + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes, + responseFields = s.responseFields; + + // Fill responseXXX fields + for ( type in responseFields ) { + if ( type in responses ) { + jqXHR[ responseFields[type] ] = responses[ type ]; + } + } + + // Remove auto dataType and get content-type in the process + while( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "content-type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +// Chain conversions given the request and the original response +function ajaxConvert( s, response ) { + + var conv, conv2, current, tmp, + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(), + prev = dataTypes[ 0 ], + converters = {}, + i = 0; + + // Apply the dataFilter if provided + if ( s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } + + // Convert to each sequential dataType, tolerating list modification + for ( ; (current = dataTypes[++i]); ) { + + // There's only work to do if current dataType is non-auto + if ( current !== "*" ) { + + // Convert response if prev dataType is non-auto and differs from current + if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split(" "); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.splice( i--, 0, current ); + } + + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s["throws"] ) { + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { state: "parsererror", error: conv ? e : "No conversion from " + prev + " to " + current }; + } + } + } + } + + // Update prev for next iteration + prev = current; + } + } + + return { state: "success", data: response }; +} +var oldCallbacks = [], + rquestion = /\?/, + rjsonp = /(=)\?(?=&|$)|\?\?/, + nonce = jQuery.now(); + +// Default jsonp settings +jQuery.ajaxSetup({ + jsonp: "callback", + jsonpCallback: function() { + var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce++ ) ); + this[ callback ] = true; + return callback; + } +}); + +// Detect, normalize options and install callbacks for jsonp requests +jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { + + var callbackName, overwritten, responseContainer, + data = s.data, + url = s.url, + hasCallback = s.jsonp !== false, + replaceInUrl = hasCallback && rjsonp.test( url ), + replaceInData = hasCallback && !replaceInUrl && typeof data === "string" && + !( s.contentType || "" ).indexOf("application/x-www-form-urlencoded") && + rjsonp.test( data ); + + // Handle iff the expected data type is "jsonp" or we have a parameter to set + if ( s.dataTypes[ 0 ] === "jsonp" || replaceInUrl || replaceInData ) { + + // Get callback name, remembering preexisting value associated with it + callbackName = s.jsonpCallback = jQuery.isFunction( s.jsonpCallback ) ? + s.jsonpCallback() : + s.jsonpCallback; + overwritten = window[ callbackName ]; + + // Insert callback into url or form data + if ( replaceInUrl ) { + s.url = url.replace( rjsonp, "$1" + callbackName ); + } else if ( replaceInData ) { + s.data = data.replace( rjsonp, "$1" + callbackName ); + } else if ( hasCallback ) { + s.url += ( rquestion.test( url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName; + } + + // Use data converter to retrieve json after script execution + s.converters["script json"] = function() { + if ( !responseContainer ) { + jQuery.error( callbackName + " was not called" ); + } + return responseContainer[ 0 ]; + }; + + // force json dataType + s.dataTypes[ 0 ] = "json"; + + // Install callback + window[ callbackName ] = function() { + responseContainer = arguments; + }; + + // Clean-up function (fires after converters) + jqXHR.always(function() { + // Restore preexisting value + window[ callbackName ] = overwritten; + + // Save back as free + if ( s[ callbackName ] ) { + // make sure that re-using the options doesn't screw things around + s.jsonpCallback = originalSettings.jsonpCallback; + + // save the callback name for future use + oldCallbacks.push( callbackName ); + } + + // Call if it was a function and we have a response + if ( responseContainer && jQuery.isFunction( overwritten ) ) { + overwritten( responseContainer[ 0 ] ); + } + + responseContainer = overwritten = undefined; + }); + + // Delegate to script + return "script"; + } +}); +// Install script dataType +jQuery.ajaxSetup({ + accepts: { + script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /javascript|ecmascript/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +}); + +// Handle cache's special case and global +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + s.global = false; + } +}); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function(s) { + + // This transport only deals with cross domain requests + if ( s.crossDomain ) { + + var script, + head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement; + + return { + + send: function( _, callback ) { + + script = document.createElement( "script" ); + + script.async = "async"; + + if ( s.scriptCharset ) { + script.charset = s.scriptCharset; + } + + script.src = s.url; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function( _, isAbort ) { + + if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) { + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + + // Remove the script + if ( head && script.parentNode ) { + head.removeChild( script ); + } + + // Dereference the script + script = undefined; + + // Callback if not abort + if ( !isAbort ) { + callback( 200, "success" ); + } + } + }; + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709 and #4378). + head.insertBefore( script, head.firstChild ); + }, + + abort: function() { + if ( script ) { + script.onload( 0, 1 ); + } + } + }; + } +}); +var xhrCallbacks, + // #5280: Internet Explorer will keep connections alive if we don't abort on unload + xhrOnUnloadAbort = window.ActiveXObject ? function() { + // Abort all pending requests + for ( var key in xhrCallbacks ) { + xhrCallbacks[ key ]( 0, 1 ); + } + } : false, + xhrId = 0; + +// Functions to create xhrs +function createStandardXHR() { + try { + return new window.XMLHttpRequest(); + } catch( e ) {} +} + +function createActiveXHR() { + try { + return new window.ActiveXObject( "Microsoft.XMLHTTP" ); + } catch( e ) {} +} + +// Create the request object +// (This is still attached to ajaxSettings for backward compatibility) +jQuery.ajaxSettings.xhr = window.ActiveXObject ? + /* Microsoft failed to properly + * implement the XMLHttpRequest in IE7 (can't request local files), + * so we use the ActiveXObject when it is available + * Additionally XMLHttpRequest can be disabled in IE7/IE8 so + * we need a fallback. + */ + function() { + return !this.isLocal && createStandardXHR() || createActiveXHR(); + } : + // For all other browsers, use the standard XMLHttpRequest object + createStandardXHR; + +// Determine support properties +(function( xhr ) { + jQuery.extend( jQuery.support, { + ajax: !!xhr, + cors: !!xhr && ( "withCredentials" in xhr ) + }); +})( jQuery.ajaxSettings.xhr() ); + +// Create transport if the browser can provide an xhr +if ( jQuery.support.ajax ) { + + jQuery.ajaxTransport(function( s ) { + // Cross domain only allowed if supported through XMLHttpRequest + if ( !s.crossDomain || jQuery.support.cors ) { + + var callback; + + return { + send: function( headers, complete ) { + + // Get a new xhr + var handle, i, + xhr = s.xhr(); + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if ( s.username ) { + xhr.open( s.type, s.url, s.async, s.username, s.password ); + } else { + xhr.open( s.type, s.url, s.async ); + } + + // Apply custom fields if provided + if ( s.xhrFields ) { + for ( i in s.xhrFields ) { + xhr[ i ] = s.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( s.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( s.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !s.crossDomain && !headers["X-Requested-With"] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + } catch( _ ) {} + + // Do send the request + // This may raise an exception which is actually + // handled in jQuery.ajax (so no try/catch here) + xhr.send( ( s.hasContent && s.data ) || null ); + + // Listener + callback = function( _, isAbort ) { + + var status, + statusText, + responseHeaders, + responses, + xml; + + // Firefox throws exceptions when accessing properties + // of an xhr when a network error occurred + // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE) + try { + + // Was never called and is aborted or complete + if ( callback && ( isAbort || xhr.readyState === 4 ) ) { + + // Only called once + callback = undefined; + + // Do not keep as active anymore + if ( handle ) { + xhr.onreadystatechange = jQuery.noop; + if ( xhrOnUnloadAbort ) { + delete xhrCallbacks[ handle ]; + } + } + + // If it's an abort + if ( isAbort ) { + // Abort it manually if needed + if ( xhr.readyState !== 4 ) { + xhr.abort(); + } + } else { + status = xhr.status; + responseHeaders = xhr.getAllResponseHeaders(); + responses = {}; + xml = xhr.responseXML; + + // Construct response list + if ( xml && xml.documentElement /* #4958 */ ) { + responses.xml = xml; + } + + // When requesting binary data, IE6-9 will throw an exception + // on any attempt to access responseText (#11426) + try { + responses.text = xhr.responseText; + } catch( _ ) { + } + + // Firefox throws an exception when accessing + // statusText for faulty cross-domain requests + try { + statusText = xhr.statusText; + } catch( e ) { + // We normalize with Webkit giving an empty statusText + statusText = ""; + } + + // Filter status for non standard behaviors + + // If the request is local and we have data: assume a success + // (success with no data won't get notified, that's the best we + // can do given current implementations) + if ( !status && s.isLocal && !s.crossDomain ) { + status = responses.text ? 200 : 404; + // IE - #1450: sometimes returns 1223 when it should be 204 + } else if ( status === 1223 ) { + status = 204; + } + } + } + } catch( firefoxAccessException ) { + if ( !isAbort ) { + complete( -1, firefoxAccessException ); + } + } + + // Call complete if needed + if ( responses ) { + complete( status, statusText, responses, responseHeaders ); + } + }; + + if ( !s.async ) { + // if we're in sync mode we fire the callback + callback(); + } else if ( xhr.readyState === 4 ) { + // (IE6 & IE7) if it's in cache and has been + // retrieved directly we need to fire the callback + setTimeout( callback, 0 ); + } else { + handle = ++xhrId; + if ( xhrOnUnloadAbort ) { + // Create the active xhrs callbacks list if needed + // and attach the unload handler + if ( !xhrCallbacks ) { + xhrCallbacks = {}; + jQuery( window ).unload( xhrOnUnloadAbort ); + } + // Add to list of active xhrs callbacks + xhrCallbacks[ handle ] = callback; + } + xhr.onreadystatechange = callback; + } + }, + + abort: function() { + if ( callback ) { + callback(0,1); + } + } + }; + } + }); +} +var fxNow, timerId, + rfxtypes = /^(?:toggle|show|hide)$/, + rfxnum = new RegExp( "^(?:([-+])=|)(" + core_pnum + ")([a-z%]*)$", "i" ), + rrun = /queueHooks$/, + animationPrefilters = [ defaultPrefilter ], + tweeners = { + "*": [function( prop, value ) { + var end, unit, + tween = this.createTween( prop, value ), + parts = rfxnum.exec( value ), + target = tween.cur(), + start = +target || 0, + scale = 1, + maxIterations = 20; + + if ( parts ) { + end = +parts[2]; + unit = parts[3] || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + + // We need to compute starting value + if ( unit !== "px" && start ) { + // Iteratively approximate from a nonzero starting point + // Prefer the current property, because this process will be trivial if it uses the same units + // Fallback to end or a simple constant + start = jQuery.css( tween.elem, prop, true ) || end || 1; + + do { + // If previous iteration zeroed out, double until we get *something* + // Use a string for doubling factor so we don't accidentally see scale as unchanged below + scale = scale || ".5"; + + // Adjust and apply + start = start / scale; + jQuery.style( tween.elem, prop, start + unit ); + + // Update scale, tolerating zero or NaN from tween.cur() + // And breaking the loop if scale is unchanged or perfect, or if we've just had enough + } while ( scale !== (scale = tween.cur() / target) && scale !== 1 && --maxIterations ); + } + + tween.unit = unit; + tween.start = start; + // If a +=/-= token was provided, we're doing a relative animation + tween.end = parts[1] ? start + ( parts[1] + 1 ) * end : end; + } + return tween; + }] + }; + +// Animations created synchronously will run synchronously +function createFxNow() { + setTimeout(function() { + fxNow = undefined; + }, 0 ); + return ( fxNow = jQuery.now() ); +} + +function createTweens( animation, props ) { + jQuery.each( props, function( prop, value ) { + var collection = ( tweeners[ prop ] || [] ).concat( tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( collection[ index ].call( animation, prop, value ) ) { + + // we're done with this property + return; + } + } + }); +} + +function Animation( elem, properties, options ) { + var result, + index = 0, + tweenerIndex = 0, + length = animationPrefilters.length, + deferred = jQuery.Deferred().always( function() { + // don't match elem in the :animated selector + delete tick.elem; + }), + tick = function() { + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), + percent = 1 - ( remaining / animation.duration || 0 ), + index = 0, + length = animation.tweens.length; + + for ( ; index < length ; index++ ) { + animation.tweens[ index ].run( percent ); + } + + deferred.notifyWith( elem, [ animation, percent, remaining ]); + + if ( percent < 1 && length ) { + return remaining; + } else { + deferred.resolveWith( elem, [ animation ] ); + return false; + } + }, + animation = deferred.promise({ + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { specialEasing: {} }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end, easing ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, + // if we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + + for ( ; index < length ; index++ ) { + animation.tweens[ index ].run( 1 ); + } + + // resolve when we played the last frame + // otherwise, reject + if ( gotoEnd ) { + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; + } + }), + props = animation.props; + + propFilter( props, animation.opts.specialEasing ); + + for ( ; index < length ; index++ ) { + result = animationPrefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + return result; + } + } + + createTweens( animation, props ); + + if ( jQuery.isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); + } + + jQuery.fx.timer( + jQuery.extend( tick, { + anim: animation, + queue: animation.opts.queue, + elem: elem + }) + ); + + // attach callbacks from options + return animation.progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); +} + +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = jQuery.camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( jQuery.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; + } + + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; + } + + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; + + // not quite $.extend, this wont overwrite keys already present. + // also - reusing 'index' from above because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; + } + } +} + +jQuery.Animation = jQuery.extend( Animation, { + + tweener: function( props, callback ) { + if ( jQuery.isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.split(" "); + } + + var prop, + index = 0, + length = props.length; + + for ( ; index < length ; index++ ) { + prop = props[ index ]; + tweeners[ prop ] = tweeners[ prop ] || []; + tweeners[ prop ].unshift( callback ); + } + }, + + prefilter: function( callback, prepend ) { + if ( prepend ) { + animationPrefilters.unshift( callback ); + } else { + animationPrefilters.push( callback ); + } + } +}); + +function defaultPrefilter( elem, props, opts ) { + var index, prop, value, length, dataShow, tween, hooks, oldfire, + anim = this, + style = elem.style, + orig = {}, + handled = [], + hidden = elem.nodeType && isHidden( elem ); + + // handle queue: false promises + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always(function() { + // doing this makes sure that the complete handler will be called + // before this completes + anim.always(function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + }); + }); + } + + // height/width overflow pass + if ( elem.nodeType === 1 && ( "height" in props || "width" in props ) ) { + // Make sure that nothing sneaks out + // Record all 3 overflow attributes because IE does not + // change the overflow attribute when overflowX and + // overflowY are set to the same value + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; + + // Set display property to inline-block for height/width + // animations on inline elements that are having width/height animated + if ( jQuery.css( elem, "display" ) === "inline" && + jQuery.css( elem, "float" ) === "none" ) { + + // inline-level elements accept inline-block; + // block-level elements need to be inline with layout + if ( !jQuery.support.inlineBlockNeedsLayout || css_defaultDisplay( elem.nodeName ) === "inline" ) { + style.display = "inline-block"; + + } else { + style.zoom = 1; + } + } + } + + if ( opts.overflow ) { + style.overflow = "hidden"; + if ( !jQuery.support.shrinkWrapBlocks ) { + anim.done(function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + }); + } + } + + + // show/hide pass + for ( index in props ) { + value = props[ index ]; + if ( rfxtypes.exec( value ) ) { + delete props[ index ]; + if ( value === ( hidden ? "hide" : "show" ) ) { + continue; + } + handled.push( index ); + } + } + + length = handled.length; + if ( length ) { + dataShow = jQuery._data( elem, "fxshow" ) || jQuery._data( elem, "fxshow", {} ); + if ( hidden ) { + jQuery( elem ).show(); + } else { + anim.done(function() { + jQuery( elem ).hide(); + }); + } + anim.done(function() { + var prop; + jQuery.removeData( elem, "fxshow", true ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + }); + for ( index = 0 ; index < length ; index++ ) { + prop = handled[ index ]; + tween = anim.createTween( prop, hidden ? dataShow[ prop ] : 0 ); + orig[ prop ] = dataShow[ prop ] || jQuery.style( elem, prop ); + + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = tween.start; + if ( hidden ) { + tween.end = tween.start; + tween.start = prop === "width" || prop === "height" ? 1 : 0; + } + } + } + } +} + +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; + +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || "swing"; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; + + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; + + if ( this.options.duration ) { + this.pos = eased = jQuery.easing[ this.easing ]( + percent, this.options.duration * percent, 0, 1, this.options.duration + ); + } else { + this.pos = eased = percent; + } + this.now = ( this.end - this.start ) * eased + this.start; + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); + } + return this; + } +}; + +Tween.prototype.init.prototype = Tween.prototype; + +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; + + if ( tween.elem[ tween.prop ] != null && + (!tween.elem.style || tween.elem.style[ tween.prop ] == null) ) { + return tween.elem[ tween.prop ]; + } + + // passing any value as a 4th parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails + // so, simple values such as "10px" are parsed to Float. + // complex values such as "rotate(1rad)" are returned as is. + result = jQuery.css( tween.elem, tween.prop, false, "" ); + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + // use step hook for back compat - use cssHook if its there - use .style if its + // available and use plain properties where available + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.style && ( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null || jQuery.cssHooks[ tween.prop ] ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } +}; + +// Remove in 2.0 - this supports IE8's panic based approach +// to setting things on disconnected nodes + +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } + } +}; + +jQuery.each([ "toggle", "show", "hide" ], function( i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" || + // special check for .toggle( handler, handler, ... ) + ( !i && jQuery.isFunction( speed ) && jQuery.isFunction( easing ) ) ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +}); + +jQuery.fn.extend({ + fadeTo: function( speed, to, easing, callback ) { + + // show any hidden elements after setting opacity to 0 + return this.filter( isHidden ).css( "opacity", 0 ).show() + + // animate to the value specified + .end().animate({ opacity: to }, speed, easing, callback ); + }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); + + // Empty animations resolve immediately + if ( empty ) { + anim.stop( true ); + } + }; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; + + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue && type !== false ) { + this.queue( type || "fx", [] ); + } + + return this.each(function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = jQuery._data( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && (type == null || timers[ index ].queue === type) ) { + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } + } + + // start the next in the queue if the last step wasn't forced + // timers currently will call their complete callbacks, which will dequeue + // but only if they were gotoEnd + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); + } + }); + } +}); + +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + attrs = { height: type }, + i = 0; + + // if we include width, step value is 1 to do all cssExpand values, + // if we don't include width, step value is 2 to skip over Left and Right + includeWidth = includeWidth? 1 : 0; + for( ; i < 4 ; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } + + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } + + return attrs; +} + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx("show"), + slideUp: genFx("hide"), + slideToggle: genFx("toggle"), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +}); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default; + + // normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function() { + if ( jQuery.isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } + }; + + return opt; +}; + +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p*Math.PI ) / 2; + } +}; + +jQuery.timers = []; +jQuery.fx = Tween.prototype.init; +jQuery.fx.tick = function() { + var timer, + timers = jQuery.timers, + i = 0; + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + // Checks the timer has not already been removed + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } +}; + +jQuery.fx.timer = function( timer ) { + if ( timer() && jQuery.timers.push( timer ) && !timerId ) { + timerId = setInterval( jQuery.fx.tick, jQuery.fx.interval ); + } +}; + +jQuery.fx.interval = 13; + +jQuery.fx.stop = function() { + clearInterval( timerId ); + timerId = null; +}; + +jQuery.fx.speeds = { + slow: 600, + fast: 200, + // Default speed + _default: 400 +}; + +// Back Compat <1.8 extension point +jQuery.fx.step = {}; + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.animated = function( elem ) { + return jQuery.grep(jQuery.timers, function( fn ) { + return elem === fn.elem; + }).length; + }; +} +var rroot = /^(?:body|html)$/i; + +jQuery.fn.offset = function( options ) { + if ( arguments.length ) { + return options === undefined ? + this : + this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + var docElem, body, win, clientTop, clientLeft, scrollTop, scrollLeft, + box = { top: 0, left: 0 }, + elem = this[ 0 ], + doc = elem && elem.ownerDocument; + + if ( !doc ) { + return; + } + + if ( (body = doc.body) === elem ) { + return jQuery.offset.bodyOffset( elem ); + } + + docElem = doc.documentElement; + + // Make sure it's not a disconnected DOM node + if ( !jQuery.contains( docElem, elem ) ) { + return box; + } + + // If we don't have gBCR, just use 0,0 rather than error + // BlackBerry 5, iOS 3 (original iPhone) + if ( typeof elem.getBoundingClientRect !== "undefined" ) { + box = elem.getBoundingClientRect(); + } + win = getWindow( doc ); + clientTop = docElem.clientTop || body.clientTop || 0; + clientLeft = docElem.clientLeft || body.clientLeft || 0; + scrollTop = win.pageYOffset || docElem.scrollTop; + scrollLeft = win.pageXOffset || docElem.scrollLeft; + return { + top: box.top + scrollTop - clientTop, + left: box.left + scrollLeft - clientLeft + }; +}; + +jQuery.offset = { + + bodyOffset: function( body ) { + var top = body.offsetTop, + left = body.offsetLeft; + + if ( jQuery.support.doesNotIncludeMarginInBodyOffset ) { + top += parseFloat( jQuery.css(body, "marginTop") ) || 0; + left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; + } + + return { top: top, left: left }; + }, + + setOffset: function( elem, options, i ) { + var position = jQuery.css( elem, "position" ); + + // set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + var curElem = jQuery( elem ), + curOffset = curElem.offset(), + curCSSTop = jQuery.css( elem, "top" ), + curCSSLeft = jQuery.css( elem, "left" ), + calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1, + props = {}, curPosition = {}, curTop, curLeft; + + // need to be able to calculate position if either top or left is auto and position is either absolute or fixed + if ( calculatePosition ) { + curPosition = curElem.position(); + curTop = curPosition.top; + curLeft = curPosition.left; + } else { + curTop = parseFloat( curCSSTop ) || 0; + curLeft = parseFloat( curCSSLeft ) || 0; + } + + if ( jQuery.isFunction( options ) ) { + options = options.call( elem, i, curOffset ); + } + + if ( options.top != null ) { + props.top = ( options.top - curOffset.top ) + curTop; + } + if ( options.left != null ) { + props.left = ( options.left - curOffset.left ) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + } +}; + + +jQuery.fn.extend({ + + position: function() { + if ( !this[0] ) { + return; + } + + var elem = this[0], + + // Get *real* offsetParent + offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; + offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; + + // Add offsetParent borders + parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; + parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; + + // Subtract the two offsets + return { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + }, + + offsetParent: function() { + return this.map(function() { + var offsetParent = this.offsetParent || document.body; + while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { + offsetParent = offsetParent.offsetParent; + } + return offsetParent || document.body; + }); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( {scrollLeft: "pageXOffset", scrollTop: "pageYOffset"}, function( method, prop ) { + var top = /Y/.test( prop ); + + jQuery.fn[ method ] = function( val ) { + return jQuery.access( this, function( elem, method, val ) { + var win = getWindow( elem ); + + if ( val === undefined ) { + return win ? (prop in win) ? win[ prop ] : + win.document.documentElement[ method ] : + elem[ method ]; + } + + if ( win ) { + win.scrollTo( + !top ? val : jQuery( win ).scrollLeft(), + top ? val : jQuery( win ).scrollTop() + ); + + } else { + elem[ method ] = val; + } + }, method, val, arguments.length, null ); + }; +}); + +function getWindow( elem ) { + return jQuery.isWindow( elem ) ? + elem : + elem.nodeType === 9 ? + elem.defaultView || elem.parentWindow : + false; +} +// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods +jQuery.each( { Height: "height", Width: "width" }, function( name, type ) { + jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name }, function( defaultExtra, funcName ) { + // margin is only for outerHeight, outerWidth + jQuery.fn[ funcName ] = function( margin, value ) { + var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ), + extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" ); + + return jQuery.access( this, function( elem, type, value ) { + var doc; + + if ( jQuery.isWindow( elem ) ) { + // As of 5/8/2012 this will yield incorrect results for Mobile Safari, but there + // isn't a whole lot we can do. See pull request at this URL for discussion: + // https://github.com/jquery/jquery/pull/764 + return elem.document.documentElement[ "client" + name ]; + } + + // Get document width or height + if ( elem.nodeType === 9 ) { + doc = elem.documentElement; + + // Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height], whichever is greatest + // unfortunately, this causes bug #3838 in IE6/8 only, but there is currently no good, small way to fix it. + return Math.max( + elem.body[ "scroll" + name ], doc[ "scroll" + name ], + elem.body[ "offset" + name ], doc[ "offset" + name ], + doc[ "client" + name ] + ); + } + + return value === undefined ? + // Get width or height on the element, requesting but not forcing parseFloat + jQuery.css( elem, type, value, extra ) : + + // Set width or height on the element + jQuery.style( elem, type, value, extra ); + }, type, chainable ? margin : undefined, chainable, null ); + }; + }); +}); +// Expose jQuery to the global object +window.jQuery = window.$ = jQuery; + +// Expose jQuery as an AMD module, but only for AMD loaders that +// understand the issues with loading multiple versions of jQuery +// in a page that all might call define(). The loader will indicate +// they have special allowances for multiple jQuery versions by +// specifying define.amd.jQuery = true. Register as a named module, +// since jQuery can be concatenated with other files that may use define, +// but not use a proper concatenation script that understands anonymous +// AMD modules. A named AMD is safest and most robust way to register. +// Lowercase jquery is used because AMD module names are derived from +// file names, and jQuery is normally delivered in a lowercase file name. +// Do this after creating the global so that if an AMD module wants to call +// noConflict to hide this version of jQuery, it will work. +if ( typeof define === "function" && define.amd && define.amd.jQuery ) { + define( "jquery", [], function () { return jQuery; } ); +} + +})( window ); diff --git a/modules/files/views/default/assets/jquery/jquery.min.js b/modules/files/views/default/assets/jquery/jquery.min.js new file mode 100755 index 0000000..f65cf1d --- /dev/null +++ b/modules/files/views/default/assets/jquery/jquery.min.js @@ -0,0 +1,2 @@ +/*! jQuery v1.8.2 jquery.com | jquery.org/license */ +(function(a,b){function G(a){var b=F[a]={};return p.each(a.split(s),function(a,c){b[c]=!0}),b}function J(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(I,"-$1").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:+d+""===d?+d:H.test(d)?p.parseJSON(d):d}catch(f){}p.data(a,c,d)}else d=b}return d}function K(a){var b;for(b in a){if(b==="data"&&p.isEmptyObject(a[b]))continue;if(b!=="toJSON")return!1}return!0}function ba(){return!1}function bb(){return!0}function bh(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function bi(a,b){do a=a[b];while(a&&a.nodeType!==1);return a}function bj(a,b,c){b=b||0;if(p.isFunction(b))return p.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return p.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=p.grep(a,function(a){return a.nodeType===1});if(be.test(b))return p.filter(b,d,!c);b=p.filter(b,d)}return p.grep(a,function(a,d){return p.inArray(a,b)>=0===c})}function bk(a){var b=bl.split("|"),c=a.createDocumentFragment();if(c.createElement)while(b.length)c.createElement(b.pop());return c}function bC(a,b){return a.getElementsByTagName(b)[0]||a.appendChild(a.ownerDocument.createElement(b))}function bD(a,b){if(b.nodeType!==1||!p.hasData(a))return;var c,d,e,f=p._data(a),g=p._data(b,f),h=f.events;if(h){delete g.handle,g.events={};for(c in h)for(d=0,e=h[c].length;d").appendTo(e.body),c=b.css("display");b.remove();if(c==="none"||c===""){bI=e.body.appendChild(bI||p.extend(e.createElement("iframe"),{frameBorder:0,width:0,height:0}));if(!bJ||!bI.createElement)bJ=(bI.contentWindow||bI.contentDocument).document,bJ.write(""),bJ.close();b=bJ.body.appendChild(bJ.createElement(a)),c=bH(b,"display"),e.body.removeChild(bI)}return bS[a]=c,c}function ci(a,b,c,d){var e;if(p.isArray(b))p.each(b,function(b,e){c||ce.test(a)?d(a,e):ci(a+"["+(typeof e=="object"?b:"")+"]",e,c,d)});else if(!c&&p.type(b)==="object")for(e in b)ci(a+"["+e+"]",b[e],c,d);else d(a,b)}function cz(a){return function(b,c){typeof b!="string"&&(c=b,b="*");var d,e,f,g=b.toLowerCase().split(s),h=0,i=g.length;if(p.isFunction(c))for(;h)[^>]*$|#([\w\-]*)$)/,v=/^<(\w+)\s*\/?>(?:<\/\1>|)$/,w=/^[\],:{}\s]*$/,x=/(?:^|:|,)(?:\s*\[)+/g,y=/\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g,z=/"[^"\\\r\n]*"|true|false|null|-?(?:\d\d*\.|)\d+(?:[eE][\-+]?\d+|)/g,A=/^-ms-/,B=/-([\da-z])/gi,C=function(a,b){return(b+"").toUpperCase()},D=function(){e.addEventListener?(e.removeEventListener("DOMContentLoaded",D,!1),p.ready()):e.readyState==="complete"&&(e.detachEvent("onreadystatechange",D),p.ready())},E={};p.fn=p.prototype={constructor:p,init:function(a,c,d){var f,g,h,i;if(!a)return this;if(a.nodeType)return this.context=this[0]=a,this.length=1,this;if(typeof a=="string"){a.charAt(0)==="<"&&a.charAt(a.length-1)===">"&&a.length>=3?f=[null,a,null]:f=u.exec(a);if(f&&(f[1]||!c)){if(f[1])return c=c instanceof p?c[0]:c,i=c&&c.nodeType?c.ownerDocument||c:e,a=p.parseHTML(f[1],i,!0),v.test(f[1])&&p.isPlainObject(c)&&this.attr.call(a,c,!0),p.merge(this,a);g=e.getElementById(f[2]);if(g&&g.parentNode){if(g.id!==f[2])return d.find(a);this.length=1,this[0]=g}return this.context=e,this.selector=a,this}return!c||c.jquery?(c||d).find(a):this.constructor(c).find(a)}return p.isFunction(a)?d.ready(a):(a.selector!==b&&(this.selector=a.selector,this.context=a.context),p.makeArray(a,this))},selector:"",jquery:"1.8.2",length:0,size:function(){return this.length},toArray:function(){return k.call(this)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=p.merge(this.constructor(),a);return d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")"),d},each:function(a,b){return p.each(this,a,b)},ready:function(a){return p.ready.promise().done(a),this},eq:function(a){return a=+a,a===-1?this.slice(a):this.slice(a,a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(k.apply(this,arguments),"slice",k.call(arguments).join(","))},map:function(a){return this.pushStack(p.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:j,sort:[].sort,splice:[].splice},p.fn.init.prototype=p.fn,p.extend=p.fn.extend=function(){var a,c,d,e,f,g,h=arguments[0]||{},i=1,j=arguments.length,k=!1;typeof h=="boolean"&&(k=h,h=arguments[1]||{},i=2),typeof h!="object"&&!p.isFunction(h)&&(h={}),j===i&&(h=this,--i);for(;i0)return;d.resolveWith(e,[p]),p.fn.trigger&&p(e).trigger("ready").off("ready")},isFunction:function(a){return p.type(a)==="function"},isArray:Array.isArray||function(a){return p.type(a)==="array"},isWindow:function(a){return a!=null&&a==a.window},isNumeric:function(a){return!isNaN(parseFloat(a))&&isFinite(a)},type:function(a){return a==null?String(a):E[m.call(a)]||"object"},isPlainObject:function(a){if(!a||p.type(a)!=="object"||a.nodeType||p.isWindow(a))return!1;try{if(a.constructor&&!n.call(a,"constructor")&&!n.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(c){return!1}var d;for(d in a);return d===b||n.call(a,d)},isEmptyObject:function(a){var b;for(b in a)return!1;return!0},error:function(a){throw new Error(a)},parseHTML:function(a,b,c){var d;return!a||typeof a!="string"?null:(typeof b=="boolean"&&(c=b,b=0),b=b||e,(d=v.exec(a))?[b.createElement(d[1])]:(d=p.buildFragment([a],b,c?null:[]),p.merge([],(d.cacheable?p.clone(d.fragment):d.fragment).childNodes)))},parseJSON:function(b){if(!b||typeof b!="string")return null;b=p.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(w.test(b.replace(y,"@").replace(z,"]").replace(x,"")))return(new Function("return "+b))();p.error("Invalid JSON: "+b)},parseXML:function(c){var d,e;if(!c||typeof c!="string")return null;try{a.DOMParser?(e=new DOMParser,d=e.parseFromString(c,"text/xml")):(d=new ActiveXObject("Microsoft.XMLDOM"),d.async="false",d.loadXML(c))}catch(f){d=b}return(!d||!d.documentElement||d.getElementsByTagName("parsererror").length)&&p.error("Invalid XML: "+c),d},noop:function(){},globalEval:function(b){b&&r.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(A,"ms-").replace(B,C)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toLowerCase()===b.toLowerCase()},each:function(a,c,d){var e,f=0,g=a.length,h=g===b||p.isFunction(a);if(d){if(h){for(e in a)if(c.apply(a[e],d)===!1)break}else for(;f0&&a[0]&&a[i-1]||i===0||p.isArray(a));if(j)for(;h-1)i.splice(c,1),e&&(c<=g&&g--,c<=h&&h--)}),this},has:function(a){return p.inArray(a,i)>-1},empty:function(){return i=[],this},disable:function(){return i=j=c=b,this},disabled:function(){return!i},lock:function(){return j=b,c||l.disable(),this},locked:function(){return!j},fireWith:function(a,b){return b=b||[],b=[a,b.slice?b.slice():b],i&&(!d||j)&&(e?j.push(b):k(b)),this},fire:function(){return l.fireWith(this,arguments),this},fired:function(){return!!d}};return l},p.extend({Deferred:function(a){var b=[["resolve","done",p.Callbacks("once memory"),"resolved"],["reject","fail",p.Callbacks("once memory"),"rejected"],["notify","progress",p.Callbacks("memory")]],c="pending",d={state:function(){return c},always:function(){return e.done(arguments).fail(arguments),this},then:function(){var a=arguments;return p.Deferred(function(c){p.each(b,function(b,d){var f=d[0],g=a[b];e[d[1]](p.isFunction(g)?function(){var a=g.apply(this,arguments);a&&p.isFunction(a.promise)?a.promise().done(c.resolve).fail(c.reject).progress(c.notify):c[f+"With"](this===e?c:this,[a])}:c[f])}),a=null}).promise()},promise:function(a){return a!=null?p.extend(a,d):d}},e={};return d.pipe=d.then,p.each(b,function(a,f){var g=f[2],h=f[3];d[f[1]]=g.add,h&&g.add(function(){c=h},b[a^1][2].disable,b[2][2].lock),e[f[0]]=g.fire,e[f[0]+"With"]=g.fireWith}),d.promise(e),a&&a.call(e,e),e},when:function(a){var b=0,c=k.call(arguments),d=c.length,e=d!==1||a&&p.isFunction(a.promise)?d:0,f=e===1?a:p.Deferred(),g=function(a,b,c){return function(d){b[a]=this,c[a]=arguments.length>1?k.call(arguments):d,c===h?f.notifyWith(b,c):--e||f.resolveWith(b,c)}},h,i,j;if(d>1){h=new Array(d),i=new Array(d),j=new Array(d);for(;b
      a",c=n.getElementsByTagName("*"),d=n.getElementsByTagName("a")[0],d.style.cssText="top:1px;float:left;opacity:.5";if(!c||!c.length)return{};f=e.createElement("select"),g=f.appendChild(e.createElement("option")),h=n.getElementsByTagName("input")[0],b={leadingWhitespace:n.firstChild.nodeType===3,tbody:!n.getElementsByTagName("tbody").length,htmlSerialize:!!n.getElementsByTagName("link").length,style:/top/.test(d.getAttribute("style")),hrefNormalized:d.getAttribute("href")==="/a",opacity:/^0.5/.test(d.style.opacity),cssFloat:!!d.style.cssFloat,checkOn:h.value==="on",optSelected:g.selected,getSetAttribute:n.className!=="t",enctype:!!e.createElement("form").enctype,html5Clone:e.createElement("nav").cloneNode(!0).outerHTML!=="<:nav>",boxModel:e.compatMode==="CSS1Compat",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0,boxSizingReliable:!0,pixelPosition:!1},h.checked=!0,b.noCloneChecked=h.cloneNode(!0).checked,f.disabled=!0,b.optDisabled=!g.disabled;try{delete n.test}catch(o){b.deleteExpando=!1}!n.addEventListener&&n.attachEvent&&n.fireEvent&&(n.attachEvent("onclick",m=function(){b.noCloneEvent=!1}),n.cloneNode(!0).fireEvent("onclick"),n.detachEvent("onclick",m)),h=e.createElement("input"),h.value="t",h.setAttribute("type","radio"),b.radioValue=h.value==="t",h.setAttribute("checked","checked"),h.setAttribute("name","t"),n.appendChild(h),i=e.createDocumentFragment(),i.appendChild(n.lastChild),b.checkClone=i.cloneNode(!0).cloneNode(!0).lastChild.checked,b.appendChecked=h.checked,i.removeChild(h),i.appendChild(n);if(n.attachEvent)for(k in{submit:!0,change:!0,focusin:!0})j="on"+k,l=j in n,l||(n.setAttribute(j,"return;"),l=typeof n[j]=="function"),b[k+"Bubbles"]=l;return p(function(){var c,d,f,g,h="padding:0;margin:0;border:0;display:block;overflow:hidden;",i=e.getElementsByTagName("body")[0];if(!i)return;c=e.createElement("div"),c.style.cssText="visibility:hidden;border:0;width:0;height:0;position:static;top:0;margin-top:1px",i.insertBefore(c,i.firstChild),d=e.createElement("div"),c.appendChild(d),d.innerHTML="
      t
      ",f=d.getElementsByTagName("td"),f[0].style.cssText="padding:0;margin:0;border:0;display:none",l=f[0].offsetHeight===0,f[0].style.display="",f[1].style.display="none",b.reliableHiddenOffsets=l&&f[0].offsetHeight===0,d.innerHTML="",d.style.cssText="box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;",b.boxSizing=d.offsetWidth===4,b.doesNotIncludeMarginInBodyOffset=i.offsetTop!==1,a.getComputedStyle&&(b.pixelPosition=(a.getComputedStyle(d,null)||{}).top!=="1%",b.boxSizingReliable=(a.getComputedStyle(d,null)||{width:"4px"}).width==="4px",g=e.createElement("div"),g.style.cssText=d.style.cssText=h,g.style.marginRight=g.style.width="0",d.style.width="1px",d.appendChild(g),b.reliableMarginRight=!parseFloat((a.getComputedStyle(g,null)||{}).marginRight)),typeof d.style.zoom!="undefined"&&(d.innerHTML="",d.style.cssText=h+"width:1px;padding:1px;display:inline;zoom:1",b.inlineBlockNeedsLayout=d.offsetWidth===3,d.style.display="block",d.style.overflow="visible",d.innerHTML="
      ",d.firstChild.style.width="5px",b.shrinkWrapBlocks=d.offsetWidth!==3,c.style.zoom=1),i.removeChild(c),c=d=f=g=null}),i.removeChild(n),c=d=f=g=h=i=n=null,b}();var H=/(?:\{[\s\S]*\}|\[[\s\S]*\])$/,I=/([A-Z])/g;p.extend({cache:{},deletedIds:[],uuid:0,expando:"jQuery"+(p.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){return a=a.nodeType?p.cache[a[p.expando]]:a[p.expando],!!a&&!K(a)},data:function(a,c,d,e){if(!p.acceptData(a))return;var f,g,h=p.expando,i=typeof c=="string",j=a.nodeType,k=j?p.cache:a,l=j?a[h]:a[h]&&h;if((!l||!k[l]||!e&&!k[l].data)&&i&&d===b)return;l||(j?a[h]=l=p.deletedIds.pop()||p.guid++:l=h),k[l]||(k[l]={},j||(k[l].toJSON=p.noop));if(typeof c=="object"||typeof c=="function")e?k[l]=p.extend(k[l],c):k[l].data=p.extend(k[l].data,c);return f=k[l],e||(f.data||(f.data={}),f=f.data),d!==b&&(f[p.camelCase(c)]=d),i?(g=f[c],g==null&&(g=f[p.camelCase(c)])):g=f,g},removeData:function(a,b,c){if(!p.acceptData(a))return;var d,e,f,g=a.nodeType,h=g?p.cache:a,i=g?a[p.expando]:p.expando;if(!h[i])return;if(b){d=c?h[i]:h[i].data;if(d){p.isArray(b)||(b in d?b=[b]:(b=p.camelCase(b),b in d?b=[b]:b=b.split(" ")));for(e=0,f=b.length;e1,null,!1))},removeData:function(a){return this.each(function(){p.removeData(this,a)})}}),p.extend({queue:function(a,b,c){var d;if(a)return b=(b||"fx")+"queue",d=p._data(a,b),c&&(!d||p.isArray(c)?d=p._data(a,b,p.makeArray(c)):d.push(c)),d||[]},dequeue:function(a,b){b=b||"fx";var c=p.queue(a,b),d=c.length,e=c.shift(),f=p._queueHooks(a,b),g=function(){p.dequeue(a,b)};e==="inprogress"&&(e=c.shift(),d--),e&&(b==="fx"&&c.unshift("inprogress"),delete f.stop,e.call(a,g,f)),!d&&f&&f.empty.fire()},_queueHooks:function(a,b){var c=b+"queueHooks";return p._data(a,c)||p._data(a,c,{empty:p.Callbacks("once memory").add(function(){p.removeData(a,b+"queue",!0),p.removeData(a,c,!0)})})}}),p.fn.extend({queue:function(a,c){var d=2;return typeof a!="string"&&(c=a,a="fx",d--),arguments.length1)},removeAttr:function(a){return this.each(function(){p.removeAttr(this,a)})},prop:function(a,b){return p.access(this,p.prop,a,b,arguments.length>1)},removeProp:function(a){return a=p.propFix[a]||a,this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){var b,c,d,e,f,g,h;if(p.isFunction(a))return this.each(function(b){p(this).addClass(a.call(this,b,this.className))});if(a&&typeof a=="string"){b=a.split(s);for(c=0,d=this.length;c=0)d=d.replace(" "+c[f]+" "," ");e.className=a?p.trim(d):""}}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";return p.isFunction(a)?this.each(function(c){p(this).toggleClass(a.call(this,c,this.className,b),b)}):this.each(function(){if(c==="string"){var e,f=0,g=p(this),h=b,i=a.split(s);while(e=i[f++])h=d?h:!g.hasClass(e),g[h?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&p._data(this,"__className__",this.className),this.className=this.className||a===!1?"":p._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ",c=0,d=this.length;for(;c=0)return!0;return!1},val:function(a){var c,d,e,f=this[0];if(!arguments.length){if(f)return c=p.valHooks[f.type]||p.valHooks[f.nodeName.toLowerCase()],c&&"get"in c&&(d=c.get(f,"value"))!==b?d:(d=f.value,typeof d=="string"?d.replace(P,""):d==null?"":d);return}return e=p.isFunction(a),this.each(function(d){var f,g=p(this);if(this.nodeType!==1)return;e?f=a.call(this,d,g.val()):f=a,f==null?f="":typeof f=="number"?f+="":p.isArray(f)&&(f=p.map(f,function(a){return a==null?"":a+""})),c=p.valHooks[this.type]||p.valHooks[this.nodeName.toLowerCase()];if(!c||!("set"in c)||c.set(this,f,"value")===b)this.value=f})}}),p.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c,d,e,f=a.selectedIndex,g=[],h=a.options,i=a.type==="select-one";if(f<0)return null;c=i?f:0,d=i?f+1:h.length;for(;c=0}),c.length||(a.selectedIndex=-1),c}}},attrFn:{},attr:function(a,c,d,e){var f,g,h,i=a.nodeType;if(!a||i===3||i===8||i===2)return;if(e&&p.isFunction(p.fn[c]))return p(a)[c](d);if(typeof a.getAttribute=="undefined")return p.prop(a,c,d);h=i!==1||!p.isXMLDoc(a),h&&(c=c.toLowerCase(),g=p.attrHooks[c]||(T.test(c)?M:L));if(d!==b){if(d===null){p.removeAttr(a,c);return}return g&&"set"in g&&h&&(f=g.set(a,d,c))!==b?f:(a.setAttribute(c,d+""),d)}return g&&"get"in g&&h&&(f=g.get(a,c))!==null?f:(f=a.getAttribute(c),f===null?b:f)},removeAttr:function(a,b){var c,d,e,f,g=0;if(b&&a.nodeType===1){d=b.split(s);for(;g=0}})});var V=/^(?:textarea|input|select)$/i,W=/^([^\.]*|)(?:\.(.+)|)$/,X=/(?:^|\s)hover(\.\S+|)\b/,Y=/^key/,Z=/^(?:mouse|contextmenu)|click/,$=/^(?:focusinfocus|focusoutblur)$/,_=function(a){return p.event.special.hover?a:a.replace(X,"mouseenter$1 mouseleave$1")};p.event={add:function(a,c,d,e,f){var g,h,i,j,k,l,m,n,o,q,r;if(a.nodeType===3||a.nodeType===8||!c||!d||!(g=p._data(a)))return;d.handler&&(o=d,d=o.handler,f=o.selector),d.guid||(d.guid=p.guid++),i=g.events,i||(g.events=i={}),h=g.handle,h||(g.handle=h=function(a){return typeof p!="undefined"&&(!a||p.event.triggered!==a.type)?p.event.dispatch.apply(h.elem,arguments):b},h.elem=a),c=p.trim(_(c)).split(" ");for(j=0;j=0&&(s=s.slice(0,-1),i=!0),s.indexOf(".")>=0&&(t=s.split("."),s=t.shift(),t.sort());if((!f||p.event.customEvent[s])&&!p.event.global[s])return;c=typeof c=="object"?c[p.expando]?c:new p.Event(s,c):new p.Event(s),c.type=s,c.isTrigger=!0,c.exclusive=i,c.namespace=t.join("."),c.namespace_re=c.namespace?new RegExp("(^|\\.)"+t.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,m=s.indexOf(":")<0?"on"+s:"";if(!f){h=p.cache;for(j in h)h[j].events&&h[j].events[s]&&p.event.trigger(c,d,h[j].handle.elem,!0);return}c.result=b,c.target||(c.target=f),d=d!=null?p.makeArray(d):[],d.unshift(c),n=p.event.special[s]||{};if(n.trigger&&n.trigger.apply(f,d)===!1)return;q=[[f,n.bindType||s]];if(!g&&!n.noBubble&&!p.isWindow(f)){r=n.delegateType||s,k=$.test(r+s)?f:f.parentNode;for(l=f;k;k=k.parentNode)q.push([k,r]),l=k;l===(f.ownerDocument||e)&&q.push([l.defaultView||l.parentWindow||a,r])}for(j=0;j=0:p.find(m,this,null,[f]).length),h[m]&&j.push(l);j.length&&u.push({elem:f,matches:j})}o.length>q&&u.push({elem:this,matches:o.slice(q)});for(d=0;d0?this.on(b,null,a,c):this.trigger(b)},Y.test(b)&&(p.event.fixHooks[b]=p.event.keyHooks),Z.test(b)&&(p.event.fixHooks[b]=p.event.mouseHooks)}),function(a,b){function bc(a,b,c,d){c=c||[],b=b||r;var e,f,i,j,k=b.nodeType;if(!a||typeof a!="string")return c;if(k!==1&&k!==9)return[];i=g(b);if(!i&&!d)if(e=P.exec(a))if(j=e[1]){if(k===9){f=b.getElementById(j);if(!f||!f.parentNode)return c;if(f.id===j)return c.push(f),c}else if(b.ownerDocument&&(f=b.ownerDocument.getElementById(j))&&h(b,f)&&f.id===j)return c.push(f),c}else{if(e[2])return w.apply(c,x.call(b.getElementsByTagName(a),0)),c;if((j=e[3])&&_&&b.getElementsByClassName)return w.apply(c,x.call(b.getElementsByClassName(j),0)),c}return bp(a.replace(L,"$1"),b,c,d,i)}function bd(a){return function(b){var c=b.nodeName.toLowerCase();return c==="input"&&b.type===a}}function be(a){return function(b){var c=b.nodeName.toLowerCase();return(c==="input"||c==="button")&&b.type===a}}function bf(a){return z(function(b){return b=+b,z(function(c,d){var e,f=a([],c.length,b),g=f.length;while(g--)c[e=f[g]]&&(c[e]=!(d[e]=c[e]))})})}function bg(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}function bh(a,b){var c,d,f,g,h,i,j,k=C[o][a];if(k)return b?0:k.slice(0);h=a,i=[],j=e.preFilter;while(h){if(!c||(d=M.exec(h)))d&&(h=h.slice(d[0].length)),i.push(f=[]);c=!1;if(d=N.exec(h))f.push(c=new q(d.shift())),h=h.slice(c.length),c.type=d[0].replace(L," ");for(g in e.filter)(d=W[g].exec(h))&&(!j[g]||(d=j[g](d,r,!0)))&&(f.push(c=new q(d.shift())),h=h.slice(c.length),c.type=g,c.matches=d);if(!c)break}return b?h.length:h?bc.error(a):C(a,i).slice(0)}function bi(a,b,d){var e=b.dir,f=d&&b.dir==="parentNode",g=u++;return b.first?function(b,c,d){while(b=b[e])if(f||b.nodeType===1)return a(b,c,d)}:function(b,d,h){if(!h){var i,j=t+" "+g+" ",k=j+c;while(b=b[e])if(f||b.nodeType===1){if((i=b[o])===k)return b.sizset;if(typeof i=="string"&&i.indexOf(j)===0){if(b.sizset)return b}else{b[o]=k;if(a(b,d,h))return b.sizset=!0,b;b.sizset=!1}}}else while(b=b[e])if(f||b.nodeType===1)if(a(b,d,h))return b}}function bj(a){return a.length>1?function(b,c,d){var e=a.length;while(e--)if(!a[e](b,c,d))return!1;return!0}:a[0]}function bk(a,b,c,d,e){var f,g=[],h=0,i=a.length,j=b!=null;for(;h-1},h,!0),m=[function(a,c,d){return!g&&(d||c!==l)||((b=c).nodeType?j(a,c,d):k(a,c,d))}];for(;i1&&bj(m),i>1&&a.slice(0,i-1).join("").replace(L,"$1"),c,i0,f=a.length>0,g=function(h,i,j,k,m){var n,o,p,q=[],s=0,u="0",x=h&&[],y=m!=null,z=l,A=h||f&&e.find.TAG("*",m&&i.parentNode||i),B=t+=z==null?1:Math.E;y&&(l=i!==r&&i,c=g.el);for(;(n=A[u])!=null;u++){if(f&&n){for(o=0;p=a[o];o++)if(p(n,i,j)){k.push(n);break}y&&(t=B,c=++g.el)}d&&((n=!p&&n)&&s--,h&&x.push(n))}s+=u;if(d&&u!==s){for(o=0;p=b[o];o++)p(x,q,i,j);if(h){if(s>0)while(u--)!x[u]&&!q[u]&&(q[u]=v.call(k));q=bk(q)}w.apply(k,q),y&&!h&&q.length>0&&s+b.length>1&&bc.uniqueSort(k)}return y&&(t=B,l=z),x};return g.el=0,d?z(g):g}function bo(a,b,c,d){var e=0,f=b.length;for(;e2&&(j=h[0]).type==="ID"&&b.nodeType===9&&!f&&e.relative[h[1].type]){b=e.find.ID(j.matches[0].replace(V,""),b,f)[0];if(!b)return c;a=a.slice(h.shift().length)}for(g=W.POS.test(a)?-1:h.length-1;g>=0;g--){j=h[g];if(e.relative[k=j.type])break;if(l=e.find[k])if(d=l(j.matches[0].replace(V,""),R.test(h[0].type)&&b.parentNode||b,f)){h.splice(g,1),a=d.length&&h.join("");if(!a)return w.apply(c,x.call(d,0)),c;break}}}return i(a,m)(d,b,f,c,R.test(a)),c}function bq(){}var c,d,e,f,g,h,i,j,k,l,m=!0,n="undefined",o=("sizcache"+Math.random()).replace(".",""),q=String,r=a.document,s=r.documentElement,t=0,u=0,v=[].pop,w=[].push,x=[].slice,y=[].indexOf||function(a){var b=0,c=this.length;for(;be.cacheLength&&delete a[b.shift()],a[c]=d},a)},B=A(),C=A(),D=A(),E="[\\x20\\t\\r\\n\\f]",F="(?:\\\\.|[-\\w]|[^\\x00-\\xa0])+",G=F.replace("w","w#"),H="([*^$|!~]?=)",I="\\["+E+"*("+F+")"+E+"*(?:"+H+E+"*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|("+G+")|)|)"+E+"*\\]",J=":("+F+")(?:\\((?:(['\"])((?:\\\\.|[^\\\\])*?)\\2|([^()[\\]]*|(?:(?:"+I+")|[^:]|\\\\.)*|.*))\\)|)",K=":(even|odd|eq|gt|lt|nth|first|last)(?:\\("+E+"*((?:-\\d)?\\d*)"+E+"*\\)|)(?=[^-]|$)",L=new RegExp("^"+E+"+|((?:^|[^\\\\])(?:\\\\.)*)"+E+"+$","g"),M=new RegExp("^"+E+"*,"+E+"*"),N=new RegExp("^"+E+"*([\\x20\\t\\r\\n\\f>+~])"+E+"*"),O=new RegExp(J),P=/^(?:#([\w\-]+)|(\w+)|\.([\w\-]+))$/,Q=/^:not/,R=/[\x20\t\r\n\f]*[+~]/,S=/:not\($/,T=/h\d/i,U=/input|select|textarea|button/i,V=/\\(?!\\)/g,W={ID:new RegExp("^#("+F+")"),CLASS:new RegExp("^\\.("+F+")"),NAME:new RegExp("^\\[name=['\"]?("+F+")['\"]?\\]"),TAG:new RegExp("^("+F.replace("w","w*")+")"),ATTR:new RegExp("^"+I),PSEUDO:new RegExp("^"+J),POS:new RegExp(K,"i"),CHILD:new RegExp("^:(only|nth|first|last)-child(?:\\("+E+"*(even|odd|(([+-]|)(\\d*)n|)"+E+"*(?:([+-]|)"+E+"*(\\d+)|))"+E+"*\\)|)","i"),needsContext:new RegExp("^"+E+"*[>+~]|"+K,"i")},X=function(a){var b=r.createElement("div");try{return a(b)}catch(c){return!1}finally{b=null}},Y=X(function(a){return a.appendChild(r.createComment("")),!a.getElementsByTagName("*").length}),Z=X(function(a){return a.innerHTML="",a.firstChild&&typeof a.firstChild.getAttribute!==n&&a.firstChild.getAttribute("href")==="#"}),$=X(function(a){a.innerHTML="";var b=typeof a.lastChild.getAttribute("multiple");return b!=="boolean"&&b!=="string"}),_=X(function(a){return a.innerHTML="",!a.getElementsByClassName||!a.getElementsByClassName("e").length?!1:(a.lastChild.className="e",a.getElementsByClassName("e").length===2)}),ba=X(function(a){a.id=o+0,a.innerHTML="
      ",s.insertBefore(a,s.firstChild);var b=r.getElementsByName&&r.getElementsByName(o).length===2+r.getElementsByName(o+0).length;return d=!r.getElementById(o),s.removeChild(a),b});try{x.call(s.childNodes,0)[0].nodeType}catch(bb){x=function(a){var b,c=[];for(;b=this[a];a++)c.push(b);return c}}bc.matches=function(a,b){return bc(a,null,null,b)},bc.matchesSelector=function(a,b){return bc(b,null,null,[a]).length>0},f=bc.getText=function(a){var b,c="",d=0,e=a.nodeType;if(e){if(e===1||e===9||e===11){if(typeof a.textContent=="string")return a.textContent;for(a=a.firstChild;a;a=a.nextSibling)c+=f(a)}else if(e===3||e===4)return a.nodeValue}else for(;b=a[d];d++)c+=f(b);return c},g=bc.isXML=function(a){var b=a&&(a.ownerDocument||a).documentElement;return b?b.nodeName!=="HTML":!1},h=bc.contains=s.contains?function(a,b){var c=a.nodeType===9?a.documentElement:a,d=b&&b.parentNode;return a===d||!!(d&&d.nodeType===1&&c.contains&&c.contains(d))}:s.compareDocumentPosition?function(a,b){return b&&!!(a.compareDocumentPosition(b)&16)}:function(a,b){while(b=b.parentNode)if(b===a)return!0;return!1},bc.attr=function(a,b){var c,d=g(a);return d||(b=b.toLowerCase()),(c=e.attrHandle[b])?c(a):d||$?a.getAttribute(b):(c=a.getAttributeNode(b),c?typeof a[b]=="boolean"?a[b]?b:null:c.specified?c.value:null:null)},e=bc.selectors={cacheLength:50,createPseudo:z,match:W,attrHandle:Z?{}:{href:function(a){return a.getAttribute("href",2)},type:function(a){return a.getAttribute("type")}},find:{ID:d?function(a,b,c){if(typeof b.getElementById!==n&&!c){var d=b.getElementById(a);return d&&d.parentNode?[d]:[]}}:function(a,c,d){if(typeof c.getElementById!==n&&!d){var e=c.getElementById(a);return e?e.id===a||typeof e.getAttributeNode!==n&&e.getAttributeNode("id").value===a?[e]:b:[]}},TAG:Y?function(a,b){if(typeof b.getElementsByTagName!==n)return b.getElementsByTagName(a)}:function(a,b){var c=b.getElementsByTagName(a);if(a==="*"){var d,e=[],f=0;for(;d=c[f];f++)d.nodeType===1&&e.push(d);return e}return c},NAME:ba&&function(a,b){if(typeof b.getElementsByName!==n)return b.getElementsByName(name)},CLASS:_&&function(a,b,c){if(typeof b.getElementsByClassName!==n&&!c)return b.getElementsByClassName(a)}},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(a){return a[1]=a[1].replace(V,""),a[3]=(a[4]||a[5]||"").replace(V,""),a[2]==="~="&&(a[3]=" "+a[3]+" "),a.slice(0,4)},CHILD:function(a){return a[1]=a[1].toLowerCase(),a[1]==="nth"?(a[2]||bc.error(a[0]),a[3]=+(a[3]?a[4]+(a[5]||1):2*(a[2]==="even"||a[2]==="odd")),a[4]=+(a[6]+a[7]||a[2]==="odd")):a[2]&&bc.error(a[0]),a},PSEUDO:function(a){var b,c;if(W.CHILD.test(a[0]))return null;if(a[3])a[2]=a[3];else if(b=a[4])O.test(b)&&(c=bh(b,!0))&&(c=b.indexOf(")",b.length-c)-b.length)&&(b=b.slice(0,c),a[0]=a[0].slice(0,c)),a[2]=b;return a.slice(0,3)}},filter:{ID:d?function(a){return a=a.replace(V,""),function(b){return b.getAttribute("id")===a}}:function(a){return a=a.replace(V,""),function(b){var c=typeof b.getAttributeNode!==n&&b.getAttributeNode("id");return c&&c.value===a}},TAG:function(a){return a==="*"?function(){return!0}:(a=a.replace(V,"").toLowerCase(),function(b){return b.nodeName&&b.nodeName.toLowerCase()===a})},CLASS:function(a){var b=B[o][a];return b||(b=B(a,new RegExp("(^|"+E+")"+a+"("+E+"|$)"))),function(a){return b.test(a.className||typeof a.getAttribute!==n&&a.getAttribute("class")||"")}},ATTR:function(a,b,c){return function(d,e){var f=bc.attr(d,a);return f==null?b==="!=":b?(f+="",b==="="?f===c:b==="!="?f!==c:b==="^="?c&&f.indexOf(c)===0:b==="*="?c&&f.indexOf(c)>-1:b==="$="?c&&f.substr(f.length-c.length)===c:b==="~="?(" "+f+" ").indexOf(c)>-1:b==="|="?f===c||f.substr(0,c.length+1)===c+"-":!1):!0}},CHILD:function(a,b,c,d){return a==="nth"?function(a){var b,e,f=a.parentNode;if(c===1&&d===0)return!0;if(f){e=0;for(b=f.firstChild;b;b=b.nextSibling)if(b.nodeType===1){e++;if(a===b)break}}return e-=d,e===c||e%c===0&&e/c>=0}:function(b){var c=b;switch(a){case"only":case"first":while(c=c.previousSibling)if(c.nodeType===1)return!1;if(a==="first")return!0;c=b;case"last":while(c=c.nextSibling)if(c.nodeType===1)return!1;return!0}}},PSEUDO:function(a,b){var c,d=e.pseudos[a]||e.setFilters[a.toLowerCase()]||bc.error("unsupported pseudo: "+a);return d[o]?d(b):d.length>1?(c=[a,a,"",b],e.setFilters.hasOwnProperty(a.toLowerCase())?z(function(a,c){var e,f=d(a,b),g=f.length;while(g--)e=y.call(a,f[g]),a[e]=!(c[e]=f[g])}):function(a){return d(a,0,c)}):d}},pseudos:{not:z(function(a){var b=[],c=[],d=i(a.replace(L,"$1"));return d[o]?z(function(a,b,c,e){var f,g=d(a,null,e,[]),h=a.length;while(h--)if(f=g[h])a[h]=!(b[h]=f)}):function(a,e,f){return b[0]=a,d(b,null,f,c),!c.pop()}}),has:z(function(a){return function(b){return bc(a,b).length>0}}),contains:z(function(a){return function(b){return(b.textContent||b.innerText||f(b)).indexOf(a)>-1}}),enabled:function(a){return a.disabled===!1},disabled:function(a){return a.disabled===!0},checked:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&!!a.checked||b==="option"&&!!a.selected},selected:function(a){return a.parentNode&&a.parentNode.selectedIndex,a.selected===!0},parent:function(a){return!e.pseudos.empty(a)},empty:function(a){var b;a=a.firstChild;while(a){if(a.nodeName>"@"||(b=a.nodeType)===3||b===4)return!1;a=a.nextSibling}return!0},header:function(a){return T.test(a.nodeName)},text:function(a){var b,c;return a.nodeName.toLowerCase()==="input"&&(b=a.type)==="text"&&((c=a.getAttribute("type"))==null||c.toLowerCase()===b)},radio:bd("radio"),checkbox:bd("checkbox"),file:bd("file"),password:bd("password"),image:bd("image"),submit:be("submit"),reset:be("reset"),button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&a.type==="button"||b==="button"},input:function(a){return U.test(a.nodeName)},focus:function(a){var b=a.ownerDocument;return a===b.activeElement&&(!b.hasFocus||b.hasFocus())&&(!!a.type||!!a.href)},active:function(a){return a===a.ownerDocument.activeElement},first:bf(function(a,b,c){return[0]}),last:bf(function(a,b,c){return[b-1]}),eq:bf(function(a,b,c){return[c<0?c+b:c]}),even:bf(function(a,b,c){for(var d=0;d=0;)a.push(d);return a}),gt:bf(function(a,b,c){for(var d=c<0?c+b:c;++d",a.querySelectorAll("[selected]").length||e.push("\\["+E+"*(?:checked|disabled|ismap|multiple|readonly|selected|value)"),a.querySelectorAll(":checked").length||e.push(":checked")}),X(function(a){a.innerHTML="

      ",a.querySelectorAll("[test^='']").length&&e.push("[*^$]="+E+"*(?:\"\"|'')"),a.innerHTML="",a.querySelectorAll(":enabled").length||e.push(":enabled",":disabled")}),e=new RegExp(e.join("|")),bp=function(a,d,f,g,h){if(!g&&!h&&(!e||!e.test(a))){var i,j,k=!0,l=o,m=d,n=d.nodeType===9&&a;if(d.nodeType===1&&d.nodeName.toLowerCase()!=="object"){i=bh(a),(k=d.getAttribute("id"))?l=k.replace(c,"\\$&"):d.setAttribute("id",l),l="[id='"+l+"'] ",j=i.length;while(j--)i[j]=l+i[j].join("");m=R.test(a)&&d.parentNode||d,n=i.join(",")}if(n)try{return w.apply(f,x.call(m.querySelectorAll(n),0)),f}catch(p){}finally{k||d.removeAttribute("id")}}return b(a,d,f,g,h)},h&&(X(function(b){a=h.call(b,"div");try{h.call(b,"[test!='']:sizzle"),f.push("!=",J)}catch(c){}}),f=new RegExp(f.join("|")),bc.matchesSelector=function(b,c){c=c.replace(d,"='$1']");if(!g(b)&&!f.test(c)&&(!e||!e.test(c)))try{var i=h.call(b,c);if(i||a||b.document&&b.document.nodeType!==11)return i}catch(j){}return bc(c,null,null,[b]).length>0})}(),e.pseudos.nth=e.pseudos.eq,e.filters=bq.prototype=e.pseudos,e.setFilters=new bq,bc.attr=p.attr,p.find=bc,p.expr=bc.selectors,p.expr[":"]=p.expr.pseudos,p.unique=bc.uniqueSort,p.text=bc.getText,p.isXMLDoc=bc.isXML,p.contains=bc.contains}(a);var bc=/Until$/,bd=/^(?:parents|prev(?:Until|All))/,be=/^.[^:#\[\.,]*$/,bf=p.expr.match.needsContext,bg={children:!0,contents:!0,next:!0,prev:!0};p.fn.extend({find:function(a){var b,c,d,e,f,g,h=this;if(typeof a!="string")return p(a).filter(function(){for(b=0,c=h.length;b0)for(e=d;e=0:p.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c,d=0,e=this.length,f=[],g=bf.test(a)||typeof a!="string"?p(a,b||this.context):0;for(;d-1:p.find.matchesSelector(c,a)){f.push(c);break}c=c.parentNode}}return f=f.length>1?p.unique(f):f,this.pushStack(f,"closest",a)},index:function(a){return a?typeof a=="string"?p.inArray(this[0],p(a)):p.inArray(a.jquery?a[0]:a,this):this[0]&&this[0].parentNode?this.prevAll().length:-1},add:function(a,b){var c=typeof a=="string"?p(a,b):p.makeArray(a&&a.nodeType?[a]:a),d=p.merge(this.get(),c);return this.pushStack(bh(c[0])||bh(d[0])?d:p.unique(d))},addBack:function(a){return this.add(a==null?this.prevObject:this.prevObject.filter(a))}}),p.fn.andSelf=p.fn.addBack,p.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return p.dir(a,"parentNode")},parentsUntil:function(a,b,c){return p.dir(a,"parentNode",c)},next:function(a){return bi(a,"nextSibling")},prev:function(a){return bi(a,"previousSibling")},nextAll:function(a){return p.dir(a,"nextSibling")},prevAll:function(a){return p.dir(a,"previousSibling")},nextUntil:function(a,b,c){return p.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return p.dir(a,"previousSibling",c)},siblings:function(a){return p.sibling((a.parentNode||{}).firstChild,a)},children:function(a){return p.sibling(a.firstChild)},contents:function(a){return p.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:p.merge([],a.childNodes)}},function(a,b){p.fn[a]=function(c,d){var e=p.map(this,b,c);return bc.test(a)||(d=c),d&&typeof d=="string"&&(e=p.filter(d,e)),e=this.length>1&&!bg[a]?p.unique(e):e,this.length>1&&bd.test(a)&&(e=e.reverse()),this.pushStack(e,a,k.call(arguments).join(","))}}),p.extend({filter:function(a,b,c){return c&&(a=":not("+a+")"),b.length===1?p.find.matchesSelector(b[0],a)?[b[0]]:[]:p.find.matches(a,b)},dir:function(a,c,d){var e=[],f=a[c];while(f&&f.nodeType!==9&&(d===b||f.nodeType!==1||!p(f).is(d)))f.nodeType===1&&e.push(f),f=f[c];return e},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var bl="abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",bm=/ jQuery\d+="(?:null|\d+)"/g,bn=/^\s+/,bo=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,bp=/<([\w:]+)/,bq=/]","i"),bv=/^(?:checkbox|radio)$/,bw=/checked\s*(?:[^=]|=\s*.checked.)/i,bx=/\/(java|ecma)script/i,by=/^\s*\s*$/g,bz={option:[1,""],legend:[1,"
      ","
      "],thead:[1,"","
      "],tr:[2,"","
      "],td:[3,"","
      "],col:[2,"","
      "],area:[1,"",""],_default:[0,"",""]},bA=bk(e),bB=bA.appendChild(e.createElement("div"));bz.optgroup=bz.option,bz.tbody=bz.tfoot=bz.colgroup=bz.caption=bz.thead,bz.th=bz.td,p.support.htmlSerialize||(bz._default=[1,"X
      ","
      "]),p.fn.extend({text:function(a){return p.access(this,function(a){return a===b?p.text(this):this.empty().append((this[0]&&this[0].ownerDocument||e).createTextNode(a))},null,a,arguments.length)},wrapAll:function(a){if(p.isFunction(a))return this.each(function(b){p(this).wrapAll(a.call(this,b))});if(this[0]){var b=p(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){return p.isFunction(a)?this.each(function(b){p(this).wrapInner(a.call(this,b))}):this.each(function(){var b=p(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=p.isFunction(a);return this.each(function(c){p(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){p.nodeName(this,"body")||p(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){(this.nodeType===1||this.nodeType===11)&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){(this.nodeType===1||this.nodeType===11)&&this.insertBefore(a,this.firstChild)})},before:function(){if(!bh(this[0]))return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=p.clean(arguments);return this.pushStack(p.merge(a,this),"before",this.selector)}},after:function(){if(!bh(this[0]))return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=p.clean(arguments);return this.pushStack(p.merge(this,a),"after",this.selector)}},remove:function(a,b){var c,d=0;for(;(c=this[d])!=null;d++)if(!a||p.filter(a,[c]).length)!b&&c.nodeType===1&&(p.cleanData(c.getElementsByTagName("*")),p.cleanData([c])),c.parentNode&&c.parentNode.removeChild(c);return this},empty:function(){var a,b=0;for(;(a=this[b])!=null;b++){a.nodeType===1&&p.cleanData(a.getElementsByTagName("*"));while(a.firstChild)a.removeChild(a.firstChild)}return this},clone:function(a,b){return a=a==null?!1:a,b=b==null?a:b,this.map(function(){return p.clone(this,a,b)})},html:function(a){return p.access(this,function(a){var c=this[0]||{},d=0,e=this.length;if(a===b)return c.nodeType===1?c.innerHTML.replace(bm,""):b;if(typeof a=="string"&&!bs.test(a)&&(p.support.htmlSerialize||!bu.test(a))&&(p.support.leadingWhitespace||!bn.test(a))&&!bz[(bp.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(bo,"<$1>");try{for(;d1&&typeof j=="string"&&bw.test(j))return this.each(function(){p(this).domManip(a,c,d)});if(p.isFunction(j))return this.each(function(e){var f=p(this);a[0]=j.call(this,e,c?f.html():b),f.domManip(a,c,d)});if(this[0]){e=p.buildFragment(a,this,k),g=e.fragment,f=g.firstChild,g.childNodes.length===1&&(g=f);if(f){c=c&&p.nodeName(f,"tr");for(h=e.cacheable||l-1;i0?this.clone(!0):this).get(),p(g[e])[b](d),f=f.concat(d);return this.pushStack(f,a,g.selector)}}),p.extend({clone:function(a,b,c){var d,e,f,g;p.support.html5Clone||p.isXMLDoc(a)||!bu.test("<"+a.nodeName+">")?g=a.cloneNode(!0):(bB.innerHTML=a.outerHTML,bB.removeChild(g=bB.firstChild));if((!p.support.noCloneEvent||!p.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!p.isXMLDoc(a)){bE(a,g),d=bF(a),e=bF(g);for(f=0;d[f];++f)e[f]&&bE(d[f],e[f])}if(b){bD(a,g);if(c){d=bF(a),e=bF(g);for(f=0;d[f];++f)bD(d[f],e[f])}}return d=e=null,g},clean:function(a,b,c,d){var f,g,h,i,j,k,l,m,n,o,q,r,s=b===e&&bA,t=[];if(!b||typeof b.createDocumentFragment=="undefined")b=e;for(f=0;(h=a[f])!=null;f++){typeof h=="number"&&(h+="");if(!h)continue;if(typeof h=="string")if(!br.test(h))h=b.createTextNode(h);else{s=s||bk(b),l=b.createElement("div"),s.appendChild(l),h=h.replace(bo,"<$1>"),i=(bp.exec(h)||["",""])[1].toLowerCase(),j=bz[i]||bz._default,k=j[0],l.innerHTML=j[1]+h+j[2];while(k--)l=l.lastChild;if(!p.support.tbody){m=bq.test(h),n=i==="table"&&!m?l.firstChild&&l.firstChild.childNodes:j[1]===""&&!m?l.childNodes:[];for(g=n.length-1;g>=0;--g)p.nodeName(n[g],"tbody")&&!n[g].childNodes.length&&n[g].parentNode.removeChild(n[g])}!p.support.leadingWhitespace&&bn.test(h)&&l.insertBefore(b.createTextNode(bn.exec(h)[0]),l.firstChild),h=l.childNodes,l.parentNode.removeChild(l)}h.nodeType?t.push(h):p.merge(t,h)}l&&(h=l=s=null);if(!p.support.appendChecked)for(f=0;(h=t[f])!=null;f++)p.nodeName(h,"input")?bG(h):typeof h.getElementsByTagName!="undefined"&&p.grep(h.getElementsByTagName("input"),bG);if(c){q=function(a){if(!a.type||bx.test(a.type))return d?d.push(a.parentNode?a.parentNode.removeChild(a):a):c.appendChild(a)};for(f=0;(h=t[f])!=null;f++)if(!p.nodeName(h,"script")||!q(h))c.appendChild(h),typeof h.getElementsByTagName!="undefined"&&(r=p.grep(p.merge([],h.getElementsByTagName("script")),q),t.splice.apply(t,[f+1,0].concat(r)),f+=r.length)}return t},cleanData:function(a,b){var c,d,e,f,g=0,h=p.expando,i=p.cache,j=p.support.deleteExpando,k=p.event.special;for(;(e=a[g])!=null;g++)if(b||p.acceptData(e)){d=e[h],c=d&&i[d];if(c){if(c.events)for(f in c.events)k[f]?p.event.remove(e,f):p.removeEvent(e,f,c.handle);i[d]&&(delete i[d],j?delete e[h]:e.removeAttribute?e.removeAttribute(h):e[h]=null,p.deletedIds.push(d))}}}}),function(){var a,b;p.uaMatch=function(a){a=a.toLowerCase();var b=/(chrome)[ \/]([\w.]+)/.exec(a)||/(webkit)[ \/]([\w.]+)/.exec(a)||/(opera)(?:.*version|)[ \/]([\w.]+)/.exec(a)||/(msie) ([\w.]+)/.exec(a)||a.indexOf("compatible")<0&&/(mozilla)(?:.*? rv:([\w.]+)|)/.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},a=p.uaMatch(g.userAgent),b={},a.browser&&(b[a.browser]=!0,b.version=a.version),b.chrome?b.webkit=!0:b.webkit&&(b.safari=!0),p.browser=b,p.sub=function(){function a(b,c){return new a.fn.init(b,c)}p.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function c(c,d){return d&&d instanceof p&&!(d instanceof a)&&(d=a(d)),p.fn.init.call(this,c,d,b)},a.fn.init.prototype=a.fn;var b=a(e);return a}}();var bH,bI,bJ,bK=/alpha\([^)]*\)/i,bL=/opacity=([^)]*)/,bM=/^(top|right|bottom|left)$/,bN=/^(none|table(?!-c[ea]).+)/,bO=/^margin/,bP=new RegExp("^("+q+")(.*)$","i"),bQ=new RegExp("^("+q+")(?!px)[a-z%]+$","i"),bR=new RegExp("^([-+])=("+q+")","i"),bS={},bT={position:"absolute",visibility:"hidden",display:"block"},bU={letterSpacing:0,fontWeight:400},bV=["Top","Right","Bottom","Left"],bW=["Webkit","O","Moz","ms"],bX=p.fn.toggle;p.fn.extend({css:function(a,c){return p.access(this,function(a,c,d){return d!==b?p.style(a,c,d):p.css(a,c)},a,c,arguments.length>1)},show:function(){return b$(this,!0)},hide:function(){return b$(this)},toggle:function(a,b){var c=typeof a=="boolean";return p.isFunction(a)&&p.isFunction(b)?bX.apply(this,arguments):this.each(function(){(c?a:bZ(this))?p(this).show():p(this).hide()})}}),p.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bH(a,"opacity");return c===""?"1":c}}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":p.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!a||a.nodeType===3||a.nodeType===8||!a.style)return;var f,g,h,i=p.camelCase(c),j=a.style;c=p.cssProps[i]||(p.cssProps[i]=bY(j,i)),h=p.cssHooks[c]||p.cssHooks[i];if(d===b)return h&&"get"in h&&(f=h.get(a,!1,e))!==b?f:j[c];g=typeof d,g==="string"&&(f=bR.exec(d))&&(d=(f[1]+1)*f[2]+parseFloat(p.css(a,c)),g="number");if(d==null||g==="number"&&isNaN(d))return;g==="number"&&!p.cssNumber[i]&&(d+="px");if(!h||!("set"in h)||(d=h.set(a,d,e))!==b)try{j[c]=d}catch(k){}},css:function(a,c,d,e){var f,g,h,i=p.camelCase(c);return c=p.cssProps[i]||(p.cssProps[i]=bY(a.style,i)),h=p.cssHooks[c]||p.cssHooks[i],h&&"get"in h&&(f=h.get(a,!0,e)),f===b&&(f=bH(a,c)),f==="normal"&&c in bU&&(f=bU[c]),d||e!==b?(g=parseFloat(f),d||p.isNumeric(g)?g||0:f):f},swap:function(a,b,c){var d,e,f={};for(e in b)f[e]=a.style[e],a.style[e]=b[e];d=c.call(a);for(e in b)a.style[e]=f[e];return d}}),a.getComputedStyle?bH=function(b,c){var d,e,f,g,h=a.getComputedStyle(b,null),i=b.style;return h&&(d=h[c],d===""&&!p.contains(b.ownerDocument,b)&&(d=p.style(b,c)),bQ.test(d)&&bO.test(c)&&(e=i.width,f=i.minWidth,g=i.maxWidth,i.minWidth=i.maxWidth=i.width=d,d=h.width,i.width=e,i.minWidth=f,i.maxWidth=g)),d}:e.documentElement.currentStyle&&(bH=function(a,b){var c,d,e=a.currentStyle&&a.currentStyle[b],f=a.style;return e==null&&f&&f[b]&&(e=f[b]),bQ.test(e)&&!bM.test(b)&&(c=f.left,d=a.runtimeStyle&&a.runtimeStyle.left,d&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":e,e=f.pixelLeft+"px",f.left=c,d&&(a.runtimeStyle.left=d)),e===""?"auto":e}),p.each(["height","width"],function(a,b){p.cssHooks[b]={get:function(a,c,d){if(c)return a.offsetWidth===0&&bN.test(bH(a,"display"))?p.swap(a,bT,function(){return cb(a,b,d)}):cb(a,b,d)},set:function(a,c,d){return b_(a,c,d?ca(a,b,d,p.support.boxSizing&&p.css(a,"boxSizing")==="border-box"):0)}}}),p.support.opacity||(p.cssHooks.opacity={get:function(a,b){return bL.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?.01*parseFloat(RegExp.$1)+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle,e=p.isNumeric(b)?"alpha(opacity="+b*100+")":"",f=d&&d.filter||c.filter||"";c.zoom=1;if(b>=1&&p.trim(f.replace(bK,""))===""&&c.removeAttribute){c.removeAttribute("filter");if(d&&!d.filter)return}c.filter=bK.test(f)?f.replace(bK,e):f+" "+e}}),p(function(){p.support.reliableMarginRight||(p.cssHooks.marginRight={get:function(a,b){return p.swap(a,{display:"inline-block"},function(){if(b)return bH(a,"marginRight")})}}),!p.support.pixelPosition&&p.fn.position&&p.each(["top","left"],function(a,b){p.cssHooks[b]={get:function(a,c){if(c){var d=bH(a,b);return bQ.test(d)?p(a).position()[b]+"px":d}}}})}),p.expr&&p.expr.filters&&(p.expr.filters.hidden=function(a){return a.offsetWidth===0&&a.offsetHeight===0||!p.support.reliableHiddenOffsets&&(a.style&&a.style.display||bH(a,"display"))==="none"},p.expr.filters.visible=function(a){return!p.expr.filters.hidden(a)}),p.each({margin:"",padding:"",border:"Width"},function(a,b){p.cssHooks[a+b]={expand:function(c){var d,e=typeof c=="string"?c.split(" "):[c],f={};for(d=0;d<4;d++)f[a+bV[d]+b]=e[d]||e[d-2]||e[0];return f}},bO.test(a)||(p.cssHooks[a+b].set=b_)});var cd=/%20/g,ce=/\[\]$/,cf=/\r?\n/g,cg=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,ch=/^(?:select|textarea)/i;p.fn.extend({serialize:function(){return p.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?p.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||ch.test(this.nodeName)||cg.test(this.type))}).map(function(a,b){var c=p(this).val();return c==null?null:p.isArray(c)?p.map(c,function(a,c){return{name:b.name,value:a.replace(cf,"\r\n")}}):{name:b.name,value:c.replace(cf,"\r\n")}}).get()}}),p.param=function(a,c){var d,e=[],f=function(a,b){b=p.isFunction(b)?b():b==null?"":b,e[e.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=p.ajaxSettings&&p.ajaxSettings.traditional);if(p.isArray(a)||a.jquery&&!p.isPlainObject(a))p.each(a,function(){f(this.name,this.value)});else for(d in a)ci(d,a[d],c,f);return e.join("&").replace(cd,"+")};var cj,ck,cl=/#.*$/,cm=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,cn=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,co=/^(?:GET|HEAD)$/,cp=/^\/\//,cq=/\?/,cr=/)<[^<]*)*<\/script>/gi,cs=/([?&])_=[^&]*/,ct=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/,cu=p.fn.load,cv={},cw={},cx=["*/"]+["*"];try{ck=f.href}catch(cy){ck=e.createElement("a"),ck.href="",ck=ck.href}cj=ct.exec(ck.toLowerCase())||[],p.fn.load=function(a,c,d){if(typeof a!="string"&&cu)return cu.apply(this,arguments);if(!this.length)return this;var e,f,g,h=this,i=a.indexOf(" ");return i>=0&&(e=a.slice(i,a.length),a=a.slice(0,i)),p.isFunction(c)?(d=c,c=b):c&&typeof c=="object"&&(f="POST"),p.ajax({url:a,type:f,dataType:"html",data:c,complete:function(a,b){d&&h.each(d,g||[a.responseText,b,a])}}).done(function(a){g=arguments,h.html(e?p("
      ").append(a.replace(cr,"")).find(e):a)}),this},p.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){p.fn[b]=function(a){return this.on(b,a)}}),p.each(["get","post"],function(a,c){p[c]=function(a,d,e,f){return p.isFunction(d)&&(f=f||e,e=d,d=b),p.ajax({type:c,url:a,data:d,success:e,dataType:f})}}),p.extend({getScript:function(a,c){return p.get(a,b,c,"script")},getJSON:function(a,b,c){return p.get(a,b,c,"json")},ajaxSetup:function(a,b){return b?cB(a,p.ajaxSettings):(b=a,a=p.ajaxSettings),cB(a,b),a},ajaxSettings:{url:ck,isLocal:cn.test(cj[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded; charset=UTF-8",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":cx},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":p.parseJSON,"text xml":p.parseXML},flatOptions:{context:!0,url:!0}},ajaxPrefilter:cz(cv),ajaxTransport:cz(cw),ajax:function(a,c){function y(a,c,f,i){var k,s,t,u,w,y=c;if(v===2)return;v=2,h&&clearTimeout(h),g=b,e=i||"",x.readyState=a>0?4:0,f&&(u=cC(l,x,f));if(a>=200&&a<300||a===304)l.ifModified&&(w=x.getResponseHeader("Last-Modified"),w&&(p.lastModified[d]=w),w=x.getResponseHeader("Etag"),w&&(p.etag[d]=w)),a===304?(y="notmodified",k=!0):(k=cD(l,u),y=k.state,s=k.data,t=k.error,k=!t);else{t=y;if(!y||a)y="error",a<0&&(a=0)}x.status=a,x.statusText=(c||y)+"",k?o.resolveWith(m,[s,y,x]):o.rejectWith(m,[x,y,t]),x.statusCode(r),r=b,j&&n.trigger("ajax"+(k?"Success":"Error"),[x,l,k?s:t]),q.fireWith(m,[x,y]),j&&(n.trigger("ajaxComplete",[x,l]),--p.active||p.event.trigger("ajaxStop"))}typeof a=="object"&&(c=a,a=b),c=c||{};var d,e,f,g,h,i,j,k,l=p.ajaxSetup({},c),m=l.context||l,n=m!==l&&(m.nodeType||m instanceof p)?p(m):p.event,o=p.Deferred(),q=p.Callbacks("once memory"),r=l.statusCode||{},t={},u={},v=0,w="canceled",x={readyState:0,setRequestHeader:function(a,b){if(!v){var c=a.toLowerCase();a=u[c]=u[c]||a,t[a]=b}return this},getAllResponseHeaders:function(){return v===2?e:null},getResponseHeader:function(a){var c;if(v===2){if(!f){f={};while(c=cm.exec(e))f[c[1].toLowerCase()]=c[2]}c=f[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){return v||(l.mimeType=a),this},abort:function(a){return a=a||w,g&&g.abort(a),y(0,a),this}};o.promise(x),x.success=x.done,x.error=x.fail,x.complete=q.add,x.statusCode=function(a){if(a){var b;if(v<2)for(b in a)r[b]=[r[b],a[b]];else b=a[x.status],x.always(b)}return this},l.url=((a||l.url)+"").replace(cl,"").replace(cp,cj[1]+"//"),l.dataTypes=p.trim(l.dataType||"*").toLowerCase().split(s),l.crossDomain==null&&(i=ct.exec(l.url.toLowerCase())||!1,l.crossDomain=i&&i.join(":")+(i[3]?"":i[1]==="http:"?80:443)!==cj.join(":")+(cj[3]?"":cj[1]==="http:"?80:443)),l.data&&l.processData&&typeof l.data!="string"&&(l.data=p.param(l.data,l.traditional)),cA(cv,l,c,x);if(v===2)return x;j=l.global,l.type=l.type.toUpperCase(),l.hasContent=!co.test(l.type),j&&p.active++===0&&p.event.trigger("ajaxStart");if(!l.hasContent){l.data&&(l.url+=(cq.test(l.url)?"&":"?")+l.data,delete l.data),d=l.url;if(l.cache===!1){var z=p.now(),A=l.url.replace(cs,"$1_="+z);l.url=A+(A===l.url?(cq.test(l.url)?"&":"?")+"_="+z:"")}}(l.data&&l.hasContent&&l.contentType!==!1||c.contentType)&&x.setRequestHeader("Content-Type",l.contentType),l.ifModified&&(d=d||l.url,p.lastModified[d]&&x.setRequestHeader("If-Modified-Since",p.lastModified[d]),p.etag[d]&&x.setRequestHeader("If-None-Match",p.etag[d])),x.setRequestHeader("Accept",l.dataTypes[0]&&l.accepts[l.dataTypes[0]]?l.accepts[l.dataTypes[0]]+(l.dataTypes[0]!=="*"?", "+cx+"; q=0.01":""):l.accepts["*"]);for(k in l.headers)x.setRequestHeader(k,l.headers[k]);if(!l.beforeSend||l.beforeSend.call(m,x,l)!==!1&&v!==2){w="abort";for(k in{success:1,error:1,complete:1})x[k](l[k]);g=cA(cw,l,c,x);if(!g)y(-1,"No Transport");else{x.readyState=1,j&&n.trigger("ajaxSend",[x,l]),l.async&&l.timeout>0&&(h=setTimeout(function(){x.abort("timeout")},l.timeout));try{v=1,g.send(t,y)}catch(B){if(v<2)y(-1,B);else throw B}}return x}return x.abort()},active:0,lastModified:{},etag:{}});var cE=[],cF=/\?/,cG=/(=)\?(?=&|$)|\?\?/,cH=p.now();p.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var a=cE.pop()||p.expando+"_"+cH++;return this[a]=!0,a}}),p.ajaxPrefilter("json jsonp",function(c,d,e){var f,g,h,i=c.data,j=c.url,k=c.jsonp!==!1,l=k&&cG.test(j),m=k&&!l&&typeof i=="string"&&!(c.contentType||"").indexOf("application/x-www-form-urlencoded")&&cG.test(i);if(c.dataTypes[0]==="jsonp"||l||m)return f=c.jsonpCallback=p.isFunction(c.jsonpCallback)?c.jsonpCallback():c.jsonpCallback,g=a[f],l?c.url=j.replace(cG,"$1"+f):m?c.data=i.replace(cG,"$1"+f):k&&(c.url+=(cF.test(j)?"&":"?")+c.jsonp+"="+f),c.converters["script json"]=function(){return h||p.error(f+" was not called"),h[0]},c.dataTypes[0]="json",a[f]=function(){h=arguments},e.always(function(){a[f]=g,c[f]&&(c.jsonpCallback=d.jsonpCallback,cE.push(f)),h&&p.isFunction(g)&&g(h[0]),h=g=b}),"script"}),p.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){return p.globalEval(a),a}}}),p.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),p.ajaxTransport("script",function(a){if(a.crossDomain){var c,d=e.head||e.getElementsByTagName("head")[0]||e.documentElement;return{send:function(f,g){c=e.createElement("script"),c.async="async",a.scriptCharset&&(c.charset=a.scriptCharset),c.src=a.url,c.onload=c.onreadystatechange=function(a,e){if(e||!c.readyState||/loaded|complete/.test(c.readyState))c.onload=c.onreadystatechange=null,d&&c.parentNode&&d.removeChild(c),c=b,e||g(200,"success")},d.insertBefore(c,d.firstChild)},abort:function(){c&&c.onload(0,1)}}}});var cI,cJ=a.ActiveXObject?function(){for(var a in cI)cI[a](0,1)}:!1,cK=0;p.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&cL()||cM()}:cL,function(a){p.extend(p.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(p.ajaxSettings.xhr()),p.support.ajax&&p.ajaxTransport(function(c){if(!c.crossDomain||p.support.cors){var d;return{send:function(e,f){var g,h,i=c.xhr();c.username?i.open(c.type,c.url,c.async,c.username,c.password):i.open(c.type,c.url,c.async);if(c.xhrFields)for(h in c.xhrFields)i[h]=c.xhrFields[h];c.mimeType&&i.overrideMimeType&&i.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(h in e)i.setRequestHeader(h,e[h])}catch(j){}i.send(c.hasContent&&c.data||null),d=function(a,e){var h,j,k,l,m;try{if(d&&(e||i.readyState===4)){d=b,g&&(i.onreadystatechange=p.noop,cJ&&delete cI[g]);if(e)i.readyState!==4&&i.abort();else{h=i.status,k=i.getAllResponseHeaders(),l={},m=i.responseXML,m&&m.documentElement&&(l.xml=m);try{l.text=i.responseText}catch(a){}try{j=i.statusText}catch(n){j=""}!h&&c.isLocal&&!c.crossDomain?h=l.text?200:404:h===1223&&(h=204)}}}catch(o){e||f(-1,o)}l&&f(h,j,l,k)},c.async?i.readyState===4?setTimeout(d,0):(g=++cK,cJ&&(cI||(cI={},p(a).unload(cJ)),cI[g]=d),i.onreadystatechange=d):d()},abort:function(){d&&d(0,1)}}}});var cN,cO,cP=/^(?:toggle|show|hide)$/,cQ=new RegExp("^(?:([-+])=|)("+q+")([a-z%]*)$","i"),cR=/queueHooks$/,cS=[cY],cT={"*":[function(a,b){var c,d,e=this.createTween(a,b),f=cQ.exec(b),g=e.cur(),h=+g||0,i=1,j=20;if(f){c=+f[2],d=f[3]||(p.cssNumber[a]?"":"px");if(d!=="px"&&h){h=p.css(e.elem,a,!0)||c||1;do i=i||".5",h=h/i,p.style(e.elem,a,h+d);while(i!==(i=e.cur()/g)&&i!==1&&--j)}e.unit=d,e.start=h,e.end=f[1]?h+(f[1]+1)*c:c}return e}]};p.Animation=p.extend(cW,{tweener:function(a,b){p.isFunction(a)?(b=a,a=["*"]):a=a.split(" ");var c,d=0,e=a.length;for(;d-1,j={},k={},l,m;i?(k=e.position(),l=k.top,m=k.left):(l=parseFloat(g)||0,m=parseFloat(h)||0),p.isFunction(b)&&(b=b.call(a,c,f)),b.top!=null&&(j.top=b.top-f.top+l),b.left!=null&&(j.left=b.left-f.left+m),"using"in b?b.using.call(a,j):e.css(j)}},p.fn.extend({position:function(){if(!this[0])return;var a=this[0],b=this.offsetParent(),c=this.offset(),d=c_.test(b[0].nodeName)?{top:0,left:0}:b.offset();return c.top-=parseFloat(p.css(a,"marginTop"))||0,c.left-=parseFloat(p.css(a,"marginLeft"))||0,d.top+=parseFloat(p.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(p.css(b[0],"borderLeftWidth"))||0,{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||e.body;while(a&&!c_.test(a.nodeName)&&p.css(a,"position")==="static")a=a.offsetParent;return a||e.body})}}),p.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(a,c){var d=/Y/.test(c);p.fn[a]=function(e){return p.access(this,function(a,e,f){var g=da(a);if(f===b)return g?c in g?g[c]:g.document.documentElement[e]:a[e];g?g.scrollTo(d?p(g).scrollLeft():f,d?f:p(g).scrollTop()):a[e]=f},a,e,arguments.length,null)}}),p.each({Height:"height",Width:"width"},function(a,c){p.each({padding:"inner"+a,content:c,"":"outer"+a},function(d,e){p.fn[e]=function(e,f){var g=arguments.length&&(d||typeof e!="boolean"),h=d||(e===!0||f===!0?"margin":"border");return p.access(this,function(c,d,e){var f;return p.isWindow(c)?c.document.documentElement["client"+a]:c.nodeType===9?(f=c.documentElement,Math.max(c.body["scroll"+a],f["scroll"+a],c.body["offset"+a],f["offset"+a],f["client"+a])):e===b?p.css(c,d,e,h):p.style(c,d,e,h)},c,g?e:b,g,null)}})}),a.jQuery=a.$=p,typeof define=="function"&&define.amd&&define.amd.jQuery&&define("jquery",[],function(){return p})})(window); \ No newline at end of file diff --git a/modules/files/views/default/assets/lib/codemirror.css b/modules/files/views/default/assets/lib/codemirror.css new file mode 100755 index 0000000..ee26937 --- /dev/null +++ b/modules/files/views/default/assets/lib/codemirror.css @@ -0,0 +1,246 @@ +/* BASICS */ + +.CodeMirror { + /* Set height, width, borders, and global font properties here */ + font-family: monospace; + height: 530px; +} +.CodeMirror-scroll { + /* Set scrolling behaviour here */ + overflow: auto; +} + +/* PADDING */ + +.CodeMirror-lines { + padding: 4px 0; /* Vertical padding around content */ +} +.CodeMirror pre { + padding: 0 4px; /* Horizontal padding of content */ +} + +.CodeMirror-scrollbar-filler { + background-color: white; /* The little square between H and V scrollbars */ +} + +/* GUTTER */ + +.CodeMirror-gutters { + border-right: 1px solid #ddd; + background-color: #f7f7f7; +} +.CodeMirror-linenumbers {} +.CodeMirror-linenumber { + padding: 0 3px 0 5px; + min-width: 20px; + text-align: right; + color: #999; +} + +/* CURSOR */ + +.CodeMirror div.CodeMirror-cursor { + border-left: 1px solid black; + z-index: 3; +} +/* Shown when moving in bi-directional text */ +.CodeMirror div.CodeMirror-secondarycursor { + border-left: 1px solid silver; +} +.CodeMirror.cm-keymap-fat-cursor div.CodeMirror-cursor { + width: auto; + border: 0; + background: #7e7; + z-index: 1; +} +/* Can style cursor different in overwrite (non-insert) mode */ +.CodeMirror div.CodeMirror-cursor.CodeMirror-overwrite {} + +.cm-tab { display: inline-block; } + +/* DEFAULT THEME */ + +.cm-s-default .cm-keyword {color: #708;} +.cm-s-default .cm-atom {color: #219;} +.cm-s-default .cm-number {color: #164;} +.cm-s-default .cm-def {color: #00f;} +.cm-s-default .cm-variable {color: black;} +.cm-s-default .cm-variable-2 {color: #05a;} +.cm-s-default .cm-variable-3 {color: #085;} +.cm-s-default .cm-property {color: black;} +.cm-s-default .cm-operator {color: black;} +.cm-s-default .cm-comment {color: #a50;} +.cm-s-default .cm-string {color: #a11;} +.cm-s-default .cm-string-2 {color: #f50;} +.cm-s-default .cm-meta {color: #555;} +.cm-s-default .cm-error {color: #f00;} +.cm-s-default .cm-qualifier {color: #555;} +.cm-s-default .cm-builtin {color: #30a;} +.cm-s-default .cm-bracket {color: #997;} +.cm-s-default .cm-tag {color: #170;} +.cm-s-default .cm-attribute {color: #00c;} +.cm-s-default .cm-header {color: blue;} +.cm-s-default .cm-quote {color: #090;} +.cm-s-default .cm-hr {color: #999;} +.cm-s-default .cm-link {color: #00c;} + +.cm-negative {color: #d44;} +.cm-positive {color: #292;} +.cm-header, .cm-strong {font-weight: bold;} +.cm-em {font-style: italic;} +.cm-link {text-decoration: underline;} + +.cm-invalidchar {color: #f00;} + +div.CodeMirror span.CodeMirror-matchingbracket {color: #0f0;} +div.CodeMirror span.CodeMirror-nonmatchingbracket {color: #f22;} + +/* STOP */ + +/* The rest of this file contains styles related to the mechanics of + the editor. You probably shouldn't touch them. */ + +.CodeMirror { + line-height: 1; + position: relative; + overflow: hidden; + background: white; + color: black; +} + +.CodeMirror-scroll { + /* 30px is the magic margin used to hide the element's real scrollbars */ + /* See overflow: hidden in .CodeMirror */ + margin-bottom: -30px; margin-right: -30px; + padding-bottom: 30px; padding-right: 30px; + height: 100%; + outline: none; /* Prevent dragging from highlighting the element */ + position: relative; +} +.CodeMirror-sizer { + position: relative; +} + +/* The fake, visible scrollbars. Used to force redraw during scrolling + before actuall scrolling happens, thus preventing shaking and + flickering artifacts. */ +.CodeMirror-vscrollbar, .CodeMirror-hscrollbar, .CodeMirror-scrollbar-filler { + position: absolute; + z-index: 6; + display: none; +} +.CodeMirror-vscrollbar { + right: 0; top: 0; + overflow-x: hidden; + overflow-y: scroll; +} +.CodeMirror-hscrollbar { + bottom: 0; left: 0; + overflow-y: hidden; + overflow-x: scroll; +} +.CodeMirror-scrollbar-filler { + right: 0; bottom: 0; + z-index: 6; +} + +.CodeMirror-gutters { + position: absolute; left: 0; top: 0; + height: 100%; + padding-bottom: 30px; + z-index: 3; +} +.CodeMirror-gutter { + height: 100%; + padding-bottom: 30px; + margin-bottom: -32px; + display: inline-block; + /* Hack to make IE7 behave */ + *zoom:1; + *display:inline; +} +.CodeMirror-gutter-elt { + position: absolute; + cursor: default; + z-index: 4; +} + +.CodeMirror-lines { + cursor: text; +} +.CodeMirror pre { + /* Reset some styles that the rest of the page might have set */ + -moz-border-radius: 0; -webkit-border-radius: 0; border-radius: 0; + border-width: 0; + background: transparent; + font-family: inherit; + font-size: inherit; + margin: 0; + white-space: pre; + word-wrap: normal; + line-height: inherit; + color: inherit; + z-index: 2; + position: relative; + overflow: visible; +} +.CodeMirror-wrap pre { + word-wrap: break-word; + white-space: pre-wrap; + word-break: normal; +} +.CodeMirror-linebackground { + position: absolute; + left: 0; right: 0; top: 0; bottom: 0; + z-index: 0; +} + +.CodeMirror-linewidget { + position: relative; + z-index: 2; + overflow: auto; +} + +.CodeMirror-widget { + display: inline-block; +} + +.CodeMirror-wrap .CodeMirror-scroll { + overflow-x: hidden; +} + +.CodeMirror-measure { + position: absolute; + width: 100%; height: 0px; + overflow: hidden; + visibility: hidden; +} +.CodeMirror-measure pre { position: static; } + +.CodeMirror div.CodeMirror-cursor { + position: absolute; + visibility: hidden; + border-right: none; + width: 0; +} +.CodeMirror-focused div.CodeMirror-cursor { + visibility: visible; +} + +.CodeMirror-selected { background: #d9d9d9; } +.CodeMirror-focused .CodeMirror-selected { background: #d7d4f0; } + +.cm-searching { + background: #ffa; + background: rgba(255, 255, 0, .4); +} + +/* IE7 hack to prevent it from returning funny offsetTops on the spans */ +.CodeMirror span { *vertical-align: text-bottom; } + +@media print { + /* Hide the cursor when printing */ + .CodeMirror div.CodeMirror-cursor { + visibility: hidden; + } +} diff --git a/modules/files/views/default/assets/lib/codemirror.js b/modules/files/views/default/assets/lib/codemirror.js new file mode 100755 index 0000000..1570e49 --- /dev/null +++ b/modules/files/views/default/assets/lib/codemirror.js @@ -0,0 +1,5585 @@ +// CodeMirror version 3.12 +// +// CodeMirror is the only global var we claim +window.CodeMirror = (function() { + "use strict"; + + // BROWSER SNIFFING + + // Crude, but necessary to handle a number of hard-to-feature-detect + // bugs and behavior differences. + var gecko = /gecko\/\d/i.test(navigator.userAgent); + var ie = /MSIE \d/.test(navigator.userAgent); + var ie_lt8 = ie && (document.documentMode == null || document.documentMode < 8); + var ie_lt9 = ie && (document.documentMode == null || document.documentMode < 9); + var webkit = /WebKit\//.test(navigator.userAgent); + var qtwebkit = webkit && /Qt\/\d+\.\d+/.test(navigator.userAgent); + var chrome = /Chrome\//.test(navigator.userAgent); + var opera = /Opera\//.test(navigator.userAgent); + var safari = /Apple Computer/.test(navigator.vendor); + var khtml = /KHTML\//.test(navigator.userAgent); + var mac_geLion = /Mac OS X 1\d\D([7-9]|\d\d)\D/.test(navigator.userAgent); + var mac_geMountainLion = /Mac OS X 1\d\D([8-9]|\d\d)\D/.test(navigator.userAgent); + var phantom = /PhantomJS/.test(navigator.userAgent); + + var ios = /AppleWebKit/.test(navigator.userAgent) && /Mobile\/\w+/.test(navigator.userAgent); + // This is woefully incomplete. Suggestions for alternative methods welcome. + var mobile = ios || /Android|webOS|BlackBerry|Opera Mini|Opera Mobi|IEMobile/i.test(navigator.userAgent); + var mac = ios || /Mac/.test(navigator.platform); + var windows = /windows/i.test(navigator.platform); + + var opera_version = opera && navigator.userAgent.match(/Version\/(\d*\.\d*)/); + if (opera_version) opera_version = Number(opera_version[1]); + // Some browsers use the wrong event properties to signal cmd/ctrl on OS X + var flipCtrlCmd = mac && (qtwebkit || opera && (opera_version == null || opera_version < 12.11)); + var captureMiddleClick = gecko || (ie && !ie_lt9); + + // Optimize some code when these features are not used + var sawReadOnlySpans = false, sawCollapsedSpans = false; + + // CONSTRUCTOR + + function CodeMirror(place, options) { + if (!(this instanceof CodeMirror)) return new CodeMirror(place, options); + + this.options = options = options || {}; + // Determine effective options based on given values and defaults. + for (var opt in defaults) if (!options.hasOwnProperty(opt) && defaults.hasOwnProperty(opt)) + options[opt] = defaults[opt]; + setGuttersForLineNumbers(options); + + var docStart = typeof options.value == "string" ? 0 : options.value.first; + var display = this.display = makeDisplay(place, docStart); + display.wrapper.CodeMirror = this; + updateGutters(this); + if (options.autofocus && !mobile) focusInput(this); + + this.state = {keyMaps: [], + overlays: [], + modeGen: 0, + overwrite: false, focused: false, + suppressEdits: false, pasteIncoming: false, + draggingText: false, + highlight: new Delayed()}; + + themeChanged(this); + if (options.lineWrapping) + this.display.wrapper.className += " CodeMirror-wrap"; + + var doc = options.value; + if (typeof doc == "string") doc = new Doc(options.value, options.mode); + operation(this, attachDoc)(this, doc); + + // Override magic textarea content restore that IE sometimes does + // on our hidden textarea on reload + if (ie) setTimeout(bind(resetInput, this, true), 20); + + registerEventHandlers(this); + // IE throws unspecified error in certain cases, when + // trying to access activeElement before onload + var hasFocus; try { hasFocus = (document.activeElement == display.input); } catch(e) { } + if (hasFocus || (options.autofocus && !mobile)) setTimeout(bind(onFocus, this), 20); + else onBlur(this); + + operation(this, function() { + for (var opt in optionHandlers) + if (optionHandlers.propertyIsEnumerable(opt)) + optionHandlers[opt](this, options[opt], Init); + for (var i = 0; i < initHooks.length; ++i) initHooks[i](this); + })(); + } + + // DISPLAY CONSTRUCTOR + + function makeDisplay(place, docStart) { + var d = {}; + + var input = d.input = elt("textarea", null, null, "position: absolute; padding: 0; width: 1px; height: 1em; outline: none; font-size: 4px;"); + if (webkit) input.style.width = "1000px"; + else input.setAttribute("wrap", "off"); + // if border: 0; -- iOS fails to open keyboard (issue #1287) + if (ios) input.style.border = "1px solid black"; + input.setAttribute("autocorrect", "off"); input.setAttribute("autocapitalize", "off"); + + // Wraps and hides input textarea + d.inputDiv = elt("div", [input], null, "overflow: hidden; position: relative; width: 3px; height: 0px;"); + // The actual fake scrollbars. + d.scrollbarH = elt("div", [elt("div", null, null, "height: 1px")], "CodeMirror-hscrollbar"); + d.scrollbarV = elt("div", [elt("div", null, null, "width: 1px")], "CodeMirror-vscrollbar"); + d.scrollbarFiller = elt("div", null, "CodeMirror-scrollbar-filler"); + // DIVs containing the selection and the actual code + d.lineDiv = elt("div"); + d.selectionDiv = elt("div", null, null, "position: relative; z-index: 1"); + // Blinky cursor, and element used to ensure cursor fits at the end of a line + d.cursor = elt("div", "\u00a0", "CodeMirror-cursor"); + // Secondary cursor, shown when on a 'jump' in bi-directional text + d.otherCursor = elt("div", "\u00a0", "CodeMirror-cursor CodeMirror-secondarycursor"); + // Used to measure text size + d.measure = elt("div", null, "CodeMirror-measure"); + // Wraps everything that needs to exist inside the vertically-padded coordinate system + d.lineSpace = elt("div", [d.measure, d.selectionDiv, d.lineDiv, d.cursor, d.otherCursor], + null, "position: relative; outline: none"); + // Moved around its parent to cover visible view + d.mover = elt("div", [elt("div", [d.lineSpace], "CodeMirror-lines")], null, "position: relative"); + // Set to the height of the text, causes scrolling + d.sizer = elt("div", [d.mover], "CodeMirror-sizer"); + // D is needed because behavior of elts with overflow: auto and padding is inconsistent across browsers + d.heightForcer = elt("div", null, null, "position: absolute; height: " + scrollerCutOff + "px; width: 1px;"); + // Will contain the gutters, if any + d.gutters = elt("div", null, "CodeMirror-gutters"); + d.lineGutter = null; + // Helper element to properly size the gutter backgrounds + var scrollerInner = elt("div", [d.sizer, d.heightForcer, d.gutters], null, "position: relative; min-height: 100%"); + // Provides scrolling + d.scroller = elt("div", [scrollerInner], "CodeMirror-scroll"); + d.scroller.setAttribute("tabIndex", "-1"); + // The element in which the editor lives. + d.wrapper = elt("div", [d.inputDiv, d.scrollbarH, d.scrollbarV, + d.scrollbarFiller, d.scroller], "CodeMirror"); + // Work around IE7 z-index bug + if (ie_lt8) { d.gutters.style.zIndex = -1; d.scroller.style.paddingRight = 0; } + if (place.appendChild) place.appendChild(d.wrapper); else place(d.wrapper); + + // Needed to hide big blue blinking cursor on Mobile Safari + if (ios) input.style.width = "0px"; + if (!webkit) d.scroller.draggable = true; + // Needed to handle Tab key in KHTML + if (khtml) { d.inputDiv.style.height = "1px"; d.inputDiv.style.position = "absolute"; } + // Need to set a minimum width to see the scrollbar on IE7 (but must not set it on IE8). + else if (ie_lt8) d.scrollbarH.style.minWidth = d.scrollbarV.style.minWidth = "18px"; + + // Current visible range (may be bigger than the view window). + d.viewOffset = d.lastSizeC = 0; + d.showingFrom = d.showingTo = docStart; + + // Used to only resize the line number gutter when necessary (when + // the amount of lines crosses a boundary that makes its width change) + d.lineNumWidth = d.lineNumInnerWidth = d.lineNumChars = null; + // See readInput and resetInput + d.prevInput = ""; + // Set to true when a non-horizontal-scrolling widget is added. As + // an optimization, widget aligning is skipped when d is false. + d.alignWidgets = false; + // Flag that indicates whether we currently expect input to appear + // (after some event like 'keypress' or 'input') and are polling + // intensively. + d.pollingFast = false; + // Self-resetting timeout for the poller + d.poll = new Delayed(); + + d.cachedCharWidth = d.cachedTextHeight = null; + d.measureLineCache = []; + d.measureLineCachePos = 0; + + // Tracks when resetInput has punted to just putting a short + // string instead of the (large) selection. + d.inaccurateSelection = false; + + // Tracks the maximum line length so that the horizontal scrollbar + // can be kept static when scrolling. + d.maxLine = null; + d.maxLineLength = 0; + d.maxLineChanged = false; + + // Used for measuring wheel scrolling granularity + d.wheelDX = d.wheelDY = d.wheelStartX = d.wheelStartY = null; + + return d; + } + + // STATE UPDATES + + // Used to get the editor into a consistent state again when options change. + + function loadMode(cm) { + cm.doc.mode = CodeMirror.getMode(cm.options, cm.doc.modeOption); + cm.doc.iter(function(line) { + if (line.stateAfter) line.stateAfter = null; + if (line.styles) line.styles = null; + }); + cm.doc.frontier = cm.doc.first; + startWorker(cm, 100); + cm.state.modeGen++; + if (cm.curOp) regChange(cm); + } + + function wrappingChanged(cm) { + if (cm.options.lineWrapping) { + cm.display.wrapper.className += " CodeMirror-wrap"; + cm.display.sizer.style.minWidth = ""; + } else { + cm.display.wrapper.className = cm.display.wrapper.className.replace(" CodeMirror-wrap", ""); + computeMaxLength(cm); + } + estimateLineHeights(cm); + regChange(cm); + clearCaches(cm); + setTimeout(function(){updateScrollbars(cm.display, cm.doc.height);}, 100); + } + + function estimateHeight(cm) { + var th = textHeight(cm.display), wrapping = cm.options.lineWrapping; + var perLine = wrapping && Math.max(5, cm.display.scroller.clientWidth / charWidth(cm.display) - 3); + return function(line) { + if (lineIsHidden(cm.doc, line)) + return 0; + else if (wrapping) + return (Math.ceil(line.text.length / perLine) || 1) * th; + else + return th; + }; + } + + function estimateLineHeights(cm) { + var doc = cm.doc, est = estimateHeight(cm); + doc.iter(function(line) { + var estHeight = est(line); + if (estHeight != line.height) updateLineHeight(line, estHeight); + }); + } + + function keyMapChanged(cm) { + var style = keyMap[cm.options.keyMap].style; + cm.display.wrapper.className = cm.display.wrapper.className.replace(/\s*cm-keymap-\S+/g, "") + + (style ? " cm-keymap-" + style : ""); + } + + function themeChanged(cm) { + cm.display.wrapper.className = cm.display.wrapper.className.replace(/\s*cm-s-\S+/g, "") + + cm.options.theme.replace(/(^|\s)\s*/g, " cm-s-"); + clearCaches(cm); + } + + function guttersChanged(cm) { + updateGutters(cm); + regChange(cm); + } + + function updateGutters(cm) { + var gutters = cm.display.gutters, specs = cm.options.gutters; + removeChildren(gutters); + for (var i = 0; i < specs.length; ++i) { + var gutterClass = specs[i]; + var gElt = gutters.appendChild(elt("div", null, "CodeMirror-gutter " + gutterClass)); + if (gutterClass == "CodeMirror-linenumbers") { + cm.display.lineGutter = gElt; + gElt.style.width = (cm.display.lineNumWidth || 1) + "px"; + } + } + gutters.style.display = i ? "" : "none"; + } + + function lineLength(doc, line) { + if (line.height == 0) return 0; + var len = line.text.length, merged, cur = line; + while (merged = collapsedSpanAtStart(cur)) { + var found = merged.find(); + cur = getLine(doc, found.from.line); + len += found.from.ch - found.to.ch; + } + cur = line; + while (merged = collapsedSpanAtEnd(cur)) { + var found = merged.find(); + len -= cur.text.length - found.from.ch; + cur = getLine(doc, found.to.line); + len += cur.text.length - found.to.ch; + } + return len; + } + + function computeMaxLength(cm) { + var d = cm.display, doc = cm.doc; + d.maxLine = getLine(doc, doc.first); + d.maxLineLength = lineLength(doc, d.maxLine); + d.maxLineChanged = true; + doc.iter(function(line) { + var len = lineLength(doc, line); + if (len > d.maxLineLength) { + d.maxLineLength = len; + d.maxLine = line; + } + }); + } + + // Make sure the gutters options contains the element + // "CodeMirror-linenumbers" when the lineNumbers option is true. + function setGuttersForLineNumbers(options) { + var found = false; + for (var i = 0; i < options.gutters.length; ++i) { + if (options.gutters[i] == "CodeMirror-linenumbers") { + if (options.lineNumbers) found = true; + else options.gutters.splice(i--, 1); + } + } + if (!found && options.lineNumbers) + options.gutters.push("CodeMirror-linenumbers"); + } + + // SCROLLBARS + + // Re-synchronize the fake scrollbars with the actual size of the + // content. Optionally force a scrollTop. + function updateScrollbars(d /* display */, docHeight) { + var totalHeight = docHeight + paddingVert(d); + d.sizer.style.minHeight = d.heightForcer.style.top = totalHeight + "px"; + var scrollHeight = Math.max(totalHeight, d.scroller.scrollHeight); + var needsH = d.scroller.scrollWidth > d.scroller.clientWidth; + var needsV = scrollHeight > d.scroller.clientHeight; + if (needsV) { + d.scrollbarV.style.display = "block"; + d.scrollbarV.style.bottom = needsH ? scrollbarWidth(d.measure) + "px" : "0"; + d.scrollbarV.firstChild.style.height = + (scrollHeight - d.scroller.clientHeight + d.scrollbarV.clientHeight) + "px"; + } else d.scrollbarV.style.display = ""; + if (needsH) { + d.scrollbarH.style.display = "block"; + d.scrollbarH.style.right = needsV ? scrollbarWidth(d.measure) + "px" : "0"; + d.scrollbarH.firstChild.style.width = + (d.scroller.scrollWidth - d.scroller.clientWidth + d.scrollbarH.clientWidth) + "px"; + } else d.scrollbarH.style.display = ""; + if (needsH && needsV) { + d.scrollbarFiller.style.display = "block"; + d.scrollbarFiller.style.height = d.scrollbarFiller.style.width = scrollbarWidth(d.measure) + "px"; + } else d.scrollbarFiller.style.display = ""; + + if (mac_geLion && scrollbarWidth(d.measure) === 0) + d.scrollbarV.style.minWidth = d.scrollbarH.style.minHeight = mac_geMountainLion ? "18px" : "12px"; + } + + function visibleLines(display, doc, viewPort) { + var top = display.scroller.scrollTop, height = display.wrapper.clientHeight; + if (typeof viewPort == "number") top = viewPort; + else if (viewPort) {top = viewPort.top; height = viewPort.bottom - viewPort.top;} + top = Math.floor(top - paddingTop(display)); + var bottom = Math.ceil(top + height); + return {from: lineAtHeight(doc, top), to: lineAtHeight(doc, bottom)}; + } + + // LINE NUMBERS + + function alignHorizontally(cm) { + var display = cm.display; + if (!display.alignWidgets && (!display.gutters.firstChild || !cm.options.fixedGutter)) return; + var comp = compensateForHScroll(display) - display.scroller.scrollLeft + cm.doc.scrollLeft; + var gutterW = display.gutters.offsetWidth, l = comp + "px"; + for (var n = display.lineDiv.firstChild; n; n = n.nextSibling) if (n.alignable) { + for (var i = 0, a = n.alignable; i < a.length; ++i) a[i].style.left = l; + } + if (cm.options.fixedGutter) + display.gutters.style.left = (comp + gutterW) + "px"; + } + + function maybeUpdateLineNumberWidth(cm) { + if (!cm.options.lineNumbers) return false; + var doc = cm.doc, last = lineNumberFor(cm.options, doc.first + doc.size - 1), display = cm.display; + if (last.length != display.lineNumChars) { + var test = display.measure.appendChild(elt("div", [elt("div", last)], + "CodeMirror-linenumber CodeMirror-gutter-elt")); + var innerW = test.firstChild.offsetWidth, padding = test.offsetWidth - innerW; + display.lineGutter.style.width = ""; + display.lineNumInnerWidth = Math.max(innerW, display.lineGutter.offsetWidth - padding); + display.lineNumWidth = display.lineNumInnerWidth + padding; + display.lineNumChars = display.lineNumInnerWidth ? last.length : -1; + display.lineGutter.style.width = display.lineNumWidth + "px"; + return true; + } + return false; + } + + function lineNumberFor(options, i) { + return String(options.lineNumberFormatter(i + options.firstLineNumber)); + } + function compensateForHScroll(display) { + return getRect(display.scroller).left - getRect(display.sizer).left; + } + + // DISPLAY DRAWING + + function updateDisplay(cm, changes, viewPort) { + var oldFrom = cm.display.showingFrom, oldTo = cm.display.showingTo, updated; + var visible = visibleLines(cm.display, cm.doc, viewPort); + for (;;) { + if (updateDisplayInner(cm, changes, visible)) { + updated = true; + signalLater(cm, "update", cm); + if (cm.display.showingFrom != oldFrom || cm.display.showingTo != oldTo) + signalLater(cm, "viewportChange", cm, cm.display.showingFrom, cm.display.showingTo); + } else break; + updateSelection(cm); + updateScrollbars(cm.display, cm.doc.height); + + // Clip forced viewport to actual scrollable area + if (viewPort) + viewPort = Math.min(cm.display.scroller.scrollHeight - cm.display.scroller.clientHeight, + typeof viewPort == "number" ? viewPort : viewPort.top); + visible = visibleLines(cm.display, cm.doc, viewPort); + if (visible.from >= cm.display.showingFrom && visible.to <= cm.display.showingTo) + break; + changes = []; + } + + return updated; + } + + // Uses a set of changes plus the current scroll position to + // determine which DOM updates have to be made, and makes the + // updates. + function updateDisplayInner(cm, changes, visible) { + var display = cm.display, doc = cm.doc; + if (!display.wrapper.clientWidth) { + display.showingFrom = display.showingTo = doc.first; + display.viewOffset = 0; + return; + } + + // Bail out if the visible area is already rendered and nothing changed. + if (changes.length == 0 && + visible.from > display.showingFrom && visible.to < display.showingTo) + return; + + if (maybeUpdateLineNumberWidth(cm)) + changes = [{from: doc.first, to: doc.first + doc.size}]; + var gutterW = display.sizer.style.marginLeft = display.gutters.offsetWidth + "px"; + display.scrollbarH.style.left = cm.options.fixedGutter ? gutterW : "0"; + + // Used to determine which lines need their line numbers updated + var positionsChangedFrom = Infinity; + if (cm.options.lineNumbers) + for (var i = 0; i < changes.length; ++i) + if (changes[i].diff) { positionsChangedFrom = changes[i].from; break; } + + var end = doc.first + doc.size; + var from = Math.max(visible.from - cm.options.viewportMargin, doc.first); + var to = Math.min(end, visible.to + cm.options.viewportMargin); + if (display.showingFrom < from && from - display.showingFrom < 20) from = Math.max(doc.first, display.showingFrom); + if (display.showingTo > to && display.showingTo - to < 20) to = Math.min(end, display.showingTo); + if (sawCollapsedSpans) { + from = lineNo(visualLine(doc, getLine(doc, from))); + while (to < end && lineIsHidden(doc, getLine(doc, to))) ++to; + } + + // Create a range of theoretically intact lines, and punch holes + // in that using the change info. + var intact = [{from: Math.max(display.showingFrom, doc.first), + to: Math.min(display.showingTo, end)}]; + if (intact[0].from >= intact[0].to) intact = []; + else intact = computeIntact(intact, changes); + // When merged lines are present, we might have to reduce the + // intact ranges because changes in continued fragments of the + // intact lines do require the lines to be redrawn. + if (sawCollapsedSpans) + for (var i = 0; i < intact.length; ++i) { + var range = intact[i], merged; + while (merged = collapsedSpanAtEnd(getLine(doc, range.to - 1))) { + var newTo = merged.find().from.line; + if (newTo > range.from) range.to = newTo; + else { intact.splice(i--, 1); break; } + } + } + + // Clip off the parts that won't be visible + var intactLines = 0; + for (var i = 0; i < intact.length; ++i) { + var range = intact[i]; + if (range.from < from) range.from = from; + if (range.to > to) range.to = to; + if (range.from >= range.to) intact.splice(i--, 1); + else intactLines += range.to - range.from; + } + if (intactLines == to - from && from == display.showingFrom && to == display.showingTo) { + updateViewOffset(cm); + return; + } + intact.sort(function(a, b) {return a.from - b.from;}); + + // Avoid crashing on IE's "unspecified error" when in iframes + try { + var focused = document.activeElement; + } catch(e) {} + if (intactLines < (to - from) * .7) display.lineDiv.style.display = "none"; + patchDisplay(cm, from, to, intact, positionsChangedFrom); + display.lineDiv.style.display = ""; + if (focused && document.activeElement != focused && focused.offsetHeight) focused.focus(); + + var different = from != display.showingFrom || to != display.showingTo || + display.lastSizeC != display.wrapper.clientHeight; + // This is just a bogus formula that detects when the editor is + // resized or the font size changes. + if (different) display.lastSizeC = display.wrapper.clientHeight; + display.showingFrom = from; display.showingTo = to; + startWorker(cm, 100); + + var prevBottom = display.lineDiv.offsetTop; + for (var node = display.lineDiv.firstChild, height; node; node = node.nextSibling) if (node.lineObj) { + if (ie_lt8) { + var bot = node.offsetTop + node.offsetHeight; + height = bot - prevBottom; + prevBottom = bot; + } else { + var box = getRect(node); + height = box.bottom - box.top; + } + var diff = node.lineObj.height - height; + if (height < 2) height = textHeight(display); + if (diff > .001 || diff < -.001) { + updateLineHeight(node.lineObj, height); + var widgets = node.lineObj.widgets; + if (widgets) for (var i = 0; i < widgets.length; ++i) + widgets[i].height = widgets[i].node.offsetHeight; + } + } + updateViewOffset(cm); + + return true; + } + + function updateViewOffset(cm) { + var off = cm.display.viewOffset = heightAtLine(cm, getLine(cm.doc, cm.display.showingFrom)); + // Position the mover div to align with the current virtual scroll position + cm.display.mover.style.top = off + "px"; + } + + function computeIntact(intact, changes) { + for (var i = 0, l = changes.length || 0; i < l; ++i) { + var change = changes[i], intact2 = [], diff = change.diff || 0; + for (var j = 0, l2 = intact.length; j < l2; ++j) { + var range = intact[j]; + if (change.to <= range.from && change.diff) { + intact2.push({from: range.from + diff, to: range.to + diff}); + } else if (change.to <= range.from || change.from >= range.to) { + intact2.push(range); + } else { + if (change.from > range.from) + intact2.push({from: range.from, to: change.from}); + if (change.to < range.to) + intact2.push({from: change.to + diff, to: range.to + diff}); + } + } + intact = intact2; + } + return intact; + } + + function getDimensions(cm) { + var d = cm.display, left = {}, width = {}; + for (var n = d.gutters.firstChild, i = 0; n; n = n.nextSibling, ++i) { + left[cm.options.gutters[i]] = n.offsetLeft; + width[cm.options.gutters[i]] = n.offsetWidth; + } + return {fixedPos: compensateForHScroll(d), + gutterTotalWidth: d.gutters.offsetWidth, + gutterLeft: left, + gutterWidth: width, + wrapperWidth: d.wrapper.clientWidth}; + } + + function patchDisplay(cm, from, to, intact, updateNumbersFrom) { + var dims = getDimensions(cm); + var display = cm.display, lineNumbers = cm.options.lineNumbers; + if (!intact.length && (!webkit || !cm.display.currentWheelTarget)) + removeChildren(display.lineDiv); + var container = display.lineDiv, cur = container.firstChild; + + function rm(node) { + var next = node.nextSibling; + if (webkit && mac && cm.display.currentWheelTarget == node) { + node.style.display = "none"; + node.lineObj = null; + } else { + node.parentNode.removeChild(node); + } + return next; + } + + var nextIntact = intact.shift(), lineN = from; + cm.doc.iter(from, to, function(line) { + if (nextIntact && nextIntact.to == lineN) nextIntact = intact.shift(); + if (lineIsHidden(cm.doc, line)) { + if (line.height != 0) updateLineHeight(line, 0); + if (line.widgets && cur.previousSibling) for (var i = 0; i < line.widgets.length; ++i) + if (line.widgets[i].showIfHidden) { + var prev = cur.previousSibling; + if (/pre/i.test(prev.nodeName)) { + var wrap = elt("div", null, null, "position: relative"); + prev.parentNode.replaceChild(wrap, prev); + wrap.appendChild(prev); + prev = wrap; + } + var wnode = prev.appendChild(elt("div", [line.widgets[i].node], "CodeMirror-linewidget")); + positionLineWidget(line.widgets[i], wnode, prev, dims); + } + } else if (nextIntact && nextIntact.from <= lineN && nextIntact.to > lineN) { + // This line is intact. Skip to the actual node. Update its + // line number if needed. + while (cur.lineObj != line) cur = rm(cur); + if (lineNumbers && updateNumbersFrom <= lineN && cur.lineNumber) + setTextContent(cur.lineNumber, lineNumberFor(cm.options, lineN)); + cur = cur.nextSibling; + } else { + // For lines with widgets, make an attempt to find and reuse + // the existing element, so that widgets aren't needlessly + // removed and re-inserted into the dom + if (line.widgets) for (var j = 0, search = cur, reuse; search && j < 20; ++j, search = search.nextSibling) + if (search.lineObj == line && /div/i.test(search.nodeName)) { reuse = search; break; } + // This line needs to be generated. + var lineNode = buildLineElement(cm, line, lineN, dims, reuse); + if (lineNode != reuse) { + container.insertBefore(lineNode, cur); + } else { + while (cur != reuse) cur = rm(cur); + cur = cur.nextSibling; + } + + lineNode.lineObj = line; + } + ++lineN; + }); + while (cur) cur = rm(cur); + } + + function buildLineElement(cm, line, lineNo, dims, reuse) { + var lineElement = lineContent(cm, line); + var markers = line.gutterMarkers, display = cm.display, wrap; + + if (!cm.options.lineNumbers && !markers && !line.bgClass && !line.wrapClass && !line.widgets) + return lineElement; + + // Lines with gutter elements, widgets or a background class need + // to be wrapped again, and have the extra elements added to the + // wrapper div + + if (reuse) { + reuse.alignable = null; + var isOk = true, widgetsSeen = 0; + for (var n = reuse.firstChild, next; n; n = next) { + next = n.nextSibling; + if (!/\bCodeMirror-linewidget\b/.test(n.className)) { + reuse.removeChild(n); + } else { + for (var i = 0, first = true; i < line.widgets.length; ++i) { + var widget = line.widgets[i], isFirst = false; + if (!widget.above) { isFirst = first; first = false; } + if (widget.node == n.firstChild) { + positionLineWidget(widget, n, reuse, dims); + ++widgetsSeen; + if (isFirst) reuse.insertBefore(lineElement, n); + break; + } + } + if (i == line.widgets.length) { isOk = false; break; } + } + } + if (isOk && widgetsSeen == line.widgets.length) { + wrap = reuse; + reuse.className = line.wrapClass || ""; + } + } + if (!wrap) { + wrap = elt("div", null, line.wrapClass, "position: relative"); + wrap.appendChild(lineElement); + } + // Kludge to make sure the styled element lies behind the selection (by z-index) + if (line.bgClass) + wrap.insertBefore(elt("div", null, line.bgClass + " CodeMirror-linebackground"), wrap.firstChild); + if (cm.options.lineNumbers || markers) { + var gutterWrap = wrap.insertBefore(elt("div", null, null, "position: absolute; left: " + + (cm.options.fixedGutter ? dims.fixedPos : -dims.gutterTotalWidth) + "px"), + wrap.firstChild); + if (cm.options.fixedGutter) (wrap.alignable || (wrap.alignable = [])).push(gutterWrap); + if (cm.options.lineNumbers && (!markers || !markers["CodeMirror-linenumbers"])) + wrap.lineNumber = gutterWrap.appendChild( + elt("div", lineNumberFor(cm.options, lineNo), + "CodeMirror-linenumber CodeMirror-gutter-elt", + "left: " + dims.gutterLeft["CodeMirror-linenumbers"] + "px; width: " + + display.lineNumInnerWidth + "px")); + if (markers) + for (var k = 0; k < cm.options.gutters.length; ++k) { + var id = cm.options.gutters[k], found = markers.hasOwnProperty(id) && markers[id]; + if (found) + gutterWrap.appendChild(elt("div", [found], "CodeMirror-gutter-elt", "left: " + + dims.gutterLeft[id] + "px; width: " + dims.gutterWidth[id] + "px")); + } + } + if (ie_lt8) wrap.style.zIndex = 2; + if (line.widgets && wrap != reuse) for (var i = 0, ws = line.widgets; i < ws.length; ++i) { + var widget = ws[i], node = elt("div", [widget.node], "CodeMirror-linewidget"); + positionLineWidget(widget, node, wrap, dims); + if (widget.above) + wrap.insertBefore(node, cm.options.lineNumbers && line.height != 0 ? gutterWrap : lineElement); + else + wrap.appendChild(node); + signalLater(widget, "redraw"); + } + return wrap; + } + + function positionLineWidget(widget, node, wrap, dims) { + if (widget.noHScroll) { + (wrap.alignable || (wrap.alignable = [])).push(node); + var width = dims.wrapperWidth; + node.style.left = dims.fixedPos + "px"; + if (!widget.coverGutter) { + width -= dims.gutterTotalWidth; + node.style.paddingLeft = dims.gutterTotalWidth + "px"; + } + node.style.width = width + "px"; + } + if (widget.coverGutter) { + node.style.zIndex = 5; + node.style.position = "relative"; + if (!widget.noHScroll) node.style.marginLeft = -dims.gutterTotalWidth + "px"; + } + } + + // SELECTION / CURSOR + + function updateSelection(cm) { + var display = cm.display; + var collapsed = posEq(cm.doc.sel.from, cm.doc.sel.to); + if (collapsed || cm.options.showCursorWhenSelecting) + updateSelectionCursor(cm); + else + display.cursor.style.display = display.otherCursor.style.display = "none"; + if (!collapsed) + updateSelectionRange(cm); + else + display.selectionDiv.style.display = "none"; + + // Move the hidden textarea near the cursor to prevent scrolling artifacts + if (cm.options.moveInputWithCursor) { + var headPos = cursorCoords(cm, cm.doc.sel.head, "div"); + var wrapOff = getRect(display.wrapper), lineOff = getRect(display.lineDiv); + display.inputDiv.style.top = Math.max(0, Math.min(display.wrapper.clientHeight - 10, + headPos.top + lineOff.top - wrapOff.top)) + "px"; + display.inputDiv.style.left = Math.max(0, Math.min(display.wrapper.clientWidth - 10, + headPos.left + lineOff.left - wrapOff.left)) + "px"; + } + } + + // No selection, plain cursor + function updateSelectionCursor(cm) { + var display = cm.display, pos = cursorCoords(cm, cm.doc.sel.head, "div"); + display.cursor.style.left = pos.left + "px"; + display.cursor.style.top = pos.top + "px"; + display.cursor.style.height = Math.max(0, pos.bottom - pos.top) * cm.options.cursorHeight + "px"; + display.cursor.style.display = ""; + + if (pos.other) { + display.otherCursor.style.display = ""; + display.otherCursor.style.left = pos.other.left + "px"; + display.otherCursor.style.top = pos.other.top + "px"; + display.otherCursor.style.height = (pos.other.bottom - pos.other.top) * .85 + "px"; + } else { display.otherCursor.style.display = "none"; } + } + + // Highlight selection + function updateSelectionRange(cm) { + var display = cm.display, doc = cm.doc, sel = cm.doc.sel; + var fragment = document.createDocumentFragment(); + var clientWidth = display.lineSpace.offsetWidth, pl = paddingLeft(cm.display); + + function add(left, top, width, bottom) { + if (top < 0) top = 0; + fragment.appendChild(elt("div", null, "CodeMirror-selected", "position: absolute; left: " + left + + "px; top: " + top + "px; width: " + (width == null ? clientWidth - left : width) + + "px; height: " + (bottom - top) + "px")); + } + + function drawForLine(line, fromArg, toArg, retTop) { + var lineObj = getLine(doc, line); + var lineLen = lineObj.text.length, rVal = retTop ? Infinity : -Infinity; + function coords(ch) { + return charCoords(cm, Pos(line, ch), "div", lineObj); + } + + iterateBidiSections(getOrder(lineObj), fromArg || 0, toArg == null ? lineLen : toArg, function(from, to, dir) { + var leftPos = coords(from), rightPos, left, right; + if (from == to) { + rightPos = leftPos; + left = right = leftPos.left; + } else { + rightPos = coords(to - 1); + if (dir == "rtl") { var tmp = leftPos; leftPos = rightPos; rightPos = tmp; } + left = leftPos.left; + right = rightPos.right; + } + if (rightPos.top - leftPos.top > 3) { // Different lines, draw top part + add(left, leftPos.top, null, leftPos.bottom); + left = pl; + if (leftPos.bottom < rightPos.top) add(left, leftPos.bottom, null, rightPos.top); + } + if (toArg == null && to == lineLen) right = clientWidth; + if (fromArg == null && from == 0) left = pl; + rVal = retTop ? Math.min(rightPos.top, rVal) : Math.max(rightPos.bottom, rVal); + if (left < pl + 1) left = pl; + add(left, rightPos.top, right - left, rightPos.bottom); + }); + return rVal; + } + + if (sel.from.line == sel.to.line) { + drawForLine(sel.from.line, sel.from.ch, sel.to.ch); + } else { + var fromObj = getLine(doc, sel.from.line); + var cur = fromObj, merged, path = [sel.from.line, sel.from.ch], singleLine; + while (merged = collapsedSpanAtEnd(cur)) { + var found = merged.find(); + path.push(found.from.ch, found.to.line, found.to.ch); + if (found.to.line == sel.to.line) { + path.push(sel.to.ch); + singleLine = true; + break; + } + cur = getLine(doc, found.to.line); + } + + // This is a single, merged line + if (singleLine) { + for (var i = 0; i < path.length; i += 3) + drawForLine(path[i], path[i+1], path[i+2]); + } else { + var middleTop, middleBot, toObj = getLine(doc, sel.to.line); + if (sel.from.ch) + // Draw the first line of selection. + middleTop = drawForLine(sel.from.line, sel.from.ch, null, false); + else + // Simply include it in the middle block. + middleTop = heightAtLine(cm, fromObj) - display.viewOffset; + + if (!sel.to.ch) + middleBot = heightAtLine(cm, toObj) - display.viewOffset; + else + middleBot = drawForLine(sel.to.line, collapsedSpanAtStart(toObj) ? null : 0, sel.to.ch, true); + + if (middleTop < middleBot) add(pl, middleTop, null, middleBot); + } + } + + removeChildrenAndAdd(display.selectionDiv, fragment); + display.selectionDiv.style.display = ""; + } + + // Cursor-blinking + function restartBlink(cm) { + if (!cm.state.focused) return; + var display = cm.display; + clearInterval(display.blinker); + var on = true; + display.cursor.style.visibility = display.otherCursor.style.visibility = ""; + display.blinker = setInterval(function() { + display.cursor.style.visibility = display.otherCursor.style.visibility = (on = !on) ? "" : "hidden"; + }, cm.options.cursorBlinkRate); + } + + // HIGHLIGHT WORKER + + function startWorker(cm, time) { + if (cm.doc.mode.startState && cm.doc.frontier < cm.display.showingTo) + cm.state.highlight.set(time, bind(highlightWorker, cm)); + } + + function highlightWorker(cm) { + var doc = cm.doc; + if (doc.frontier < doc.first) doc.frontier = doc.first; + if (doc.frontier >= cm.display.showingTo) return; + var end = +new Date + cm.options.workTime; + var state = copyState(doc.mode, getStateBefore(cm, doc.frontier)); + var changed = [], prevChange; + doc.iter(doc.frontier, Math.min(doc.first + doc.size, cm.display.showingTo + 500), function(line) { + if (doc.frontier >= cm.display.showingFrom) { // Visible + var oldStyles = line.styles; + line.styles = highlightLine(cm, line, state); + var ischange = !oldStyles || oldStyles.length != line.styles.length; + for (var i = 0; !ischange && i < oldStyles.length; ++i) ischange = oldStyles[i] != line.styles[i]; + if (ischange) { + if (prevChange && prevChange.end == doc.frontier) prevChange.end++; + else changed.push(prevChange = {start: doc.frontier, end: doc.frontier + 1}); + } + line.stateAfter = copyState(doc.mode, state); + } else { + processLine(cm, line, state); + line.stateAfter = doc.frontier % 5 == 0 ? copyState(doc.mode, state) : null; + } + ++doc.frontier; + if (+new Date > end) { + startWorker(cm, cm.options.workDelay); + return true; + } + }); + if (changed.length) + operation(cm, function() { + for (var i = 0; i < changed.length; ++i) + regChange(this, changed[i].start, changed[i].end); + })(); + } + + // Finds the line to start with when starting a parse. Tries to + // find a line with a stateAfter, so that it can start with a + // valid state. If that fails, it returns the line with the + // smallest indentation, which tends to need the least context to + // parse correctly. + function findStartLine(cm, n) { + var minindent, minline, doc = cm.doc; + for (var search = n, lim = n - 100; search > lim; --search) { + if (search <= doc.first) return doc.first; + var line = getLine(doc, search - 1); + if (line.stateAfter) return search; + var indented = countColumn(line.text, null, cm.options.tabSize); + if (minline == null || minindent > indented) { + minline = search - 1; + minindent = indented; + } + } + return minline; + } + + function getStateBefore(cm, n) { + var doc = cm.doc, display = cm.display; + if (!doc.mode.startState) return true; + var pos = findStartLine(cm, n), state = pos > doc.first && getLine(doc, pos-1).stateAfter; + if (!state) state = startState(doc.mode); + else state = copyState(doc.mode, state); + doc.iter(pos, n, function(line) { + processLine(cm, line, state); + var save = pos == n - 1 || pos % 5 == 0 || pos >= display.showingFrom && pos < display.showingTo; + line.stateAfter = save ? copyState(doc.mode, state) : null; + ++pos; + }); + return state; + } + + // POSITION MEASUREMENT + + function paddingTop(display) {return display.lineSpace.offsetTop;} + function paddingVert(display) {return display.mover.offsetHeight - display.lineSpace.offsetHeight;} + function paddingLeft(display) { + var e = removeChildrenAndAdd(display.measure, elt("pre", null, null, "text-align: left")).appendChild(elt("span", "x")); + return e.offsetLeft; + } + + function measureChar(cm, line, ch, data) { + var dir = -1; + data = data || measureLine(cm, line); + + for (var pos = ch;; pos += dir) { + var r = data[pos]; + if (r) break; + if (dir < 0 && pos == 0) dir = 1; + } + return {left: pos < ch ? r.right : r.left, + right: pos > ch ? r.left : r.right, + top: r.top, bottom: r.bottom}; + } + + function findCachedMeasurement(cm, line) { + var cache = cm.display.measureLineCache; + for (var i = 0; i < cache.length; ++i) { + var memo = cache[i]; + if (memo.text == line.text && memo.markedSpans == line.markedSpans && + cm.display.scroller.clientWidth == memo.width && + memo.classes == line.textClass + "|" + line.bgClass + "|" + line.wrapClass) + return memo.measure; + } + } + + function measureLine(cm, line) { + // First look in the cache + var measure = findCachedMeasurement(cm, line); + if (!measure) { + // Failing that, recompute and store result in cache + measure = measureLineInner(cm, line); + var cache = cm.display.measureLineCache; + var memo = {text: line.text, width: cm.display.scroller.clientWidth, + markedSpans: line.markedSpans, measure: measure, + classes: line.textClass + "|" + line.bgClass + "|" + line.wrapClass}; + if (cache.length == 16) cache[++cm.display.measureLineCachePos % 16] = memo; + else cache.push(memo); + } + return measure; + } + + function measureLineInner(cm, line) { + var display = cm.display, measure = emptyArray(line.text.length); + var pre = lineContent(cm, line, measure); + + // IE does not cache element positions of inline elements between + // calls to getBoundingClientRect. This makes the loop below, + // which gathers the positions of all the characters on the line, + // do an amount of layout work quadratic to the number of + // characters. When line wrapping is off, we try to improve things + // by first subdividing the line into a bunch of inline blocks, so + // that IE can reuse most of the layout information from caches + // for those blocks. This does interfere with line wrapping, so it + // doesn't work when wrapping is on, but in that case the + // situation is slightly better, since IE does cache line-wrapping + // information and only recomputes per-line. + if (ie && !ie_lt8 && !cm.options.lineWrapping && pre.childNodes.length > 100) { + var fragment = document.createDocumentFragment(); + var chunk = 10, n = pre.childNodes.length; + for (var i = 0, chunks = Math.ceil(n / chunk); i < chunks; ++i) { + var wrap = elt("div", null, null, "display: inline-block"); + for (var j = 0; j < chunk && n; ++j) { + wrap.appendChild(pre.firstChild); + --n; + } + fragment.appendChild(wrap); + } + pre.appendChild(fragment); + } + + removeChildrenAndAdd(display.measure, pre); + + var outer = getRect(display.lineDiv); + var vranges = [], data = emptyArray(line.text.length), maxBot = pre.offsetHeight; + // Work around an IE7/8 bug where it will sometimes have randomly + // replaced our pre with a clone at this point. + if (ie_lt9 && display.measure.first != pre) + removeChildrenAndAdd(display.measure, pre); + + for (var i = 0, cur; i < measure.length; ++i) if (cur = measure[i]) { + var size = getRect(cur); + var top = Math.max(0, size.top - outer.top), bot = Math.min(size.bottom - outer.top, maxBot); + for (var j = 0; j < vranges.length; j += 2) { + var rtop = vranges[j], rbot = vranges[j+1]; + if (rtop > bot || rbot < top) continue; + if (rtop <= top && rbot >= bot || + top <= rtop && bot >= rbot || + Math.min(bot, rbot) - Math.max(top, rtop) >= (bot - top) >> 1) { + vranges[j] = Math.min(top, rtop); + vranges[j+1] = Math.max(bot, rbot); + break; + } + } + if (j == vranges.length) vranges.push(top, bot); + var right = size.right; + if (cur.measureRight) right = getRect(cur.measureRight).left; + data[i] = {left: size.left - outer.left, right: right - outer.left, top: j}; + } + for (var i = 0, cur; i < data.length; ++i) if (cur = data[i]) { + var vr = cur.top; + cur.top = vranges[vr]; cur.bottom = vranges[vr+1]; + } + + return data; + } + + function measureLineWidth(cm, line) { + var hasBadSpan = false; + if (line.markedSpans) for (var i = 0; i < line.markedSpans; ++i) { + var sp = line.markedSpans[i]; + if (sp.collapsed && (sp.to == null || sp.to == line.text.length)) hasBadSpan = true; + } + var cached = !hasBadSpan && findCachedMeasurement(cm, line); + if (cached) return measureChar(cm, line, line.text.length, cached).right; + + var pre = lineContent(cm, line); + var end = pre.appendChild(zeroWidthElement(cm.display.measure)); + removeChildrenAndAdd(cm.display.measure, pre); + return getRect(end).right - getRect(cm.display.lineDiv).left; + } + + function clearCaches(cm) { + cm.display.measureLineCache.length = cm.display.measureLineCachePos = 0; + cm.display.cachedCharWidth = cm.display.cachedTextHeight = null; + if (!cm.options.lineWrapping) cm.display.maxLineChanged = true; + cm.display.lineNumChars = null; + } + + // Context is one of "line", "div" (display.lineDiv), "local"/null (editor), or "page" + function intoCoordSystem(cm, lineObj, rect, context) { + if (lineObj.widgets) for (var i = 0; i < lineObj.widgets.length; ++i) if (lineObj.widgets[i].above) { + var size = widgetHeight(lineObj.widgets[i]); + rect.top += size; rect.bottom += size; + } + if (context == "line") return rect; + if (!context) context = "local"; + var yOff = heightAtLine(cm, lineObj); + if (context != "local") yOff -= cm.display.viewOffset; + if (context == "page") { + var lOff = getRect(cm.display.lineSpace); + yOff += lOff.top + (window.pageYOffset || (document.documentElement || document.body).scrollTop); + var xOff = lOff.left + (window.pageXOffset || (document.documentElement || document.body).scrollLeft); + rect.left += xOff; rect.right += xOff; + } + rect.top += yOff; rect.bottom += yOff; + return rect; + } + + // Context may be "window", "page", "div", or "local"/null + // Result is in "div" coords + function fromCoordSystem(cm, coords, context) { + if (context == "div") return coords; + var left = coords.left, top = coords.top; + if (context == "page") { + left -= window.pageXOffset || (document.documentElement || document.body).scrollLeft; + top -= window.pageYOffset || (document.documentElement || document.body).scrollTop; + } + var lineSpaceBox = getRect(cm.display.lineSpace); + left -= lineSpaceBox.left; + top -= lineSpaceBox.top; + if (context == "local" || !context) { + var editorBox = getRect(cm.display.wrapper); + left += editorBox.left; + top += editorBox.top; + } + return {left: left, top: top}; + } + + function charCoords(cm, pos, context, lineObj) { + if (!lineObj) lineObj = getLine(cm.doc, pos.line); + return intoCoordSystem(cm, lineObj, measureChar(cm, lineObj, pos.ch), context); + } + + function cursorCoords(cm, pos, context, lineObj, measurement) { + lineObj = lineObj || getLine(cm.doc, pos.line); + if (!measurement) measurement = measureLine(cm, lineObj); + function get(ch, right) { + var m = measureChar(cm, lineObj, ch, measurement); + if (right) m.left = m.right; else m.right = m.left; + return intoCoordSystem(cm, lineObj, m, context); + } + var order = getOrder(lineObj), ch = pos.ch; + if (!order) return get(ch); + var main, other, linedir = order[0].level; + for (var i = 0; i < order.length; ++i) { + var part = order[i], rtl = part.level % 2, nb, here; + if (part.from < ch && part.to > ch) return get(ch, rtl); + var left = rtl ? part.to : part.from, right = rtl ? part.from : part.to; + if (left == ch) { + // IE returns bogus offsets and widths for edges where the + // direction flips, but only for the side with the lower + // level. So we try to use the side with the higher level. + if (i && part.level < (nb = order[i-1]).level) here = get(nb.level % 2 ? nb.from : nb.to - 1, true); + else here = get(rtl && part.from != part.to ? ch - 1 : ch); + if (rtl == linedir) main = here; else other = here; + } else if (right == ch) { + var nb = i < order.length - 1 && order[i+1]; + if (!rtl && nb && nb.from == nb.to) continue; + if (nb && part.level < nb.level) here = get(nb.level % 2 ? nb.to - 1 : nb.from); + else here = get(rtl ? ch : ch - 1, true); + if (rtl == linedir) main = here; else other = here; + } + } + if (linedir && !ch) other = get(order[0].to - 1); + if (!main) return other; + if (other) main.other = other; + return main; + } + + function PosMaybeOutside(line, ch, outside) { + var pos = new Pos(line, ch); + if (outside) pos.outside = true; + return pos; + } + + // Coords must be lineSpace-local + function coordsChar(cm, x, y) { + var doc = cm.doc; + y += cm.display.viewOffset; + if (y < 0) return PosMaybeOutside(doc.first, 0, true); + var lineNo = lineAtHeight(doc, y), last = doc.first + doc.size - 1; + if (lineNo > last) + return PosMaybeOutside(doc.first + doc.size - 1, getLine(doc, last).text.length, true); + if (x < 0) x = 0; + + for (;;) { + var lineObj = getLine(doc, lineNo); + var found = coordsCharInner(cm, lineObj, lineNo, x, y); + var merged = collapsedSpanAtEnd(lineObj); + var mergedPos = merged && merged.find(); + if (merged && found.ch >= mergedPos.from.ch) + lineNo = mergedPos.to.line; + else + return found; + } + } + + function coordsCharInner(cm, lineObj, lineNo, x, y) { + var innerOff = y - heightAtLine(cm, lineObj); + var wrongLine = false, adjust = 2 * cm.display.wrapper.clientWidth; + var measurement = measureLine(cm, lineObj); + + function getX(ch) { + var sp = cursorCoords(cm, Pos(lineNo, ch), "line", + lineObj, measurement); + wrongLine = true; + if (innerOff > sp.bottom) return sp.left - adjust; + else if (innerOff < sp.top) return sp.left + adjust; + else wrongLine = false; + return sp.left; + } + + var bidi = getOrder(lineObj), dist = lineObj.text.length; + var from = lineLeft(lineObj), to = lineRight(lineObj); + var fromX = getX(from), fromOutside = wrongLine, toX = getX(to), toOutside = wrongLine; + + if (x > toX) return PosMaybeOutside(lineNo, to, toOutside); + // Do a binary search between these bounds. + for (;;) { + if (bidi ? to == from || to == moveVisually(lineObj, from, 1) : to - from <= 1) { + var after = x - fromX < toX - x, ch = after ? from : to; + while (isExtendingChar.test(lineObj.text.charAt(ch))) ++ch; + var pos = PosMaybeOutside(lineNo, ch, after ? fromOutside : toOutside); + pos.after = after; + return pos; + } + var step = Math.ceil(dist / 2), middle = from + step; + if (bidi) { + middle = from; + for (var i = 0; i < step; ++i) middle = moveVisually(lineObj, middle, 1); + } + var middleX = getX(middle); + if (middleX > x) {to = middle; toX = middleX; if (toOutside = wrongLine) toX += 1000; dist = step;} + else {from = middle; fromX = middleX; fromOutside = wrongLine; dist -= step;} + } + } + + var measureText; + function textHeight(display) { + if (display.cachedTextHeight != null) return display.cachedTextHeight; + if (measureText == null) { + measureText = elt("pre"); + // Measure a bunch of lines, for browsers that compute + // fractional heights. + for (var i = 0; i < 49; ++i) { + measureText.appendChild(document.createTextNode("x")); + measureText.appendChild(elt("br")); + } + measureText.appendChild(document.createTextNode("x")); + } + removeChildrenAndAdd(display.measure, measureText); + var height = measureText.offsetHeight / 50; + if (height > 3) display.cachedTextHeight = height; + removeChildren(display.measure); + return height || 1; + } + + function charWidth(display) { + if (display.cachedCharWidth != null) return display.cachedCharWidth; + var anchor = elt("span", "x"); + var pre = elt("pre", [anchor]); + removeChildrenAndAdd(display.measure, pre); + var width = anchor.offsetWidth; + if (width > 2) display.cachedCharWidth = width; + return width || 10; + } + + // OPERATIONS + + // Operations are used to wrap changes in such a way that each + // change won't have to update the cursor and display (which would + // be awkward, slow, and error-prone), but instead updates are + // batched and then all combined and executed at once. + + var nextOpId = 0; + function startOperation(cm) { + cm.curOp = { + // An array of ranges of lines that have to be updated. See + // updateDisplay. + changes: [], + updateInput: null, + userSelChange: null, + textChanged: null, + selectionChanged: false, + cursorActivity: false, + updateMaxLine: false, + updateScrollPos: false, + id: ++nextOpId + }; + if (!delayedCallbackDepth++) delayedCallbacks = []; + } + + function endOperation(cm) { + var op = cm.curOp, doc = cm.doc, display = cm.display; + cm.curOp = null; + + if (op.updateMaxLine) computeMaxLength(cm); + if (display.maxLineChanged && !cm.options.lineWrapping && display.maxLine) { + var width = measureLineWidth(cm, display.maxLine); + display.sizer.style.minWidth = Math.max(0, width + 3 + scrollerCutOff) + "px"; + display.maxLineChanged = false; + var maxScrollLeft = Math.max(0, display.sizer.offsetLeft + display.sizer.offsetWidth - display.scroller.clientWidth); + if (maxScrollLeft < doc.scrollLeft && !op.updateScrollPos) + setScrollLeft(cm, Math.min(display.scroller.scrollLeft, maxScrollLeft), true); + } + var newScrollPos, updated; + if (op.updateScrollPos) { + newScrollPos = op.updateScrollPos; + } else if (op.selectionChanged && display.scroller.clientHeight) { // don't rescroll if not visible + var coords = cursorCoords(cm, doc.sel.head); + newScrollPos = calculateScrollPos(cm, coords.left, coords.top, coords.left, coords.bottom); + } + if (op.changes.length || newScrollPos && newScrollPos.scrollTop != null) { + updated = updateDisplay(cm, op.changes, newScrollPos && newScrollPos.scrollTop); + if (cm.display.scroller.offsetHeight) cm.doc.scrollTop = cm.display.scroller.scrollTop; + } + if (!updated && op.selectionChanged) updateSelection(cm); + if (op.updateScrollPos) { + display.scroller.scrollTop = display.scrollbarV.scrollTop = doc.scrollTop = newScrollPos.scrollTop; + display.scroller.scrollLeft = display.scrollbarH.scrollLeft = doc.scrollLeft = newScrollPos.scrollLeft; + alignHorizontally(cm); + if (op.scrollToPos) + scrollPosIntoView(cm, clipPos(cm.doc, op.scrollToPos), op.scrollToPosMargin); + } else if (newScrollPos) { + scrollCursorIntoView(cm); + } + if (op.selectionChanged) restartBlink(cm); + + if (cm.state.focused && op.updateInput) + resetInput(cm, op.userSelChange); + + var hidden = op.maybeHiddenMarkers, unhidden = op.maybeUnhiddenMarkers; + if (hidden) for (var i = 0; i < hidden.length; ++i) + if (!hidden[i].lines.length) signal(hidden[i], "hide"); + if (unhidden) for (var i = 0; i < unhidden.length; ++i) + if (unhidden[i].lines.length) signal(unhidden[i], "unhide"); + + var delayed; + if (!--delayedCallbackDepth) { + delayed = delayedCallbacks; + delayedCallbacks = null; + } + if (op.textChanged) + signal(cm, "change", cm, op.textChanged); + if (op.cursorActivity) signal(cm, "cursorActivity", cm); + if (delayed) for (var i = 0; i < delayed.length; ++i) delayed[i](); + } + + // Wraps a function in an operation. Returns the wrapped function. + function operation(cm1, f) { + return function() { + var cm = cm1 || this, withOp = !cm.curOp; + if (withOp) startOperation(cm); + try { var result = f.apply(cm, arguments); } + finally { if (withOp) endOperation(cm); } + return result; + }; + } + function docOperation(f) { + return function() { + var withOp = this.cm && !this.cm.curOp, result; + if (withOp) startOperation(this.cm); + try { result = f.apply(this, arguments); } + finally { if (withOp) endOperation(this.cm); } + return result; + }; + } + function runInOp(cm, f) { + var withOp = !cm.curOp, result; + if (withOp) startOperation(cm); + try { result = f(); } + finally { if (withOp) endOperation(cm); } + return result; + } + + function regChange(cm, from, to, lendiff) { + if (from == null) from = cm.doc.first; + if (to == null) to = cm.doc.first + cm.doc.size; + cm.curOp.changes.push({from: from, to: to, diff: lendiff}); + } + + // INPUT HANDLING + + function slowPoll(cm) { + if (cm.display.pollingFast) return; + cm.display.poll.set(cm.options.pollInterval, function() { + readInput(cm); + if (cm.state.focused) slowPoll(cm); + }); + } + + function fastPoll(cm) { + var missed = false; + cm.display.pollingFast = true; + function p() { + var changed = readInput(cm); + if (!changed && !missed) {missed = true; cm.display.poll.set(60, p);} + else {cm.display.pollingFast = false; slowPoll(cm);} + } + cm.display.poll.set(20, p); + } + + // prevInput is a hack to work with IME. If we reset the textarea + // on every change, that breaks IME. So we look for changes + // compared to the previous content instead. (Modern browsers have + // events that indicate IME taking place, but these are not widely + // supported or compatible enough yet to rely on.) + function readInput(cm) { + var input = cm.display.input, prevInput = cm.display.prevInput, doc = cm.doc, sel = doc.sel; + if (!cm.state.focused || hasSelection(input) || isReadOnly(cm)) return false; + var text = input.value; + if (text == prevInput && posEq(sel.from, sel.to)) return false; + if (ie && !ie_lt9 && cm.display.inputHasSelection === text) { + resetInput(cm, true); + return false; + } + + var withOp = !cm.curOp; + if (withOp) startOperation(cm); + sel.shift = false; + var same = 0, l = Math.min(prevInput.length, text.length); + while (same < l && prevInput.charCodeAt(same) == text.charCodeAt(same)) ++same; + var from = sel.from, to = sel.to; + if (same < prevInput.length) + from = Pos(from.line, from.ch - (prevInput.length - same)); + else if (cm.state.overwrite && posEq(from, to) && !cm.state.pasteIncoming) + to = Pos(to.line, Math.min(getLine(doc, to.line).text.length, to.ch + (text.length - same))); + var updateInput = cm.curOp.updateInput; + makeChange(cm.doc, {from: from, to: to, text: splitLines(text.slice(same)), + origin: cm.state.pasteIncoming ? "paste" : "+input"}, "end"); + + cm.curOp.updateInput = updateInput; + if (text.length > 1000 || text.indexOf("\n") > -1) input.value = cm.display.prevInput = ""; + else cm.display.prevInput = text; + if (withOp) endOperation(cm); + cm.state.pasteIncoming = false; + return true; + } + + function resetInput(cm, user) { + var minimal, selected, doc = cm.doc; + if (!posEq(doc.sel.from, doc.sel.to)) { + cm.display.prevInput = ""; + minimal = hasCopyEvent && + (doc.sel.to.line - doc.sel.from.line > 100 || (selected = cm.getSelection()).length > 1000); + var content = minimal ? "-" : selected || cm.getSelection(); + cm.display.input.value = content; + if (cm.state.focused) selectInput(cm.display.input); + if (ie && !ie_lt9) cm.display.inputHasSelection = content; + } else if (user) { + cm.display.prevInput = cm.display.input.value = ""; + if (ie && !ie_lt9) cm.display.inputHasSelection = null; + } + cm.display.inaccurateSelection = minimal; + } + + function focusInput(cm) { + if (cm.options.readOnly != "nocursor" && (!mobile || document.activeElement != cm.display.input)) + cm.display.input.focus(); + } + + function isReadOnly(cm) { + return cm.options.readOnly || cm.doc.cantEdit; + } + + // EVENT HANDLERS + + function registerEventHandlers(cm) { + var d = cm.display; + on(d.scroller, "mousedown", operation(cm, onMouseDown)); + if (ie) + on(d.scroller, "dblclick", operation(cm, function(e) { + var pos = posFromMouse(cm, e); + if (!pos || clickInGutter(cm, e) || eventInWidget(cm.display, e)) return; + e_preventDefault(e); + var word = findWordAt(getLine(cm.doc, pos.line).text, pos); + extendSelection(cm.doc, word.from, word.to); + })); + else + on(d.scroller, "dblclick", e_preventDefault); + on(d.lineSpace, "selectstart", function(e) { + if (!eventInWidget(d, e)) e_preventDefault(e); + }); + // Gecko browsers fire contextmenu *after* opening the menu, at + // which point we can't mess with it anymore. Context menu is + // handled in onMouseDown for Gecko. + if (!captureMiddleClick) on(d.scroller, "contextmenu", function(e) {onContextMenu(cm, e);}); + + on(d.scroller, "scroll", function() { + if (d.scroller.clientHeight) { + setScrollTop(cm, d.scroller.scrollTop); + setScrollLeft(cm, d.scroller.scrollLeft, true); + signal(cm, "scroll", cm); + } + }); + on(d.scrollbarV, "scroll", function() { + if (d.scroller.clientHeight) setScrollTop(cm, d.scrollbarV.scrollTop); + }); + on(d.scrollbarH, "scroll", function() { + if (d.scroller.clientHeight) setScrollLeft(cm, d.scrollbarH.scrollLeft); + }); + + on(d.scroller, "mousewheel", function(e){onScrollWheel(cm, e);}); + on(d.scroller, "DOMMouseScroll", function(e){onScrollWheel(cm, e);}); + + function reFocus() { if (cm.state.focused) setTimeout(bind(focusInput, cm), 0); } + on(d.scrollbarH, "mousedown", reFocus); + on(d.scrollbarV, "mousedown", reFocus); + // Prevent wrapper from ever scrolling + on(d.wrapper, "scroll", function() { d.wrapper.scrollTop = d.wrapper.scrollLeft = 0; }); + + function onResize() { + // Might be a text scaling operation, clear size caches. + d.cachedCharWidth = d.cachedTextHeight = null; + clearCaches(cm); + runInOp(cm, bind(regChange, cm)); + } + on(window, "resize", onResize); + // Above handler holds on to the editor and its data structures. + // Here we poll to unregister it when the editor is no longer in + // the document, so that it can be garbage-collected. + function unregister() { + for (var p = d.wrapper.parentNode; p && p != document.body; p = p.parentNode) {} + if (p) setTimeout(unregister, 5000); + else off(window, "resize", onResize); + } + setTimeout(unregister, 5000); + + on(d.input, "keyup", operation(cm, function(e) { + if (cm.options.onKeyEvent && cm.options.onKeyEvent(cm, addStop(e))) return; + if (e.keyCode == 16) cm.doc.sel.shift = false; + })); + on(d.input, "input", bind(fastPoll, cm)); + on(d.input, "keydown", operation(cm, onKeyDown)); + on(d.input, "keypress", operation(cm, onKeyPress)); + on(d.input, "focus", bind(onFocus, cm)); + on(d.input, "blur", bind(onBlur, cm)); + + function drag_(e) { + if (cm.options.onDragEvent && cm.options.onDragEvent(cm, addStop(e))) return; + e_stop(e); + } + if (cm.options.dragDrop) { + on(d.scroller, "dragstart", function(e){onDragStart(cm, e);}); + on(d.scroller, "dragenter", drag_); + on(d.scroller, "dragover", drag_); + on(d.scroller, "drop", operation(cm, onDrop)); + } + on(d.scroller, "paste", function(e){ + if (eventInWidget(d, e)) return; + focusInput(cm); + fastPoll(cm); + }); + on(d.input, "paste", function() { + cm.state.pasteIncoming = true; + fastPoll(cm); + }); + + function prepareCopy() { + if (d.inaccurateSelection) { + d.prevInput = ""; + d.inaccurateSelection = false; + d.input.value = cm.getSelection(); + selectInput(d.input); + } + } + on(d.input, "cut", prepareCopy); + on(d.input, "copy", prepareCopy); + + // Needed to handle Tab key in KHTML + if (khtml) on(d.sizer, "mouseup", function() { + if (document.activeElement == d.input) d.input.blur(); + focusInput(cm); + }); + } + + function eventInWidget(display, e) { + for (var n = e_target(e); n != display.wrapper; n = n.parentNode) { + if (!n) return true; + if (/\bCodeMirror-(?:line)?widget\b/.test(n.className) || + n.parentNode == display.sizer && n != display.mover) return true; + } + } + + function posFromMouse(cm, e, liberal) { + var display = cm.display; + if (!liberal) { + var target = e_target(e); + if (target == display.scrollbarH || target == display.scrollbarH.firstChild || + target == display.scrollbarV || target == display.scrollbarV.firstChild || + target == display.scrollbarFiller) return null; + } + var x, y, space = getRect(display.lineSpace); + // Fails unpredictably on IE[67] when mouse is dragged around quickly. + try { x = e.clientX; y = e.clientY; } catch (e) { return null; } + return coordsChar(cm, x - space.left, y - space.top); + } + + var lastClick, lastDoubleClick; + function onMouseDown(e) { + var cm = this, display = cm.display, doc = cm.doc, sel = doc.sel; + sel.shift = e.shiftKey; + + if (eventInWidget(display, e)) { + if (!webkit) { + display.scroller.draggable = false; + setTimeout(function(){display.scroller.draggable = true;}, 100); + } + return; + } + if (clickInGutter(cm, e)) return; + var start = posFromMouse(cm, e); + + switch (e_button(e)) { + case 3: + if (captureMiddleClick) onContextMenu.call(cm, cm, e); + return; + case 2: + if (start) extendSelection(cm.doc, start); + setTimeout(bind(focusInput, cm), 20); + e_preventDefault(e); + return; + } + // For button 1, if it was clicked inside the editor + // (posFromMouse returning non-null), we have to adjust the + // selection. + if (!start) {if (e_target(e) == display.scroller) e_preventDefault(e); return;} + + if (!cm.state.focused) onFocus(cm); + + var now = +new Date, type = "single"; + if (lastDoubleClick && lastDoubleClick.time > now - 400 && posEq(lastDoubleClick.pos, start)) { + type = "triple"; + e_preventDefault(e); + setTimeout(bind(focusInput, cm), 20); + selectLine(cm, start.line); + } else if (lastClick && lastClick.time > now - 400 && posEq(lastClick.pos, start)) { + type = "double"; + lastDoubleClick = {time: now, pos: start}; + e_preventDefault(e); + var word = findWordAt(getLine(doc, start.line).text, start); + extendSelection(cm.doc, word.from, word.to); + } else { lastClick = {time: now, pos: start}; } + + var last = start; + if (cm.options.dragDrop && dragAndDrop && !isReadOnly(cm) && !posEq(sel.from, sel.to) && + !posLess(start, sel.from) && !posLess(sel.to, start) && type == "single") { + var dragEnd = operation(cm, function(e2) { + if (webkit) display.scroller.draggable = false; + cm.state.draggingText = false; + off(document, "mouseup", dragEnd); + off(display.scroller, "drop", dragEnd); + if (Math.abs(e.clientX - e2.clientX) + Math.abs(e.clientY - e2.clientY) < 10) { + e_preventDefault(e2); + extendSelection(cm.doc, start); + focusInput(cm); + } + }); + // Let the drag handler handle this. + if (webkit) display.scroller.draggable = true; + cm.state.draggingText = dragEnd; + // IE's approach to draggable + if (display.scroller.dragDrop) display.scroller.dragDrop(); + on(document, "mouseup", dragEnd); + on(display.scroller, "drop", dragEnd); + return; + } + e_preventDefault(e); + if (type == "single") extendSelection(cm.doc, clipPos(doc, start)); + + var startstart = sel.from, startend = sel.to, lastPos = start; + + function doSelect(cur) { + if (posEq(lastPos, cur)) return; + lastPos = cur; + + if (type == "single") { + extendSelection(cm.doc, clipPos(doc, start), cur); + return; + } + + startstart = clipPos(doc, startstart); + startend = clipPos(doc, startend); + if (type == "double") { + var word = findWordAt(getLine(doc, cur.line).text, cur); + if (posLess(cur, startstart)) extendSelection(cm.doc, word.from, startend); + else extendSelection(cm.doc, startstart, word.to); + } else if (type == "triple") { + if (posLess(cur, startstart)) extendSelection(cm.doc, startend, clipPos(doc, Pos(cur.line, 0))); + else extendSelection(cm.doc, startstart, clipPos(doc, Pos(cur.line + 1, 0))); + } + } + + var editorSize = getRect(display.wrapper); + // Used to ensure timeout re-tries don't fire when another extend + // happened in the meantime (clearTimeout isn't reliable -- at + // least on Chrome, the timeouts still happen even when cleared, + // if the clear happens after their scheduled firing time). + var counter = 0; + + function extend(e) { + var curCount = ++counter; + var cur = posFromMouse(cm, e, true); + if (!cur) return; + if (!posEq(cur, last)) { + if (!cm.state.focused) onFocus(cm); + last = cur; + doSelect(cur); + var visible = visibleLines(display, doc); + if (cur.line >= visible.to || cur.line < visible.from) + setTimeout(operation(cm, function(){if (counter == curCount) extend(e);}), 150); + } else { + var outside = e.clientY < editorSize.top ? -20 : e.clientY > editorSize.bottom ? 20 : 0; + if (outside) setTimeout(operation(cm, function() { + if (counter != curCount) return; + display.scroller.scrollTop += outside; + extend(e); + }), 50); + } + } + + function done(e) { + counter = Infinity; + var cur = posFromMouse(cm, e); + if (cur) doSelect(cur); + e_preventDefault(e); + focusInput(cm); + off(document, "mousemove", move); + off(document, "mouseup", up); + } + + var move = operation(cm, function(e) { + if (!ie && !e_button(e)) done(e); + else extend(e); + }); + var up = operation(cm, done); + on(document, "mousemove", move); + on(document, "mouseup", up); + } + + function onDrop(e) { + var cm = this; + if (eventInWidget(cm.display, e) || (cm.options.onDragEvent && cm.options.onDragEvent(cm, addStop(e)))) + return; + e_preventDefault(e); + var pos = posFromMouse(cm, e, true), files = e.dataTransfer.files; + if (!pos || isReadOnly(cm)) return; + if (files && files.length && window.FileReader && window.File) { + var n = files.length, text = Array(n), read = 0; + var loadFile = function(file, i) { + var reader = new FileReader; + reader.onload = function() { + text[i] = reader.result; + if (++read == n) { + pos = clipPos(cm.doc, pos); + makeChange(cm.doc, {from: pos, to: pos, text: splitLines(text.join("\n")), origin: "paste"}, "around"); + } + }; + reader.readAsText(file); + }; + for (var i = 0; i < n; ++i) loadFile(files[i], i); + } else { + // Don't do a replace if the drop happened inside of the selected text. + if (cm.state.draggingText && !(posLess(pos, cm.doc.sel.from) || posLess(cm.doc.sel.to, pos))) { + cm.state.draggingText(e); + // Ensure the editor is re-focused + setTimeout(bind(focusInput, cm), 20); + return; + } + try { + var text = e.dataTransfer.getData("Text"); + if (text) { + var curFrom = cm.doc.sel.from, curTo = cm.doc.sel.to; + setSelection(cm.doc, pos, pos); + if (cm.state.draggingText) replaceRange(cm.doc, "", curFrom, curTo, "paste"); + cm.replaceSelection(text, null, "paste"); + focusInput(cm); + onFocus(cm); + } + } + catch(e){} + } + } + + function clickInGutter(cm, e) { + var display = cm.display; + try { var mX = e.clientX, mY = e.clientY; } + catch(e) { return false; } + + if (mX >= Math.floor(getRect(display.gutters).right)) return false; + e_preventDefault(e); + if (!hasHandler(cm, "gutterClick")) return true; + + var lineBox = getRect(display.lineDiv); + if (mY > lineBox.bottom) return true; + mY -= lineBox.top - display.viewOffset; + + for (var i = 0; i < cm.options.gutters.length; ++i) { + var g = display.gutters.childNodes[i]; + if (g && getRect(g).right >= mX) { + var line = lineAtHeight(cm.doc, mY); + var gutter = cm.options.gutters[i]; + signalLater(cm, "gutterClick", cm, line, gutter, e); + break; + } + } + return true; + } + + function onDragStart(cm, e) { + if (ie && !cm.state.draggingText) { e_stop(e); return; } + if (eventInWidget(cm.display, e)) return; + + var txt = cm.getSelection(); + e.dataTransfer.setData("Text", txt); + + // Use dummy image instead of default browsers image. + // Recent Safari (~6.0.2) have a tendency to segfault when this happens, so we don't do it there. + if (e.dataTransfer.setDragImage) { + var img = elt("img", null, null, "position: fixed; left: 0; top: 0;"); + if (opera) { + img.width = img.height = 1; + cm.display.wrapper.appendChild(img); + // Force a relayout, or Opera won't use our image for some obscure reason + img._top = img.offsetTop; + } + if (safari) { + if (cm.display.dragImg) { + img = cm.display.dragImg; + } else { + cm.display.dragImg = img; + img.src = "data:image/gif;base64,R0lGODlhAQABAAAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw=="; + cm.display.wrapper.appendChild(img); + } + } + e.dataTransfer.setDragImage(img, 0, 0); + if (opera) img.parentNode.removeChild(img); + } + } + + function setScrollTop(cm, val) { + if (Math.abs(cm.doc.scrollTop - val) < 2) return; + cm.doc.scrollTop = val; + if (!gecko) updateDisplay(cm, [], val); + if (cm.display.scroller.scrollTop != val) cm.display.scroller.scrollTop = val; + if (cm.display.scrollbarV.scrollTop != val) cm.display.scrollbarV.scrollTop = val; + if (gecko) updateDisplay(cm, []); + } + function setScrollLeft(cm, val, isScroller) { + if (isScroller ? val == cm.doc.scrollLeft : Math.abs(cm.doc.scrollLeft - val) < 2) return; + val = Math.min(val, cm.display.scroller.scrollWidth - cm.display.scroller.clientWidth); + cm.doc.scrollLeft = val; + alignHorizontally(cm); + if (cm.display.scroller.scrollLeft != val) cm.display.scroller.scrollLeft = val; + if (cm.display.scrollbarH.scrollLeft != val) cm.display.scrollbarH.scrollLeft = val; + } + + // Since the delta values reported on mouse wheel events are + // unstandardized between browsers and even browser versions, and + // generally horribly unpredictable, this code starts by measuring + // the scroll effect that the first few mouse wheel events have, + // and, from that, detects the way it can convert deltas to pixel + // offsets afterwards. + // + // The reason we want to know the amount a wheel event will scroll + // is that it gives us a chance to update the display before the + // actual scrolling happens, reducing flickering. + + var wheelSamples = 0, wheelPixelsPerUnit = null; + // Fill in a browser-detected starting value on browsers where we + // know one. These don't have to be accurate -- the result of them + // being wrong would just be a slight flicker on the first wheel + // scroll (if it is large enough). + if (ie) wheelPixelsPerUnit = -.53; + else if (gecko) wheelPixelsPerUnit = 15; + else if (chrome) wheelPixelsPerUnit = -.7; + else if (safari) wheelPixelsPerUnit = -1/3; + + function onScrollWheel(cm, e) { + var dx = e.wheelDeltaX, dy = e.wheelDeltaY; + if (dx == null && e.detail && e.axis == e.HORIZONTAL_AXIS) dx = e.detail; + if (dy == null && e.detail && e.axis == e.VERTICAL_AXIS) dy = e.detail; + else if (dy == null) dy = e.wheelDelta; + + var display = cm.display, scroll = display.scroller; + // Quit if there's nothing to scroll here + if (!(dx && scroll.scrollWidth > scroll.clientWidth || + dy && scroll.scrollHeight > scroll.clientHeight)) return; + + // Webkit browsers on OS X abort momentum scrolls when the target + // of the scroll event is removed from the scrollable element. + // This hack (see related code in patchDisplay) makes sure the + // element is kept around. + if (dy && mac && webkit) { + for (var cur = e.target; cur != scroll; cur = cur.parentNode) { + if (cur.lineObj) { + cm.display.currentWheelTarget = cur; + break; + } + } + } + + // On some browsers, horizontal scrolling will cause redraws to + // happen before the gutter has been realigned, causing it to + // wriggle around in a most unseemly way. When we have an + // estimated pixels/delta value, we just handle horizontal + // scrolling entirely here. It'll be slightly off from native, but + // better than glitching out. + if (dx && !gecko && !opera && wheelPixelsPerUnit != null) { + if (dy) + setScrollTop(cm, Math.max(0, Math.min(scroll.scrollTop + dy * wheelPixelsPerUnit, scroll.scrollHeight - scroll.clientHeight))); + setScrollLeft(cm, Math.max(0, Math.min(scroll.scrollLeft + dx * wheelPixelsPerUnit, scroll.scrollWidth - scroll.clientWidth))); + e_preventDefault(e); + display.wheelStartX = null; // Abort measurement, if in progress + return; + } + + if (dy && wheelPixelsPerUnit != null) { + var pixels = dy * wheelPixelsPerUnit; + var top = cm.doc.scrollTop, bot = top + display.wrapper.clientHeight; + if (pixels < 0) top = Math.max(0, top + pixels - 50); + else bot = Math.min(cm.doc.height, bot + pixels + 50); + updateDisplay(cm, [], {top: top, bottom: bot}); + } + + if (wheelSamples < 20) { + if (display.wheelStartX == null) { + display.wheelStartX = scroll.scrollLeft; display.wheelStartY = scroll.scrollTop; + display.wheelDX = dx; display.wheelDY = dy; + setTimeout(function() { + if (display.wheelStartX == null) return; + var movedX = scroll.scrollLeft - display.wheelStartX; + var movedY = scroll.scrollTop - display.wheelStartY; + var sample = (movedY && display.wheelDY && movedY / display.wheelDY) || + (movedX && display.wheelDX && movedX / display.wheelDX); + display.wheelStartX = display.wheelStartY = null; + if (!sample) return; + wheelPixelsPerUnit = (wheelPixelsPerUnit * wheelSamples + sample) / (wheelSamples + 1); + ++wheelSamples; + }, 200); + } else { + display.wheelDX += dx; display.wheelDY += dy; + } + } + } + + function doHandleBinding(cm, bound, dropShift) { + if (typeof bound == "string") { + bound = commands[bound]; + if (!bound) return false; + } + // Ensure previous input has been read, so that the handler sees a + // consistent view of the document + if (cm.display.pollingFast && readInput(cm)) cm.display.pollingFast = false; + var doc = cm.doc, prevShift = doc.sel.shift, done = false; + try { + if (isReadOnly(cm)) cm.state.suppressEdits = true; + if (dropShift) doc.sel.shift = false; + done = bound(cm) != Pass; + } finally { + doc.sel.shift = prevShift; + cm.state.suppressEdits = false; + } + return done; + } + + function allKeyMaps(cm) { + var maps = cm.state.keyMaps.slice(0); + if (cm.options.extraKeys) maps.push(cm.options.extraKeys); + maps.push(cm.options.keyMap); + return maps; + } + + var maybeTransition; + function handleKeyBinding(cm, e) { + // Handle auto keymap transitions + var startMap = getKeyMap(cm.options.keyMap), next = startMap.auto; + clearTimeout(maybeTransition); + if (next && !isModifierKey(e)) maybeTransition = setTimeout(function() { + if (getKeyMap(cm.options.keyMap) == startMap) + cm.options.keyMap = (next.call ? next.call(null, cm) : next); + }, 50); + + var name = keyName(e, true), handled = false; + if (!name) return false; + var keymaps = allKeyMaps(cm); + + if (e.shiftKey) { + // First try to resolve full name (including 'Shift-'). Failing + // that, see if there is a cursor-motion command (starting with + // 'go') bound to the keyname without 'Shift-'. + handled = lookupKey("Shift-" + name, keymaps, function(b) {return doHandleBinding(cm, b, true);}) + || lookupKey(name, keymaps, function(b) { + if (typeof b == "string" && /^go[A-Z]/.test(b)) return doHandleBinding(cm, b); + }); + } else { + handled = lookupKey(name, keymaps, function(b) { return doHandleBinding(cm, b); }); + } + if (handled == "stop") handled = false; + + if (handled) { + e_preventDefault(e); + restartBlink(cm); + if (ie_lt9) { e.oldKeyCode = e.keyCode; e.keyCode = 0; } + } + return handled; + } + + function handleCharBinding(cm, e, ch) { + var handled = lookupKey("'" + ch + "'", allKeyMaps(cm), + function(b) { return doHandleBinding(cm, b, true); }); + if (handled) { + e_preventDefault(e); + restartBlink(cm); + } + return handled; + } + + var lastStoppedKey = null; + function onKeyDown(e) { + var cm = this; + if (!cm.state.focused) onFocus(cm); + if (ie && e.keyCode == 27) { e.returnValue = false; } + if (cm.options.onKeyEvent && cm.options.onKeyEvent(cm, addStop(e))) return; + var code = e.keyCode; + // IE does strange things with escape. + cm.doc.sel.shift = code == 16 || e.shiftKey; + // First give onKeyEvent option a chance to handle this. + var handled = handleKeyBinding(cm, e); + if (opera) { + lastStoppedKey = handled ? code : null; + // Opera has no cut event... we try to at least catch the key combo + if (!handled && code == 88 && !hasCopyEvent && (mac ? e.metaKey : e.ctrlKey)) + cm.replaceSelection(""); + } + } + + function onKeyPress(e) { + var cm = this; + if (cm.options.onKeyEvent && cm.options.onKeyEvent(cm, addStop(e))) return; + var keyCode = e.keyCode, charCode = e.charCode; + if (opera && keyCode == lastStoppedKey) {lastStoppedKey = null; e_preventDefault(e); return;} + if (((opera && (!e.which || e.which < 10)) || khtml) && handleKeyBinding(cm, e)) return; + var ch = String.fromCharCode(charCode == null ? keyCode : charCode); + if (this.options.electricChars && this.doc.mode.electricChars && + this.options.smartIndent && !isReadOnly(this) && + this.doc.mode.electricChars.indexOf(ch) > -1) + setTimeout(operation(cm, function() {indentLine(cm, cm.doc.sel.to.line, "smart");}), 75); + if (handleCharBinding(cm, e, ch)) return; + if (ie && !ie_lt9) cm.display.inputHasSelection = null; + fastPoll(cm); + } + + function onFocus(cm) { + if (cm.options.readOnly == "nocursor") return; + if (!cm.state.focused) { + signal(cm, "focus", cm); + cm.state.focused = true; + if (cm.display.wrapper.className.search(/\bCodeMirror-focused\b/) == -1) + cm.display.wrapper.className += " CodeMirror-focused"; + resetInput(cm, true); + } + slowPoll(cm); + restartBlink(cm); + } + function onBlur(cm) { + if (cm.state.focused) { + signal(cm, "blur", cm); + cm.state.focused = false; + cm.display.wrapper.className = cm.display.wrapper.className.replace(" CodeMirror-focused", ""); + } + clearInterval(cm.display.blinker); + setTimeout(function() {if (!cm.state.focused) cm.doc.sel.shift = false;}, 150); + } + + var detectingSelectAll; + function onContextMenu(cm, e) { + var display = cm.display, sel = cm.doc.sel; + if (eventInWidget(display, e)) return; + + var pos = posFromMouse(cm, e), scrollPos = display.scroller.scrollTop; + if (!pos || opera) return; // Opera is difficult. + if (posEq(sel.from, sel.to) || posLess(pos, sel.from) || !posLess(pos, sel.to)) + operation(cm, setSelection)(cm.doc, pos, pos); + + var oldCSS = display.input.style.cssText; + display.inputDiv.style.position = "absolute"; + display.input.style.cssText = "position: fixed; width: 30px; height: 30px; top: " + (e.clientY - 5) + + "px; left: " + (e.clientX - 5) + "px; z-index: 1000; background: white; outline: none;" + + "border-width: 0; outline: none; overflow: hidden; opacity: .05; -ms-opacity: .05; filter: alpha(opacity=5);"; + focusInput(cm); + resetInput(cm, true); + // Adds "Select all" to context menu in FF + if (posEq(sel.from, sel.to)) display.input.value = display.prevInput = " "; + + function rehide() { + display.inputDiv.style.position = "relative"; + display.input.style.cssText = oldCSS; + if (ie_lt9) display.scrollbarV.scrollTop = display.scroller.scrollTop = scrollPos; + slowPoll(cm); + + // Try to detect the user choosing select-all + if (display.input.selectionStart != null && (!ie || ie_lt9)) { + clearTimeout(detectingSelectAll); + var extval = display.input.value = " " + (posEq(sel.from, sel.to) ? "" : display.input.value), i = 0; + display.prevInput = " "; + display.input.selectionStart = 1; display.input.selectionEnd = extval.length; + var poll = function(){ + if (display.prevInput == " " && display.input.selectionStart == 0) + operation(cm, commands.selectAll)(cm); + else if (i++ < 10) detectingSelectAll = setTimeout(poll, 500); + else resetInput(cm); + }; + detectingSelectAll = setTimeout(poll, 200); + } + } + + if (captureMiddleClick) { + e_stop(e); + var mouseup = function() { + off(window, "mouseup", mouseup); + setTimeout(rehide, 20); + }; + on(window, "mouseup", mouseup); + } else { + setTimeout(rehide, 50); + } + } + + // UPDATING + + function changeEnd(change) { + if (!change.text) return change.to; + return Pos(change.from.line + change.text.length - 1, + lst(change.text).length + (change.text.length == 1 ? change.from.ch : 0)); + } + + // Make sure a position will be valid after the given change. + function clipPostChange(doc, change, pos) { + if (!posLess(change.from, pos)) return clipPos(doc, pos); + var diff = (change.text.length - 1) - (change.to.line - change.from.line); + if (pos.line > change.to.line + diff) { + var preLine = pos.line - diff, lastLine = doc.first + doc.size - 1; + if (preLine > lastLine) return Pos(lastLine, getLine(doc, lastLine).text.length); + return clipToLen(pos, getLine(doc, preLine).text.length); + } + if (pos.line == change.to.line + diff) + return clipToLen(pos, lst(change.text).length + (change.text.length == 1 ? change.from.ch : 0) + + getLine(doc, change.to.line).text.length - change.to.ch); + var inside = pos.line - change.from.line; + return clipToLen(pos, change.text[inside].length + (inside ? 0 : change.from.ch)); + } + + // Hint can be null|"end"|"start"|"around"|{anchor,head} + function computeSelAfterChange(doc, change, hint) { + if (hint && typeof hint == "object") // Assumed to be {anchor, head} object + return {anchor: clipPostChange(doc, change, hint.anchor), + head: clipPostChange(doc, change, hint.head)}; + + if (hint == "start") return {anchor: change.from, head: change.from}; + + var end = changeEnd(change); + if (hint == "around") return {anchor: change.from, head: end}; + if (hint == "end") return {anchor: end, head: end}; + + // hint is null, leave the selection alone as much as possible + var adjustPos = function(pos) { + if (posLess(pos, change.from)) return pos; + if (!posLess(change.to, pos)) return end; + + var line = pos.line + change.text.length - (change.to.line - change.from.line) - 1, ch = pos.ch; + if (pos.line == change.to.line) ch += end.ch - change.to.ch; + return Pos(line, ch); + }; + return {anchor: adjustPos(doc.sel.anchor), head: adjustPos(doc.sel.head)}; + } + + function filterChange(doc, change) { + var obj = { + canceled: false, + from: change.from, + to: change.to, + text: change.text, + origin: change.origin, + update: function(from, to, text, origin) { + if (from) this.from = clipPos(doc, from); + if (to) this.to = clipPos(doc, to); + if (text) this.text = text; + if (origin !== undefined) this.origin = origin; + }, + cancel: function() { this.canceled = true; } + }; + signal(doc, "beforeChange", doc, obj); + if (doc.cm) signal(doc.cm, "beforeChange", doc.cm, obj); + + if (obj.canceled) return null; + return {from: obj.from, to: obj.to, text: obj.text, origin: obj.origin}; + } + + // Replace the range from from to to by the strings in replacement. + // change is a {from, to, text [, origin]} object + function makeChange(doc, change, selUpdate, ignoreReadOnly) { + if (doc.cm) { + if (!doc.cm.curOp) return operation(doc.cm, makeChange)(doc, change, selUpdate, ignoreReadOnly); + if (doc.cm.state.suppressEdits) return; + } + + if (hasHandler(doc, "beforeChange") || doc.cm && hasHandler(doc.cm, "beforeChange")) { + change = filterChange(doc, change); + if (!change) return; + } + + // Possibly split or suppress the update based on the presence + // of read-only spans in its range. + var split = sawReadOnlySpans && !ignoreReadOnly && removeReadOnlyRanges(doc, change.from, change.to); + if (split) { + for (var i = split.length - 1; i >= 1; --i) + makeChangeNoReadonly(doc, {from: split[i].from, to: split[i].to, text: [""]}); + if (split.length) + makeChangeNoReadonly(doc, {from: split[0].from, to: split[0].to, text: change.text}, selUpdate); + } else { + makeChangeNoReadonly(doc, change, selUpdate); + } + } + + function makeChangeNoReadonly(doc, change, selUpdate) { + var selAfter = computeSelAfterChange(doc, change, selUpdate); + addToHistory(doc, change, selAfter, doc.cm ? doc.cm.curOp.id : NaN); + + makeChangeSingleDoc(doc, change, selAfter, stretchSpansOverChange(doc, change)); + var rebased = []; + + linkedDocs(doc, function(doc, sharedHist) { + if (!sharedHist && indexOf(rebased, doc.history) == -1) { + rebaseHist(doc.history, change); + rebased.push(doc.history); + } + makeChangeSingleDoc(doc, change, null, stretchSpansOverChange(doc, change)); + }); + } + + function makeChangeFromHistory(doc, type) { + if (doc.cm && doc.cm.state.suppressEdits) return; + + var hist = doc.history; + var event = (type == "undo" ? hist.done : hist.undone).pop(); + if (!event) return; + hist.dirtyCounter += type == "undo" ? -1 : 1; + + var anti = {changes: [], anchorBefore: event.anchorAfter, headBefore: event.headAfter, + anchorAfter: event.anchorBefore, headAfter: event.headBefore}; + (type == "undo" ? hist.undone : hist.done).push(anti); + + for (var i = event.changes.length - 1; i >= 0; --i) { + var change = event.changes[i]; + change.origin = type; + anti.changes.push(historyChangeFromChange(doc, change)); + + var after = i ? computeSelAfterChange(doc, change, null) + : {anchor: event.anchorBefore, head: event.headBefore}; + makeChangeSingleDoc(doc, change, after, mergeOldSpans(doc, change)); + var rebased = []; + + linkedDocs(doc, function(doc, sharedHist) { + if (!sharedHist && indexOf(rebased, doc.history) == -1) { + rebaseHist(doc.history, change); + rebased.push(doc.history); + } + makeChangeSingleDoc(doc, change, null, mergeOldSpans(doc, change)); + }); + } + } + + function shiftDoc(doc, distance) { + function shiftPos(pos) {return Pos(pos.line + distance, pos.ch);} + doc.first += distance; + if (doc.cm) regChange(doc.cm, doc.first, doc.first, distance); + doc.sel.head = shiftPos(doc.sel.head); doc.sel.anchor = shiftPos(doc.sel.anchor); + doc.sel.from = shiftPos(doc.sel.from); doc.sel.to = shiftPos(doc.sel.to); + } + + function makeChangeSingleDoc(doc, change, selAfter, spans) { + if (doc.cm && !doc.cm.curOp) + return operation(doc.cm, makeChangeSingleDoc)(doc, change, selAfter, spans); + + if (change.to.line < doc.first) { + shiftDoc(doc, change.text.length - 1 - (change.to.line - change.from.line)); + return; + } + if (change.from.line > doc.lastLine()) return; + + // Clip the change to the size of this doc + if (change.from.line < doc.first) { + var shift = change.text.length - 1 - (doc.first - change.from.line); + shiftDoc(doc, shift); + change = {from: Pos(doc.first, 0), to: Pos(change.to.line + shift, change.to.ch), + text: [lst(change.text)], origin: change.origin}; + } + var last = doc.lastLine(); + if (change.to.line > last) { + change = {from: change.from, to: Pos(last, getLine(doc, last).text.length), + text: [change.text[0]], origin: change.origin}; + } + + change.removed = getBetween(doc, change.from, change.to); + + if (!selAfter) selAfter = computeSelAfterChange(doc, change, null); + if (doc.cm) makeChangeSingleDocInEditor(doc.cm, change, spans, selAfter); + else updateDoc(doc, change, spans, selAfter); + } + + function makeChangeSingleDocInEditor(cm, change, spans, selAfter) { + var doc = cm.doc, display = cm.display, from = change.from, to = change.to; + + var recomputeMaxLength = false, checkWidthStart = from.line; + if (!cm.options.lineWrapping) { + checkWidthStart = lineNo(visualLine(doc, getLine(doc, from.line))); + doc.iter(checkWidthStart, to.line + 1, function(line) { + if (line == display.maxLine) { + recomputeMaxLength = true; + return true; + } + }); + } + + if (!posLess(doc.sel.head, change.from) && !posLess(change.to, doc.sel.head)) + cm.curOp.cursorActivity = true; + + updateDoc(doc, change, spans, selAfter, estimateHeight(cm)); + + if (!cm.options.lineWrapping) { + doc.iter(checkWidthStart, from.line + change.text.length, function(line) { + var len = lineLength(doc, line); + if (len > display.maxLineLength) { + display.maxLine = line; + display.maxLineLength = len; + display.maxLineChanged = true; + recomputeMaxLength = false; + } + }); + if (recomputeMaxLength) cm.curOp.updateMaxLine = true; + } + + // Adjust frontier, schedule worker + doc.frontier = Math.min(doc.frontier, from.line); + startWorker(cm, 400); + + var lendiff = change.text.length - (to.line - from.line) - 1; + // Remember that these lines changed, for updating the display + regChange(cm, from.line, to.line + 1, lendiff); + + if (hasHandler(cm, "change")) { + var changeObj = {from: from, to: to, + text: change.text, + removed: change.removed, + origin: change.origin}; + if (cm.curOp.textChanged) { + for (var cur = cm.curOp.textChanged; cur.next; cur = cur.next) {} + cur.next = changeObj; + } else cm.curOp.textChanged = changeObj; + } + } + + function replaceRange(doc, code, from, to, origin) { + if (!to) to = from; + if (posLess(to, from)) { var tmp = to; to = from; from = tmp; } + if (typeof code == "string") code = splitLines(code); + makeChange(doc, {from: from, to: to, text: code, origin: origin}, null); + } + + // POSITION OBJECT + + function Pos(line, ch) { + if (!(this instanceof Pos)) return new Pos(line, ch); + this.line = line; this.ch = ch; + } + CodeMirror.Pos = Pos; + + function posEq(a, b) {return a.line == b.line && a.ch == b.ch;} + function posLess(a, b) {return a.line < b.line || (a.line == b.line && a.ch < b.ch);} + function copyPos(x) {return Pos(x.line, x.ch);} + + // SELECTION + + function clipLine(doc, n) {return Math.max(doc.first, Math.min(n, doc.first + doc.size - 1));} + function clipPos(doc, pos) { + if (pos.line < doc.first) return Pos(doc.first, 0); + var last = doc.first + doc.size - 1; + if (pos.line > last) return Pos(last, getLine(doc, last).text.length); + return clipToLen(pos, getLine(doc, pos.line).text.length); + } + function clipToLen(pos, linelen) { + var ch = pos.ch; + if (ch == null || ch > linelen) return Pos(pos.line, linelen); + else if (ch < 0) return Pos(pos.line, 0); + else return pos; + } + function isLine(doc, l) {return l >= doc.first && l < doc.first + doc.size;} + + // If shift is held, this will move the selection anchor. Otherwise, + // it'll set the whole selection. + function extendSelection(doc, pos, other, bias) { + if (doc.sel.shift || doc.sel.extend) { + var anchor = doc.sel.anchor; + if (other) { + var posBefore = posLess(pos, anchor); + if (posBefore != posLess(other, anchor)) { + anchor = pos; + pos = other; + } else if (posBefore != posLess(pos, other)) { + pos = other; + } + } + setSelection(doc, anchor, pos, bias); + } else { + setSelection(doc, pos, other || pos, bias); + } + if (doc.cm) doc.cm.curOp.userSelChange = true; + } + + function filterSelectionChange(doc, anchor, head) { + var obj = {anchor: anchor, head: head}; + signal(doc, "beforeSelectionChange", doc, obj); + if (doc.cm) signal(doc.cm, "beforeSelectionChange", doc.cm, obj); + obj.anchor = clipPos(doc, obj.anchor); obj.head = clipPos(doc, obj.head); + return obj; + } + + // Update the selection. Last two args are only used by + // updateDoc, since they have to be expressed in the line + // numbers before the update. + function setSelection(doc, anchor, head, bias, checkAtomic) { + if (!checkAtomic && hasHandler(doc, "beforeSelectionChange") || doc.cm && hasHandler(doc.cm, "beforeSelectionChange")) { + var filtered = filterSelectionChange(doc, anchor, head); + head = filtered.head; + anchor = filtered.anchor; + } + + var sel = doc.sel; + sel.goalColumn = null; + // Skip over atomic spans. + if (checkAtomic || !posEq(anchor, sel.anchor)) + anchor = skipAtomic(doc, anchor, bias, checkAtomic != "push"); + if (checkAtomic || !posEq(head, sel.head)) + head = skipAtomic(doc, head, bias, checkAtomic != "push"); + + if (posEq(sel.anchor, anchor) && posEq(sel.head, head)) return; + + sel.anchor = anchor; sel.head = head; + var inv = posLess(head, anchor); + sel.from = inv ? head : anchor; + sel.to = inv ? anchor : head; + + if (doc.cm) + doc.cm.curOp.updateInput = doc.cm.curOp.selectionChanged = + doc.cm.curOp.cursorActivity = true; + + signalLater(doc, "cursorActivity", doc); + } + + function reCheckSelection(cm) { + setSelection(cm.doc, cm.doc.sel.from, cm.doc.sel.to, null, "push"); + } + + function skipAtomic(doc, pos, bias, mayClear) { + var flipped = false, curPos = pos; + var dir = bias || 1; + doc.cantEdit = false; + search: for (;;) { + var line = getLine(doc, curPos.line); + if (line.markedSpans) { + for (var i = 0; i < line.markedSpans.length; ++i) { + var sp = line.markedSpans[i], m = sp.marker; + if ((sp.from == null || (m.inclusiveLeft ? sp.from <= curPos.ch : sp.from < curPos.ch)) && + (sp.to == null || (m.inclusiveRight ? sp.to >= curPos.ch : sp.to > curPos.ch))) { + if (mayClear) { + signal(m, "beforeCursorEnter"); + if (m.explicitlyCleared) { + if (!line.markedSpans) break; + else {--i; continue;} + } + } + if (!m.atomic) continue; + var newPos = m.find()[dir < 0 ? "from" : "to"]; + if (posEq(newPos, curPos)) { + newPos.ch += dir; + if (newPos.ch < 0) { + if (newPos.line > doc.first) newPos = clipPos(doc, Pos(newPos.line - 1)); + else newPos = null; + } else if (newPos.ch > line.text.length) { + if (newPos.line < doc.first + doc.size - 1) newPos = Pos(newPos.line + 1, 0); + else newPos = null; + } + if (!newPos) { + if (flipped) { + // Driven in a corner -- no valid cursor position found at all + // -- try again *with* clearing, if we didn't already + if (!mayClear) return skipAtomic(doc, pos, bias, true); + // Otherwise, turn off editing until further notice, and return the start of the doc + doc.cantEdit = true; + return Pos(doc.first, 0); + } + flipped = true; newPos = pos; dir = -dir; + } + } + curPos = newPos; + continue search; + } + } + } + return curPos; + } + } + + // SCROLLING + + function scrollCursorIntoView(cm) { + var coords = scrollPosIntoView(cm, cm.doc.sel.head); + if (!cm.state.focused) return; + var display = cm.display, box = getRect(display.sizer), doScroll = null, pTop = paddingTop(cm.display); + if (coords.top + pTop + box.top < 0) doScroll = true; + else if (coords.bottom + pTop + box.top > (window.innerHeight || document.documentElement.clientHeight)) doScroll = false; + if (doScroll != null && !phantom) { + var hidden = display.cursor.style.display == "none"; + if (hidden) { + display.cursor.style.display = ""; + display.cursor.style.left = coords.left + "px"; + display.cursor.style.top = (coords.top - display.viewOffset) + "px"; + } + display.cursor.scrollIntoView(doScroll); + if (hidden) display.cursor.style.display = "none"; + } + } + + function scrollPosIntoView(cm, pos, margin) { + if (margin == null) margin = 0; + for (;;) { + var changed = false, coords = cursorCoords(cm, pos); + var scrollPos = calculateScrollPos(cm, coords.left, coords.top - margin, coords.left, coords.bottom + margin); + var startTop = cm.doc.scrollTop, startLeft = cm.doc.scrollLeft; + if (scrollPos.scrollTop != null) { + setScrollTop(cm, scrollPos.scrollTop); + if (Math.abs(cm.doc.scrollTop - startTop) > 1) changed = true; + } + if (scrollPos.scrollLeft != null) { + setScrollLeft(cm, scrollPos.scrollLeft); + if (Math.abs(cm.doc.scrollLeft - startLeft) > 1) changed = true; + } + if (!changed) return coords; + } + } + + function scrollIntoView(cm, x1, y1, x2, y2) { + var scrollPos = calculateScrollPos(cm, x1, y1, x2, y2); + if (scrollPos.scrollTop != null) setScrollTop(cm, scrollPos.scrollTop); + if (scrollPos.scrollLeft != null) setScrollLeft(cm, scrollPos.scrollLeft); + } + + function calculateScrollPos(cm, x1, y1, x2, y2) { + var display = cm.display, pt = paddingTop(display); + y1 += pt; y2 += pt; + if (y1 < 0) y1 = 0; + var screen = display.scroller.clientHeight - scrollerCutOff, screentop = display.scroller.scrollTop, result = {}; + var docBottom = cm.doc.height + paddingVert(display); + var atTop = y1 < pt + 10, atBottom = y2 + pt > docBottom - 10; + if (y1 < screentop) { + result.scrollTop = atTop ? 0 : y1; + } else if (y2 > screentop + screen) { + var newTop = Math.min(y1, (atBottom ? docBottom : y2) - screen); + if (newTop != screentop) result.scrollTop = newTop; + } + + var screenw = display.scroller.clientWidth - scrollerCutOff, screenleft = display.scroller.scrollLeft; + x1 += display.gutters.offsetWidth; x2 += display.gutters.offsetWidth; + var gutterw = display.gutters.offsetWidth; + var atLeft = x1 < gutterw + 10; + if (x1 < screenleft + gutterw || atLeft) { + if (atLeft) x1 = 0; + result.scrollLeft = Math.max(0, x1 - 10 - gutterw); + } else if (x2 > screenw + screenleft - 3) { + result.scrollLeft = x2 + 10 - screenw; + } + return result; + } + + function updateScrollPos(cm, left, top) { + cm.curOp.updateScrollPos = {scrollLeft: left == null ? cm.doc.scrollLeft : left, + scrollTop: top == null ? cm.doc.scrollTop : top}; + } + + function addToScrollPos(cm, left, top) { + var pos = cm.curOp.updateScrollPos || (cm.curOp.updateScrollPos = {scrollLeft: cm.doc.scrollLeft, scrollTop: cm.doc.scrollTop}); + var scroll = cm.display.scroller; + pos.scrollTop = Math.max(0, Math.min(scroll.scrollHeight - scroll.clientHeight, pos.scrollTop + top)); + pos.scrollLeft = Math.max(0, Math.min(scroll.scrollWidth - scroll.clientWidth, pos.scrollLeft + left)); + } + + // API UTILITIES + + function indentLine(cm, n, how, aggressive) { + var doc = cm.doc; + if (!how) how = "add"; + if (how == "smart") { + if (!cm.doc.mode.indent) how = "prev"; + else var state = getStateBefore(cm, n); + } + + var tabSize = cm.options.tabSize; + var line = getLine(doc, n), curSpace = countColumn(line.text, null, tabSize); + var curSpaceString = line.text.match(/^\s*/)[0], indentation; + if (how == "smart") { + indentation = cm.doc.mode.indent(state, line.text.slice(curSpaceString.length), line.text); + if (indentation == Pass) { + if (!aggressive) return; + how = "prev"; + } + } + if (how == "prev") { + if (n > doc.first) indentation = countColumn(getLine(doc, n-1).text, null, tabSize); + else indentation = 0; + } else if (how == "add") { + indentation = curSpace + cm.options.indentUnit; + } else if (how == "subtract") { + indentation = curSpace - cm.options.indentUnit; + } + indentation = Math.max(0, indentation); + + var indentString = "", pos = 0; + if (cm.options.indentWithTabs) + for (var i = Math.floor(indentation / tabSize); i; --i) {pos += tabSize; indentString += "\t";} + if (pos < indentation) indentString += spaceStr(indentation - pos); + + if (indentString != curSpaceString) + replaceRange(cm.doc, indentString, Pos(n, 0), Pos(n, curSpaceString.length), "+input"); + line.stateAfter = null; + } + + function changeLine(cm, handle, op) { + var no = handle, line = handle, doc = cm.doc; + if (typeof handle == "number") line = getLine(doc, clipLine(doc, handle)); + else no = lineNo(handle); + if (no == null) return null; + if (op(line, no)) regChange(cm, no, no + 1); + else return null; + return line; + } + + function findPosH(doc, pos, dir, unit, visually) { + var line = pos.line, ch = pos.ch; + var lineObj = getLine(doc, line); + var possible = true; + function findNextLine() { + var l = line + dir; + if (l < doc.first || l >= doc.first + doc.size) return (possible = false); + line = l; + return lineObj = getLine(doc, l); + } + function moveOnce(boundToLine) { + var next = (visually ? moveVisually : moveLogically)(lineObj, ch, dir, true); + if (next == null) { + if (!boundToLine && findNextLine()) { + if (visually) ch = (dir < 0 ? lineRight : lineLeft)(lineObj); + else ch = dir < 0 ? lineObj.text.length : 0; + } else return (possible = false); + } else ch = next; + return true; + } + + if (unit == "char") moveOnce(); + else if (unit == "column") moveOnce(true); + else if (unit == "word" || unit == "group") { + var sawType = null, group = unit == "group"; + for (var first = true;; first = false) { + if (dir < 0 && !moveOnce(!first)) break; + var cur = lineObj.text.charAt(ch) || "\n"; + var type = isWordChar(cur) ? "w" + : !group ? null + : /\s/.test(cur) ? null + : "p"; + if (sawType && sawType != type) { + if (dir < 0) {dir = 1; moveOnce();} + break; + } + if (type) sawType = type; + if (dir > 0 && !moveOnce(!first)) break; + } + } + var result = skipAtomic(doc, Pos(line, ch), dir, true); + if (!possible) result.hitSide = true; + return result; + } + + function findPosV(cm, pos, dir, unit) { + var doc = cm.doc, x = pos.left, y; + if (unit == "page") { + var pageSize = Math.min(cm.display.wrapper.clientHeight, window.innerHeight || document.documentElement.clientHeight); + y = pos.top + dir * (pageSize - (dir < 0 ? 1.5 : .5) * textHeight(cm.display)); + } else if (unit == "line") { + y = dir > 0 ? pos.bottom + 3 : pos.top - 3; + } + for (;;) { + var target = coordsChar(cm, x, y); + if (!target.outside) break; + if (dir < 0 ? y <= 0 : y >= doc.height) { target.hitSide = true; break; } + y += dir * 5; + } + return target; + } + + function findWordAt(line, pos) { + var start = pos.ch, end = pos.ch; + if (line) { + if (pos.after === false || end == line.length) --start; else ++end; + var startChar = line.charAt(start); + var check = isWordChar(startChar) ? isWordChar + : /\s/.test(startChar) ? function(ch) {return /\s/.test(ch);} + : function(ch) {return !/\s/.test(ch) && !isWordChar(ch);}; + while (start > 0 && check(line.charAt(start - 1))) --start; + while (end < line.length && check(line.charAt(end))) ++end; + } + return {from: Pos(pos.line, start), to: Pos(pos.line, end)}; + } + + function selectLine(cm, line) { + extendSelection(cm.doc, Pos(line, 0), clipPos(cm.doc, Pos(line + 1, 0))); + } + + // PROTOTYPE + + // The publicly visible API. Note that operation(null, f) means + // 'wrap f in an operation, performed on its `this` parameter' + + CodeMirror.prototype = { + focus: function(){window.focus(); focusInput(this); onFocus(this); fastPoll(this);}, + + setOption: function(option, value) { + var options = this.options, old = options[option]; + if (options[option] == value && option != "mode") return; + options[option] = value; + if (optionHandlers.hasOwnProperty(option)) + operation(this, optionHandlers[option])(this, value, old); + }, + + getOption: function(option) {return this.options[option];}, + getDoc: function() {return this.doc;}, + + addKeyMap: function(map, bottom) { + this.state.keyMaps[bottom ? "push" : "unshift"](map); + }, + removeKeyMap: function(map) { + var maps = this.state.keyMaps; + for (var i = 0; i < maps.length; ++i) + if ((typeof map == "string" ? maps[i].name : maps[i]) == map) { + maps.splice(i, 1); + return true; + } + }, + + addOverlay: operation(null, function(spec, options) { + var mode = spec.token ? spec : CodeMirror.getMode(this.options, spec); + if (mode.startState) throw new Error("Overlays may not be stateful."); + this.state.overlays.push({mode: mode, modeSpec: spec, opaque: options && options.opaque}); + this.state.modeGen++; + regChange(this); + }), + removeOverlay: operation(null, function(spec) { + var overlays = this.state.overlays; + for (var i = 0; i < overlays.length; ++i) { + if (overlays[i].modeSpec == spec) { + overlays.splice(i, 1); + this.state.modeGen++; + regChange(this); + return; + } + } + }), + + indentLine: operation(null, function(n, dir, aggressive) { + if (typeof dir != "string") { + if (dir == null) dir = this.options.smartIndent ? "smart" : "prev"; + else dir = dir ? "add" : "subtract"; + } + if (isLine(this.doc, n)) indentLine(this, n, dir, aggressive); + }), + indentSelection: operation(null, function(how) { + var sel = this.doc.sel; + if (posEq(sel.from, sel.to)) return indentLine(this, sel.from.line, how); + var e = sel.to.line - (sel.to.ch ? 0 : 1); + for (var i = sel.from.line; i <= e; ++i) indentLine(this, i, how); + }), + + // Fetch the parser token for a given character. Useful for hacks + // that want to inspect the mode state (say, for completion). + getTokenAt: function(pos) { + var doc = this.doc; + pos = clipPos(doc, pos); + var state = getStateBefore(this, pos.line), mode = this.doc.mode; + var line = getLine(doc, pos.line); + var stream = new StringStream(line.text, this.options.tabSize); + while (stream.pos < pos.ch && !stream.eol()) { + stream.start = stream.pos; + var style = mode.token(stream, state); + } + return {start: stream.start, + end: stream.pos, + string: stream.current(), + className: style || null, // Deprecated, use 'type' instead + type: style || null, + state: state}; + }, + + getStateAfter: function(line) { + var doc = this.doc; + line = clipLine(doc, line == null ? doc.first + doc.size - 1: line); + return getStateBefore(this, line + 1); + }, + + cursorCoords: function(start, mode) { + var pos, sel = this.doc.sel; + if (start == null) pos = sel.head; + else if (typeof start == "object") pos = clipPos(this.doc, start); + else pos = start ? sel.from : sel.to; + return cursorCoords(this, pos, mode || "page"); + }, + + charCoords: function(pos, mode) { + return charCoords(this, clipPos(this.doc, pos), mode || "page"); + }, + + coordsChar: function(coords, mode) { + coords = fromCoordSystem(this, coords, mode || "page"); + return coordsChar(this, coords.left, coords.top); + }, + + defaultTextHeight: function() { return textHeight(this.display); }, + defaultCharWidth: function() { return charWidth(this.display); }, + + setGutterMarker: operation(null, function(line, gutterID, value) { + return changeLine(this, line, function(line) { + var markers = line.gutterMarkers || (line.gutterMarkers = {}); + markers[gutterID] = value; + if (!value && isEmpty(markers)) line.gutterMarkers = null; + return true; + }); + }), + + clearGutter: operation(null, function(gutterID) { + var cm = this, doc = cm.doc, i = doc.first; + doc.iter(function(line) { + if (line.gutterMarkers && line.gutterMarkers[gutterID]) { + line.gutterMarkers[gutterID] = null; + regChange(cm, i, i + 1); + if (isEmpty(line.gutterMarkers)) line.gutterMarkers = null; + } + ++i; + }); + }), + + addLineClass: operation(null, function(handle, where, cls) { + return changeLine(this, handle, function(line) { + var prop = where == "text" ? "textClass" : where == "background" ? "bgClass" : "wrapClass"; + if (!line[prop]) line[prop] = cls; + else if (new RegExp("\\b" + cls + "\\b").test(line[prop])) return false; + else line[prop] += " " + cls; + return true; + }); + }), + + removeLineClass: operation(null, function(handle, where, cls) { + return changeLine(this, handle, function(line) { + var prop = where == "text" ? "textClass" : where == "background" ? "bgClass" : "wrapClass"; + var cur = line[prop]; + if (!cur) return false; + else if (cls == null) line[prop] = null; + else { + var upd = cur.replace(new RegExp("^" + cls + "\\b\\s*|\\s*\\b" + cls + "\\b"), ""); + if (upd == cur) return false; + line[prop] = upd || null; + } + return true; + }); + }), + + addLineWidget: operation(null, function(handle, node, options) { + return addLineWidget(this, handle, node, options); + }), + + removeLineWidget: function(widget) { widget.clear(); }, + + lineInfo: function(line) { + if (typeof line == "number") { + if (!isLine(this.doc, line)) return null; + var n = line; + line = getLine(this.doc, line); + if (!line) return null; + } else { + var n = lineNo(line); + if (n == null) return null; + } + return {line: n, handle: line, text: line.text, gutterMarkers: line.gutterMarkers, + textClass: line.textClass, bgClass: line.bgClass, wrapClass: line.wrapClass, + widgets: line.widgets}; + }, + + getViewport: function() { return {from: this.display.showingFrom, to: this.display.showingTo};}, + + addWidget: function(pos, node, scroll, vert, horiz) { + var display = this.display; + pos = cursorCoords(this, clipPos(this.doc, pos)); + var top = pos.bottom, left = pos.left; + node.style.position = "absolute"; + display.sizer.appendChild(node); + if (vert == "over") { + top = pos.top; + } else if (vert == "above" || vert == "near") { + var vspace = Math.max(display.wrapper.clientHeight, this.doc.height), + hspace = Math.max(display.sizer.clientWidth, display.lineSpace.clientWidth); + // Default to positioning above (if specified and possible); otherwise default to positioning below + if ((vert == 'above' || pos.bottom + node.offsetHeight > vspace) && pos.top > node.offsetHeight) + top = pos.top - node.offsetHeight; + else if (pos.bottom + node.offsetHeight <= vspace) + top = pos.bottom; + if (left + node.offsetWidth > hspace) + left = hspace - node.offsetWidth; + } + node.style.top = (top + paddingTop(display)) + "px"; + node.style.left = node.style.right = ""; + if (horiz == "right") { + left = display.sizer.clientWidth - node.offsetWidth; + node.style.right = "0px"; + } else { + if (horiz == "left") left = 0; + else if (horiz == "middle") left = (display.sizer.clientWidth - node.offsetWidth) / 2; + node.style.left = left + "px"; + } + if (scroll) + scrollIntoView(this, left, top, left + node.offsetWidth, top + node.offsetHeight); + }, + + triggerOnKeyDown: operation(null, onKeyDown), + + execCommand: function(cmd) {return commands[cmd](this);}, + + findPosH: function(from, amount, unit, visually) { + var dir = 1; + if (amount < 0) { dir = -1; amount = -amount; } + for (var i = 0, cur = clipPos(this.doc, from); i < amount; ++i) { + cur = findPosH(this.doc, cur, dir, unit, visually); + if (cur.hitSide) break; + } + return cur; + }, + + moveH: operation(null, function(dir, unit) { + var sel = this.doc.sel, pos; + if (sel.shift || sel.extend || posEq(sel.from, sel.to)) + pos = findPosH(this.doc, sel.head, dir, unit, this.options.rtlMoveVisually); + else + pos = dir < 0 ? sel.from : sel.to; + extendSelection(this.doc, pos, pos, dir); + }), + + deleteH: operation(null, function(dir, unit) { + var sel = this.doc.sel; + if (!posEq(sel.from, sel.to)) replaceRange(this.doc, "", sel.from, sel.to, "+delete"); + else replaceRange(this.doc, "", sel.from, findPosH(this.doc, sel.head, dir, unit, false), "+delete"); + this.curOp.userSelChange = true; + }), + + findPosV: function(from, amount, unit, goalColumn) { + var dir = 1, x = goalColumn; + if (amount < 0) { dir = -1; amount = -amount; } + for (var i = 0, cur = clipPos(this.doc, from); i < amount; ++i) { + var coords = cursorCoords(this, cur, "div"); + if (x == null) x = coords.left; + else coords.left = x; + cur = findPosV(this, coords, dir, unit); + if (cur.hitSide) break; + } + return cur; + }, + + moveV: operation(null, function(dir, unit) { + var sel = this.doc.sel; + var pos = cursorCoords(this, sel.head, "div"); + if (sel.goalColumn != null) pos.left = sel.goalColumn; + var target = findPosV(this, pos, dir, unit); + + if (unit == "page") addToScrollPos(this, 0, charCoords(this, target, "div").top - pos.top); + extendSelection(this.doc, target, target, dir); + sel.goalColumn = pos.left; + }), + + toggleOverwrite: function() { + if (this.state.overwrite = !this.state.overwrite) + this.display.cursor.className += " CodeMirror-overwrite"; + else + this.display.cursor.className = this.display.cursor.className.replace(" CodeMirror-overwrite", ""); + }, + hasFocus: function() { return this.state.focused; }, + + scrollTo: operation(null, function(x, y) { + updateScrollPos(this, x, y); + }), + getScrollInfo: function() { + var scroller = this.display.scroller, co = scrollerCutOff; + return {left: scroller.scrollLeft, top: scroller.scrollTop, + height: scroller.scrollHeight - co, width: scroller.scrollWidth - co, + clientHeight: scroller.clientHeight - co, clientWidth: scroller.clientWidth - co}; + }, + + scrollIntoView: operation(null, function(pos, margin) { + if (typeof pos == "number") pos = Pos(pos, 0); + if (!margin) margin = 0; + var coords = pos; + + if (!pos || pos.line != null) { + this.curOp.scrollToPos = pos ? clipPos(this.doc, pos) : this.doc.sel.head; + this.curOp.scrollToPosMargin = margin; + coords = cursorCoords(this, this.curOp.scrollToPos); + } + var sPos = calculateScrollPos(this, coords.left, coords.top - margin, coords.right, coords.bottom + margin); + updateScrollPos(this, sPos.scrollLeft, sPos.scrollTop); + }), + + setSize: function(width, height) { + function interpret(val) { + return typeof val == "number" || /^\d+$/.test(String(val)) ? val + "px" : val; + } + if (width != null) this.display.wrapper.style.width = interpret(width); + if (height != null) this.display.wrapper.style.height = interpret(height); + this.refresh(); + }, + + on: function(type, f) {on(this, type, f);}, + off: function(type, f) {off(this, type, f);}, + + operation: function(f){return runInOp(this, f);}, + + refresh: operation(null, function() { + clearCaches(this); + updateScrollPos(this, this.doc.scrollLeft, this.doc.scrollTop); + regChange(this); + }), + + swapDoc: operation(null, function(doc) { + var old = this.doc; + old.cm = null; + attachDoc(this, doc); + clearCaches(this); + resetInput(this, true); + updateScrollPos(this, doc.scrollLeft, doc.scrollTop); + return old; + }), + + getInputField: function(){return this.display.input;}, + getWrapperElement: function(){return this.display.wrapper;}, + getScrollerElement: function(){return this.display.scroller;}, + getGutterElement: function(){return this.display.gutters;} + }; + + // OPTION DEFAULTS + + var optionHandlers = CodeMirror.optionHandlers = {}; + + // The default configuration options. + var defaults = CodeMirror.defaults = {}; + + function option(name, deflt, handle, notOnInit) { + CodeMirror.defaults[name] = deflt; + if (handle) optionHandlers[name] = + notOnInit ? function(cm, val, old) {if (old != Init) handle(cm, val, old);} : handle; + } + + var Init = CodeMirror.Init = {toString: function(){return "CodeMirror.Init";}}; + + // These two are, on init, called from the constructor because they + // have to be initialized before the editor can start at all. + option("value", "", function(cm, val) { + cm.setValue(val); + }, true); + option("mode", null, function(cm, val) { + cm.doc.modeOption = val; + loadMode(cm); + }, true); + + option("indentUnit", 2, loadMode, true); + option("indentWithTabs", false); + option("smartIndent", true); + option("tabSize", 4, function(cm) { + loadMode(cm); + clearCaches(cm); + regChange(cm); + }, true); + option("electricChars", true); + option("rtlMoveVisually", !windows); + + option("theme", "default", function(cm) { + themeChanged(cm); + guttersChanged(cm); + }, true); + option("keyMap", "default", keyMapChanged); + option("extraKeys", null); + + option("onKeyEvent", null); + option("onDragEvent", null); + + option("lineWrapping", false, wrappingChanged, true); + option("gutters", [], function(cm) { + setGuttersForLineNumbers(cm.options); + guttersChanged(cm); + }, true); + option("fixedGutter", true, function(cm, val) { + cm.display.gutters.style.left = val ? compensateForHScroll(cm.display) + "px" : "0"; + cm.refresh(); + }, true); + option("lineNumbers", false, function(cm) { + setGuttersForLineNumbers(cm.options); + guttersChanged(cm); + }, true); + option("firstLineNumber", 1, guttersChanged, true); + option("lineNumberFormatter", function(integer) {return integer;}, guttersChanged, true); + option("showCursorWhenSelecting", false, updateSelection, true); + + option("readOnly", false, function(cm, val) { + if (val == "nocursor") {onBlur(cm); cm.display.input.blur();} + else if (!val) resetInput(cm, true); + }); + option("dragDrop", true); + + option("cursorBlinkRate", 530); + option("cursorHeight", 1); + option("workTime", 100); + option("workDelay", 100); + option("flattenSpans", true); + option("pollInterval", 100); + option("undoDepth", 40, function(cm, val){cm.doc.history.undoDepth = val;}); + option("historyEventDelay", 500); + option("viewportMargin", 10, function(cm){cm.refresh();}, true); + option("maxHighlightLength", 10000, function(cm){loadMode(cm); cm.refresh();}, true); + option("moveInputWithCursor", true, function(cm, val) { + if (!val) cm.display.inputDiv.style.top = cm.display.inputDiv.style.left = 0; + }); + + option("tabindex", null, function(cm, val) { + cm.display.input.tabIndex = val || ""; + }); + option("autofocus", null); + + // MODE DEFINITION AND QUERYING + + // Known modes, by name and by MIME + var modes = CodeMirror.modes = {}, mimeModes = CodeMirror.mimeModes = {}; + + CodeMirror.defineMode = function(name, mode) { + if (!CodeMirror.defaults.mode && name != "null") CodeMirror.defaults.mode = name; + if (arguments.length > 2) { + mode.dependencies = []; + for (var i = 2; i < arguments.length; ++i) mode.dependencies.push(arguments[i]); + } + modes[name] = mode; + }; + + CodeMirror.defineMIME = function(mime, spec) { + mimeModes[mime] = spec; + }; + + CodeMirror.resolveMode = function(spec) { + if (typeof spec == "string" && mimeModes.hasOwnProperty(spec)) + spec = mimeModes[spec]; + else if (typeof spec == "string" && /^[\w\-]+\/[\w\-]+\+xml$/.test(spec)) + return CodeMirror.resolveMode("application/xml"); + if (typeof spec == "string") return {name: spec}; + else return spec || {name: "null"}; + }; + + CodeMirror.getMode = function(options, spec) { + spec = CodeMirror.resolveMode(spec); + var mfactory = modes[spec.name]; + if (!mfactory) return CodeMirror.getMode(options, "text/plain"); + var modeObj = mfactory(options, spec); + if (modeExtensions.hasOwnProperty(spec.name)) { + var exts = modeExtensions[spec.name]; + for (var prop in exts) { + if (!exts.hasOwnProperty(prop)) continue; + if (modeObj.hasOwnProperty(prop)) modeObj["_" + prop] = modeObj[prop]; + modeObj[prop] = exts[prop]; + } + } + modeObj.name = spec.name; + return modeObj; + }; + + CodeMirror.defineMode("null", function() { + return {token: function(stream) {stream.skipToEnd();}}; + }); + CodeMirror.defineMIME("text/plain", "null"); + + var modeExtensions = CodeMirror.modeExtensions = {}; + CodeMirror.extendMode = function(mode, properties) { + var exts = modeExtensions.hasOwnProperty(mode) ? modeExtensions[mode] : (modeExtensions[mode] = {}); + copyObj(properties, exts); + }; + + // EXTENSIONS + + CodeMirror.defineExtension = function(name, func) { + CodeMirror.prototype[name] = func; + }; + CodeMirror.defineDocExtension = function(name, func) { + Doc.prototype[name] = func; + }; + CodeMirror.defineOption = option; + + var initHooks = []; + CodeMirror.defineInitHook = function(f) {initHooks.push(f);}; + + // MODE STATE HANDLING + + // Utility functions for working with state. Exported because modes + // sometimes need to do this. + function copyState(mode, state) { + if (state === true) return state; + if (mode.copyState) return mode.copyState(state); + var nstate = {}; + for (var n in state) { + var val = state[n]; + if (val instanceof Array) val = val.concat([]); + nstate[n] = val; + } + return nstate; + } + CodeMirror.copyState = copyState; + + function startState(mode, a1, a2) { + return mode.startState ? mode.startState(a1, a2) : true; + } + CodeMirror.startState = startState; + + CodeMirror.innerMode = function(mode, state) { + while (mode.innerMode) { + var info = mode.innerMode(state); + state = info.state; + mode = info.mode; + } + return info || {mode: mode, state: state}; + }; + + // STANDARD COMMANDS + + var commands = CodeMirror.commands = { + selectAll: function(cm) {cm.setSelection(Pos(cm.firstLine(), 0), Pos(cm.lastLine()));}, + killLine: function(cm) { + var from = cm.getCursor(true), to = cm.getCursor(false), sel = !posEq(from, to); + if (!sel && cm.getLine(from.line).length == from.ch) + cm.replaceRange("", from, Pos(from.line + 1, 0), "+delete"); + else cm.replaceRange("", from, sel ? to : Pos(from.line), "+delete"); + }, + deleteLine: function(cm) { + var l = cm.getCursor().line; + cm.replaceRange("", Pos(l, 0), Pos(l), "+delete"); + }, + undo: function(cm) {cm.undo();}, + redo: function(cm) {cm.redo();}, + goDocStart: function(cm) {cm.extendSelection(Pos(cm.firstLine(), 0));}, + goDocEnd: function(cm) {cm.extendSelection(Pos(cm.lastLine()));}, + goLineStart: function(cm) { + cm.extendSelection(lineStart(cm, cm.getCursor().line)); + }, + goLineStartSmart: function(cm) { + var cur = cm.getCursor(), start = lineStart(cm, cur.line); + var line = cm.getLineHandle(start.line); + var order = getOrder(line); + if (!order || order[0].level == 0) { + var firstNonWS = Math.max(0, line.text.search(/\S/)); + var inWS = cur.line == start.line && cur.ch <= firstNonWS && cur.ch; + cm.extendSelection(Pos(start.line, inWS ? 0 : firstNonWS)); + } else cm.extendSelection(start); + }, + goLineEnd: function(cm) { + cm.extendSelection(lineEnd(cm, cm.getCursor().line)); + }, + goLineRight: function(cm) { + var top = cm.charCoords(cm.getCursor(), "div").top + 5; + cm.extendSelection(cm.coordsChar({left: cm.display.lineDiv.offsetWidth + 100, top: top}, "div")); + }, + goLineLeft: function(cm) { + var top = cm.charCoords(cm.getCursor(), "div").top + 5; + cm.extendSelection(cm.coordsChar({left: 0, top: top}, "div")); + }, + goLineUp: function(cm) {cm.moveV(-1, "line");}, + goLineDown: function(cm) {cm.moveV(1, "line");}, + goPageUp: function(cm) {cm.moveV(-1, "page");}, + goPageDown: function(cm) {cm.moveV(1, "page");}, + goCharLeft: function(cm) {cm.moveH(-1, "char");}, + goCharRight: function(cm) {cm.moveH(1, "char");}, + goColumnLeft: function(cm) {cm.moveH(-1, "column");}, + goColumnRight: function(cm) {cm.moveH(1, "column");}, + goWordLeft: function(cm) {cm.moveH(-1, "word");}, + goGroupRight: function(cm) {cm.moveH(1, "group");}, + goGroupLeft: function(cm) {cm.moveH(-1, "group");}, + goWordRight: function(cm) {cm.moveH(1, "word");}, + delCharBefore: function(cm) {cm.deleteH(-1, "char");}, + delCharAfter: function(cm) {cm.deleteH(1, "char");}, + delWordBefore: function(cm) {cm.deleteH(-1, "word");}, + delWordAfter: function(cm) {cm.deleteH(1, "word");}, + delGroupBefore: function(cm) {cm.deleteH(-1, "group");}, + delGroupAfter: function(cm) {cm.deleteH(1, "group");}, + indentAuto: function(cm) {cm.indentSelection("smart");}, + indentMore: function(cm) {cm.indentSelection("add");}, + indentLess: function(cm) {cm.indentSelection("subtract");}, + insertTab: function(cm) {cm.replaceSelection("\t", "end", "+input");}, + defaultTab: function(cm) { + if (cm.somethingSelected()) cm.indentSelection("add"); + else cm.replaceSelection("\t", "end", "+input"); + }, + transposeChars: function(cm) { + var cur = cm.getCursor(), line = cm.getLine(cur.line); + if (cur.ch > 0 && cur.ch < line.length - 1) + cm.replaceRange(line.charAt(cur.ch) + line.charAt(cur.ch - 1), + Pos(cur.line, cur.ch - 1), Pos(cur.line, cur.ch + 1)); + }, + newlineAndIndent: function(cm) { + operation(cm, function() { + cm.replaceSelection("\n", "end", "+input"); + cm.indentLine(cm.getCursor().line, null, true); + })(); + }, + toggleOverwrite: function(cm) {cm.toggleOverwrite();} + }; + + // STANDARD KEYMAPS + + var keyMap = CodeMirror.keyMap = {}; + keyMap.basic = { + "Left": "goCharLeft", "Right": "goCharRight", "Up": "goLineUp", "Down": "goLineDown", + "End": "goLineEnd", "Home": "goLineStartSmart", "PageUp": "goPageUp", "PageDown": "goPageDown", + "Delete": "delCharAfter", "Backspace": "delCharBefore", "Tab": "defaultTab", "Shift-Tab": "indentAuto", + "Enter": "newlineAndIndent", "Insert": "toggleOverwrite" + }; + // Note that the save and find-related commands aren't defined by + // default. Unknown commands are simply ignored. + keyMap.pcDefault = { + "Ctrl-A": "selectAll", "Ctrl-D": "deleteLine", "Ctrl-Z": "undo", "Shift-Ctrl-Z": "redo", "Ctrl-Y": "redo", + "Ctrl-Home": "goDocStart", "Alt-Up": "goDocStart", "Ctrl-End": "goDocEnd", "Ctrl-Down": "goDocEnd", + "Ctrl-Left": "goGroupLeft", "Ctrl-Right": "goGroupRight", "Alt-Left": "goLineStart", "Alt-Right": "goLineEnd", + "Ctrl-Backspace": "delGroupBefore", "Ctrl-Delete": "delGroupAfter", "Ctrl-S": "save", "Ctrl-F": "find", + "Ctrl-G": "findNext", "Shift-Ctrl-G": "findPrev", "Shift-Ctrl-F": "replace", "Shift-Ctrl-R": "replaceAll", + "Ctrl-[": "indentLess", "Ctrl-]": "indentMore", + fallthrough: "basic" + }; + keyMap.macDefault = { + "Cmd-A": "selectAll", "Cmd-D": "deleteLine", "Cmd-Z": "undo", "Shift-Cmd-Z": "redo", "Cmd-Y": "redo", + "Cmd-Up": "goDocStart", "Cmd-End": "goDocEnd", "Cmd-Down": "goDocEnd", "Alt-Left": "goGroupLeft", + "Alt-Right": "goGroupRight", "Cmd-Left": "goLineStart", "Cmd-Right": "goLineEnd", "Alt-Backspace": "delGroupBefore", + "Ctrl-Alt-Backspace": "delGroupAfter", "Alt-Delete": "delGroupAfter", "Cmd-S": "save", "Cmd-F": "find", + "Cmd-G": "findNext", "Shift-Cmd-G": "findPrev", "Cmd-Alt-F": "replace", "Shift-Cmd-Alt-F": "replaceAll", + "Cmd-[": "indentLess", "Cmd-]": "indentMore", + fallthrough: ["basic", "emacsy"] + }; + keyMap["default"] = mac ? keyMap.macDefault : keyMap.pcDefault; + keyMap.emacsy = { + "Ctrl-F": "goCharRight", "Ctrl-B": "goCharLeft", "Ctrl-P": "goLineUp", "Ctrl-N": "goLineDown", + "Alt-F": "goWordRight", "Alt-B": "goWordLeft", "Ctrl-A": "goLineStart", "Ctrl-E": "goLineEnd", + "Ctrl-V": "goPageDown", "Shift-Ctrl-V": "goPageUp", "Ctrl-D": "delCharAfter", "Ctrl-H": "delCharBefore", + "Alt-D": "delWordAfter", "Alt-Backspace": "delWordBefore", "Ctrl-K": "killLine", "Ctrl-T": "transposeChars" + }; + + // KEYMAP DISPATCH + + function getKeyMap(val) { + if (typeof val == "string") return keyMap[val]; + else return val; + } + + function lookupKey(name, maps, handle) { + function lookup(map) { + map = getKeyMap(map); + var found = map[name]; + if (found === false) return "stop"; + if (found != null && handle(found)) return true; + if (map.nofallthrough) return "stop"; + + var fallthrough = map.fallthrough; + if (fallthrough == null) return false; + if (Object.prototype.toString.call(fallthrough) != "[object Array]") + return lookup(fallthrough); + for (var i = 0, e = fallthrough.length; i < e; ++i) { + var done = lookup(fallthrough[i]); + if (done) return done; + } + return false; + } + + for (var i = 0; i < maps.length; ++i) { + var done = lookup(maps[i]); + if (done) return done; + } + } + function isModifierKey(event) { + var name = keyNames[event.keyCode]; + return name == "Ctrl" || name == "Alt" || name == "Shift" || name == "Mod"; + } + function keyName(event, noShift) { + if (opera && event.keyCode == 34 && event["char"]) return false; + var name = keyNames[event.keyCode]; + if (name == null || event.altGraphKey) return false; + if (event.altKey) name = "Alt-" + name; + if (flipCtrlCmd ? event.metaKey : event.ctrlKey) name = "Ctrl-" + name; + if (flipCtrlCmd ? event.ctrlKey : event.metaKey) name = "Cmd-" + name; + if (!noShift && event.shiftKey) name = "Shift-" + name; + return name; + } + CodeMirror.lookupKey = lookupKey; + CodeMirror.isModifierKey = isModifierKey; + CodeMirror.keyName = keyName; + + // FROMTEXTAREA + + CodeMirror.fromTextArea = function(textarea, options) { + if (!options) options = {}; + options.value = textarea.value; + if (!options.tabindex && textarea.tabindex) + options.tabindex = textarea.tabindex; + if (!options.placeholder && textarea.placeholder) + options.placeholder = textarea.placeholder; + // Set autofocus to true if this textarea is focused, or if it has + // autofocus and no other element is focused. + if (options.autofocus == null) { + var hasFocus = document.body; + // doc.activeElement occasionally throws on IE + try { hasFocus = document.activeElement; } catch(e) {} + options.autofocus = hasFocus == textarea || + textarea.getAttribute("autofocus") != null && hasFocus == document.body; + } + + function save() {textarea.value = cm.getValue();} + if (textarea.form) { + on(textarea.form, "submit", save); + // Deplorable hack to make the submit method do the right thing. + if (!options.leaveSubmitMethodAlone) { + var form = textarea.form, realSubmit = form.submit; + try { + var wrappedSubmit = form.submit = function() { + save(); + form.submit = realSubmit; + form.submit(); + form.submit = wrappedSubmit; + }; + } catch(e) {} + } + } + + textarea.style.display = "none"; + var cm = CodeMirror(function(node) { + textarea.parentNode.insertBefore(node, textarea.nextSibling); + }, options); + cm.save = save; + cm.getTextArea = function() { return textarea; }; + cm.toTextArea = function() { + save(); + textarea.parentNode.removeChild(cm.getWrapperElement()); + textarea.style.display = ""; + if (textarea.form) { + off(textarea.form, "submit", save); + if (typeof textarea.form.submit == "function") + textarea.form.submit = realSubmit; + } + }; + return cm; + }; + + // STRING STREAM + + // Fed to the mode parsers, provides helper functions to make + // parsers more succinct. + + // The character stream used by a mode's parser. + function StringStream(string, tabSize) { + this.pos = this.start = 0; + this.string = string; + this.tabSize = tabSize || 8; + this.lastColumnPos = this.lastColumnValue = 0; + } + + StringStream.prototype = { + eol: function() {return this.pos >= this.string.length;}, + sol: function() {return this.pos == 0;}, + peek: function() {return this.string.charAt(this.pos) || undefined;}, + next: function() { + if (this.pos < this.string.length) + return this.string.charAt(this.pos++); + }, + eat: function(match) { + var ch = this.string.charAt(this.pos); + if (typeof match == "string") var ok = ch == match; + else var ok = ch && (match.test ? match.test(ch) : match(ch)); + if (ok) {++this.pos; return ch;} + }, + eatWhile: function(match) { + var start = this.pos; + while (this.eat(match)){} + return this.pos > start; + }, + eatSpace: function() { + var start = this.pos; + while (/[\s\u00a0]/.test(this.string.charAt(this.pos))) ++this.pos; + return this.pos > start; + }, + skipToEnd: function() {this.pos = this.string.length;}, + skipTo: function(ch) { + var found = this.string.indexOf(ch, this.pos); + if (found > -1) {this.pos = found; return true;} + }, + backUp: function(n) {this.pos -= n;}, + column: function() { + if (this.lastColumnPos < this.start) { + this.lastColumnValue = countColumn(this.string, this.start, this.tabSize, this.lastColumnPos, this.lastColumnValue); + this.lastColumnPos = this.start; + } + return this.lastColumnValue; + }, + indentation: function() {return countColumn(this.string, null, this.tabSize);}, + match: function(pattern, consume, caseInsensitive) { + if (typeof pattern == "string") { + var cased = function(str) {return caseInsensitive ? str.toLowerCase() : str;}; + var substr = this.string.substr(this.pos, pattern.length); + if (cased(substr) == cased(pattern)) { + if (consume !== false) this.pos += pattern.length; + return true; + } + } else { + var match = this.string.slice(this.pos).match(pattern); + if (match && match.index > 0) return null; + if (match && consume !== false) this.pos += match[0].length; + return match; + } + }, + current: function(){return this.string.slice(this.start, this.pos);} + }; + CodeMirror.StringStream = StringStream; + + // TEXTMARKERS + + function TextMarker(doc, type) { + this.lines = []; + this.type = type; + this.doc = doc; + } + CodeMirror.TextMarker = TextMarker; + + TextMarker.prototype.clear = function() { + if (this.explicitlyCleared) return; + var cm = this.doc.cm, withOp = cm && !cm.curOp; + if (withOp) startOperation(cm); + var min = null, max = null; + for (var i = 0; i < this.lines.length; ++i) { + var line = this.lines[i]; + var span = getMarkedSpanFor(line.markedSpans, this); + if (span.to != null) max = lineNo(line); + line.markedSpans = removeMarkedSpan(line.markedSpans, span); + if (span.from != null) + min = lineNo(line); + else if (this.collapsed && !lineIsHidden(this.doc, line) && cm) + updateLineHeight(line, textHeight(cm.display)); + } + if (cm && this.collapsed && !cm.options.lineWrapping) for (var i = 0; i < this.lines.length; ++i) { + var visual = visualLine(cm.doc, this.lines[i]), len = lineLength(cm.doc, visual); + if (len > cm.display.maxLineLength) { + cm.display.maxLine = visual; + cm.display.maxLineLength = len; + cm.display.maxLineChanged = true; + } + } + + if (min != null && cm) regChange(cm, min, max + 1); + this.lines.length = 0; + this.explicitlyCleared = true; + if (this.collapsed && this.doc.cantEdit) { + this.doc.cantEdit = false; + if (cm) reCheckSelection(cm); + } + if (withOp) endOperation(cm); + signalLater(this, "clear"); + }; + + TextMarker.prototype.find = function() { + var from, to; + for (var i = 0; i < this.lines.length; ++i) { + var line = this.lines[i]; + var span = getMarkedSpanFor(line.markedSpans, this); + if (span.from != null || span.to != null) { + var found = lineNo(line); + if (span.from != null) from = Pos(found, span.from); + if (span.to != null) to = Pos(found, span.to); + } + } + if (this.type == "bookmark") return from; + return from && {from: from, to: to}; + }; + + TextMarker.prototype.getOptions = function(copyWidget) { + var repl = this.replacedWith; + return {className: this.className, + inclusiveLeft: this.inclusiveLeft, inclusiveRight: this.inclusiveRight, + atomic: this.atomic, + collapsed: this.collapsed, + replacedWith: copyWidget ? repl && repl.cloneNode(true) : repl, + readOnly: this.readOnly, + startStyle: this.startStyle, endStyle: this.endStyle}; + }; + + TextMarker.prototype.attachLine = function(line) { + if (!this.lines.length && this.doc.cm) { + var op = this.doc.cm.curOp; + if (!op.maybeHiddenMarkers || indexOf(op.maybeHiddenMarkers, this) == -1) + (op.maybeUnhiddenMarkers || (op.maybeUnhiddenMarkers = [])).push(this); + } + this.lines.push(line); + }; + TextMarker.prototype.detachLine = function(line) { + this.lines.splice(indexOf(this.lines, line), 1); + if (!this.lines.length && this.doc.cm) { + var op = this.doc.cm.curOp; + (op.maybeHiddenMarkers || (op.maybeHiddenMarkers = [])).push(this); + } + }; + + function markText(doc, from, to, options, type) { + if (options && options.shared) return markTextShared(doc, from, to, options, type); + if (doc.cm && !doc.cm.curOp) return operation(doc.cm, markText)(doc, from, to, options, type); + + var marker = new TextMarker(doc, type); + if (type == "range" && !posLess(from, to)) return marker; + if (options) copyObj(options, marker); + if (marker.replacedWith) { + marker.collapsed = true; + marker.replacedWith = elt("span", [marker.replacedWith], "CodeMirror-widget"); + } + if (marker.collapsed) sawCollapsedSpans = true; + + if (marker.addToHistory) + addToHistory(doc, {from: from, to: to, origin: "markText"}, + {head: doc.sel.head, anchor: doc.sel.anchor}, NaN); + + var curLine = from.line, size = 0, collapsedAtStart, collapsedAtEnd, cm = doc.cm, updateMaxLine; + doc.iter(curLine, to.line + 1, function(line) { + if (cm && marker.collapsed && !cm.options.lineWrapping && visualLine(doc, line) == cm.display.maxLine) + updateMaxLine = true; + var span = {from: null, to: null, marker: marker}; + size += line.text.length; + if (curLine == from.line) {span.from = from.ch; size -= from.ch;} + if (curLine == to.line) {span.to = to.ch; size -= line.text.length - to.ch;} + if (marker.collapsed) { + if (curLine == to.line) collapsedAtEnd = collapsedSpanAt(line, to.ch); + if (curLine == from.line) collapsedAtStart = collapsedSpanAt(line, from.ch); + else updateLineHeight(line, 0); + } + addMarkedSpan(line, span); + ++curLine; + }); + if (marker.collapsed) doc.iter(from.line, to.line + 1, function(line) { + if (lineIsHidden(doc, line)) updateLineHeight(line, 0); + }); + + if (marker.clearOnEnter) on(marker, "beforeCursorEnter", function() { marker.clear(); }); + + if (marker.readOnly) { + sawReadOnlySpans = true; + if (doc.history.done.length || doc.history.undone.length) + doc.clearHistory(); + } + if (marker.collapsed) { + if (collapsedAtStart != collapsedAtEnd) + throw new Error("Inserting collapsed marker overlapping an existing one"); + marker.size = size; + marker.atomic = true; + } + if (cm) { + if (updateMaxLine) cm.curOp.updateMaxLine = true; + if (marker.className || marker.startStyle || marker.endStyle || marker.collapsed) + regChange(cm, from.line, to.line + 1); + if (marker.atomic) reCheckSelection(cm); + } + return marker; + } + + // SHARED TEXTMARKERS + + function SharedTextMarker(markers, primary) { + this.markers = markers; + this.primary = primary; + for (var i = 0, me = this; i < markers.length; ++i) { + markers[i].parent = this; + on(markers[i], "clear", function(){me.clear();}); + } + } + CodeMirror.SharedTextMarker = SharedTextMarker; + + SharedTextMarker.prototype.clear = function() { + if (this.explicitlyCleared) return; + this.explicitlyCleared = true; + for (var i = 0; i < this.markers.length; ++i) + this.markers[i].clear(); + signalLater(this, "clear"); + }; + SharedTextMarker.prototype.find = function() { + return this.primary.find(); + }; + SharedTextMarker.prototype.getOptions = function(copyWidget) { + var inner = this.primary.getOptions(copyWidget); + inner.shared = true; + return inner; + }; + + function markTextShared(doc, from, to, options, type) { + options = copyObj(options); + options.shared = false; + var markers = [markText(doc, from, to, options, type)], primary = markers[0]; + var widget = options.replacedWith; + linkedDocs(doc, function(doc) { + if (widget) options.replacedWith = widget.cloneNode(true); + markers.push(markText(doc, clipPos(doc, from), clipPos(doc, to), options, type)); + for (var i = 0; i < doc.linked.length; ++i) + if (doc.linked[i].isParent) return; + primary = lst(markers); + }); + return new SharedTextMarker(markers, primary); + } + + // TEXTMARKER SPANS + + function getMarkedSpanFor(spans, marker) { + if (spans) for (var i = 0; i < spans.length; ++i) { + var span = spans[i]; + if (span.marker == marker) return span; + } + } + function removeMarkedSpan(spans, span) { + for (var r, i = 0; i < spans.length; ++i) + if (spans[i] != span) (r || (r = [])).push(spans[i]); + return r; + } + function addMarkedSpan(line, span) { + line.markedSpans = line.markedSpans ? line.markedSpans.concat([span]) : [span]; + span.marker.attachLine(line); + } + + function markedSpansBefore(old, startCh, isInsert) { + if (old) for (var i = 0, nw; i < old.length; ++i) { + var span = old[i], marker = span.marker; + var startsBefore = span.from == null || (marker.inclusiveLeft ? span.from <= startCh : span.from < startCh); + if (startsBefore || marker.type == "bookmark" && span.from == startCh && (!isInsert || !span.marker.insertLeft)) { + var endsAfter = span.to == null || (marker.inclusiveRight ? span.to >= startCh : span.to > startCh); + (nw || (nw = [])).push({from: span.from, + to: endsAfter ? null : span.to, + marker: marker}); + } + } + return nw; + } + + function markedSpansAfter(old, endCh, isInsert) { + if (old) for (var i = 0, nw; i < old.length; ++i) { + var span = old[i], marker = span.marker; + var endsAfter = span.to == null || (marker.inclusiveRight ? span.to >= endCh : span.to > endCh); + if (endsAfter || marker.type == "bookmark" && span.from == endCh && (!isInsert || span.marker.insertLeft)) { + var startsBefore = span.from == null || (marker.inclusiveLeft ? span.from <= endCh : span.from < endCh); + (nw || (nw = [])).push({from: startsBefore ? null : span.from - endCh, + to: span.to == null ? null : span.to - endCh, + marker: marker}); + } + } + return nw; + } + + function stretchSpansOverChange(doc, change) { + var oldFirst = isLine(doc, change.from.line) && getLine(doc, change.from.line).markedSpans; + var oldLast = isLine(doc, change.to.line) && getLine(doc, change.to.line).markedSpans; + if (!oldFirst && !oldLast) return null; + + var startCh = change.from.ch, endCh = change.to.ch, isInsert = posEq(change.from, change.to); + // Get the spans that 'stick out' on both sides + var first = markedSpansBefore(oldFirst, startCh, isInsert); + var last = markedSpansAfter(oldLast, endCh, isInsert); + + // Next, merge those two ends + var sameLine = change.text.length == 1, offset = lst(change.text).length + (sameLine ? startCh : 0); + if (first) { + // Fix up .to properties of first + for (var i = 0; i < first.length; ++i) { + var span = first[i]; + if (span.to == null) { + var found = getMarkedSpanFor(last, span.marker); + if (!found) span.to = startCh; + else if (sameLine) span.to = found.to == null ? null : found.to + offset; + } + } + } + if (last) { + // Fix up .from in last (or move them into first in case of sameLine) + for (var i = 0; i < last.length; ++i) { + var span = last[i]; + if (span.to != null) span.to += offset; + if (span.from == null) { + var found = getMarkedSpanFor(first, span.marker); + if (!found) { + span.from = offset; + if (sameLine) (first || (first = [])).push(span); + } + } else { + span.from += offset; + if (sameLine) (first || (first = [])).push(span); + } + } + } + + var newMarkers = [first]; + if (!sameLine) { + // Fill gap with whole-line-spans + var gap = change.text.length - 2, gapMarkers; + if (gap > 0 && first) + for (var i = 0; i < first.length; ++i) + if (first[i].to == null) + (gapMarkers || (gapMarkers = [])).push({from: null, to: null, marker: first[i].marker}); + for (var i = 0; i < gap; ++i) + newMarkers.push(gapMarkers); + newMarkers.push(last); + } + return newMarkers; + } + + function mergeOldSpans(doc, change) { + var old = getOldSpans(doc, change); + var stretched = stretchSpansOverChange(doc, change); + if (!old) return stretched; + if (!stretched) return old; + + for (var i = 0; i < old.length; ++i) { + var oldCur = old[i], stretchCur = stretched[i]; + if (oldCur && stretchCur) { + spans: for (var j = 0; j < stretchCur.length; ++j) { + var span = stretchCur[j]; + for (var k = 0; k < oldCur.length; ++k) + if (oldCur[k].marker == span.marker) continue spans; + oldCur.push(span); + } + } else if (stretchCur) { + old[i] = stretchCur; + } + } + return old; + } + + function removeReadOnlyRanges(doc, from, to) { + var markers = null; + doc.iter(from.line, to.line + 1, function(line) { + if (line.markedSpans) for (var i = 0; i < line.markedSpans.length; ++i) { + var mark = line.markedSpans[i].marker; + if (mark.readOnly && (!markers || indexOf(markers, mark) == -1)) + (markers || (markers = [])).push(mark); + } + }); + if (!markers) return null; + var parts = [{from: from, to: to}]; + for (var i = 0; i < markers.length; ++i) { + var mk = markers[i], m = mk.find(); + for (var j = 0; j < parts.length; ++j) { + var p = parts[j]; + if (posLess(p.to, m.from) || posLess(m.to, p.from)) continue; + var newParts = [j, 1]; + if (posLess(p.from, m.from) || !mk.inclusiveLeft && posEq(p.from, m.from)) + newParts.push({from: p.from, to: m.from}); + if (posLess(m.to, p.to) || !mk.inclusiveRight && posEq(p.to, m.to)) + newParts.push({from: m.to, to: p.to}); + parts.splice.apply(parts, newParts); + j += newParts.length - 1; + } + } + return parts; + } + + function collapsedSpanAt(line, ch) { + var sps = sawCollapsedSpans && line.markedSpans, found; + if (sps) for (var sp, i = 0; i < sps.length; ++i) { + sp = sps[i]; + if (!sp.marker.collapsed) continue; + if ((sp.from == null || sp.from < ch) && + (sp.to == null || sp.to > ch) && + (!found || found.width < sp.marker.width)) + found = sp.marker; + } + return found; + } + function collapsedSpanAtStart(line) { return collapsedSpanAt(line, -1); } + function collapsedSpanAtEnd(line) { return collapsedSpanAt(line, line.text.length + 1); } + + function visualLine(doc, line) { + var merged; + while (merged = collapsedSpanAtStart(line)) + line = getLine(doc, merged.find().from.line); + return line; + } + + function lineIsHidden(doc, line) { + var sps = sawCollapsedSpans && line.markedSpans; + if (sps) for (var sp, i = 0; i < sps.length; ++i) { + sp = sps[i]; + if (!sp.marker.collapsed) continue; + if (sp.from == null) return true; + if (sp.from == 0 && sp.marker.inclusiveLeft && lineIsHiddenInner(doc, line, sp)) + return true; + } + } + function lineIsHiddenInner(doc, line, span) { + if (span.to == null) { + var end = span.marker.find().to, endLine = getLine(doc, end.line); + return lineIsHiddenInner(doc, endLine, getMarkedSpanFor(endLine.markedSpans, span.marker)); + } + if (span.marker.inclusiveRight && span.to == line.text.length) + return true; + for (var sp, i = 0; i < line.markedSpans.length; ++i) { + sp = line.markedSpans[i]; + if (sp.marker.collapsed && sp.from == span.to && + (sp.marker.inclusiveLeft || span.marker.inclusiveRight) && + lineIsHiddenInner(doc, line, sp)) return true; + } + } + + function detachMarkedSpans(line) { + var spans = line.markedSpans; + if (!spans) return; + for (var i = 0; i < spans.length; ++i) + spans[i].marker.detachLine(line); + line.markedSpans = null; + } + + function attachMarkedSpans(line, spans) { + if (!spans) return; + for (var i = 0; i < spans.length; ++i) + spans[i].marker.attachLine(line); + line.markedSpans = spans; + } + + // LINE WIDGETS + + var LineWidget = CodeMirror.LineWidget = function(cm, node, options) { + for (var opt in options) if (options.hasOwnProperty(opt)) + this[opt] = options[opt]; + this.cm = cm; + this.node = node; + }; + function widgetOperation(f) { + return function() { + var withOp = !this.cm.curOp; + if (withOp) startOperation(this.cm); + try {var result = f.apply(this, arguments);} + finally {if (withOp) endOperation(this.cm);} + return result; + }; + } + LineWidget.prototype.clear = widgetOperation(function() { + var ws = this.line.widgets, no = lineNo(this.line); + if (no == null || !ws) return; + for (var i = 0; i < ws.length; ++i) if (ws[i] == this) ws.splice(i--, 1); + if (!ws.length) this.line.widgets = null; + updateLineHeight(this.line, Math.max(0, this.line.height - widgetHeight(this))); + regChange(this.cm, no, no + 1); + }); + LineWidget.prototype.changed = widgetOperation(function() { + var oldH = this.height; + this.height = null; + var diff = widgetHeight(this) - oldH; + if (!diff) return; + updateLineHeight(this.line, this.line.height + diff); + var no = lineNo(this.line); + regChange(this.cm, no, no + 1); + }); + + function widgetHeight(widget) { + if (widget.height != null) return widget.height; + if (!widget.node.parentNode || widget.node.parentNode.nodeType != 1) + removeChildrenAndAdd(widget.cm.display.measure, elt("div", [widget.node], null, "position: relative")); + return widget.height = widget.node.offsetHeight; + } + + function addLineWidget(cm, handle, node, options) { + var widget = new LineWidget(cm, node, options); + if (widget.noHScroll) cm.display.alignWidgets = true; + changeLine(cm, handle, function(line) { + (line.widgets || (line.widgets = [])).push(widget); + widget.line = line; + if (!lineIsHidden(cm.doc, line) || widget.showIfHidden) { + var aboveVisible = heightAtLine(cm, line) < cm.display.scroller.scrollTop; + updateLineHeight(line, line.height + widgetHeight(widget)); + if (aboveVisible) addToScrollPos(cm, 0, widget.height); + } + return true; + }); + return widget; + } + + // LINE DATA STRUCTURE + + // Line objects. These hold state related to a line, including + // highlighting info (the styles array). + function makeLine(text, markedSpans, estimateHeight) { + var line = {text: text}; + attachMarkedSpans(line, markedSpans); + line.height = estimateHeight ? estimateHeight(line) : 1; + return line; + } + + function updateLine(line, text, markedSpans, estimateHeight) { + line.text = text; + if (line.stateAfter) line.stateAfter = null; + if (line.styles) line.styles = null; + if (line.order != null) line.order = null; + detachMarkedSpans(line); + attachMarkedSpans(line, markedSpans); + var estHeight = estimateHeight ? estimateHeight(line) : 1; + if (estHeight != line.height) updateLineHeight(line, estHeight); + } + + function cleanUpLine(line) { + line.parent = null; + detachMarkedSpans(line); + } + + // Run the given mode's parser over a line, update the styles + // array, which contains alternating fragments of text and CSS + // classes. + function runMode(cm, text, mode, state, f) { + var flattenSpans = mode.flattenSpans; + if (flattenSpans == null) flattenSpans = cm.options.flattenSpans; + var curText = "", curStyle = null; + var stream = new StringStream(text, cm.options.tabSize), style; + if (text == "" && mode.blankLine) mode.blankLine(state); + while (!stream.eol()) { + if (stream.pos > cm.options.maxHighlightLength) { + flattenSpans = false; + // Webkit seems to refuse to render text nodes longer than 57444 characters + stream.pos = Math.min(text.length, stream.start + 50000); + style = null; + } else { + style = mode.token(stream, state); + } + var substr = stream.current(); + stream.start = stream.pos; + if (!flattenSpans || curStyle != style) { + if (curText) f(curText, curStyle); + curText = substr; curStyle = style; + } else curText = curText + substr; + } + if (curText) f(curText, curStyle); + } + + function highlightLine(cm, line, state) { + // A styles array always starts with a number identifying the + // mode/overlays that it is based on (for easy invalidation). + var st = [cm.state.modeGen]; + // Compute the base array of styles + runMode(cm, line.text, cm.doc.mode, state, function(txt, style) {st.push(txt, style);}); + + // Run overlays, adjust style array. + for (var o = 0; o < cm.state.overlays.length; ++o) { + var overlay = cm.state.overlays[o], i = 1; + runMode(cm, line.text, overlay.mode, true, function(txt, style) { + var start = i, len = txt.length; + // Ensure there's a token end at the current position, and that i points at it + while (len) { + var cur = st[i], len_ = cur.length; + if (len_ <= len) { + len -= len_; + } else { + st.splice(i, 1, cur.slice(0, len), st[i+1], cur.slice(len)); + len = 0; + } + i += 2; + } + if (!style) return; + if (overlay.opaque) { + st.splice(start, i - start, txt, style); + i = start + 2; + } else { + for (; start < i; start += 2) { + var cur = st[start+1]; + st[start+1] = cur ? cur + " " + style : style; + } + } + }); + } + + return st; + } + + function getLineStyles(cm, line) { + if (!line.styles || line.styles[0] != cm.state.modeGen) + line.styles = highlightLine(cm, line, line.stateAfter = getStateBefore(cm, lineNo(line))); + return line.styles; + } + + // Lightweight form of highlight -- proceed over this line and + // update state, but don't save a style array. + function processLine(cm, line, state) { + var mode = cm.doc.mode; + var stream = new StringStream(line.text, cm.options.tabSize); + if (line.text == "" && mode.blankLine) mode.blankLine(state); + while (!stream.eol() && stream.pos <= cm.options.maxHighlightLength) { + mode.token(stream, state); + stream.start = stream.pos; + } + } + + var styleToClassCache = {}; + function styleToClass(style) { + if (!style) return null; + return styleToClassCache[style] || + (styleToClassCache[style] = "cm-" + style.replace(/ +/g, " cm-")); + } + + function lineContent(cm, realLine, measure) { + var merged, line = realLine, lineBefore, sawBefore, simple = true; + while (merged = collapsedSpanAtStart(line)) { + simple = false; + line = getLine(cm.doc, merged.find().from.line); + if (!lineBefore) lineBefore = line; + } + + var builder = {pre: elt("pre"), col: 0, pos: 0, display: !measure, + measure: null, addedOne: false, cm: cm}; + if (line.textClass) builder.pre.className = line.textClass; + + do { + builder.measure = line == realLine && measure; + builder.pos = 0; + builder.addToken = builder.measure ? buildTokenMeasure : buildToken; + if ((ie || webkit) && cm.getOption("lineWrapping")) + builder.addToken = buildTokenSplitSpaces(builder.addToken); + if (measure && sawBefore && line != realLine && !builder.addedOne) { + measure[0] = builder.pre.appendChild(zeroWidthElement(cm.display.measure)); + builder.addedOne = true; + } + var next = insertLineContent(line, builder, getLineStyles(cm, line)); + sawBefore = line == lineBefore; + if (next) { + line = getLine(cm.doc, next.to.line); + simple = false; + } + } while (next); + + if (measure && !builder.addedOne) + measure[0] = builder.pre.appendChild(simple ? elt("span", "\u00a0") : zeroWidthElement(cm.display.measure)); + if (!builder.pre.firstChild && !lineIsHidden(cm.doc, realLine)) + builder.pre.appendChild(document.createTextNode("\u00a0")); + + var order; + // Work around problem with the reported dimensions of single-char + // direction spans on IE (issue #1129). See also the comment in + // cursorCoords. + if (measure && ie && (order = getOrder(line))) { + var l = order.length - 1; + if (order[l].from == order[l].to) --l; + var last = order[l], prev = order[l - 1]; + if (last.from + 1 == last.to && prev && last.level < prev.level) { + var span = measure[builder.pos - 1]; + if (span) span.parentNode.insertBefore(span.measureRight = zeroWidthElement(cm.display.measure), + span.nextSibling); + } + } + + signal(cm, "renderLine", cm, realLine, builder.pre); + return builder.pre; + } + + var tokenSpecialChars = /[\t\u0000-\u0019\u00ad\u200b\u2028\u2029\uFEFF]/g; + function buildToken(builder, text, style, startStyle, endStyle) { + if (!text) return; + if (!tokenSpecialChars.test(text)) { + builder.col += text.length; + var content = document.createTextNode(text); + } else { + var content = document.createDocumentFragment(), pos = 0; + while (true) { + tokenSpecialChars.lastIndex = pos; + var m = tokenSpecialChars.exec(text); + var skipped = m ? m.index - pos : text.length - pos; + if (skipped) { + content.appendChild(document.createTextNode(text.slice(pos, pos + skipped))); + builder.col += skipped; + } + if (!m) break; + pos += skipped + 1; + if (m[0] == "\t") { + var tabSize = builder.cm.options.tabSize, tabWidth = tabSize - builder.col % tabSize; + content.appendChild(elt("span", spaceStr(tabWidth), "cm-tab")); + builder.col += tabWidth; + } else { + var token = elt("span", "\u2022", "cm-invalidchar"); + token.title = "\\u" + m[0].charCodeAt(0).toString(16); + content.appendChild(token); + builder.col += 1; + } + } + } + if (style || startStyle || endStyle || builder.measure) { + var fullStyle = style || ""; + if (startStyle) fullStyle += startStyle; + if (endStyle) fullStyle += endStyle; + return builder.pre.appendChild(elt("span", [content], fullStyle)); + } + builder.pre.appendChild(content); + } + + function buildTokenMeasure(builder, text, style, startStyle, endStyle) { + var wrapping = builder.cm.options.lineWrapping; + for (var i = 0; i < text.length; ++i) { + var ch = text.charAt(i), start = i == 0; + if (ch >= "\ud800" && ch < "\udbff" && i < text.length - 1) { + ch = text.slice(i, i + 2); + ++i; + } else if (i && wrapping && + spanAffectsWrapping.test(text.slice(i - 1, i + 1))) { + builder.pre.appendChild(elt("wbr")); + } + var span = builder.measure[builder.pos] = + buildToken(builder, ch, style, + start && startStyle, i == text.length - 1 && endStyle); + // In IE single-space nodes wrap differently than spaces + // embedded in larger text nodes, except when set to + // white-space: normal (issue #1268). + if (ie && wrapping && ch == " " && i && !/\s/.test(text.charAt(i - 1)) && + i < text.length - 1 && !/\s/.test(text.charAt(i + 1))) + span.style.whiteSpace = "normal"; + builder.pos += ch.length; + } + if (text.length) builder.addedOne = true; + } + + function buildTokenSplitSpaces(inner) { + function split(old) { + var out = " "; + for (var i = 0; i < old.length - 2; ++i) out += i % 2 ? " " : "\u00a0"; + out += " "; + return out; + } + return function(builder, text, style, startStyle, endStyle) { + return inner(builder, text.replace(/ {3,}/, split), style, startStyle, endStyle); + }; + } + + function buildCollapsedSpan(builder, size, widget) { + if (widget) { + if (!builder.display) widget = widget.cloneNode(true); + builder.pre.appendChild(widget); + if (builder.measure && size) { + builder.measure[builder.pos] = widget; + builder.addedOne = true; + } + } + builder.pos += size; + } + + // Outputs a number of spans to make up a line, taking highlighting + // and marked text into account. + function insertLineContent(line, builder, styles) { + var spans = line.markedSpans; + if (!spans) { + for (var i = 1; i < styles.length; i+=2) + builder.addToken(builder, styles[i], styleToClass(styles[i+1])); + return; + } + + var allText = line.text, len = allText.length; + var pos = 0, i = 1, text = "", style; + var nextChange = 0, spanStyle, spanEndStyle, spanStartStyle, collapsed; + for (;;) { + if (nextChange == pos) { // Update current marker set + spanStyle = spanEndStyle = spanStartStyle = ""; + collapsed = null; nextChange = Infinity; + var foundBookmark = null; + for (var j = 0; j < spans.length; ++j) { + var sp = spans[j], m = sp.marker; + if (sp.from <= pos && (sp.to == null || sp.to > pos)) { + if (sp.to != null && nextChange > sp.to) { nextChange = sp.to; spanEndStyle = ""; } + if (m.className) spanStyle += " " + m.className; + if (m.startStyle && sp.from == pos) spanStartStyle += " " + m.startStyle; + if (m.endStyle && sp.to == nextChange) spanEndStyle += " " + m.endStyle; + if (m.collapsed && (!collapsed || collapsed.marker.width < m.width)) + collapsed = sp; + } else if (sp.from > pos && nextChange > sp.from) { + nextChange = sp.from; + } + if (m.type == "bookmark" && sp.from == pos && m.replacedWith) + foundBookmark = m.replacedWith; + } + if (collapsed && (collapsed.from || 0) == pos) { + buildCollapsedSpan(builder, (collapsed.to == null ? len : collapsed.to) - pos, + collapsed.from != null && collapsed.marker.replacedWith); + if (collapsed.to == null) return collapsed.marker.find(); + } + if (foundBookmark && !collapsed) buildCollapsedSpan(builder, 0, foundBookmark); + } + if (pos >= len) break; + + var upto = Math.min(len, nextChange); + while (true) { + if (text) { + var end = pos + text.length; + if (!collapsed) { + var tokenText = end > upto ? text.slice(0, upto - pos) : text; + builder.addToken(builder, tokenText, style ? style + spanStyle : spanStyle, + spanStartStyle, pos + tokenText.length == nextChange ? spanEndStyle : ""); + } + if (end >= upto) {text = text.slice(upto - pos); pos = upto; break;} + pos = end; + spanStartStyle = ""; + } + text = styles[i++]; style = styleToClass(styles[i++]); + } + } + } + + // DOCUMENT DATA STRUCTURE + + function updateDoc(doc, change, markedSpans, selAfter, estimateHeight) { + function spansFor(n) {return markedSpans ? markedSpans[n] : null;} + function update(line, text, spans) { + updateLine(line, text, spans, estimateHeight); + signalLater(line, "change", line, change); + } + + var from = change.from, to = change.to, text = change.text; + var firstLine = getLine(doc, from.line), lastLine = getLine(doc, to.line); + var lastText = lst(text), lastSpans = spansFor(text.length - 1), nlines = to.line - from.line; + + // First adjust the line structure + if (from.ch == 0 && to.ch == 0 && lastText == "") { + // This is a whole-line replace. Treated specially to make + // sure line objects move the way they are supposed to. + for (var i = 0, e = text.length - 1, added = []; i < e; ++i) + added.push(makeLine(text[i], spansFor(i), estimateHeight)); + update(lastLine, lastLine.text, lastSpans); + if (nlines) doc.remove(from.line, nlines); + if (added.length) doc.insert(from.line, added); + } else if (firstLine == lastLine) { + if (text.length == 1) { + update(firstLine, firstLine.text.slice(0, from.ch) + lastText + firstLine.text.slice(to.ch), lastSpans); + } else { + for (var added = [], i = 1, e = text.length - 1; i < e; ++i) + added.push(makeLine(text[i], spansFor(i), estimateHeight)); + added.push(makeLine(lastText + firstLine.text.slice(to.ch), lastSpans, estimateHeight)); + update(firstLine, firstLine.text.slice(0, from.ch) + text[0], spansFor(0)); + doc.insert(from.line + 1, added); + } + } else if (text.length == 1) { + update(firstLine, firstLine.text.slice(0, from.ch) + text[0] + lastLine.text.slice(to.ch), spansFor(0)); + doc.remove(from.line + 1, nlines); + } else { + update(firstLine, firstLine.text.slice(0, from.ch) + text[0], spansFor(0)); + update(lastLine, lastText + lastLine.text.slice(to.ch), lastSpans); + for (var i = 1, e = text.length - 1, added = []; i < e; ++i) + added.push(makeLine(text[i], spansFor(i), estimateHeight)); + if (nlines > 1) doc.remove(from.line + 1, nlines - 1); + doc.insert(from.line + 1, added); + } + + signalLater(doc, "change", doc, change); + setSelection(doc, selAfter.anchor, selAfter.head, null, true); + } + + function LeafChunk(lines) { + this.lines = lines; + this.parent = null; + for (var i = 0, e = lines.length, height = 0; i < e; ++i) { + lines[i].parent = this; + height += lines[i].height; + } + this.height = height; + } + + LeafChunk.prototype = { + chunkSize: function() { return this.lines.length; }, + removeInner: function(at, n) { + for (var i = at, e = at + n; i < e; ++i) { + var line = this.lines[i]; + this.height -= line.height; + cleanUpLine(line); + signalLater(line, "delete"); + } + this.lines.splice(at, n); + }, + collapse: function(lines) { + lines.splice.apply(lines, [lines.length, 0].concat(this.lines)); + }, + insertInner: function(at, lines, height) { + this.height += height; + this.lines = this.lines.slice(0, at).concat(lines).concat(this.lines.slice(at)); + for (var i = 0, e = lines.length; i < e; ++i) lines[i].parent = this; + }, + iterN: function(at, n, op) { + for (var e = at + n; at < e; ++at) + if (op(this.lines[at])) return true; + } + }; + + function BranchChunk(children) { + this.children = children; + var size = 0, height = 0; + for (var i = 0, e = children.length; i < e; ++i) { + var ch = children[i]; + size += ch.chunkSize(); height += ch.height; + ch.parent = this; + } + this.size = size; + this.height = height; + this.parent = null; + } + + BranchChunk.prototype = { + chunkSize: function() { return this.size; }, + removeInner: function(at, n) { + this.size -= n; + for (var i = 0; i < this.children.length; ++i) { + var child = this.children[i], sz = child.chunkSize(); + if (at < sz) { + var rm = Math.min(n, sz - at), oldHeight = child.height; + child.removeInner(at, rm); + this.height -= oldHeight - child.height; + if (sz == rm) { this.children.splice(i--, 1); child.parent = null; } + if ((n -= rm) == 0) break; + at = 0; + } else at -= sz; + } + if (this.size - n < 25) { + var lines = []; + this.collapse(lines); + this.children = [new LeafChunk(lines)]; + this.children[0].parent = this; + } + }, + collapse: function(lines) { + for (var i = 0, e = this.children.length; i < e; ++i) this.children[i].collapse(lines); + }, + insertInner: function(at, lines, height) { + this.size += lines.length; + this.height += height; + for (var i = 0, e = this.children.length; i < e; ++i) { + var child = this.children[i], sz = child.chunkSize(); + if (at <= sz) { + child.insertInner(at, lines, height); + if (child.lines && child.lines.length > 50) { + while (child.lines.length > 50) { + var spilled = child.lines.splice(child.lines.length - 25, 25); + var newleaf = new LeafChunk(spilled); + child.height -= newleaf.height; + this.children.splice(i + 1, 0, newleaf); + newleaf.parent = this; + } + this.maybeSpill(); + } + break; + } + at -= sz; + } + }, + maybeSpill: function() { + if (this.children.length <= 10) return; + var me = this; + do { + var spilled = me.children.splice(me.children.length - 5, 5); + var sibling = new BranchChunk(spilled); + if (!me.parent) { // Become the parent node + var copy = new BranchChunk(me.children); + copy.parent = me; + me.children = [copy, sibling]; + me = copy; + } else { + me.size -= sibling.size; + me.height -= sibling.height; + var myIndex = indexOf(me.parent.children, me); + me.parent.children.splice(myIndex + 1, 0, sibling); + } + sibling.parent = me.parent; + } while (me.children.length > 10); + me.parent.maybeSpill(); + }, + iterN: function(at, n, op) { + for (var i = 0, e = this.children.length; i < e; ++i) { + var child = this.children[i], sz = child.chunkSize(); + if (at < sz) { + var used = Math.min(n, sz - at); + if (child.iterN(at, used, op)) return true; + if ((n -= used) == 0) break; + at = 0; + } else at -= sz; + } + } + }; + + var nextDocId = 0; + var Doc = CodeMirror.Doc = function(text, mode, firstLine) { + if (!(this instanceof Doc)) return new Doc(text, mode, firstLine); + if (firstLine == null) firstLine = 0; + + BranchChunk.call(this, [new LeafChunk([makeLine("", null)])]); + this.first = firstLine; + this.scrollTop = this.scrollLeft = 0; + this.cantEdit = false; + this.history = makeHistory(); + this.frontier = firstLine; + var start = Pos(firstLine, 0); + this.sel = {from: start, to: start, head: start, anchor: start, shift: false, extend: false, goalColumn: null}; + this.id = ++nextDocId; + this.modeOption = mode; + + if (typeof text == "string") text = splitLines(text); + updateDoc(this, {from: start, to: start, text: text}, null, {head: start, anchor: start}); + }; + + Doc.prototype = createObj(BranchChunk.prototype, { + iter: function(from, to, op) { + if (op) this.iterN(from - this.first, to - from, op); + else this.iterN(this.first, this.first + this.size, from); + }, + + insert: function(at, lines) { + var height = 0; + for (var i = 0, e = lines.length; i < e; ++i) height += lines[i].height; + this.insertInner(at - this.first, lines, height); + }, + remove: function(at, n) { this.removeInner(at - this.first, n); }, + + getValue: function(lineSep) { + var lines = getLines(this, this.first, this.first + this.size); + if (lineSep === false) return lines; + return lines.join(lineSep || "\n"); + }, + setValue: function(code) { + var top = Pos(this.first, 0), last = this.first + this.size - 1; + makeChange(this, {from: top, to: Pos(last, getLine(this, last).text.length), + text: splitLines(code), origin: "setValue"}, + {head: top, anchor: top}, true); + }, + replaceRange: function(code, from, to, origin) { + from = clipPos(this, from); + to = to ? clipPos(this, to) : from; + replaceRange(this, code, from, to, origin); + }, + getRange: function(from, to, lineSep) { + var lines = getBetween(this, clipPos(this, from), clipPos(this, to)); + if (lineSep === false) return lines; + return lines.join(lineSep || "\n"); + }, + + getLine: function(line) {var l = this.getLineHandle(line); return l && l.text;}, + setLine: function(line, text) { + if (isLine(this, line)) + replaceRange(this, text, Pos(line, 0), clipPos(this, Pos(line))); + }, + removeLine: function(line) { + if (line) replaceRange(this, "", clipPos(this, Pos(line - 1)), clipPos(this, Pos(line))); + else replaceRange(this, "", Pos(0, 0), clipPos(this, Pos(1, 0))); + }, + + getLineHandle: function(line) {if (isLine(this, line)) return getLine(this, line);}, + getLineNumber: function(line) {return lineNo(line);}, + + lineCount: function() {return this.size;}, + firstLine: function() {return this.first;}, + lastLine: function() {return this.first + this.size - 1;}, + + clipPos: function(pos) {return clipPos(this, pos);}, + + getCursor: function(start) { + var sel = this.sel, pos; + if (start == null || start == "head") pos = sel.head; + else if (start == "anchor") pos = sel.anchor; + else if (start == "end" || start === false) pos = sel.to; + else pos = sel.from; + return copyPos(pos); + }, + somethingSelected: function() {return !posEq(this.sel.head, this.sel.anchor);}, + + setCursor: docOperation(function(line, ch, extend) { + var pos = clipPos(this, typeof line == "number" ? Pos(line, ch || 0) : line); + if (extend) extendSelection(this, pos); + else setSelection(this, pos, pos); + }), + setSelection: docOperation(function(anchor, head) { + setSelection(this, clipPos(this, anchor), clipPos(this, head || anchor)); + }), + extendSelection: docOperation(function(from, to) { + extendSelection(this, clipPos(this, from), to && clipPos(this, to)); + }), + + getSelection: function(lineSep) {return this.getRange(this.sel.from, this.sel.to, lineSep);}, + replaceSelection: function(code, collapse, origin) { + makeChange(this, {from: this.sel.from, to: this.sel.to, text: splitLines(code), origin: origin}, collapse || "around"); + }, + undo: docOperation(function() {makeChangeFromHistory(this, "undo");}), + redo: docOperation(function() {makeChangeFromHistory(this, "redo");}), + + setExtending: function(val) {this.sel.extend = val;}, + + historySize: function() { + var hist = this.history; + return {undo: hist.done.length, redo: hist.undone.length}; + }, + clearHistory: function() {this.history = makeHistory();}, + + markClean: function() { + this.history.dirtyCounter = 0; + this.history.lastOp = this.history.lastOrigin = null; + }, + isClean: function () {return this.history.dirtyCounter == 0;}, + + getHistory: function() { + return {done: copyHistoryArray(this.history.done), + undone: copyHistoryArray(this.history.undone)}; + }, + setHistory: function(histData) { + var hist = this.history = makeHistory(); + hist.done = histData.done.slice(0); + hist.undone = histData.undone.slice(0); + }, + + markText: function(from, to, options) { + return markText(this, clipPos(this, from), clipPos(this, to), options, "range"); + }, + setBookmark: function(pos, options) { + var realOpts = {replacedWith: options && (options.nodeType == null ? options.widget : options), + insertLeft: options && options.insertLeft}; + pos = clipPos(this, pos); + return markText(this, pos, pos, realOpts, "bookmark"); + }, + findMarksAt: function(pos) { + pos = clipPos(this, pos); + var markers = [], spans = getLine(this, pos.line).markedSpans; + if (spans) for (var i = 0; i < spans.length; ++i) { + var span = spans[i]; + if ((span.from == null || span.from <= pos.ch) && + (span.to == null || span.to >= pos.ch)) + markers.push(span.marker.parent || span.marker); + } + return markers; + }, + getAllMarks: function() { + var markers = []; + this.iter(function(line) { + var sps = line.markedSpans; + if (sps) for (var i = 0; i < sps.length; ++i) + if (sps[i].from != null) markers.push(sps[i].marker); + }); + return markers; + }, + + posFromIndex: function(off) { + var ch, lineNo = this.first; + this.iter(function(line) { + var sz = line.text.length + 1; + if (sz > off) { ch = off; return true; } + off -= sz; + ++lineNo; + }); + return clipPos(this, Pos(lineNo, ch)); + }, + indexFromPos: function (coords) { + coords = clipPos(this, coords); + var index = coords.ch; + if (coords.line < this.first || coords.ch < 0) return 0; + this.iter(this.first, coords.line, function (line) { + index += line.text.length + 1; + }); + return index; + }, + + copy: function(copyHistory) { + var doc = new Doc(getLines(this, this.first, this.first + this.size), this.modeOption, this.first); + doc.scrollTop = this.scrollTop; doc.scrollLeft = this.scrollLeft; + doc.sel = {from: this.sel.from, to: this.sel.to, head: this.sel.head, anchor: this.sel.anchor, + shift: this.sel.shift, extend: false, goalColumn: this.sel.goalColumn}; + if (copyHistory) { + doc.history.undoDepth = this.history.undoDepth; + doc.setHistory(this.getHistory()); + } + return doc; + }, + + linkedDoc: function(options) { + if (!options) options = {}; + var from = this.first, to = this.first + this.size; + if (options.from != null && options.from > from) from = options.from; + if (options.to != null && options.to < to) to = options.to; + var copy = new Doc(getLines(this, from, to), options.mode || this.modeOption, from); + if (options.sharedHist) copy.history = this.history; + (this.linked || (this.linked = [])).push({doc: copy, sharedHist: options.sharedHist}); + copy.linked = [{doc: this, isParent: true, sharedHist: options.sharedHist}]; + return copy; + }, + unlinkDoc: function(other) { + if (other instanceof CodeMirror) other = other.doc; + if (this.linked) for (var i = 0; i < this.linked.length; ++i) { + var link = this.linked[i]; + if (link.doc != other) continue; + this.linked.splice(i, 1); + other.unlinkDoc(this); + break; + } + // If the histories were shared, split them again + if (other.history == this.history) { + var splitIds = [other.id]; + linkedDocs(other, function(doc) {splitIds.push(doc.id);}, true); + other.history = makeHistory(); + other.history.done = copyHistoryArray(this.history.done, splitIds); + other.history.undone = copyHistoryArray(this.history.undone, splitIds); + } + }, + iterLinkedDocs: function(f) {linkedDocs(this, f);}, + + getMode: function() {return this.mode;}, + getEditor: function() {return this.cm;} + }); + + Doc.prototype.eachLine = Doc.prototype.iter; + + // The Doc methods that should be available on CodeMirror instances + var dontDelegate = "iter insert remove copy getEditor".split(" "); + for (var prop in Doc.prototype) if (Doc.prototype.hasOwnProperty(prop) && indexOf(dontDelegate, prop) < 0) + CodeMirror.prototype[prop] = (function(method) { + return function() {return method.apply(this.doc, arguments);}; + })(Doc.prototype[prop]); + + function linkedDocs(doc, f, sharedHistOnly) { + function propagate(doc, skip, sharedHist) { + if (doc.linked) for (var i = 0; i < doc.linked.length; ++i) { + var rel = doc.linked[i]; + if (rel.doc == skip) continue; + var shared = sharedHist && rel.sharedHist; + if (sharedHistOnly && !shared) continue; + f(rel.doc, shared); + propagate(rel.doc, doc, shared); + } + } + propagate(doc, null, true); + } + + function attachDoc(cm, doc) { + if (doc.cm) throw new Error("This document is already in use."); + cm.doc = doc; + doc.cm = cm; + estimateLineHeights(cm); + loadMode(cm); + if (!cm.options.lineWrapping) computeMaxLength(cm); + cm.options.mode = doc.modeOption; + regChange(cm); + } + + // LINE UTILITIES + + function getLine(chunk, n) { + n -= chunk.first; + while (!chunk.lines) { + for (var i = 0;; ++i) { + var child = chunk.children[i], sz = child.chunkSize(); + if (n < sz) { chunk = child; break; } + n -= sz; + } + } + return chunk.lines[n]; + } + + function getBetween(doc, start, end) { + var out = [], n = start.line; + doc.iter(start.line, end.line + 1, function(line) { + var text = line.text; + if (n == end.line) text = text.slice(0, end.ch); + if (n == start.line) text = text.slice(start.ch); + out.push(text); + ++n; + }); + return out; + } + function getLines(doc, from, to) { + var out = []; + doc.iter(from, to, function(line) { out.push(line.text); }); + return out; + } + + function updateLineHeight(line, height) { + var diff = height - line.height; + for (var n = line; n; n = n.parent) n.height += diff; + } + + function lineNo(line) { + if (line.parent == null) return null; + var cur = line.parent, no = indexOf(cur.lines, line); + for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) { + for (var i = 0;; ++i) { + if (chunk.children[i] == cur) break; + no += chunk.children[i].chunkSize(); + } + } + return no + cur.first; + } + + function lineAtHeight(chunk, h) { + var n = chunk.first; + outer: do { + for (var i = 0, e = chunk.children.length; i < e; ++i) { + var child = chunk.children[i], ch = child.height; + if (h < ch) { chunk = child; continue outer; } + h -= ch; + n += child.chunkSize(); + } + return n; + } while (!chunk.lines); + for (var i = 0, e = chunk.lines.length; i < e; ++i) { + var line = chunk.lines[i], lh = line.height; + if (h < lh) break; + h -= lh; + } + return n + i; + } + + function heightAtLine(cm, lineObj) { + lineObj = visualLine(cm.doc, lineObj); + + var h = 0, chunk = lineObj.parent; + for (var i = 0; i < chunk.lines.length; ++i) { + var line = chunk.lines[i]; + if (line == lineObj) break; + else h += line.height; + } + for (var p = chunk.parent; p; chunk = p, p = chunk.parent) { + for (var i = 0; i < p.children.length; ++i) { + var cur = p.children[i]; + if (cur == chunk) break; + else h += cur.height; + } + } + return h; + } + + function getOrder(line) { + var order = line.order; + if (order == null) order = line.order = bidiOrdering(line.text); + return order; + } + + // HISTORY + + function makeHistory() { + return { + // Arrays of history events. Doing something adds an event to + // done and clears undo. Undoing moves events from done to + // undone, redoing moves them in the other direction. + done: [], undone: [], undoDepth: Infinity, + // Used to track when changes can be merged into a single undo + // event + lastTime: 0, lastOp: null, lastOrigin: null, + // Used by the isClean() method + dirtyCounter: 0 + }; + } + + function attachLocalSpans(doc, change, from, to) { + var existing = change["spans_" + doc.id], n = 0; + doc.iter(Math.max(doc.first, from), Math.min(doc.first + doc.size, to), function(line) { + if (line.markedSpans) + (existing || (existing = change["spans_" + doc.id] = {}))[n] = line.markedSpans; + ++n; + }); + } + + function historyChangeFromChange(doc, change) { + var histChange = {from: change.from, to: changeEnd(change), text: getBetween(doc, change.from, change.to)}; + attachLocalSpans(doc, histChange, change.from.line, change.to.line + 1); + linkedDocs(doc, function(doc) {attachLocalSpans(doc, histChange, change.from.line, change.to.line + 1);}, true); + return histChange; + } + + function addToHistory(doc, change, selAfter, opId) { + var hist = doc.history; + hist.undone.length = 0; + var time = +new Date, cur = lst(hist.done); + + if (cur && + (hist.lastOp == opId || + hist.lastOrigin == change.origin && change.origin && + ((change.origin.charAt(0) == "+" && doc.cm && hist.lastTime > time - doc.cm.options.historyEventDelay) || + change.origin.charAt(0) == "*"))) { + // Merge this change into the last event + var last = lst(cur.changes); + if (posEq(change.from, change.to) && posEq(change.from, last.to)) { + // Optimized case for simple insertion -- don't want to add + // new changesets for every character typed + last.to = changeEnd(change); + } else { + // Add new sub-event + cur.changes.push(historyChangeFromChange(doc, change)); + } + cur.anchorAfter = selAfter.anchor; cur.headAfter = selAfter.head; + } else { + // Can not be merged, start a new event. + cur = {changes: [historyChangeFromChange(doc, change)], + anchorBefore: doc.sel.anchor, headBefore: doc.sel.head, + anchorAfter: selAfter.anchor, headAfter: selAfter.head}; + hist.done.push(cur); + while (hist.done.length > hist.undoDepth) + hist.done.shift(); + if (hist.dirtyCounter < 0) + // The user has made a change after undoing past the last clean state. + // We can never get back to a clean state now until markClean() is called. + hist.dirtyCounter = NaN; + else + hist.dirtyCounter++; + } + hist.lastTime = time; + hist.lastOp = opId; + hist.lastOrigin = change.origin; + } + + function removeClearedSpans(spans) { + if (!spans) return null; + for (var i = 0, out; i < spans.length; ++i) { + if (spans[i].marker.explicitlyCleared) { if (!out) out = spans.slice(0, i); } + else if (out) out.push(spans[i]); + } + return !out ? spans : out.length ? out : null; + } + + function getOldSpans(doc, change) { + var found = change["spans_" + doc.id]; + if (!found) return null; + for (var i = 0, nw = []; i < change.text.length; ++i) + nw.push(removeClearedSpans(found[i])); + return nw; + } + + // Used both to provide a JSON-safe object in .getHistory, and, when + // detaching a document, to split the history in two + function copyHistoryArray(events, newGroup) { + for (var i = 0, copy = []; i < events.length; ++i) { + var event = events[i], changes = event.changes, newChanges = []; + copy.push({changes: newChanges, anchorBefore: event.anchorBefore, headBefore: event.headBefore, + anchorAfter: event.anchorAfter, headAfter: event.headAfter}); + for (var j = 0; j < changes.length; ++j) { + var change = changes[j], m; + newChanges.push({from: change.from, to: change.to, text: change.text}); + if (newGroup) for (var prop in change) if (m = prop.match(/^spans_(\d+)$/)) { + if (indexOf(newGroup, Number(m[1])) > -1) { + lst(newChanges)[prop] = change[prop]; + delete change[prop]; + } + } + } + } + return copy; + } + + // Rebasing/resetting history to deal with externally-sourced changes + + function rebaseHistSel(pos, from, to, diff) { + if (to < pos.line) { + pos.line += diff; + } else if (from < pos.line) { + pos.line = from; + pos.ch = 0; + } + } + + // Tries to rebase an array of history events given a change in the + // document. If the change touches the same lines as the event, the + // event, and everything 'behind' it, is discarded. If the change is + // before the event, the event's positions are updated. Uses a + // copy-on-write scheme for the positions, to avoid having to + // reallocate them all on every rebase, but also avoid problems with + // shared position objects being unsafely updated. + function rebaseHistArray(array, from, to, diff) { + for (var i = 0; i < array.length; ++i) { + var sub = array[i], ok = true; + for (var j = 0; j < sub.changes.length; ++j) { + var cur = sub.changes[j]; + if (!sub.copied) { cur.from = copyPos(cur.from); cur.to = copyPos(cur.to); } + if (to < cur.from.line) { + cur.from.line += diff; + cur.to.line += diff; + } else if (from <= cur.to.line) { + ok = false; + break; + } + } + if (!sub.copied) { + sub.anchorBefore = copyPos(sub.anchorBefore); sub.headBefore = copyPos(sub.headBefore); + sub.anchorAfter = copyPos(sub.anchorAfter); sub.readAfter = copyPos(sub.headAfter); + sub.copied = true; + } + if (!ok) { + array.splice(0, i + 1); + i = 0; + } else { + rebaseHistSel(sub.anchorBefore); rebaseHistSel(sub.headBefore); + rebaseHistSel(sub.anchorAfter); rebaseHistSel(sub.headAfter); + } + } + } + + function rebaseHist(hist, change) { + var from = change.from.line, to = change.to.line, diff = change.text.length - (to - from) - 1; + rebaseHistArray(hist.done, from, to, diff); + rebaseHistArray(hist.undone, from, to, diff); + } + + // EVENT OPERATORS + + function stopMethod() {e_stop(this);} + // Ensure an event has a stop method. + function addStop(event) { + if (!event.stop) event.stop = stopMethod; + return event; + } + + function e_preventDefault(e) { + if (e.preventDefault) e.preventDefault(); + else e.returnValue = false; + } + function e_stopPropagation(e) { + if (e.stopPropagation) e.stopPropagation(); + else e.cancelBubble = true; + } + function e_stop(e) {e_preventDefault(e); e_stopPropagation(e);} + CodeMirror.e_stop = e_stop; + CodeMirror.e_preventDefault = e_preventDefault; + CodeMirror.e_stopPropagation = e_stopPropagation; + + function e_target(e) {return e.target || e.srcElement;} + function e_button(e) { + var b = e.which; + if (b == null) { + if (e.button & 1) b = 1; + else if (e.button & 2) b = 3; + else if (e.button & 4) b = 2; + } + if (mac && e.ctrlKey && b == 1) b = 3; + return b; + } + + // EVENT HANDLING + + function on(emitter, type, f) { + if (emitter.addEventListener) + emitter.addEventListener(type, f, false); + else if (emitter.attachEvent) + emitter.attachEvent("on" + type, f); + else { + var map = emitter._handlers || (emitter._handlers = {}); + var arr = map[type] || (map[type] = []); + arr.push(f); + } + } + + function off(emitter, type, f) { + if (emitter.removeEventListener) + emitter.removeEventListener(type, f, false); + else if (emitter.detachEvent) + emitter.detachEvent("on" + type, f); + else { + var arr = emitter._handlers && emitter._handlers[type]; + if (!arr) return; + for (var i = 0; i < arr.length; ++i) + if (arr[i] == f) { arr.splice(i, 1); break; } + } + } + + function signal(emitter, type /*, values...*/) { + var arr = emitter._handlers && emitter._handlers[type]; + if (!arr) return; + var args = Array.prototype.slice.call(arguments, 2); + for (var i = 0; i < arr.length; ++i) arr[i].apply(null, args); + } + + var delayedCallbacks, delayedCallbackDepth = 0; + function signalLater(emitter, type /*, values...*/) { + var arr = emitter._handlers && emitter._handlers[type]; + if (!arr) return; + var args = Array.prototype.slice.call(arguments, 2); + if (!delayedCallbacks) { + ++delayedCallbackDepth; + delayedCallbacks = []; + setTimeout(fireDelayed, 0); + } + function bnd(f) {return function(){f.apply(null, args);};}; + for (var i = 0; i < arr.length; ++i) + delayedCallbacks.push(bnd(arr[i])); + } + + function fireDelayed() { + --delayedCallbackDepth; + var delayed = delayedCallbacks; + delayedCallbacks = null; + for (var i = 0; i < delayed.length; ++i) delayed[i](); + } + + function hasHandler(emitter, type) { + var arr = emitter._handlers && emitter._handlers[type]; + return arr && arr.length > 0; + } + + CodeMirror.on = on; CodeMirror.off = off; CodeMirror.signal = signal; + + // MISC UTILITIES + + // Number of pixels added to scroller and sizer to hide scrollbar + var scrollerCutOff = 30; + + // Returned or thrown by various protocols to signal 'I'm not + // handling this'. + var Pass = CodeMirror.Pass = {toString: function(){return "CodeMirror.Pass";}}; + + function Delayed() {this.id = null;} + Delayed.prototype = {set: function(ms, f) {clearTimeout(this.id); this.id = setTimeout(f, ms);}}; + + // Counts the column offset in a string, taking tabs into account. + // Used mostly to find indentation. + function countColumn(string, end, tabSize, startIndex, startValue) { + if (end == null) { + end = string.search(/[^\s\u00a0]/); + if (end == -1) end = string.length; + } + for (var i = startIndex || 0, n = startValue || 0; i < end; ++i) { + if (string.charAt(i) == "\t") n += tabSize - (n % tabSize); + else ++n; + } + return n; + } + CodeMirror.countColumn = countColumn; + + var spaceStrs = [""]; + function spaceStr(n) { + while (spaceStrs.length <= n) + spaceStrs.push(lst(spaceStrs) + " "); + return spaceStrs[n]; + } + + function lst(arr) { return arr[arr.length-1]; } + + function selectInput(node) { + if (ios) { // Mobile Safari apparently has a bug where select() is broken. + node.selectionStart = 0; + node.selectionEnd = node.value.length; + } else node.select(); + } + + function indexOf(collection, elt) { + if (collection.indexOf) return collection.indexOf(elt); + for (var i = 0, e = collection.length; i < e; ++i) + if (collection[i] == elt) return i; + return -1; + } + + function createObj(base, props) { + function Obj() {} + Obj.prototype = base; + var inst = new Obj(); + if (props) copyObj(props, inst); + return inst; + } + + function copyObj(obj, target) { + if (!target) target = {}; + for (var prop in obj) if (obj.hasOwnProperty(prop)) target[prop] = obj[prop]; + return target; + } + + function emptyArray(size) { + for (var a = [], i = 0; i < size; ++i) a.push(undefined); + return a; + } + + function bind(f) { + var args = Array.prototype.slice.call(arguments, 1); + return function(){return f.apply(null, args);}; + } + + var nonASCIISingleCaseWordChar = /[\u3040-\u309f\u30a0-\u30ff\u3400-\u4db5\u4e00-\u9fcc]/; + function isWordChar(ch) { + return /\w/.test(ch) || ch > "\x80" && + (ch.toUpperCase() != ch.toLowerCase() || nonASCIISingleCaseWordChar.test(ch)); + } + + function isEmpty(obj) { + for (var n in obj) if (obj.hasOwnProperty(n) && obj[n]) return false; + return true; + } + + var isExtendingChar = /[\u0300-\u036F\u0483-\u0487\u0488-\u0489\u0591-\u05BD\u05BF\u05C1-\u05C2\u05C4-\u05C5\u05C7\u0610-\u061A\u064B-\u065F\u0670\u06D6-\u06DC\u06DF-\u06E4\u06E7-\u06E8\u06EA-\u06ED\uA66F\uA670-\uA672\uA674-\uA67D\uA69F\udc00-\udfff]/; + + // DOM UTILITIES + + function elt(tag, content, className, style) { + var e = document.createElement(tag); + if (className) e.className = className; + if (style) e.style.cssText = style; + if (typeof content == "string") setTextContent(e, content); + else if (content) for (var i = 0; i < content.length; ++i) e.appendChild(content[i]); + return e; + } + + function removeChildren(e) { + for (var count = e.childNodes.length; count > 0; --count) + e.removeChild(e.firstChild); + return e; + } + + function removeChildrenAndAdd(parent, e) { + return removeChildren(parent).appendChild(e); + } + + function setTextContent(e, str) { + if (ie_lt9) { + e.innerHTML = ""; + e.appendChild(document.createTextNode(str)); + } else e.textContent = str; + } + + function getRect(node) { + return node.getBoundingClientRect(); + } + CodeMirror.replaceGetRect = function(f) { getRect = f; }; + + // FEATURE DETECTION + + // Detect drag-and-drop + var dragAndDrop = function() { + // There is *some* kind of drag-and-drop support in IE6-8, but I + // couldn't get it to work yet. + if (ie_lt9) return false; + var div = elt('div'); + return "draggable" in div || "dragDrop" in div; + }(); + + // For a reason I have yet to figure out, some browsers disallow + // word wrapping between certain characters *only* if a new inline + // element is started between them. This makes it hard to reliably + // measure the position of things, since that requires inserting an + // extra span. This terribly fragile set of regexps matches the + // character combinations that suffer from this phenomenon on the + // various browsers. + var spanAffectsWrapping = /^$/; // Won't match any two-character string + if (gecko) spanAffectsWrapping = /$'/; + else if (safari && !/Version\/([6-9]|\d\d)\b/.test(navigator.userAgent)) spanAffectsWrapping = /\-[^ \-?]|\?[^ !'\"\),.\-\/:;\?\]\}]/; + else if (webkit) spanAffectsWrapping = /[~!#%&*)=+}\]|\"\.>,:;][({[<]|-[^\-?\.]|\?[\w~`@#$%\^&*(_=+{[|><]/; + + var knownScrollbarWidth; + function scrollbarWidth(measure) { + if (knownScrollbarWidth != null) return knownScrollbarWidth; + var test = elt("div", null, null, "width: 50px; height: 50px; overflow-x: scroll"); + removeChildrenAndAdd(measure, test); + if (test.offsetWidth) + knownScrollbarWidth = test.offsetHeight - test.clientHeight; + return knownScrollbarWidth || 0; + } + + var zwspSupported; + function zeroWidthElement(measure) { + if (zwspSupported == null) { + var test = elt("span", "\u200b"); + removeChildrenAndAdd(measure, elt("span", [test, document.createTextNode("x")])); + if (measure.firstChild.offsetHeight != 0) + zwspSupported = test.offsetWidth <= 1 && test.offsetHeight > 2 && !ie_lt8; + } + if (zwspSupported) return elt("span", "\u200b"); + else return elt("span", "\u00a0", null, "display: inline-block; width: 1px; margin-right: -1px"); + } + + // See if "".split is the broken IE version, if so, provide an + // alternative way to split lines. + var splitLines = "\n\nb".split(/\n/).length != 3 ? function(string) { + var pos = 0, result = [], l = string.length; + while (pos <= l) { + var nl = string.indexOf("\n", pos); + if (nl == -1) nl = string.length; + var line = string.slice(pos, string.charAt(nl - 1) == "\r" ? nl - 1 : nl); + var rt = line.indexOf("\r"); + if (rt != -1) { + result.push(line.slice(0, rt)); + pos += rt + 1; + } else { + result.push(line); + pos = nl + 1; + } + } + return result; + } : function(string){return string.split(/\r\n?|\n/);}; + CodeMirror.splitLines = splitLines; + + var hasSelection = window.getSelection ? function(te) { + try { return te.selectionStart != te.selectionEnd; } + catch(e) { return false; } + } : function(te) { + try {var range = te.ownerDocument.selection.createRange();} + catch(e) {} + if (!range || range.parentElement() != te) return false; + return range.compareEndPoints("StartToEnd", range) != 0; + }; + + var hasCopyEvent = (function() { + var e = elt("div"); + if ("oncopy" in e) return true; + e.setAttribute("oncopy", "return;"); + return typeof e.oncopy == 'function'; + })(); + + // KEY NAMING + + var keyNames = {3: "Enter", 8: "Backspace", 9: "Tab", 13: "Enter", 16: "Shift", 17: "Ctrl", 18: "Alt", + 19: "Pause", 20: "CapsLock", 27: "Esc", 32: "Space", 33: "PageUp", 34: "PageDown", 35: "End", + 36: "Home", 37: "Left", 38: "Up", 39: "Right", 40: "Down", 44: "PrintScrn", 45: "Insert", + 46: "Delete", 59: ";", 91: "Mod", 92: "Mod", 93: "Mod", 109: "-", 107: "=", 127: "Delete", + 186: ";", 187: "=", 188: ",", 189: "-", 190: ".", 191: "/", 192: "`", 219: "[", 220: "\\", + 221: "]", 222: "'", 63276: "PageUp", 63277: "PageDown", 63275: "End", 63273: "Home", + 63234: "Left", 63232: "Up", 63235: "Right", 63233: "Down", 63302: "Insert", 63272: "Delete"}; + CodeMirror.keyNames = keyNames; + (function() { + // Number keys + for (var i = 0; i < 10; i++) keyNames[i + 48] = String(i); + // Alphabetic keys + for (var i = 65; i <= 90; i++) keyNames[i] = String.fromCharCode(i); + // Function keys + for (var i = 1; i <= 12; i++) keyNames[i + 111] = keyNames[i + 63235] = "F" + i; + })(); + + // BIDI HELPERS + + function iterateBidiSections(order, from, to, f) { + if (!order) return f(from, to, "ltr"); + for (var i = 0; i < order.length; ++i) { + var part = order[i]; + if (part.from < to && part.to > from || from == to && part.to == from) + f(Math.max(part.from, from), Math.min(part.to, to), part.level == 1 ? "rtl" : "ltr"); + } + } + + function bidiLeft(part) { return part.level % 2 ? part.to : part.from; } + function bidiRight(part) { return part.level % 2 ? part.from : part.to; } + + function lineLeft(line) { var order = getOrder(line); return order ? bidiLeft(order[0]) : 0; } + function lineRight(line) { + var order = getOrder(line); + if (!order) return line.text.length; + return bidiRight(lst(order)); + } + + function lineStart(cm, lineN) { + var line = getLine(cm.doc, lineN); + var visual = visualLine(cm.doc, line); + if (visual != line) lineN = lineNo(visual); + var order = getOrder(visual); + var ch = !order ? 0 : order[0].level % 2 ? lineRight(visual) : lineLeft(visual); + return Pos(lineN, ch); + } + function lineEnd(cm, lineN) { + var merged, line; + while (merged = collapsedSpanAtEnd(line = getLine(cm.doc, lineN))) + lineN = merged.find().to.line; + var order = getOrder(line); + var ch = !order ? line.text.length : order[0].level % 2 ? lineLeft(line) : lineRight(line); + return Pos(lineN, ch); + } + + // This is somewhat involved. It is needed in order to move + // 'visually' through bi-directional text -- i.e., pressing left + // should make the cursor go left, even when in RTL text. The + // tricky part is the 'jumps', where RTL and LTR text touch each + // other. This often requires the cursor offset to move more than + // one unit, in order to visually move one unit. + function moveVisually(line, start, dir, byUnit) { + var bidi = getOrder(line); + if (!bidi) return moveLogically(line, start, dir, byUnit); + var moveOneUnit = byUnit ? function(pos, dir) { + do pos += dir; + while (pos > 0 && isExtendingChar.test(line.text.charAt(pos))); + return pos; + } : function(pos, dir) { return pos + dir; }; + var linedir = bidi[0].level; + for (var i = 0; i < bidi.length; ++i) { + var part = bidi[i], sticky = part.level % 2 == linedir; + if ((part.from < start && part.to > start) || + (sticky && (part.from == start || part.to == start))) break; + } + var target = moveOneUnit(start, part.level % 2 ? -dir : dir); + + while (target != null) { + if (part.level % 2 == linedir) { + if (target < part.from || target > part.to) { + part = bidi[i += dir]; + target = part && (dir > 0 == part.level % 2 ? moveOneUnit(part.to, -1) : moveOneUnit(part.from, 1)); + } else break; + } else { + if (target == bidiLeft(part)) { + part = bidi[--i]; + target = part && bidiRight(part); + } else if (target == bidiRight(part)) { + part = bidi[++i]; + target = part && bidiLeft(part); + } else break; + } + } + + return target < 0 || target > line.text.length ? null : target; + } + + function moveLogically(line, start, dir, byUnit) { + var target = start + dir; + if (byUnit) while (target > 0 && isExtendingChar.test(line.text.charAt(target))) target += dir; + return target < 0 || target > line.text.length ? null : target; + } + + // Bidirectional ordering algorithm + // See http://unicode.org/reports/tr9/tr9-13.html for the algorithm + // that this (partially) implements. + + // One-char codes used for character types: + // L (L): Left-to-Right + // R (R): Right-to-Left + // r (AL): Right-to-Left Arabic + // 1 (EN): European Number + // + (ES): European Number Separator + // % (ET): European Number Terminator + // n (AN): Arabic Number + // , (CS): Common Number Separator + // m (NSM): Non-Spacing Mark + // b (BN): Boundary Neutral + // s (B): Paragraph Separator + // t (S): Segment Separator + // w (WS): Whitespace + // N (ON): Other Neutrals + + // Returns null if characters are ordered as they appear + // (left-to-right), or an array of sections ({from, to, level} + // objects) in the order in which they occur visually. + var bidiOrdering = (function() { + // Character types for codepoints 0 to 0xff + var lowTypes = "bbbbbbbbbtstwsbbbbbbbbbbbbbbssstwNN%%%NNNNNN,N,N1111111111NNNNNNNLLLLLLLLLLLLLLLLLLLLLLLLLLNNNNNNLLLLLLLLLLLLLLLLLLLLLLLLLLNNNNbbbbbbsbbbbbbbbbbbbbbbbbbbbbbbbbb,N%%%%NNNNLNNNNN%%11NLNNN1LNNNNNLLLLLLLLLLLLLLLLLLLLLLLNLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLNLLLLLLLL"; + // Character types for codepoints 0x600 to 0x6ff + var arabicTypes = "rrrrrrrrrrrr,rNNmmmmmmrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrmmmmmmmmmmmmmmrrrrrrrnnnnnnnnnn%nnrrrmrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrmmmmmmmmmmmmmmmmmmmNmmmmrrrrrrrrrrrrrrrrrr"; + function charType(code) { + if (code <= 0xff) return lowTypes.charAt(code); + else if (0x590 <= code && code <= 0x5f4) return "R"; + else if (0x600 <= code && code <= 0x6ff) return arabicTypes.charAt(code - 0x600); + else if (0x700 <= code && code <= 0x8ac) return "r"; + else return "L"; + } + + var bidiRE = /[\u0590-\u05f4\u0600-\u06ff\u0700-\u08ac]/; + var isNeutral = /[stwN]/, isStrong = /[LRr]/, countsAsLeft = /[Lb1n]/, countsAsNum = /[1n]/; + // Browsers seem to always treat the boundaries of block elements as being L. + var outerType = "L"; + + return function(str) { + if (!bidiRE.test(str)) return false; + var len = str.length, types = []; + for (var i = 0, type; i < len; ++i) + types.push(type = charType(str.charCodeAt(i))); + + // W1. Examine each non-spacing mark (NSM) in the level run, and + // change the type of the NSM to the type of the previous + // character. If the NSM is at the start of the level run, it will + // get the type of sor. + for (var i = 0, prev = outerType; i < len; ++i) { + var type = types[i]; + if (type == "m") types[i] = prev; + else prev = type; + } + + // W2. Search backwards from each instance of a European number + // until the first strong type (R, L, AL, or sor) is found. If an + // AL is found, change the type of the European number to Arabic + // number. + // W3. Change all ALs to R. + for (var i = 0, cur = outerType; i < len; ++i) { + var type = types[i]; + if (type == "1" && cur == "r") types[i] = "n"; + else if (isStrong.test(type)) { cur = type; if (type == "r") types[i] = "R"; } + } + + // W4. A single European separator between two European numbers + // changes to a European number. A single common separator between + // two numbers of the same type changes to that type. + for (var i = 1, prev = types[0]; i < len - 1; ++i) { + var type = types[i]; + if (type == "+" && prev == "1" && types[i+1] == "1") types[i] = "1"; + else if (type == "," && prev == types[i+1] && + (prev == "1" || prev == "n")) types[i] = prev; + prev = type; + } + + // W5. A sequence of European terminators adjacent to European + // numbers changes to all European numbers. + // W6. Otherwise, separators and terminators change to Other + // Neutral. + for (var i = 0; i < len; ++i) { + var type = types[i]; + if (type == ",") types[i] = "N"; + else if (type == "%") { + for (var end = i + 1; end < len && types[end] == "%"; ++end) {} + var replace = (i && types[i-1] == "!") || (end < len - 1 && types[end] == "1") ? "1" : "N"; + for (var j = i; j < end; ++j) types[j] = replace; + i = end - 1; + } + } + + // W7. Search backwards from each instance of a European number + // until the first strong type (R, L, or sor) is found. If an L is + // found, then change the type of the European number to L. + for (var i = 0, cur = outerType; i < len; ++i) { + var type = types[i]; + if (cur == "L" && type == "1") types[i] = "L"; + else if (isStrong.test(type)) cur = type; + } + + // N1. A sequence of neutrals takes the direction of the + // surrounding strong text if the text on both sides has the same + // direction. European and Arabic numbers act as if they were R in + // terms of their influence on neutrals. Start-of-level-run (sor) + // and end-of-level-run (eor) are used at level run boundaries. + // N2. Any remaining neutrals take the embedding direction. + for (var i = 0; i < len; ++i) { + if (isNeutral.test(types[i])) { + for (var end = i + 1; end < len && isNeutral.test(types[end]); ++end) {} + var before = (i ? types[i-1] : outerType) == "L"; + var after = (end < len - 1 ? types[end] : outerType) == "L"; + var replace = before || after ? "L" : "R"; + for (var j = i; j < end; ++j) types[j] = replace; + i = end - 1; + } + } + + // Here we depart from the documented algorithm, in order to avoid + // building up an actual levels array. Since there are only three + // levels (0, 1, 2) in an implementation that doesn't take + // explicit embedding into account, we can build up the order on + // the fly, without following the level-based algorithm. + var order = [], m; + for (var i = 0; i < len;) { + if (countsAsLeft.test(types[i])) { + var start = i; + for (++i; i < len && countsAsLeft.test(types[i]); ++i) {} + order.push({from: start, to: i, level: 0}); + } else { + var pos = i, at = order.length; + for (++i; i < len && types[i] != "L"; ++i) {} + for (var j = pos; j < i;) { + if (countsAsNum.test(types[j])) { + if (pos < j) order.splice(at, 0, {from: pos, to: j, level: 1}); + var nstart = j; + for (++j; j < i && countsAsNum.test(types[j]); ++j) {} + order.splice(at, 0, {from: nstart, to: j, level: 2}); + pos = j; + } else ++j; + } + if (pos < i) order.splice(at, 0, {from: pos, to: i, level: 1}); + } + } + if (order[0].level == 1 && (m = str.match(/^\s+/))) { + order[0].from = m[0].length; + order.unshift({from: 0, to: m[0].length, level: 0}); + } + if (lst(order).level == 1 && (m = str.match(/\s+$/))) { + lst(order).to -= m[0].length; + order.push({from: len - m[0].length, to: len, level: 0}); + } + if (order[0].level != lst(order).level) + order.push({from: len, to: len, level: order[0].level}); + + return order; + }; + })(); + + // THE END + + CodeMirror.version = "3.12"; + + return CodeMirror; +})(); diff --git a/modules/files/views/default/assets/mode/apl/apl.js b/modules/files/views/default/assets/mode/apl/apl.js new file mode 100755 index 0000000..5c23af8 --- /dev/null +++ b/modules/files/views/default/assets/mode/apl/apl.js @@ -0,0 +1,160 @@ +CodeMirror.defineMode("apl", function() { + var builtInOps = { + ".": "innerProduct", + "\\": "scan", + "/": "reduce", + "⌿": "reduce1Axis", + "⍀": "scan1Axis", + "¨": "each", + "⍣": "power" + }; + var builtInFuncs = { + "+": ["conjugate", "add"], + "−": ["negate", "subtract"], + "×": ["signOf", "multiply"], + "÷": ["reciprocal", "divide"], + "⌈": ["ceiling", "greaterOf"], + "⌊": ["floor", "lesserOf"], + "∣": ["absolute", "residue"], + "⍳": ["indexGenerate", "indexOf"], + "?": ["roll", "deal"], + "⋆": ["exponentiate", "toThePowerOf"], + "⍟": ["naturalLog", "logToTheBase"], + "○": ["piTimes", "circularFuncs"], + "!": ["factorial", "binomial"], + "⌹": ["matrixInverse", "matrixDivide"], + "<": [null, "lessThan"], + "≤": [null, "lessThanOrEqual"], + "=": [null, "equals"], + ">": [null, "greaterThan"], + "≥": [null, "greaterThanOrEqual"], + "≠": [null, "notEqual"], + "≡": ["depth", "match"], + "≢": [null, "notMatch"], + "∈": ["enlist", "membership"], + "⍷": [null, "find"], + "∪": ["unique", "union"], + "∩": [null, "intersection"], + "∼": ["not", "without"], + "∨": [null, "or"], + "∧": [null, "and"], + "⍱": [null, "nor"], + "⍲": [null, "nand"], + "⍴": ["shapeOf", "reshape"], + ",": ["ravel", "catenate"], + "⍪": [null, "firstAxisCatenate"], + "⌽": ["reverse", "rotate"], + "⊖": ["axis1Reverse", "axis1Rotate"], + "⍉": ["transpose", null], + "↑": ["first", "take"], + "↓": [null, "drop"], + "⊂": ["enclose", "partitionWithAxis"], + "⊃": ["diclose", "pick"], + "⌷": [null, "index"], + "⍋": ["gradeUp", null], + "⍒": ["gradeDown", null], + "⊤": ["encode", null], + "⊥": ["decode", null], + "⍕": ["format", "formatByExample"], + "⍎": ["execute", null], + "⊣": ["stop", "left"], + "⊢": ["pass", "right"] + }; + + var isOperator = /[\.\/⌿⍀¨⍣]/; + var isNiladic = /⍬/; + var isFunction = /[\+−×÷⌈⌊∣⍳\?⋆⍟○!⌹<≤=>≥≠≡≢∈⍷∪∩∼∨∧⍱⍲⍴,⍪⌽⊖⍉↑↓⊂⊃⌷⍋⍒⊤⊥⍕⍎⊣⊢]/; + var isArrow = /←/; + var isComment = /[⍝#].*$/; + + var stringEater = function(type) { + var prev; + prev = false; + return function(c) { + prev = c; + if (c === type) { + return prev === "\\"; + } + return true; + }; + }; + return { + startState: function() { + return { + prev: false, + func: false, + op: false, + string: false, + escape: false + }; + }, + token: function(stream, state) { + var ch, funcName, word; + if (stream.eatSpace()) { + return null; + } + ch = stream.next(); + if (ch === '"' || ch === "'") { + stream.eatWhile(stringEater(ch)); + stream.next(); + state.prev = true; + return "string"; + } + if (/[\[{\(]/.test(ch)) { + state.prev = false; + return null; + } + if (/[\]}\)]/.test(ch)) { + state.prev = true; + return null; + } + if (isNiladic.test(ch)) { + state.prev = false; + return "niladic"; + } + if (/[¯\d]/.test(ch)) { + if (state.func) { + state.func = false; + state.prev = false; + } else { + state.prev = true; + } + stream.eatWhile(/[\w\.]/); + return "number"; + } + if (isOperator.test(ch)) { + return "operator apl-" + builtInOps[ch]; + } + if (isArrow.test(ch)) { + return "apl-arrow"; + } + if (isFunction.test(ch)) { + funcName = "apl-"; + if (builtInFuncs[ch] != null) { + if (state.prev) { + funcName += builtInFuncs[ch][1]; + } else { + funcName += builtInFuncs[ch][0]; + } + } + state.func = true; + state.prev = false; + return "function " + funcName; + } + if (isComment.test(ch)) { + stream.skipToEnd(); + return "comment"; + } + if (ch === "∘" && stream.peek() === ".") { + stream.next(); + return "function jot-dot"; + } + stream.eatWhile(/[\w\$_]/); + word = stream.current(); + state.prev = true; + return "keyword"; + } + }; +}); + +CodeMirror.defineMIME("text/apl", "apl"); diff --git a/modules/files/views/default/assets/mode/apl/index.html b/modules/files/views/default/assets/mode/apl/index.html new file mode 100755 index 0000000..119ff17 --- /dev/null +++ b/modules/files/views/default/assets/mode/apl/index.html @@ -0,0 +1,61 @@ + + + + + CodeMirror: APL mode + + + + + + + + +

      CodeMirror: APL mode

      + +
      + + + +

      Simple mode that tries to handle APL as well as it can.

      +

      It attempts to label functions/operators based upon + monadic/dyadic usage (but this is far from fully fleshed out). + This means there are meaningful classnames so hover states can + have popups etc.

      + +

      MIME types defined: text/apl (APL code)

      + + diff --git a/modules/files/views/default/assets/mode/asterisk/asterisk.js b/modules/files/views/default/assets/mode/asterisk/asterisk.js new file mode 100755 index 0000000..60b689d --- /dev/null +++ b/modules/files/views/default/assets/mode/asterisk/asterisk.js @@ -0,0 +1,183 @@ +/* + * ===================================================================================== + * + * Filename: mode/asterisk/asterisk.js + * + * Description: CodeMirror mode for Asterisk dialplan + * + * Created: 05/17/2012 09:20:25 PM + * Revision: none + * + * Author: Stas Kobzar (stas@modulis.ca), + * Company: Modulis.ca Inc. + * + * ===================================================================================== + */ + +CodeMirror.defineMode("asterisk", function() { + var atoms = ["exten", "same", "include","ignorepat","switch"], + dpcmd = ["#include","#exec"], + apps = [ + "addqueuemember","adsiprog","aelsub","agentlogin","agentmonitoroutgoing","agi", + "alarmreceiver","amd","answer","authenticate","background","backgrounddetect", + "bridge","busy","callcompletioncancel","callcompletionrequest","celgenuserevent", + "changemonitor","chanisavail","channelredirect","chanspy","clearhash","confbridge", + "congestion","continuewhile","controlplayback","dahdiacceptr2call","dahdibarge", + "dahdiras","dahdiscan","dahdisendcallreroutingfacility","dahdisendkeypadfacility", + "datetime","dbdel","dbdeltree","deadagi","dial","dictate","directory","disa", + "dumpchan","eagi","echo","endwhile","exec","execif","execiftime","exitwhile","extenspy", + "externalivr","festival","flash","followme","forkcdr","getcpeid","gosub","gosubif", + "goto","gotoif","gotoiftime","hangup","iax2provision","ices","importvar","incomplete", + "ivrdemo","jabberjoin","jabberleave","jabbersend","jabbersendgroup","jabberstatus", + "jack","log","macro","macroexclusive","macroexit","macroif","mailboxexists","meetme", + "meetmeadmin","meetmechanneladmin","meetmecount","milliwatt","minivmaccmess","minivmdelete", + "minivmgreet","minivmmwi","minivmnotify","minivmrecord","mixmonitor","monitor","morsecode", + "mp3player","mset","musiconhold","nbscat","nocdr","noop","odbc","odbc","odbcfinish", + "originate","ospauth","ospfinish","osplookup","ospnext","page","park","parkandannounce", + "parkedcall","pausemonitor","pausequeuemember","pickup","pickupchan","playback","playtones", + "privacymanager","proceeding","progress","queue","queuelog","raiseexception","read","readexten", + "readfile","receivefax","receivefax","receivefax","record","removequeuemember", + "resetcdr","retrydial","return","ringing","sayalpha","saycountedadj","saycountednoun", + "saycountpl","saydigits","saynumber","sayphonetic","sayunixtime","senddtmf","sendfax", + "sendfax","sendfax","sendimage","sendtext","sendurl","set","setamaflags", + "setcallerpres","setmusiconhold","sipaddheader","sipdtmfmode","sipremoveheader","skel", + "slastation","slatrunk","sms","softhangup","speechactivategrammar","speechbackground", + "speechcreate","speechdeactivategrammar","speechdestroy","speechloadgrammar","speechprocessingsound", + "speechstart","speechunloadgrammar","stackpop","startmusiconhold","stopmixmonitor","stopmonitor", + "stopmusiconhold","stopplaytones","system","testclient","testserver","transfer","tryexec", + "trysystem","unpausemonitor","unpausequeuemember","userevent","verbose","vmauthenticate", + "vmsayname","voicemail","voicemailmain","wait","waitexten","waitfornoise","waitforring", + "waitforsilence","waitmusiconhold","waituntil","while","zapateller" + ]; + + function basicToken(stream,state){ + var cur = ''; + var ch = ''; + ch = stream.next(); + // comment + if(ch == ";") { + stream.skipToEnd(); + return "comment"; + } + // context + if(ch == '[') { + stream.skipTo(']'); + stream.eat(']'); + return "header"; + } + // string + if(ch == '"') { + stream.skipTo('"'); + return "string"; + } + if(ch == "'") { + stream.skipTo("'"); + return "string-2"; + } + // dialplan commands + if(ch == '#') { + stream.eatWhile(/\w/); + cur = stream.current(); + if(dpcmd.indexOf(cur) !== -1) { + stream.skipToEnd(); + return "strong"; + } + } + // application args + if(ch == '$'){ + var ch1 = stream.peek(); + if(ch1 == '{'){ + stream.skipTo('}'); + stream.eat('}'); + return "variable-3"; + } + } + // extension + stream.eatWhile(/\w/); + cur = stream.current(); + if(atoms.indexOf(cur) !== -1) { + state.extenStart = true; + switch(cur) { + case 'same': state.extenSame = true; break; + case 'include': + case 'switch': + case 'ignorepat': + state.extenInclude = true;break; + default:break; + } + return "atom"; + } + } + + return { + startState: function() { + return { + extenStart: false, + extenSame: false, + extenInclude: false, + extenExten: false, + extenPriority: false, + extenApplication: false + }; + }, + token: function(stream, state) { + + var cur = ''; + var ch = ''; + if(stream.eatSpace()) return null; + // extension started + if(state.extenStart){ + stream.eatWhile(/[^\s]/); + cur = stream.current(); + if(/^=>?$/.test(cur)){ + state.extenExten = true; + state.extenStart = false; + return "strong"; + } else { + state.extenStart = false; + stream.skipToEnd(); + return "error"; + } + } else if(state.extenExten) { + // set exten and priority + state.extenExten = false; + state.extenPriority = true; + stream.eatWhile(/[^,]/); + if(state.extenInclude) { + stream.skipToEnd(); + state.extenPriority = false; + state.extenInclude = false; + } + if(state.extenSame) { + state.extenPriority = false; + state.extenSame = false; + state.extenApplication = true; + } + return "tag"; + } else if(state.extenPriority) { + state.extenPriority = false; + state.extenApplication = true; + ch = stream.next(); // get comma + if(state.extenSame) return null; + stream.eatWhile(/[^,]/); + return "number"; + } else if(state.extenApplication) { + stream.eatWhile(/,/); + cur = stream.current(); + if(cur === ',') return null; + stream.eatWhile(/\w/); + cur = stream.current().toLowerCase(); + state.extenApplication = false; + if(apps.indexOf(cur) !== -1){ + return "def strong"; + } + } else{ + return basicToken(stream,state); + } + + return null; + } + }; +}); + +CodeMirror.defineMIME("text/x-asterisk", "asterisk"); diff --git a/modules/files/views/default/assets/mode/asterisk/index.html b/modules/files/views/default/assets/mode/asterisk/index.html new file mode 100755 index 0000000..0a796a0 --- /dev/null +++ b/modules/files/views/default/assets/mode/asterisk/index.html @@ -0,0 +1,142 @@ + + + + + CodeMirror: Asterisk dialplan mode + + + + + + + +

      CodeMirror: Asterisk dialplan mode

      +
      + + +

      MIME types defined: text/x-asterisk.

      + + + diff --git a/modules/files/views/default/assets/mode/clike/clike.js b/modules/files/views/default/assets/mode/clike/clike.js new file mode 100755 index 0000000..c14d7b4 --- /dev/null +++ b/modules/files/views/default/assets/mode/clike/clike.js @@ -0,0 +1,302 @@ +CodeMirror.defineMode("clike", function(config, parserConfig) { + var indentUnit = config.indentUnit, + statementIndentUnit = parserConfig.statementIndentUnit || indentUnit, + dontAlignCalls = parserConfig.dontAlignCalls, + keywords = parserConfig.keywords || {}, + builtin = parserConfig.builtin || {}, + blockKeywords = parserConfig.blockKeywords || {}, + atoms = parserConfig.atoms || {}, + hooks = parserConfig.hooks || {}, + multiLineStrings = parserConfig.multiLineStrings; + var isOperatorChar = /[+\-*&%=<>!?|\/]/; + + var curPunc; + + function tokenBase(stream, state) { + var ch = stream.next(); + if (hooks[ch]) { + var result = hooks[ch](stream, state); + if (result !== false) return result; + } + if (ch == '"' || ch == "'") { + state.tokenize = tokenString(ch); + return state.tokenize(stream, state); + } + if (/[\[\]{}\(\),;\:\.]/.test(ch)) { + curPunc = ch; + return null; + } + if (/\d/.test(ch)) { + stream.eatWhile(/[\w\.]/); + return "number"; + } + if (ch == "/") { + if (stream.eat("*")) { + state.tokenize = tokenComment; + return tokenComment(stream, state); + } + if (stream.eat("/")) { + stream.skipToEnd(); + return "comment"; + } + } + if (isOperatorChar.test(ch)) { + stream.eatWhile(isOperatorChar); + return "operator"; + } + stream.eatWhile(/[\w\$_]/); + var cur = stream.current(); + if (keywords.propertyIsEnumerable(cur)) { + if (blockKeywords.propertyIsEnumerable(cur)) curPunc = "newstatement"; + return "keyword"; + } + if (builtin.propertyIsEnumerable(cur)) { + if (blockKeywords.propertyIsEnumerable(cur)) curPunc = "newstatement"; + return "builtin"; + } + if (atoms.propertyIsEnumerable(cur)) return "atom"; + return "variable"; + } + + function tokenString(quote) { + return function(stream, state) { + var escaped = false, next, end = false; + while ((next = stream.next()) != null) { + if (next == quote && !escaped) {end = true; break;} + escaped = !escaped && next == "\\"; + } + if (end || !(escaped || multiLineStrings)) + state.tokenize = null; + return "string"; + }; + } + + function tokenComment(stream, state) { + var maybeEnd = false, ch; + while (ch = stream.next()) { + if (ch == "/" && maybeEnd) { + state.tokenize = null; + break; + } + maybeEnd = (ch == "*"); + } + return "comment"; + } + + function Context(indented, column, type, align, prev) { + this.indented = indented; + this.column = column; + this.type = type; + this.align = align; + this.prev = prev; + } + function pushContext(state, col, type) { + var indent = state.indented; + if (state.context && state.context.type == "statement") + indent = state.context.indented; + return state.context = new Context(indent, col, type, null, state.context); + } + function popContext(state) { + var t = state.context.type; + if (t == ")" || t == "]" || t == "}") + state.indented = state.context.indented; + return state.context = state.context.prev; + } + + // Interface + + return { + startState: function(basecolumn) { + return { + tokenize: null, + context: new Context((basecolumn || 0) - indentUnit, 0, "top", false), + indented: 0, + startOfLine: true + }; + }, + + token: function(stream, state) { + var ctx = state.context; + if (stream.sol()) { + if (ctx.align == null) ctx.align = false; + state.indented = stream.indentation(); + state.startOfLine = true; + } + if (stream.eatSpace()) return null; + curPunc = null; + var style = (state.tokenize || tokenBase)(stream, state); + if (style == "comment" || style == "meta") return style; + if (ctx.align == null) ctx.align = true; + + if ((curPunc == ";" || curPunc == ":" || curPunc == ",") && ctx.type == "statement") popContext(state); + else if (curPunc == "{") pushContext(state, stream.column(), "}"); + else if (curPunc == "[") pushContext(state, stream.column(), "]"); + else if (curPunc == "(") pushContext(state, stream.column(), ")"); + else if (curPunc == "}") { + while (ctx.type == "statement") ctx = popContext(state); + if (ctx.type == "}") ctx = popContext(state); + while (ctx.type == "statement") ctx = popContext(state); + } + else if (curPunc == ctx.type) popContext(state); + else if (((ctx.type == "}" || ctx.type == "top") && curPunc != ';') || (ctx.type == "statement" && curPunc == "newstatement")) + pushContext(state, stream.column(), "statement"); + state.startOfLine = false; + return style; + }, + + indent: function(state, textAfter) { + if (state.tokenize != tokenBase && state.tokenize != null) return CodeMirror.Pass; + var ctx = state.context, firstChar = textAfter && textAfter.charAt(0); + if (ctx.type == "statement" && firstChar == "}") ctx = ctx.prev; + var closing = firstChar == ctx.type; + if (ctx.type == "statement") return ctx.indented + (firstChar == "{" ? 0 : statementIndentUnit); + else if (dontAlignCalls && ctx.type == ")" && !closing) return ctx.indented + statementIndentUnit; + else if (ctx.align) return ctx.column + (closing ? 0 : 1); + else return ctx.indented + (closing ? 0 : indentUnit); + }, + + electricChars: "{}" + }; +}); + +(function() { + function words(str) { + var obj = {}, words = str.split(" "); + for (var i = 0; i < words.length; ++i) obj[words[i]] = true; + return obj; + } + var cKeywords = "auto if break int case long char register continue return default short do sizeof " + + "double static else struct entry switch extern typedef float union for unsigned " + + "goto while enum void const signed volatile"; + + function cppHook(stream, state) { + if (!state.startOfLine) return false; + for (;;) { + if (stream.skipTo("\\")) { + stream.next(); + if (stream.eol()) { + state.tokenize = cppHook; + break; + } + } else { + stream.skipToEnd(); + state.tokenize = null; + break; + } + } + return "meta"; + } + + // C#-style strings where "" escapes a quote. + function tokenAtString(stream, state) { + var next; + while ((next = stream.next()) != null) { + if (next == '"' && !stream.eat('"')) { + state.tokenize = null; + break; + } + } + return "string"; + } + + function mimes(ms, mode) { + for (var i = 0; i < ms.length; ++i) CodeMirror.defineMIME(ms[i], mode); + } + + mimes(["text/x-csrc", "text/x-c", "text/x-chdr"], { + name: "clike", + keywords: words(cKeywords), + blockKeywords: words("case do else for if switch while struct"), + atoms: words("null"), + hooks: {"#": cppHook} + }); + mimes(["text/x-c++src", "text/x-c++hdr"], { + name: "clike", + keywords: words(cKeywords + " asm dynamic_cast namespace reinterpret_cast try bool explicit new " + + "static_cast typeid catch operator template typename class friend private " + + "this using const_cast inline public throw virtual delete mutable protected " + + "wchar_t"), + blockKeywords: words("catch class do else finally for if struct switch try while"), + atoms: words("true false null"), + hooks: {"#": cppHook} + }); + CodeMirror.defineMIME("text/x-java", { + name: "clike", + keywords: words("abstract assert boolean break byte case catch char class const continue default " + + "do double else enum extends final finally float for goto if implements import " + + "instanceof int interface long native new package private protected public " + + "return short static strictfp super switch synchronized this throw throws transient " + + "try void volatile while"), + blockKeywords: words("catch class do else finally for if switch try while"), + atoms: words("true false null"), + hooks: { + "@": function(stream) { + stream.eatWhile(/[\w\$_]/); + return "meta"; + } + } + }); + CodeMirror.defineMIME("text/x-csharp", { + name: "clike", + keywords: words("abstract as base break case catch checked class const continue" + + " default delegate do else enum event explicit extern finally fixed for" + + " foreach goto if implicit in interface internal is lock namespace new" + + " operator out override params private protected public readonly ref return sealed" + + " sizeof stackalloc static struct switch this throw try typeof unchecked" + + " unsafe using virtual void volatile while add alias ascending descending dynamic from get" + + " global group into join let orderby partial remove select set value var yield"), + blockKeywords: words("catch class do else finally for foreach if struct switch try while"), + builtin: words("Boolean Byte Char DateTime DateTimeOffset Decimal Double" + + " Guid Int16 Int32 Int64 Object SByte Single String TimeSpan UInt16 UInt32" + + " UInt64 bool byte char decimal double short int long object" + + " sbyte float string ushort uint ulong"), + atoms: words("true false null"), + hooks: { + "@": function(stream, state) { + if (stream.eat('"')) { + state.tokenize = tokenAtString; + return tokenAtString(stream, state); + } + stream.eatWhile(/[\w\$_]/); + return "meta"; + } + } + }); + CodeMirror.defineMIME("text/x-scala", { + name: "clike", + keywords: words( + + /* scala */ + "abstract case catch class def do else extends false final finally for forSome if " + + "implicit import lazy match new null object override package private protected return " + + "sealed super this throw trait try trye type val var while with yield _ : = => <- <: " + + "<% >: # @ " + + + /* package scala */ + "assert assume require print println printf readLine readBoolean readByte readShort " + + "readChar readInt readLong readFloat readDouble " + + + "AnyVal App Application Array BufferedIterator BigDecimal BigInt Char Console Either " + + "Enumeration Equiv Error Exception Fractional Function IndexedSeq Integral Iterable " + + "Iterator List Map Numeric Nil NotNull Option Ordered Ordering PartialFunction PartialOrdering " + + "Product Proxy Range Responder Seq Serializable Set Specializable Stream StringBuilder " + + "StringContext Symbol Throwable Traversable TraversableOnce Tuple Unit Vector :: #:: " + + + /* package java.lang */ + "Boolean Byte Character CharSequence Class ClassLoader Cloneable Comparable " + + "Compiler Double Exception Float Integer Long Math Number Object Package Pair Process " + + "Runtime Runnable SecurityManager Short StackTraceElement StrictMath String " + + "StringBuffer System Thread ThreadGroup ThreadLocal Throwable Triple Void" + + + ), + blockKeywords: words("catch class do else finally for forSome if match switch try while"), + atoms: words("true false null"), + hooks: { + "@": function(stream) { + stream.eatWhile(/[\w\$_]/); + return "meta"; + } + } + }); +}()); diff --git a/modules/files/views/default/assets/mode/clike/index.html b/modules/files/views/default/assets/mode/clike/index.html new file mode 100755 index 0000000..5f90394 --- /dev/null +++ b/modules/files/views/default/assets/mode/clike/index.html @@ -0,0 +1,103 @@ + + + + + CodeMirror: C-like mode + + + + + + + + +

      CodeMirror: C-like mode

      + +
      + + + +

      Simple mode that tries to handle C-like languages as well as it + can. Takes two configuration parameters: keywords, an + object whose property names are the keywords in the language, + and useCPP, which determines whether C preprocessor + directives are recognized.

      + +

      MIME types defined: text/x-csrc + (C code), text/x-c++src (C++ + code), text/x-java (Java + code), text/x-csharp (C#).

      + + diff --git a/modules/files/views/default/assets/mode/clike/scala.html b/modules/files/views/default/assets/mode/clike/scala.html new file mode 100755 index 0000000..f3c7eea --- /dev/null +++ b/modules/files/views/default/assets/mode/clike/scala.html @@ -0,0 +1,767 @@ + + + + + CodeMirror: C-like mode + + + + + + + + + +
      + + + + + + diff --git a/modules/files/views/default/assets/mode/clojure/clojure.js b/modules/files/views/default/assets/mode/clojure/clojure.js new file mode 100755 index 0000000..fae6754 --- /dev/null +++ b/modules/files/views/default/assets/mode/clojure/clojure.js @@ -0,0 +1,222 @@ +/** + * Author: Hans Engel + * Branched from CodeMirror's Scheme mode (by Koh Zi Han, based on implementation by Koh Zi Chun) + */ +CodeMirror.defineMode("clojure", function () { + var BUILTIN = "builtin", COMMENT = "comment", STRING = "string", CHARACTER = "string-2", + ATOM = "atom", NUMBER = "number", BRACKET = "bracket", KEYWORD = "keyword"; + var INDENT_WORD_SKIP = 2; + + function makeKeywords(str) { + var obj = {}, words = str.split(" "); + for (var i = 0; i < words.length; ++i) obj[words[i]] = true; + return obj; + } + + var atoms = makeKeywords("true false nil"); + + var keywords = makeKeywords( + "defn defn- def def- defonce defmulti defmethod defmacro defstruct deftype defprotocol defrecord defproject deftest slice defalias defhinted defmacro- defn-memo defnk defnk defonce- defunbound defunbound- defvar defvar- let letfn do case cond condp for loop recur when when-not when-let when-first if if-let if-not . .. -> ->> doto and or dosync doseq dotimes dorun doall load import unimport ns in-ns refer try catch finally throw with-open with-local-vars binding gen-class gen-and-load-class gen-and-save-class handler-case handle"); + + var builtins = makeKeywords( + "* *' *1 *2 *3 *agent* *allow-unresolved-vars* *assert* *clojure-version* *command-line-args* *compile-files* *compile-path* *compiler-options* *data-readers* *e *err* *file* *flush-on-newline* *fn-loader* *in* *math-context* *ns* *out* *print-dup* *print-length* *print-level* *print-meta* *print-readably* *read-eval* *source-path* *unchecked-math* *use-context-classloader* *verbose-defrecords* *warn-on-reflection* + +' - -' -> ->> ->ArrayChunk ->Vec ->VecNode ->VecSeq -cache-protocol-fn -reset-methods .. / < <= = == > >= EMPTY-NODE accessor aclone add-classpath add-watch agent agent-error agent-errors aget alength alias all-ns alter alter-meta! alter-var-root amap ancestors and apply areduce array-map aset aset-boolean aset-byte aset-char aset-double aset-float aset-int aset-long aset-short assert assoc assoc! assoc-in associative? atom await await-for await1 bases bean bigdec bigint biginteger binding bit-and bit-and-not bit-clear bit-flip bit-not bit-or bit-set bit-shift-left bit-shift-right bit-test bit-xor boolean boolean-array booleans bound-fn bound-fn* bound? butlast byte byte-array bytes case cast char char-array char-escape-string char-name-string char? chars chunk chunk-append chunk-buffer chunk-cons chunk-first chunk-next chunk-rest chunked-seq? class class? clear-agent-errors clojure-version coll? comment commute comp comparator compare compare-and-set! compile complement concat cond condp conj conj! cons constantly construct-proxy contains? count counted? create-ns create-struct cycle dec dec' decimal? declare default-data-readers definline definterface defmacro defmethod defmulti defn defn- defonce defprotocol defrecord defstruct deftype delay delay? deliver denominator deref derive descendants destructure disj disj! dissoc dissoc! distinct distinct? doall dorun doseq dosync dotimes doto double double-array doubles drop drop-last drop-while empty empty? ensure enumeration-seq error-handler error-mode eval even? every-pred every? ex-data ex-info extend extend-protocol extend-type extenders extends? false? ffirst file-seq filter filterv find find-keyword find-ns find-protocol-impl find-protocol-method find-var first flatten float float-array float? floats flush fn fn? fnext fnil for force format frequencies future future-call future-cancel future-cancelled? future-done? future? gen-class gen-interface gensym get get-in get-method get-proxy-class get-thread-bindings get-validator group-by hash hash-combine hash-map hash-set identical? identity if-let if-not ifn? import in-ns inc inc' init-proxy instance? int int-array integer? interleave intern interpose into into-array ints io! isa? iterate iterator-seq juxt keep keep-indexed key keys keyword keyword? last lazy-cat lazy-seq let letfn line-seq list list* list? load load-file load-reader load-string loaded-libs locking long long-array longs loop macroexpand macroexpand-1 make-array make-hierarchy map map-indexed map? mapcat mapv max max-key memfn memoize merge merge-with meta method-sig methods min min-key mod munge name namespace namespace-munge neg? newline next nfirst nil? nnext not not-any? not-empty not-every? not= ns ns-aliases ns-imports ns-interns ns-map ns-name ns-publics ns-refers ns-resolve ns-unalias ns-unmap nth nthnext nthrest num number? numerator object-array odd? or parents partial partition partition-all partition-by pcalls peek persistent! pmap pop pop! pop-thread-bindings pos? pr pr-str prefer-method prefers primitives-classnames print print-ctor print-dup print-method print-simple print-str printf println println-str prn prn-str promise proxy proxy-call-with-super proxy-mappings proxy-name proxy-super push-thread-bindings pvalues quot rand rand-int rand-nth range ratio? rational? rationalize re-find re-groups re-matcher re-matches re-pattern re-seq read read-line read-string realized? reduce reduce-kv reductions ref ref-history-count ref-max-history ref-min-history ref-set refer refer-clojure reify release-pending-sends rem remove remove-all-methods remove-method remove-ns remove-watch repeat repeatedly replace replicate require reset! reset-meta! resolve rest restart-agent resultset-seq reverse reversible? rseq rsubseq satisfies? second select-keys send send-off seq seq? seque sequence sequential? set set-error-handler! set-error-mode! set-validator! set? short short-array shorts shuffle shutdown-agents slurp some some-fn sort sort-by sorted-map sorted-map-by sorted-set sorted-set-by sorted? special-symbol? spit split-at split-with str string? struct struct-map subs subseq subvec supers swap! symbol symbol? sync take take-last take-nth take-while test the-ns thread-bound? time to-array to-array-2d trampoline transient tree-seq true? type unchecked-add unchecked-add-int unchecked-byte unchecked-char unchecked-dec unchecked-dec-int unchecked-divide-int unchecked-double unchecked-float unchecked-inc unchecked-inc-int unchecked-int unchecked-long unchecked-multiply unchecked-multiply-int unchecked-negate unchecked-negate-int unchecked-remainder-int unchecked-short unchecked-subtract unchecked-subtract-int underive unquote unquote-splicing update-in update-proxy use val vals var-get var-set var? vary-meta vec vector vector-of vector? when when-first when-let when-not while with-bindings with-bindings* with-in-str with-loading-context with-local-vars with-meta with-open with-out-str with-precision with-redefs with-redefs-fn xml-seq zero? zipmap *default-data-reader-fn* as-> cond-> cond->> reduced reduced? send-via set-agent-send-executor! set-agent-send-off-executor! some-> some->>"); + + var indentKeys = makeKeywords( + // Built-ins + "ns fn def defn defmethod bound-fn if if-not case condp when while when-not when-first do future comment doto locking proxy with-open with-precision reify deftype defrecord defprotocol extend extend-protocol extend-type try catch " + + + // Binding forms + "let letfn binding loop for doseq dotimes when-let if-let " + + + // Data structures + "defstruct struct-map assoc " + + + // clojure.test + "testing deftest " + + + // contrib + "handler-case handle dotrace deftrace"); + + var tests = { + digit: /\d/, + digit_or_colon: /[\d:]/, + hex: /[0-9a-f]/i, + sign: /[+-]/, + exponent: /e/i, + keyword_char: /[^\s\(\[\;\)\]]/, + symbol: /[\w*+!\-\._?:\/]/ + }; + + function stateStack(indent, type, prev) { // represents a state stack object + this.indent = indent; + this.type = type; + this.prev = prev; + } + + function pushStack(state, indent, type) { + state.indentStack = new stateStack(indent, type, state.indentStack); + } + + function popStack(state) { + state.indentStack = state.indentStack.prev; + } + + function isNumber(ch, stream){ + // hex + if ( ch === '0' && stream.eat(/x/i) ) { + stream.eatWhile(tests.hex); + return true; + } + + // leading sign + if ( ( ch == '+' || ch == '-' ) && ( tests.digit.test(stream.peek()) ) ) { + stream.eat(tests.sign); + ch = stream.next(); + } + + if ( tests.digit.test(ch) ) { + stream.eat(ch); + stream.eatWhile(tests.digit); + + if ( '.' == stream.peek() ) { + stream.eat('.'); + stream.eatWhile(tests.digit); + } + + if ( stream.eat(tests.exponent) ) { + stream.eat(tests.sign); + stream.eatWhile(tests.digit); + } + + return true; + } + + return false; + } + + // Eat character that starts after backslash \ + function eatCharacter(stream) { + var first = stream.next(); + // Read special literals: backspace, newline, space, return. + // Just read all lowercase letters. + if (first.match(/[a-z]/) && stream.match(/[a-z]+/, true)) { + return; + } + // Read unicode character: \u1000 \uA0a1 + if (first === "u") { + stream.match(/[0-9a-z]{4}/i, true); + } + } + + return { + startState: function () { + return { + indentStack: null, + indentation: 0, + mode: false + }; + }, + + token: function (stream, state) { + if (state.indentStack == null && stream.sol()) { + // update indentation, but only if indentStack is empty + state.indentation = stream.indentation(); + } + + // skip spaces + if (stream.eatSpace()) { + return null; + } + var returnType = null; + + switch(state.mode){ + case "string": // multi-line string parsing mode + var next, escaped = false; + while ((next = stream.next()) != null) { + if (next == "\"" && !escaped) { + + state.mode = false; + break; + } + escaped = !escaped && next == "\\"; + } + returnType = STRING; // continue on in string mode + break; + default: // default parsing mode + var ch = stream.next(); + + if (ch == "\"") { + state.mode = "string"; + returnType = STRING; + } else if (ch == "\\") { + eatCharacter(stream); + returnType = CHARACTER; + } else if (ch == "'" && !( tests.digit_or_colon.test(stream.peek()) )) { + returnType = ATOM; + } else if (ch == ";") { // comment + stream.skipToEnd(); // rest of the line is a comment + returnType = COMMENT; + } else if (isNumber(ch,stream)){ + returnType = NUMBER; + } else if (ch == "(" || ch == "[" || ch == "{" ) { + var keyWord = '', indentTemp = stream.column(), letter; + /** + Either + (indent-word .. + (non-indent-word .. + (;something else, bracket, etc. + */ + + if (ch == "(") while ((letter = stream.eat(tests.keyword_char)) != null) { + keyWord += letter; + } + + if (keyWord.length > 0 && (indentKeys.propertyIsEnumerable(keyWord) || + /^(?:def|with)/.test(keyWord))) { // indent-word + pushStack(state, indentTemp + INDENT_WORD_SKIP, ch); + } else { // non-indent word + // we continue eating the spaces + stream.eatSpace(); + if (stream.eol() || stream.peek() == ";") { + // nothing significant after + // we restart indentation 1 space after + pushStack(state, indentTemp + 1, ch); + } else { + pushStack(state, indentTemp + stream.current().length, ch); // else we match + } + } + stream.backUp(stream.current().length - 1); // undo all the eating + + returnType = BRACKET; + } else if (ch == ")" || ch == "]" || ch == "}") { + returnType = BRACKET; + if (state.indentStack != null && state.indentStack.type == (ch == ")" ? "(" : (ch == "]" ? "[" :"{"))) { + popStack(state); + } + } else if ( ch == ":" ) { + stream.eatWhile(tests.symbol); + return ATOM; + } else { + stream.eatWhile(tests.symbol); + + if (keywords && keywords.propertyIsEnumerable(stream.current())) { + returnType = KEYWORD; + } else if (builtins && builtins.propertyIsEnumerable(stream.current())) { + returnType = BUILTIN; + } else if (atoms && atoms.propertyIsEnumerable(stream.current())) { + returnType = ATOM; + } else returnType = null; + } + } + + return returnType; + }, + + indent: function (state) { + if (state.indentStack == null) return state.indentation; + return state.indentStack.indent; + } + }; +}); + +CodeMirror.defineMIME("text/x-clojure", "clojure"); diff --git a/modules/files/views/default/assets/mode/clojure/index.html b/modules/files/views/default/assets/mode/clojure/index.html new file mode 100755 index 0000000..bfe6fc9 --- /dev/null +++ b/modules/files/views/default/assets/mode/clojure/index.html @@ -0,0 +1,76 @@ + + + + + CodeMirror: Clojure mode + + + + + + + +

      CodeMirror: Clojure mode

      +
      + + +

      MIME types defined: text/x-clojure.

      + + + diff --git a/modules/files/views/default/assets/mode/coffeescript/LICENSE b/modules/files/views/default/assets/mode/coffeescript/LICENSE new file mode 100755 index 0000000..977e284 --- /dev/null +++ b/modules/files/views/default/assets/mode/coffeescript/LICENSE @@ -0,0 +1,22 @@ +The MIT License + +Copyright (c) 2011 Jeff Pickhardt +Modified from the Python CodeMirror mode, Copyright (c) 2010 Timothy Farrell + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. \ No newline at end of file diff --git a/modules/files/views/default/assets/mode/coffeescript/coffeescript.js b/modules/files/views/default/assets/mode/coffeescript/coffeescript.js new file mode 100755 index 0000000..cf1cf4f --- /dev/null +++ b/modules/files/views/default/assets/mode/coffeescript/coffeescript.js @@ -0,0 +1,346 @@ +/** + * Link to the project's GitHub page: + * https://github.com/pickhardt/coffeescript-codemirror-mode + */ +CodeMirror.defineMode('coffeescript', function(conf) { + var ERRORCLASS = 'error'; + + function wordRegexp(words) { + return new RegExp("^((" + words.join(")|(") + "))\\b"); + } + + var singleOperators = new RegExp("^[\\+\\-\\*/%&|\\^~<>!\?]"); + var singleDelimiters = new RegExp('^[\\(\\)\\[\\]\\{\\},:`=;\\.]'); + var doubleOperators = new RegExp("^((\->)|(\=>)|(\\+\\+)|(\\+\\=)|(\\-\\-)|(\\-\\=)|(\\*\\*)|(\\*\\=)|(\\/\\/)|(\\/\\=)|(==)|(!=)|(<=)|(>=)|(<>)|(<<)|(>>)|(//))"); + var doubleDelimiters = new RegExp("^((\\.\\.)|(\\+=)|(\\-=)|(\\*=)|(%=)|(/=)|(&=)|(\\|=)|(\\^=))"); + var tripleDelimiters = new RegExp("^((\\.\\.\\.)|(//=)|(>>=)|(<<=)|(\\*\\*=))"); + var identifiers = new RegExp("^[_A-Za-z$][_A-Za-z$0-9]*"); + var properties = new RegExp("^(@|this\.)[_A-Za-z$][_A-Za-z$0-9]*"); + + var wordOperators = wordRegexp(['and', 'or', 'not', + 'is', 'isnt', 'in', + 'instanceof', 'typeof']); + var indentKeywords = ['for', 'while', 'loop', 'if', 'unless', 'else', + 'switch', 'try', 'catch', 'finally', 'class']; + var commonKeywords = ['break', 'by', 'continue', 'debugger', 'delete', + 'do', 'in', 'of', 'new', 'return', 'then', + 'this', 'throw', 'when', 'until']; + + var keywords = wordRegexp(indentKeywords.concat(commonKeywords)); + + indentKeywords = wordRegexp(indentKeywords); + + + var stringPrefixes = new RegExp("^('{3}|\"{3}|['\"])"); + var regexPrefixes = new RegExp("^(/{3}|/)"); + var commonConstants = ['Infinity', 'NaN', 'undefined', 'null', 'true', 'false', 'on', 'off', 'yes', 'no']; + var constants = wordRegexp(commonConstants); + + // Tokenizers + function tokenBase(stream, state) { + // Handle scope changes + if (stream.sol()) { + var scopeOffset = state.scopes[0].offset; + if (stream.eatSpace()) { + var lineOffset = stream.indentation(); + if (lineOffset > scopeOffset) { + return 'indent'; + } else if (lineOffset < scopeOffset) { + return 'dedent'; + } + return null; + } else { + if (scopeOffset > 0) { + dedent(stream, state); + } + } + } + if (stream.eatSpace()) { + return null; + } + + var ch = stream.peek(); + + // Handle docco title comment (single line) + if (stream.match("####")) { + stream.skipToEnd(); + return 'comment'; + } + + // Handle multi line comments + if (stream.match("###")) { + state.tokenize = longComment; + return state.tokenize(stream, state); + } + + // Single line comment + if (ch === '#') { + stream.skipToEnd(); + return 'comment'; + } + + // Handle number literals + if (stream.match(/^-?[0-9\.]/, false)) { + var floatLiteral = false; + // Floats + if (stream.match(/^-?\d*\.\d+(e[\+\-]?\d+)?/i)) { + floatLiteral = true; + } + if (stream.match(/^-?\d+\.\d*/)) { + floatLiteral = true; + } + if (stream.match(/^-?\.\d+/)) { + floatLiteral = true; + } + + if (floatLiteral) { + // prevent from getting extra . on 1.. + if (stream.peek() == "."){ + stream.backUp(1); + } + return 'number'; + } + // Integers + var intLiteral = false; + // Hex + if (stream.match(/^-?0x[0-9a-f]+/i)) { + intLiteral = true; + } + // Decimal + if (stream.match(/^-?[1-9]\d*(e[\+\-]?\d+)?/)) { + intLiteral = true; + } + // Zero by itself with no other piece of number. + if (stream.match(/^-?0(?![\dx])/i)) { + intLiteral = true; + } + if (intLiteral) { + return 'number'; + } + } + + // Handle strings + if (stream.match(stringPrefixes)) { + state.tokenize = tokenFactory(stream.current(), 'string'); + return state.tokenize(stream, state); + } + // Handle regex literals + if (stream.match(regexPrefixes)) { + if (stream.current() != '/' || stream.match(/^.*\//, false)) { // prevent highlight of division + state.tokenize = tokenFactory(stream.current(), 'string-2'); + return state.tokenize(stream, state); + } else { + stream.backUp(1); + } + } + + // Handle operators and delimiters + if (stream.match(tripleDelimiters) || stream.match(doubleDelimiters)) { + return 'punctuation'; + } + if (stream.match(doubleOperators) + || stream.match(singleOperators) + || stream.match(wordOperators)) { + return 'operator'; + } + if (stream.match(singleDelimiters)) { + return 'punctuation'; + } + + if (stream.match(constants)) { + return 'atom'; + } + + if (stream.match(keywords)) { + return 'keyword'; + } + + if (stream.match(identifiers)) { + return 'variable'; + } + + if (stream.match(properties)) { + return 'property'; + } + + // Handle non-detected items + stream.next(); + return ERRORCLASS; + } + + function tokenFactory(delimiter, outclass) { + var singleline = delimiter.length == 1; + return function(stream, state) { + while (!stream.eol()) { + stream.eatWhile(/[^'"\/\\]/); + if (stream.eat('\\')) { + stream.next(); + if (singleline && stream.eol()) { + return outclass; + } + } else if (stream.match(delimiter)) { + state.tokenize = tokenBase; + return outclass; + } else { + stream.eat(/['"\/]/); + } + } + if (singleline) { + if (conf.mode.singleLineStringErrors) { + outclass = ERRORCLASS; + } else { + state.tokenize = tokenBase; + } + } + return outclass; + }; + } + + function longComment(stream, state) { + while (!stream.eol()) { + stream.eatWhile(/[^#]/); + if (stream.match("###")) { + state.tokenize = tokenBase; + break; + } + stream.eatWhile("#"); + } + return "comment"; + } + + function indent(stream, state, type) { + type = type || 'coffee'; + var indentUnit = 0; + if (type === 'coffee') { + for (var i = 0; i < state.scopes.length; i++) { + if (state.scopes[i].type === 'coffee') { + indentUnit = state.scopes[i].offset + conf.indentUnit; + break; + } + } + } else { + indentUnit = stream.column() + stream.current().length; + } + state.scopes.unshift({ + offset: indentUnit, + type: type + }); + } + + function dedent(stream, state) { + if (state.scopes.length == 1) return; + if (state.scopes[0].type === 'coffee') { + var _indent = stream.indentation(); + var _indent_index = -1; + for (var i = 0; i < state.scopes.length; ++i) { + if (_indent === state.scopes[i].offset) { + _indent_index = i; + break; + } + } + if (_indent_index === -1) { + return true; + } + while (state.scopes[0].offset !== _indent) { + state.scopes.shift(); + } + return false; + } else { + state.scopes.shift(); + return false; + } + } + + function tokenLexer(stream, state) { + var style = state.tokenize(stream, state); + var current = stream.current(); + + // Handle '.' connected identifiers + if (current === '.') { + style = state.tokenize(stream, state); + current = stream.current(); + if (style === 'variable') { + return 'variable'; + } else { + return ERRORCLASS; + } + } + + // Handle scope changes. + if (current === 'return') { + state.dedent += 1; + } + if (((current === '->' || current === '=>') && + !state.lambda && + state.scopes[0].type == 'coffee' && + stream.peek() === '') + || style === 'indent') { + indent(stream, state); + } + var delimiter_index = '[({'.indexOf(current); + if (delimiter_index !== -1) { + indent(stream, state, '])}'.slice(delimiter_index, delimiter_index+1)); + } + if (indentKeywords.exec(current)){ + indent(stream, state); + } + if (current == 'then'){ + dedent(stream, state); + } + + + if (style === 'dedent') { + if (dedent(stream, state)) { + return ERRORCLASS; + } + } + delimiter_index = '])}'.indexOf(current); + if (delimiter_index !== -1) { + if (dedent(stream, state)) { + return ERRORCLASS; + } + } + if (state.dedent > 0 && stream.eol() && state.scopes[0].type == 'coffee') { + if (state.scopes.length > 1) state.scopes.shift(); + state.dedent -= 1; + } + + return style; + } + + var external = { + startState: function(basecolumn) { + return { + tokenize: tokenBase, + scopes: [{offset:basecolumn || 0, type:'coffee'}], + lastToken: null, + lambda: false, + dedent: 0 + }; + }, + + token: function(stream, state) { + var style = tokenLexer(stream, state); + + state.lastToken = {style:style, content: stream.current()}; + + if (stream.eol() && stream.lambda) { + state.lambda = false; + } + + return style; + }, + + indent: function(state) { + if (state.tokenize != tokenBase) { + return 0; + } + + return state.scopes[0].offset; + } + + }; + return external; +}); + +CodeMirror.defineMIME('text/x-coffeescript', 'coffeescript'); diff --git a/modules/files/views/default/assets/mode/coffeescript/index.html b/modules/files/views/default/assets/mode/coffeescript/index.html new file mode 100755 index 0000000..ee72b8d --- /dev/null +++ b/modules/files/views/default/assets/mode/coffeescript/index.html @@ -0,0 +1,728 @@ + + + + + CodeMirror: CoffeeScript mode + + + + + + + +

      CodeMirror: CoffeeScript mode

      +
      + + +

      MIME types defined: text/x-coffeescript.

      + +

      The CoffeeScript mode was written by Jeff Pickhardt (license).

      + + + diff --git a/modules/files/views/default/assets/mode/commonlisp/commonlisp.js b/modules/files/views/default/assets/mode/commonlisp/commonlisp.js new file mode 100755 index 0000000..eeba759 --- /dev/null +++ b/modules/files/views/default/assets/mode/commonlisp/commonlisp.js @@ -0,0 +1,101 @@ +CodeMirror.defineMode("commonlisp", function (config) { + var assumeBody = /^with|^def|^do|^prog|case$|^cond$|bind$|when$|unless$/; + var numLiteral = /^(?:[+\-]?(?:\d+|\d*\.\d+)(?:[efd][+\-]?\d+)?|[+\-]?\d+(?:\/[+\-]?\d+)?|#b[+\-]?[01]+|#o[+\-]?[0-7]+|#x[+\-]?[\da-f]+)/; + var symbol = /[^\s'`,@()\[\]";]/; + var type; + + function readSym(stream) { + var ch; + while (ch = stream.next()) { + if (ch == "\\") stream.next(); + else if (!symbol.test(ch)) { stream.backUp(1); break; } + } + return stream.current(); + } + + function base(stream, state) { + if (stream.eatSpace()) {type = "ws"; return null;} + if (stream.match(numLiteral)) return "number"; + var ch = stream.next(); + if (ch == "\\") ch = stream.next(); + + if (ch == '"') return (state.tokenize = inString)(stream, state); + else if (ch == "(") { type = "open"; return "bracket"; } + else if (ch == ")" || ch == "]") { type = "close"; return "bracket"; } + else if (ch == ";") { stream.skipToEnd(); type = "ws"; return "comment"; } + else if (/['`,@]/.test(ch)) return null; + else if (ch == "|") { + if (stream.skipTo("|")) { stream.next(); return "symbol"; } + else { stream.skipToEnd(); return "error"; } + } else if (ch == "#") { + var ch = stream.next(); + if (ch == "[") { type = "open"; return "bracket"; } + else if (/[+\-=\.']/.test(ch)) return null; + else if (/\d/.test(ch) && stream.match(/^\d*#/)) return null; + else if (ch == "|") return (state.tokenize = inComment)(stream, state); + else if (ch == ":") { readSym(stream); return "meta"; } + else return "error"; + } else { + var name = readSym(stream); + if (name == ".") return null; + type = "symbol"; + if (name == "nil" || name == "t") return "atom"; + if (name.charAt(0) == ":") return "keyword"; + if (name.charAt(0) == "&") return "variable-2"; + return "variable"; + } + } + + function inString(stream, state) { + var escaped = false, next; + while (next = stream.next()) { + if (next == '"' && !escaped) { state.tokenize = base; break; } + escaped = !escaped && next == "\\"; + } + return "string"; + } + + function inComment(stream, state) { + var next, last; + while (next = stream.next()) { + if (next == "#" && last == "|") { state.tokenize = base; break; } + last = next; + } + type = "ws"; + return "comment"; + } + + return { + startState: function () { + return {ctx: {prev: null, start: 0, indentTo: 0}, tokenize: base}; + }, + + token: function (stream, state) { + if (stream.sol() && typeof state.ctx.indentTo != "number") + state.ctx.indentTo = state.ctx.start + 1; + + type = null; + var style = state.tokenize(stream, state); + if (type != "ws") { + if (state.ctx.indentTo == null) { + if (type == "symbol" && assumeBody.test(stream.current())) + state.ctx.indentTo = state.ctx.start + config.indentUnit; + else + state.ctx.indentTo = "next"; + } else if (state.ctx.indentTo == "next") { + state.ctx.indentTo = stream.column(); + } + } + if (type == "open") state.ctx = {prev: state.ctx, start: stream.column(), indentTo: null}; + else if (type == "close") state.ctx = state.ctx.prev || state.ctx; + return style; + }, + + indent: function (state, _textAfter) { + var i = state.ctx.indentTo; + return typeof i == "number" ? i : state.ctx.start + 1; + } + }; +}); + +CodeMirror.defineMIME("text/x-common-lisp", "commonlisp"); diff --git a/modules/files/views/default/assets/mode/commonlisp/index.html b/modules/files/views/default/assets/mode/commonlisp/index.html new file mode 100755 index 0000000..f9766a8 --- /dev/null +++ b/modules/files/views/default/assets/mode/commonlisp/index.html @@ -0,0 +1,165 @@ + + + + + CodeMirror: Common Lisp mode + + + + + + + +

      CodeMirror: Common Lisp mode

      +
      + + +

      MIME types defined: text/x-common-lisp.

      + + + diff --git a/modules/files/views/default/assets/mode/css/css.js b/modules/files/views/default/assets/mode/css/css.js new file mode 100755 index 0000000..1ef72b5 --- /dev/null +++ b/modules/files/views/default/assets/mode/css/css.js @@ -0,0 +1,567 @@ +CodeMirror.defineMode("css", function(config) { + return CodeMirror.getMode(config, "text/css"); +}); + +CodeMirror.defineMode("css-base", function(config, parserConfig) { + "use strict"; + + var indentUnit = config.indentUnit, + hooks = parserConfig.hooks || {}, + atMediaTypes = parserConfig.atMediaTypes || {}, + atMediaFeatures = parserConfig.atMediaFeatures || {}, + propertyKeywords = parserConfig.propertyKeywords || {}, + colorKeywords = parserConfig.colorKeywords || {}, + valueKeywords = parserConfig.valueKeywords || {}, + allowNested = !!parserConfig.allowNested, + type = null; + + function ret(style, tp) { type = tp; return style; } + + function tokenBase(stream, state) { + var ch = stream.next(); + if (hooks[ch]) { + // result[0] is style and result[1] is type + var result = hooks[ch](stream, state); + if (result !== false) return result; + } + if (ch == "@") {stream.eatWhile(/[\w\\\-]/); return ret("def", stream.current());} + else if (ch == "=") ret(null, "compare"); + else if ((ch == "~" || ch == "|") && stream.eat("=")) return ret(null, "compare"); + else if (ch == "\"" || ch == "'") { + state.tokenize = tokenString(ch); + return state.tokenize(stream, state); + } + else if (ch == "#") { + stream.eatWhile(/[\w\\\-]/); + return ret("atom", "hash"); + } + else if (ch == "!") { + stream.match(/^\s*\w*/); + return ret("keyword", "important"); + } + else if (/\d/.test(ch)) { + stream.eatWhile(/[\w.%]/); + return ret("number", "unit"); + } + else if (ch === "-") { + if (/\d/.test(stream.peek())) { + stream.eatWhile(/[\w.%]/); + return ret("number", "unit"); + } else if (stream.match(/^[^-]+-/)) { + return ret("meta", "meta"); + } + } + else if (/[,+>*\/]/.test(ch)) { + return ret(null, "select-op"); + } + else if (ch == "." && stream.match(/^-?[_a-z][_a-z0-9-]*/i)) { + return ret("qualifier", "qualifier"); + } + else if (ch == ":") { + return ret("operator", ch); + } + else if (/[;{}\[\]\(\)]/.test(ch)) { + return ret(null, ch); + } + else if (ch == "u" && stream.match("rl(")) { + stream.backUp(1); + state.tokenize = tokenParenthesized; + return ret("property", "variable"); + } + else { + stream.eatWhile(/[\w\\\-]/); + return ret("property", "variable"); + } + } + + function tokenString(quote, nonInclusive) { + return function(stream, state) { + var escaped = false, ch; + while ((ch = stream.next()) != null) { + if (ch == quote && !escaped) + break; + escaped = !escaped && ch == "\\"; + } + if (!escaped) { + if (nonInclusive) stream.backUp(1); + state.tokenize = tokenBase; + } + return ret("string", "string"); + }; + } + + function tokenParenthesized(stream, state) { + stream.next(); // Must be '(' + if (!stream.match(/\s*[\"\']/, false)) + state.tokenize = tokenString(")", true); + else + state.tokenize = tokenBase; + return ret(null, "("); + } + + return { + startState: function(base) { + return {tokenize: tokenBase, + baseIndent: base || 0, + stack: []}; + }, + + token: function(stream, state) { + + // Use these terms when applicable (see http://www.xanthir.com/blog/b4E50) + // + // rule** or **ruleset: + // A selector + braces combo, or an at-rule. + // + // declaration block: + // A sequence of declarations. + // + // declaration: + // A property + colon + value combo. + // + // property value: + // The entire value of a property. + // + // component value: + // A single piece of a property value. Like the 5px in + // text-shadow: 0 0 5px blue;. Can also refer to things that are + // multiple terms, like the 1-4 terms that make up the background-size + // portion of the background shorthand. + // + // term: + // The basic unit of author-facing CSS, like a single number (5), + // dimension (5px), string ("foo"), or function. Officially defined + // by the CSS 2.1 grammar (look for the 'term' production) + // + // + // simple selector: + // A single atomic selector, like a type selector, an attr selector, a + // class selector, etc. + // + // compound selector: + // One or more simple selectors without a combinator. div.example is + // compound, div > .example is not. + // + // complex selector: + // One or more compound selectors chained with combinators. + // + // combinator: + // The parts of selectors that express relationships. There are four + // currently - the space (descendant combinator), the greater-than + // bracket (child combinator), the plus sign (next sibling combinator), + // and the tilda (following sibling combinator). + // + // sequence of selectors: + // One or more of the named type of selector chained with commas. + + state.tokenize = state.tokenize || tokenBase; + if (state.tokenize == tokenBase && stream.eatSpace()) return null; + var style = state.tokenize(stream, state); + if (style && typeof style != "string") style = ret(style[0], style[1]); + + // Changing style returned based on context + var context = state.stack[state.stack.length-1]; + if (style == "variable") { + if (type == "variable-definition") state.stack.push("propertyValue"); + return "variable-2"; + } else if (style == "property") { + if (context == "propertyValue"){ + if (valueKeywords[stream.current()]) { + style = "string-2"; + } else if (colorKeywords[stream.current()]) { + style = "keyword"; + } else { + style = "variable-2"; + } + } else if (context == "rule") { + if (!propertyKeywords[stream.current()]) { + style += " error"; + } + } else if (context == "block") { + // if a value is present in both property, value, or color, the order + // of preference is property -> color -> value + if (propertyKeywords[stream.current()]) { + style = "property"; + } else if (colorKeywords[stream.current()]) { + style = "keyword"; + } else if (valueKeywords[stream.current()]) { + style = "string-2"; + } else { + style = "tag"; + } + } else if (!context || context == "@media{") { + style = "tag"; + } else if (context == "@media") { + if (atMediaTypes[stream.current()]) { + style = "attribute"; // Known attribute + } else if (/^(only|not)$/i.test(stream.current())) { + style = "keyword"; + } else if (stream.current().toLowerCase() == "and") { + style = "error"; // "and" is only allowed in @mediaType + } else if (atMediaFeatures[stream.current()]) { + style = "error"; // Known property, should be in @mediaType( + } else { + // Unknown, expecting keyword or attribute, assuming attribute + style = "attribute error"; + } + } else if (context == "@mediaType") { + if (atMediaTypes[stream.current()]) { + style = "attribute"; + } else if (stream.current().toLowerCase() == "and") { + style = "operator"; + } else if (/^(only|not)$/i.test(stream.current())) { + style = "error"; // Only allowed in @media + } else if (atMediaFeatures[stream.current()]) { + style = "error"; // Known property, should be in parentheses + } else { + // Unknown attribute or property, but expecting property (preceded + // by "and"). Should be in parentheses + style = "error"; + } + } else if (context == "@mediaType(") { + if (propertyKeywords[stream.current()]) { + // do nothing, remains "property" + } else if (atMediaTypes[stream.current()]) { + style = "error"; // Known property, should be in parentheses + } else if (stream.current().toLowerCase() == "and") { + style = "operator"; + } else if (/^(only|not)$/i.test(stream.current())) { + style = "error"; // Only allowed in @media + } else { + style += " error"; + } + } else { + style = "error"; + } + } else if (style == "atom") { + if(!context || context == "@media{" || context == "block") { + style = "builtin"; + } else if (context == "propertyValue") { + if (!/^#([0-9a-fA-f]{3}|[0-9a-fA-f]{6})$/.test(stream.current())) { + style += " error"; + } + } else { + style = "error"; + } + } else if (context == "@media" && type == "{") { + style = "error"; + } + + // Push/pop context stack + if (type == "{") { + if (context == "@media" || context == "@mediaType") { + state.stack.pop(); + state.stack[state.stack.length-1] = "@media{"; + } + else { + var newContext = allowNested ? "block" : "rule"; + state.stack.push(newContext); + } + } + else if (type == "}") { + var lastState = state.stack[state.stack.length - 1]; + if (lastState == "interpolation") style = "operator"; + state.stack.pop(); + if (context == "propertyValue") state.stack.pop(); + } + else if (type == "interpolation") state.stack.push("interpolation"); + else if (type == "@media") state.stack.push("@media"); + else if (context == "@media" && /\b(keyword|attribute)\b/.test(style)) + state.stack.push("@mediaType"); + else if (context == "@mediaType" && stream.current() == ",") state.stack.pop(); + else if (context == "@mediaType" && type == "(") state.stack.push("@mediaType("); + else if (context == "@mediaType(" && type == ")") state.stack.pop(); + else if ((context == "rule" || context == "block") && type == ":") state.stack.push("propertyValue"); + else if (context == "propertyValue" && type == ";") state.stack.pop(); + return style; + }, + + indent: function(state, textAfter) { + var n = state.stack.length; + if (/^\}/.test(textAfter)) + n -= state.stack[state.stack.length-1] == "propertyValue" ? 2 : 1; + return state.baseIndent + n * indentUnit; + }, + + electricChars: "}" + }; +}); + +(function() { + function keySet(array) { + var keys = {}; + for (var i = 0; i < array.length; ++i) { + keys[array[i]] = true; + } + return keys; + } + + var atMediaTypes = keySet([ + "all", "aural", "braille", "handheld", "print", "projection", "screen", + "tty", "tv", "embossed" + ]); + + var atMediaFeatures = keySet([ + "width", "min-width", "max-width", "height", "min-height", "max-height", + "device-width", "min-device-width", "max-device-width", "device-height", + "min-device-height", "max-device-height", "aspect-ratio", + "min-aspect-ratio", "max-aspect-ratio", "device-aspect-ratio", + "min-device-aspect-ratio", "max-device-aspect-ratio", "color", "min-color", + "max-color", "color-index", "min-color-index", "max-color-index", + "monochrome", "min-monochrome", "max-monochrome", "resolution", + "min-resolution", "max-resolution", "scan", "grid" + ]); + + var propertyKeywords = keySet([ + "align-content", "align-items", "align-self", "alignment-adjust", + "alignment-baseline", "anchor-point", "animation", "animation-delay", + "animation-direction", "animation-duration", "animation-iteration-count", + "animation-name", "animation-play-state", "animation-timing-function", + "appearance", "azimuth", "backface-visibility", "background", + "background-attachment", "background-clip", "background-color", + "background-image", "background-origin", "background-position", + "background-repeat", "background-size", "baseline-shift", "binding", + "bleed", "bookmark-label", "bookmark-level", "bookmark-state", + "bookmark-target", "border", "border-bottom", "border-bottom-color", + "border-bottom-left-radius", "border-bottom-right-radius", + "border-bottom-style", "border-bottom-width", "border-collapse", + "border-color", "border-image", "border-image-outset", + "border-image-repeat", "border-image-slice", "border-image-source", + "border-image-width", "border-left", "border-left-color", + "border-left-style", "border-left-width", "border-radius", "border-right", + "border-right-color", "border-right-style", "border-right-width", + "border-spacing", "border-style", "border-top", "border-top-color", + "border-top-left-radius", "border-top-right-radius", "border-top-style", + "border-top-width", "border-width", "bottom", "box-decoration-break", + "box-shadow", "box-sizing", "break-after", "break-before", "break-inside", + "caption-side", "clear", "clip", "color", "color-profile", "column-count", + "column-fill", "column-gap", "column-rule", "column-rule-color", + "column-rule-style", "column-rule-width", "column-span", "column-width", + "columns", "content", "counter-increment", "counter-reset", "crop", "cue", + "cue-after", "cue-before", "cursor", "direction", "display", + "dominant-baseline", "drop-initial-after-adjust", + "drop-initial-after-align", "drop-initial-before-adjust", + "drop-initial-before-align", "drop-initial-size", "drop-initial-value", + "elevation", "empty-cells", "fit", "fit-position", "flex", "flex-basis", + "flex-direction", "flex-flow", "flex-grow", "flex-shrink", "flex-wrap", + "float", "float-offset", "font", "font-feature-settings", "font-family", + "font-kerning", "font-language-override", "font-size", "font-size-adjust", + "font-stretch", "font-style", "font-synthesis", "font-variant", + "font-variant-alternates", "font-variant-caps", "font-variant-east-asian", + "font-variant-ligatures", "font-variant-numeric", "font-variant-position", + "font-weight", "grid-cell", "grid-column", "grid-column-align", + "grid-column-sizing", "grid-column-span", "grid-columns", "grid-flow", + "grid-row", "grid-row-align", "grid-row-sizing", "grid-row-span", + "grid-rows", "grid-template", "hanging-punctuation", "height", "hyphens", + "icon", "image-orientation", "image-rendering", "image-resolution", + "inline-box-align", "justify-content", "left", "letter-spacing", + "line-break", "line-height", "line-stacking", "line-stacking-ruby", + "line-stacking-shift", "line-stacking-strategy", "list-style", + "list-style-image", "list-style-position", "list-style-type", "margin", + "margin-bottom", "margin-left", "margin-right", "margin-top", + "marker-offset", "marks", "marquee-direction", "marquee-loop", + "marquee-play-count", "marquee-speed", "marquee-style", "max-height", + "max-width", "min-height", "min-width", "move-to", "nav-down", "nav-index", + "nav-left", "nav-right", "nav-up", "opacity", "order", "orphans", "outline", + "outline-color", "outline-offset", "outline-style", "outline-width", + "overflow", "overflow-style", "overflow-wrap", "overflow-x", "overflow-y", + "padding", "padding-bottom", "padding-left", "padding-right", "padding-top", + "page", "page-break-after", "page-break-before", "page-break-inside", + "page-policy", "pause", "pause-after", "pause-before", "perspective", + "perspective-origin", "pitch", "pitch-range", "play-during", "position", + "presentation-level", "punctuation-trim", "quotes", "rendering-intent", + "resize", "rest", "rest-after", "rest-before", "richness", "right", + "rotation", "rotation-point", "ruby-align", "ruby-overhang", + "ruby-position", "ruby-span", "size", "speak", "speak-as", "speak-header", + "speak-numeral", "speak-punctuation", "speech-rate", "stress", "string-set", + "tab-size", "table-layout", "target", "target-name", "target-new", + "target-position", "text-align", "text-align-last", "text-decoration", + "text-decoration-color", "text-decoration-line", "text-decoration-skip", + "text-decoration-style", "text-emphasis", "text-emphasis-color", + "text-emphasis-position", "text-emphasis-style", "text-height", + "text-indent", "text-justify", "text-outline", "text-shadow", + "text-space-collapse", "text-transform", "text-underline-position", + "text-wrap", "top", "transform", "transform-origin", "transform-style", + "transition", "transition-delay", "transition-duration", + "transition-property", "transition-timing-function", "unicode-bidi", + "vertical-align", "visibility", "voice-balance", "voice-duration", + "voice-family", "voice-pitch", "voice-range", "voice-rate", "voice-stress", + "voice-volume", "volume", "white-space", "widows", "width", "word-break", + "word-spacing", "word-wrap", "z-index" + ]); + + var colorKeywords = keySet([ + "black", "silver", "gray", "white", "maroon", "red", "purple", "fuchsia", + "green", "lime", "olive", "yellow", "navy", "blue", "teal", "aqua" + ]); + + var valueKeywords = keySet([ + "above", "absolute", "activeborder", "activecaption", "afar", + "after-white-space", "ahead", "alias", "all", "all-scroll", "alternate", + "always", "amharic", "amharic-abegede", "antialiased", "appworkspace", + "arabic-indic", "armenian", "asterisks", "auto", "avoid", "background", + "backwards", "baseline", "below", "bidi-override", "binary", "bengali", + "blink", "block", "block-axis", "bold", "bolder", "border", "border-box", + "both", "bottom", "break-all", "break-word", "button", "button-bevel", + "buttonface", "buttonhighlight", "buttonshadow", "buttontext", "cambodian", + "capitalize", "caps-lock-indicator", "caption", "captiontext", "caret", + "cell", "center", "checkbox", "circle", "cjk-earthly-branch", + "cjk-heavenly-stem", "cjk-ideographic", "clear", "clip", "close-quote", + "col-resize", "collapse", "compact", "condensed", "contain", "content", + "content-box", "context-menu", "continuous", "copy", "cover", "crop", + "cross", "crosshair", "currentcolor", "cursive", "dashed", "decimal", + "decimal-leading-zero", "default", "default-button", "destination-atop", + "destination-in", "destination-out", "destination-over", "devanagari", + "disc", "discard", "document", "dot-dash", "dot-dot-dash", "dotted", + "double", "down", "e-resize", "ease", "ease-in", "ease-in-out", "ease-out", + "element", "ellipsis", "embed", "end", "ethiopic", "ethiopic-abegede", + "ethiopic-abegede-am-et", "ethiopic-abegede-gez", "ethiopic-abegede-ti-er", + "ethiopic-abegede-ti-et", "ethiopic-halehame-aa-er", + "ethiopic-halehame-aa-et", "ethiopic-halehame-am-et", + "ethiopic-halehame-gez", "ethiopic-halehame-om-et", + "ethiopic-halehame-sid-et", "ethiopic-halehame-so-et", + "ethiopic-halehame-ti-er", "ethiopic-halehame-ti-et", + "ethiopic-halehame-tig", "ew-resize", "expanded", "extra-condensed", + "extra-expanded", "fantasy", "fast", "fill", "fixed", "flat", "footnotes", + "forwards", "from", "geometricPrecision", "georgian", "graytext", "groove", + "gujarati", "gurmukhi", "hand", "hangul", "hangul-consonant", "hebrew", + "help", "hidden", "hide", "higher", "highlight", "highlighttext", + "hiragana", "hiragana-iroha", "horizontal", "hsl", "hsla", "icon", "ignore", + "inactiveborder", "inactivecaption", "inactivecaptiontext", "infinite", + "infobackground", "infotext", "inherit", "initial", "inline", "inline-axis", + "inline-block", "inline-table", "inset", "inside", "intrinsic", "invert", + "italic", "justify", "kannada", "katakana", "katakana-iroha", "khmer", + "landscape", "lao", "large", "larger", "left", "level", "lighter", + "line-through", "linear", "lines", "list-item", "listbox", "listitem", + "local", "logical", "loud", "lower", "lower-alpha", "lower-armenian", + "lower-greek", "lower-hexadecimal", "lower-latin", "lower-norwegian", + "lower-roman", "lowercase", "ltr", "malayalam", "match", + "media-controls-background", "media-current-time-display", + "media-fullscreen-button", "media-mute-button", "media-play-button", + "media-return-to-realtime-button", "media-rewind-button", + "media-seek-back-button", "media-seek-forward-button", "media-slider", + "media-sliderthumb", "media-time-remaining-display", "media-volume-slider", + "media-volume-slider-container", "media-volume-sliderthumb", "medium", + "menu", "menulist", "menulist-button", "menulist-text", + "menulist-textfield", "menutext", "message-box", "middle", "min-intrinsic", + "mix", "mongolian", "monospace", "move", "multiple", "myanmar", "n-resize", + "narrower", "ne-resize", "nesw-resize", "no-close-quote", "no-drop", + "no-open-quote", "no-repeat", "none", "normal", "not-allowed", "nowrap", + "ns-resize", "nw-resize", "nwse-resize", "oblique", "octal", "open-quote", + "optimizeLegibility", "optimizeSpeed", "oriya", "oromo", "outset", + "outside", "overlay", "overline", "padding", "padding-box", "painted", + "paused", "persian", "plus-darker", "plus-lighter", "pointer", "portrait", + "pre", "pre-line", "pre-wrap", "preserve-3d", "progress", "push-button", + "radio", "read-only", "read-write", "read-write-plaintext-only", "relative", + "repeat", "repeat-x", "repeat-y", "reset", "reverse", "rgb", "rgba", + "ridge", "right", "round", "row-resize", "rtl", "run-in", "running", + "s-resize", "sans-serif", "scroll", "scrollbar", "se-resize", "searchfield", + "searchfield-cancel-button", "searchfield-decoration", + "searchfield-results-button", "searchfield-results-decoration", + "semi-condensed", "semi-expanded", "separate", "serif", "show", "sidama", + "single", "skip-white-space", "slide", "slider-horizontal", + "slider-vertical", "sliderthumb-horizontal", "sliderthumb-vertical", "slow", + "small", "small-caps", "small-caption", "smaller", "solid", "somali", + "source-atop", "source-in", "source-out", "source-over", "space", "square", + "square-button", "start", "static", "status-bar", "stretch", "stroke", + "sub", "subpixel-antialiased", "super", "sw-resize", "table", + "table-caption", "table-cell", "table-column", "table-column-group", + "table-footer-group", "table-header-group", "table-row", "table-row-group", + "telugu", "text", "text-bottom", "text-top", "textarea", "textfield", "thai", + "thick", "thin", "threeddarkshadow", "threedface", "threedhighlight", + "threedlightshadow", "threedshadow", "tibetan", "tigre", "tigrinya-er", + "tigrinya-er-abegede", "tigrinya-et", "tigrinya-et-abegede", "to", "top", + "transparent", "ultra-condensed", "ultra-expanded", "underline", "up", + "upper-alpha", "upper-armenian", "upper-greek", "upper-hexadecimal", + "upper-latin", "upper-norwegian", "upper-roman", "uppercase", "urdu", "url", + "vertical", "vertical-text", "visible", "visibleFill", "visiblePainted", + "visibleStroke", "visual", "w-resize", "wait", "wave", "white", "wider", + "window", "windowframe", "windowtext", "x-large", "x-small", "xor", + "xx-large", "xx-small" + ]); + + function tokenCComment(stream, state) { + var maybeEnd = false, ch; + while ((ch = stream.next()) != null) { + if (maybeEnd && ch == "/") { + state.tokenize = null; + break; + } + maybeEnd = (ch == "*"); + } + return ["comment", "comment"]; + } + + CodeMirror.defineMIME("text/css", { + atMediaTypes: atMediaTypes, + atMediaFeatures: atMediaFeatures, + propertyKeywords: propertyKeywords, + colorKeywords: colorKeywords, + valueKeywords: valueKeywords, + hooks: { + "<": function(stream, state) { + function tokenSGMLComment(stream, state) { + var dashes = 0, ch; + while ((ch = stream.next()) != null) { + if (dashes >= 2 && ch == ">") { + state.tokenize = null; + break; + } + dashes = (ch == "-") ? dashes + 1 : 0; + } + return ["comment", "comment"]; + } + if (stream.eat("!")) { + state.tokenize = tokenSGMLComment; + return tokenSGMLComment(stream, state); + } + }, + "/": function(stream, state) { + if (stream.eat("*")) { + state.tokenize = tokenCComment; + return tokenCComment(stream, state); + } + return false; + } + }, + name: "css-base" + }); + + CodeMirror.defineMIME("text/x-scss", { + atMediaTypes: atMediaTypes, + atMediaFeatures: atMediaFeatures, + propertyKeywords: propertyKeywords, + colorKeywords: colorKeywords, + valueKeywords: valueKeywords, + allowNested: true, + hooks: { + "$": function(stream) { + stream.match(/^[\w-]+/); + if (stream.peek() == ":") { + return ["variable", "variable-definition"]; + } + return ["variable", "variable"]; + }, + "/": function(stream, state) { + if (stream.eat("/")) { + stream.skipToEnd(); + return ["comment", "comment"]; + } else if (stream.eat("*")) { + state.tokenize = tokenCComment; + return tokenCComment(stream, state); + } else { + return ["operator", "operator"]; + } + }, + "#": function(stream) { + if (stream.eat("{")) { + return ["operator", "interpolation"]; + } else { + stream.eatWhile(/[\w\\\-]/); + return ["atom", "hash"]; + } + } + }, + name: "css-base" + }); +})(); diff --git a/modules/files/views/default/assets/mode/css/index.html b/modules/files/views/default/assets/mode/css/index.html new file mode 100755 index 0000000..ae2c3bf --- /dev/null +++ b/modules/files/views/default/assets/mode/css/index.html @@ -0,0 +1,58 @@ + + + + + CodeMirror: CSS mode + + + + + + + +

      CodeMirror: CSS mode

      +
      + + +

      MIME types defined: text/css.

      + +

      Parsing/Highlighting Tests: normal, verbose.

      + + + diff --git a/modules/files/views/default/assets/mode/css/scss.html b/modules/files/views/default/assets/mode/css/scss.html new file mode 100755 index 0000000..b90cbe8 --- /dev/null +++ b/modules/files/views/default/assets/mode/css/scss.html @@ -0,0 +1,145 @@ + + + + + CodeMirror: SCSS mode + + + + + + + +

      CodeMirror: SCSS mode

      +
      + + +

      MIME types defined: text/scss.

      + +

      Parsing/Highlighting Tests: normal, verbose.

      + + + diff --git a/modules/files/views/default/assets/mode/css/scss_test.js b/modules/files/views/default/assets/mode/css/scss_test.js new file mode 100755 index 0000000..996dc78 --- /dev/null +++ b/modules/files/views/default/assets/mode/css/scss_test.js @@ -0,0 +1,80 @@ +(function() { + var mode = CodeMirror.getMode({tabSize: 4}, "text/x-scss"); + function MT(name) { test.mode(name, mode, Array.prototype.slice.call(arguments, 1), "scss"); } + + MT('url_with_quotation', + "[tag foo] { [property background][operator :][string-2 url]([string test.jpg]) }"); + + MT('url_with_double_quotes', + "[tag foo] { [property background][operator :][string-2 url]([string \"test.jpg\"]) }"); + + MT('url_with_single_quotes', + "[tag foo] { [property background][operator :][string-2 url]([string \'test.jpg\']) }"); + + MT('string', + "[def @import] [string \"compass/css3\"]"); + + MT('important_keyword', + "[tag foo] { [property background][operator :][string-2 url]([string \'test.jpg\']) [keyword !important] }"); + + MT('variable', + "[variable-2 $blue][operator :][atom #333]"); + + MT('variable_as_attribute', + "[tag foo] { [property color][operator :][variable-2 $blue] }"); + + MT('numbers', + "[tag foo] { [property padding][operator :][number 10px] [number 10] [number 10em] [number 8in] }"); + + MT('number_percentage', + "[tag foo] { [property width][operator :][number 80%] }"); + + MT('selector', + "[builtin #hello][qualifier .world]{}"); + + MT('singleline_comment', + "[comment // this is a comment]"); + + MT('multiline_comment', + "[comment /*foobar*/]"); + + MT('attribute_with_hyphen', + "[tag foo] { [property font-size][operator :][number 10px] }"); + + MT('string_after_attribute', + "[tag foo] { [property content][operator :][string \"::\"] }"); + + MT('directives', + "[def @include] [qualifier .mixin]"); + + MT('basic_structure', + "[tag p] { [property background][operator :][keyword red]; }"); + + MT('nested_structure', + "[tag p] { [tag a] { [property color][operator :][keyword red]; } }"); + + MT('mixin', + "[def @mixin] [tag table-base] {}"); + + MT('number_without_semicolon', + "[tag p] {[property width][operator :][number 12]}", + "[tag a] {[property color][operator :][keyword red];}"); + + MT('atom_in_nested_block', + "[tag p] { [tag a] { [property color][operator :][atom #000]; } }"); + + MT('interpolation_in_property', + "[tag foo] { [operator #{][variable-2 $hello][operator }:][atom #000]; }"); + + MT('interpolation_in_selector', + "[tag foo][operator #{][variable-2 $hello][operator }] { [property color][operator :][atom #000]; }"); + + MT('interpolation_error', + "[tag foo][operator #{][error foo][operator }] { [property color][operator :][atom #000]; }"); + + MT("divide_operator", + "[tag foo] { [property width][operator :][number 4] [operator /] [number 2] }"); + + MT('nested_structure_with_id_selector', + "[tag p] { [builtin #hello] { [property color][operator :][keyword red]; } }"); +})(); diff --git a/modules/files/views/default/assets/mode/css/test.js b/modules/files/views/default/assets/mode/css/test.js new file mode 100755 index 0000000..97dd0a8 --- /dev/null +++ b/modules/files/views/default/assets/mode/css/test.js @@ -0,0 +1,113 @@ +(function() { + var mode = CodeMirror.getMode({tabSize: 4}, "css"); + function MT(name) { test.mode(name, mode, Array.prototype.slice.call(arguments, 1)); } + + // Requires at least one media query + MT("atMediaEmpty", + "[def @media] [error {] }"); + + MT("atMediaMultiple", + "[def @media] [keyword not] [attribute screen] [operator and] ([property color]), [keyword not] [attribute print] [operator and] ([property color]) { }"); + + MT("atMediaCheckStack", + "[def @media] [attribute screen] { } [tag foo] { }"); + + MT("atMediaCheckStack", + "[def @media] [attribute screen] ([property color]) { } [tag foo] { }"); + + MT("atMediaCheckStackInvalidAttribute", + "[def @media] [attribute&error foobarhello] { } [tag foo] { }"); + + // Error, because "and" is only allowed immediately preceding a media expression + MT("atMediaInvalidAttribute", + "[def @media] [attribute&error foobarhello] { }"); + + // Error, because "and" is only allowed immediately preceding a media expression + MT("atMediaInvalidAnd", + "[def @media] [error and] [attribute screen] { }"); + + // Error, because "not" is only allowed as the first item in each media query + MT("atMediaInvalidNot", + "[def @media] [attribute screen] [error not] ([error not]) { }"); + + // Error, because "only" is only allowed as the first item in each media query + MT("atMediaInvalidOnly", + "[def @media] [attribute screen] [error only] ([error only]) { }"); + + // Error, because "foobarhello" is neither a known type or property, but + // property was expected (after "and"), and it should be in parenthese. + MT("atMediaUnknownType", + "[def @media] [attribute screen] [operator and] [error foobarhello] { }"); + + // Error, because "color" is not a known type, but is a known property, and + // should be in parentheses. + MT("atMediaInvalidType", + "[def @media] [attribute screen] [operator and] [error color] { }"); + + // Error, because "print" is not a known property, but is a known type, + // and should not be in parenthese. + MT("atMediaInvalidProperty", + "[def @media] [attribute screen] [operator and] ([error print]) { }"); + + // Soft error, because "foobarhello" is not a known property or type. + MT("atMediaUnknownProperty", + "[def @media] [attribute screen] [operator and] ([property&error foobarhello]) { }"); + + MT("tagSelector", + "[tag foo] { }"); + + MT("classSelector", + "[qualifier .foo-bar_hello] { }"); + + MT("idSelector", + "[builtin #foo] { [error #foo] }"); + + MT("tagSelectorUnclosed", + "[tag foo] { [property margin][operator :] [number 0] } [tag bar] { }"); + + MT("tagStringNoQuotes", + "[tag foo] { [property font-family][operator :] [variable-2 hello] [variable-2 world]; }"); + + MT("tagStringDouble", + "[tag foo] { [property font-family][operator :] [string \"hello world\"]; }"); + + MT("tagStringSingle", + "[tag foo] { [property font-family][operator :] [string 'hello world']; }"); + + MT("tagColorKeyword", + "[tag foo] {" + + "[property color][operator :] [keyword black];" + + "[property color][operator :] [keyword navy];" + + "[property color][operator :] [keyword yellow];" + + "}"); + + MT("tagColorHex3", + "[tag foo] { [property background][operator :] [atom #fff]; }"); + + MT("tagColorHex6", + "[tag foo] { [property background][operator :] [atom #ffffff]; }"); + + MT("tagColorHex4", + "[tag foo] { [property background][operator :] [atom&error #ffff]; }"); + + MT("tagColorHexInvalid", + "[tag foo] { [property background][operator :] [atom&error #ffg]; }"); + + MT("tagNegativeNumber", + "[tag foo] { [property margin][operator :] [number -5px]; }"); + + MT("tagPositiveNumber", + "[tag foo] { [property padding][operator :] [number 5px]; }"); + + MT("tagVendor", + "[tag foo] { [meta -foo-][property box-sizing][operator :] [meta -foo-][string-2 border-box]; }"); + + MT("tagBogusProperty", + "[tag foo] { [property&error barhelloworld][operator :] [number 0]; }"); + + MT("tagTwoProperties", + "[tag foo] { [property margin][operator :] [number 0]; [property padding][operator :] [number 0]; }"); + + MT("commentSGML", + "[comment ]"); +})(); diff --git a/modules/files/views/default/assets/mode/d/d.js b/modules/files/views/default/assets/mode/d/d.js new file mode 100755 index 0000000..ab345f1 --- /dev/null +++ b/modules/files/views/default/assets/mode/d/d.js @@ -0,0 +1,205 @@ +CodeMirror.defineMode("d", function(config, parserConfig) { + var indentUnit = config.indentUnit, + statementIndentUnit = parserConfig.statementIndentUnit || indentUnit, + keywords = parserConfig.keywords || {}, + builtin = parserConfig.builtin || {}, + blockKeywords = parserConfig.blockKeywords || {}, + atoms = parserConfig.atoms || {}, + hooks = parserConfig.hooks || {}, + multiLineStrings = parserConfig.multiLineStrings; + var isOperatorChar = /[+\-*&%=<>!?|\/]/; + + var curPunc; + + function tokenBase(stream, state) { + var ch = stream.next(); + if (hooks[ch]) { + var result = hooks[ch](stream, state); + if (result !== false) return result; + } + if (ch == '"' || ch == "'" || ch == "`") { + state.tokenize = tokenString(ch); + return state.tokenize(stream, state); + } + if (/[\[\]{}\(\),;\:\.]/.test(ch)) { + curPunc = ch; + return null; + } + if (/\d/.test(ch)) { + stream.eatWhile(/[\w\.]/); + return "number"; + } + if (ch == "/") { + if (stream.eat("+")) { + state.tokenize = tokenComment; + return tokenNestedComment(stream, state); + } + if (stream.eat("*")) { + state.tokenize = tokenComment; + return tokenComment(stream, state); + } + if (stream.eat("/")) { + stream.skipToEnd(); + return "comment"; + } + } + if (isOperatorChar.test(ch)) { + stream.eatWhile(isOperatorChar); + return "operator"; + } + stream.eatWhile(/[\w\$_]/); + var cur = stream.current(); + if (keywords.propertyIsEnumerable(cur)) { + if (blockKeywords.propertyIsEnumerable(cur)) curPunc = "newstatement"; + return "keyword"; + } + if (builtin.propertyIsEnumerable(cur)) { + if (blockKeywords.propertyIsEnumerable(cur)) curPunc = "newstatement"; + return "builtin"; + } + if (atoms.propertyIsEnumerable(cur)) return "atom"; + return "variable"; + } + + function tokenString(quote) { + return function(stream, state) { + var escaped = false, next, end = false; + while ((next = stream.next()) != null) { + if (next == quote && !escaped) {end = true; break;} + escaped = !escaped && next == "\\"; + } + if (end || !(escaped || multiLineStrings)) + state.tokenize = null; + return "string"; + }; + } + + function tokenComment(stream, state) { + var maybeEnd = false, ch; + while (ch = stream.next()) { + if (ch == "/" && maybeEnd) { + state.tokenize = null; + break; + } + maybeEnd = (ch == "*"); + } + return "comment"; + } + + function tokenNestedComment(stream, state) { + var maybeEnd = false, ch; + while (ch = stream.next()) { + if (ch == "/" && maybeEnd) { + state.tokenize = null; + break; + } + maybeEnd = (ch == "+"); + } + return "comment"; + } + + function Context(indented, column, type, align, prev) { + this.indented = indented; + this.column = column; + this.type = type; + this.align = align; + this.prev = prev; + } + function pushContext(state, col, type) { + var indent = state.indented; + if (state.context && state.context.type == "statement") + indent = state.context.indented; + return state.context = new Context(indent, col, type, null, state.context); + } + function popContext(state) { + var t = state.context.type; + if (t == ")" || t == "]" || t == "}") + state.indented = state.context.indented; + return state.context = state.context.prev; + } + + // Interface + + return { + startState: function(basecolumn) { + return { + tokenize: null, + context: new Context((basecolumn || 0) - indentUnit, 0, "top", false), + indented: 0, + startOfLine: true + }; + }, + + token: function(stream, state) { + var ctx = state.context; + if (stream.sol()) { + if (ctx.align == null) ctx.align = false; + state.indented = stream.indentation(); + state.startOfLine = true; + } + if (stream.eatSpace()) return null; + curPunc = null; + var style = (state.tokenize || tokenBase)(stream, state); + if (style == "comment" || style == "meta") return style; + if (ctx.align == null) ctx.align = true; + + if ((curPunc == ";" || curPunc == ":" || curPunc == ",") && ctx.type == "statement") popContext(state); + else if (curPunc == "{") pushContext(state, stream.column(), "}"); + else if (curPunc == "[") pushContext(state, stream.column(), "]"); + else if (curPunc == "(") pushContext(state, stream.column(), ")"); + else if (curPunc == "}") { + while (ctx.type == "statement") ctx = popContext(state); + if (ctx.type == "}") ctx = popContext(state); + while (ctx.type == "statement") ctx = popContext(state); + } + else if (curPunc == ctx.type) popContext(state); + else if (((ctx.type == "}" || ctx.type == "top") && curPunc != ';') || (ctx.type == "statement" && curPunc == "newstatement")) + pushContext(state, stream.column(), "statement"); + state.startOfLine = false; + return style; + }, + + indent: function(state, textAfter) { + if (state.tokenize != tokenBase && state.tokenize != null) return CodeMirror.Pass; + var ctx = state.context, firstChar = textAfter && textAfter.charAt(0); + if (ctx.type == "statement" && firstChar == "}") ctx = ctx.prev; + var closing = firstChar == ctx.type; + if (ctx.type == "statement") return ctx.indented + (firstChar == "{" ? 0 : statementIndentUnit); + else if (ctx.align) return ctx.column + (closing ? 0 : 1); + else return ctx.indented + (closing ? 0 : indentUnit); + }, + + electricChars: "{}" + }; +}); + +(function() { + function words(str) { + var obj = {}, words = str.split(" "); + for (var i = 0; i < words.length; ++i) obj[words[i]] = true; + return obj; + } + + var blockKeywords = "body catch class do else enum for foreach foreach_reverse if in interface mixin " + + "out scope struct switch try union unittest version while with"; + + CodeMirror.defineMIME("text/x-d", { + name: "d", + keywords: words("abstract alias align asm assert auto break case cast cdouble cent cfloat const continue " + + "debug default delegate delete deprecated export extern final finally function goto immutable " + + "import inout invariant is lazy macro module new nothrow override package pragma private " + + "protected public pure ref return shared short static super synchronized template this " + + "throw typedef typeid typeof volatile __FILE__ __LINE__ __gshared __traits __vector __parameters " + + blockKeywords), + blockKeywords: words(blockKeywords), + builtin: words("bool byte char creal dchar double float idouble ifloat int ireal long real short ubyte " + + "ucent uint ulong ushort wchar wstring void size_t sizediff_t"), + atoms: words("exit failure success true false null"), + hooks: { + "@": function(stream, _state) { + stream.eatWhile(/[\w\$_]/); + return "meta"; + } + } + }); +}()); diff --git a/modules/files/views/default/assets/mode/d/index.html b/modules/files/views/default/assets/mode/d/index.html new file mode 100755 index 0000000..1333272 --- /dev/null +++ b/modules/files/views/default/assets/mode/d/index.html @@ -0,0 +1,262 @@ + + + + + CodeMirror: D mode + + + + + + + + +

      CodeMirror: D mode

      + +
      + + + +

      Simple mode that handle D-Syntax (DLang Homepage).

      + +

      MIME types defined: text/x-d + .

      + + diff --git a/modules/files/views/default/assets/mode/diff/diff.js b/modules/files/views/default/assets/mode/diff/diff.js new file mode 100755 index 0000000..9a0d90e --- /dev/null +++ b/modules/files/views/default/assets/mode/diff/diff.js @@ -0,0 +1,32 @@ +CodeMirror.defineMode("diff", function() { + + var TOKEN_NAMES = { + '+': 'positive', + '-': 'negative', + '@': 'meta' + }; + + return { + token: function(stream) { + var tw_pos = stream.string.search(/[\t ]+?$/); + + if (!stream.sol() || tw_pos === 0) { + stream.skipToEnd(); + return ("error " + ( + TOKEN_NAMES[stream.string.charAt(0)] || '')).replace(/ $/, ''); + } + + var token_name = TOKEN_NAMES[stream.peek()] || stream.skipToEnd(); + + if (tw_pos === -1) { + stream.skipToEnd(); + } else { + stream.pos = tw_pos; + } + + return token_name; + } + }; +}); + +CodeMirror.defineMIME("text/x-diff", "diff"); diff --git a/modules/files/views/default/assets/mode/diff/index.html b/modules/files/views/default/assets/mode/diff/index.html new file mode 100755 index 0000000..5560252 --- /dev/null +++ b/modules/files/views/default/assets/mode/diff/index.html @@ -0,0 +1,105 @@ + + + + + CodeMirror: Diff mode + + + + + + + +

      CodeMirror: Diff mode

      +
      + + +

      MIME types defined: text/x-diff.

      + + + diff --git a/modules/files/views/default/assets/mode/ecl/ecl.js b/modules/files/views/default/assets/mode/ecl/ecl.js new file mode 100755 index 0000000..7601b18 --- /dev/null +++ b/modules/files/views/default/assets/mode/ecl/ecl.js @@ -0,0 +1,192 @@ +CodeMirror.defineMode("ecl", function(config) { + + function words(str) { + var obj = {}, words = str.split(" "); + for (var i = 0; i < words.length; ++i) obj[words[i]] = true; + return obj; + } + + function metaHook(stream, state) { + if (!state.startOfLine) return false; + stream.skipToEnd(); + return "meta"; + } + + var indentUnit = config.indentUnit; + var keyword = words("abs acos allnodes ascii asin asstring atan atan2 ave case choose choosen choosesets clustersize combine correlation cos cosh count covariance cron dataset dedup define denormalize distribute distributed distribution ebcdic enth error evaluate event eventextra eventname exists exp failcode failmessage fetch fromunicode getisvalid global graph group hash hash32 hash64 hashcrc hashmd5 having if index intformat isvalid iterate join keyunicode length library limit ln local log loop map matched matchlength matchposition matchtext matchunicode max merge mergejoin min nolocal nonempty normalize parse pipe power preload process project pull random range rank ranked realformat recordof regexfind regexreplace regroup rejected rollup round roundup row rowdiff sample set sin sinh sizeof soapcall sort sorted sqrt stepped stored sum table tan tanh thisnode topn tounicode transfer trim truncate typeof ungroup unicodeorder variance which workunit xmldecode xmlencode xmltext xmlunicode"); + var variable = words("apply assert build buildindex evaluate fail keydiff keypatch loadxml nothor notify output parallel sequential soapcall wait"); + var variable_2 = words("__compressed__ all and any as atmost before beginc++ best between case const counter csv descend encrypt end endc++ endmacro except exclusive expire export extend false few first flat from full function group header heading hole ifblock import in interface joined keep keyed last left limit load local locale lookup macro many maxcount maxlength min skew module named nocase noroot noscan nosort not of only opt or outer overwrite packed partition penalty physicallength pipe quote record relationship repeat return right scan self separator service shared skew skip sql store terminator thor threshold token transform trim true type unicodeorder unsorted validate virtual whole wild within xml xpath"); + var variable_3 = words("ascii big_endian boolean data decimal ebcdic integer pattern qstring real record rule set of string token udecimal unicode unsigned varstring varunicode"); + var builtin = words("checkpoint deprecated failcode failmessage failure global independent onwarning persist priority recovery stored success wait when"); + var blockKeywords = words("catch class do else finally for if switch try while"); + var atoms = words("true false null"); + var hooks = {"#": metaHook}; + var multiLineStrings; + var isOperatorChar = /[+\-*&%=<>!?|\/]/; + + var curPunc; + + function tokenBase(stream, state) { + var ch = stream.next(); + if (hooks[ch]) { + var result = hooks[ch](stream, state); + if (result !== false) return result; + } + if (ch == '"' || ch == "'") { + state.tokenize = tokenString(ch); + return state.tokenize(stream, state); + } + if (/[\[\]{}\(\),;\:\.]/.test(ch)) { + curPunc = ch; + return null; + } + if (/\d/.test(ch)) { + stream.eatWhile(/[\w\.]/); + return "number"; + } + if (ch == "/") { + if (stream.eat("*")) { + state.tokenize = tokenComment; + return tokenComment(stream, state); + } + if (stream.eat("/")) { + stream.skipToEnd(); + return "comment"; + } + } + if (isOperatorChar.test(ch)) { + stream.eatWhile(isOperatorChar); + return "operator"; + } + stream.eatWhile(/[\w\$_]/); + var cur = stream.current().toLowerCase(); + if (keyword.propertyIsEnumerable(cur)) { + if (blockKeywords.propertyIsEnumerable(cur)) curPunc = "newstatement"; + return "keyword"; + } else if (variable.propertyIsEnumerable(cur)) { + if (blockKeywords.propertyIsEnumerable(cur)) curPunc = "newstatement"; + return "variable"; + } else if (variable_2.propertyIsEnumerable(cur)) { + if (blockKeywords.propertyIsEnumerable(cur)) curPunc = "newstatement"; + return "variable-2"; + } else if (variable_3.propertyIsEnumerable(cur)) { + if (blockKeywords.propertyIsEnumerable(cur)) curPunc = "newstatement"; + return "variable-3"; + } else if (builtin.propertyIsEnumerable(cur)) { + if (blockKeywords.propertyIsEnumerable(cur)) curPunc = "newstatement"; + return "builtin"; + } else { //Data types are of from KEYWORD## + var i = cur.length - 1; + while(i >= 0 && (!isNaN(cur[i]) || cur[i] == '_')) + --i; + + if (i > 0) { + var cur2 = cur.substr(0, i + 1); + if (variable_3.propertyIsEnumerable(cur2)) { + if (blockKeywords.propertyIsEnumerable(cur2)) curPunc = "newstatement"; + return "variable-3"; + } + } + } + if (atoms.propertyIsEnumerable(cur)) return "atom"; + return null; + } + + function tokenString(quote) { + return function(stream, state) { + var escaped = false, next, end = false; + while ((next = stream.next()) != null) { + if (next == quote && !escaped) {end = true; break;} + escaped = !escaped && next == "\\"; + } + if (end || !(escaped || multiLineStrings)) + state.tokenize = tokenBase; + return "string"; + }; + } + + function tokenComment(stream, state) { + var maybeEnd = false, ch; + while (ch = stream.next()) { + if (ch == "/" && maybeEnd) { + state.tokenize = tokenBase; + break; + } + maybeEnd = (ch == "*"); + } + return "comment"; + } + + function Context(indented, column, type, align, prev) { + this.indented = indented; + this.column = column; + this.type = type; + this.align = align; + this.prev = prev; + } + function pushContext(state, col, type) { + return state.context = new Context(state.indented, col, type, null, state.context); + } + function popContext(state) { + var t = state.context.type; + if (t == ")" || t == "]" || t == "}") + state.indented = state.context.indented; + return state.context = state.context.prev; + } + + // Interface + + return { + startState: function(basecolumn) { + return { + tokenize: null, + context: new Context((basecolumn || 0) - indentUnit, 0, "top", false), + indented: 0, + startOfLine: true + }; + }, + + token: function(stream, state) { + var ctx = state.context; + if (stream.sol()) { + if (ctx.align == null) ctx.align = false; + state.indented = stream.indentation(); + state.startOfLine = true; + } + if (stream.eatSpace()) return null; + curPunc = null; + var style = (state.tokenize || tokenBase)(stream, state); + if (style == "comment" || style == "meta") return style; + if (ctx.align == null) ctx.align = true; + + if ((curPunc == ";" || curPunc == ":") && ctx.type == "statement") popContext(state); + else if (curPunc == "{") pushContext(state, stream.column(), "}"); + else if (curPunc == "[") pushContext(state, stream.column(), "]"); + else if (curPunc == "(") pushContext(state, stream.column(), ")"); + else if (curPunc == "}") { + while (ctx.type == "statement") ctx = popContext(state); + if (ctx.type == "}") ctx = popContext(state); + while (ctx.type == "statement") ctx = popContext(state); + } + else if (curPunc == ctx.type) popContext(state); + else if (ctx.type == "}" || ctx.type == "top" || (ctx.type == "statement" && curPunc == "newstatement")) + pushContext(state, stream.column(), "statement"); + state.startOfLine = false; + return style; + }, + + indent: function(state, textAfter) { + if (state.tokenize != tokenBase && state.tokenize != null) return 0; + var ctx = state.context, firstChar = textAfter && textAfter.charAt(0); + if (ctx.type == "statement" && firstChar == "}") ctx = ctx.prev; + var closing = firstChar == ctx.type; + if (ctx.type == "statement") return ctx.indented + (firstChar == "{" ? 0 : indentUnit); + else if (ctx.align) return ctx.column + (closing ? 0 : 1); + else return ctx.indented + (closing ? 0 : indentUnit); + }, + + electricChars: "{}" + }; +}); + +CodeMirror.defineMIME("text/x-ecl", "ecl"); diff --git a/modules/files/views/default/assets/mode/ecl/index.html b/modules/files/views/default/assets/mode/ecl/index.html new file mode 100755 index 0000000..0ba88c3 --- /dev/null +++ b/modules/files/views/default/assets/mode/ecl/index.html @@ -0,0 +1,39 @@ + + + + CodeMirror: ECL mode + + + + + + + +

      CodeMirror: ECL mode

      +
      + + +

      Based on CodeMirror's clike mode. For more information see HPCC Systems web site.

      +

      MIME types defined: text/x-ecl.

      + + + diff --git a/modules/files/views/default/assets/mode/erlang/erlang.js b/modules/files/views/default/assets/mode/erlang/erlang.js new file mode 100755 index 0000000..029b8e5 --- /dev/null +++ b/modules/files/views/default/assets/mode/erlang/erlang.js @@ -0,0 +1,463 @@ +// block; "begin", "case", "fun", "if", "receive", "try": closed by "end" +// block internal; "after", "catch", "of" +// guard; "when", closed by "->" +// "->" opens a clause, closed by ";" or "." +// "<<" opens a binary, closed by ">>" +// "," appears in arglists, lists, tuples and terminates lines of code +// "." resets indentation to 0 +// obsolete; "cond", "let", "query" + +CodeMirror.defineMIME("text/x-erlang", "erlang"); + +CodeMirror.defineMode("erlang", function(cmCfg) { + + function rval(state,stream,type) { + // distinguish between "." as terminator and record field operator + if (type == "record") { + state.context = "record"; + }else{ + state.context = false; + } + + // remember last significant bit on last line for indenting + if (type != "whitespace" && type != "comment") { + state.lastToken = stream.current(); + } + // erlang -> CodeMirror tag + switch (type) { + case "atom": return "atom"; + case "attribute": return "attribute"; + case "builtin": return "builtin"; + case "comment": return "comment"; + case "fun": return "meta"; + case "function": return "tag"; + case "guard": return "property"; + case "keyword": return "keyword"; + case "macro": return "variable-2"; + case "number": return "number"; + case "operator": return "operator"; + case "record": return "bracket"; + case "string": return "string"; + case "type": return "def"; + case "variable": return "variable"; + case "error": return "error"; + case "separator": return null; + case "open_paren": return null; + case "close_paren": return null; + default: return null; + } + } + + var typeWords = [ + "-type", "-spec", "-export_type", "-opaque"]; + + var keywordWords = [ + "after","begin","catch","case","cond","end","fun","if", + "let","of","query","receive","try","when"]; + + var separatorWords = [ + "->",";",":",".",","]; + + var operatorWords = [ + "and","andalso","band","bnot","bor","bsl","bsr","bxor", + "div","not","or","orelse","rem","xor"]; + + var symbolWords = [ + "+","-","*","/",">",">=","<","=<","=:=","==","=/=","/=","||","<-"]; + + var openParenWords = [ + "<<","(","[","{"]; + + var closeParenWords = [ + "}","]",")",">>"]; + + var guardWords = [ + "is_atom","is_binary","is_bitstring","is_boolean","is_float", + "is_function","is_integer","is_list","is_number","is_pid", + "is_port","is_record","is_reference","is_tuple", + "atom","binary","bitstring","boolean","function","integer","list", + "number","pid","port","record","reference","tuple"]; + + var bifWords = [ + "abs","adler32","adler32_combine","alive","apply","atom_to_binary", + "atom_to_list","binary_to_atom","binary_to_existing_atom", + "binary_to_list","binary_to_term","bit_size","bitstring_to_list", + "byte_size","check_process_code","contact_binary","crc32", + "crc32_combine","date","decode_packet","delete_module", + "disconnect_node","element","erase","exit","float","float_to_list", + "garbage_collect","get","get_keys","group_leader","halt","hd", + "integer_to_list","internal_bif","iolist_size","iolist_to_binary", + "is_alive","is_atom","is_binary","is_bitstring","is_boolean", + "is_float","is_function","is_integer","is_list","is_number","is_pid", + "is_port","is_process_alive","is_record","is_reference","is_tuple", + "length","link","list_to_atom","list_to_binary","list_to_bitstring", + "list_to_existing_atom","list_to_float","list_to_integer", + "list_to_pid","list_to_tuple","load_module","make_ref","module_loaded", + "monitor_node","node","node_link","node_unlink","nodes","notalive", + "now","open_port","pid_to_list","port_close","port_command", + "port_connect","port_control","pre_loaded","process_flag", + "process_info","processes","purge_module","put","register", + "registered","round","self","setelement","size","spawn","spawn_link", + "spawn_monitor","spawn_opt","split_binary","statistics", + "term_to_binary","time","throw","tl","trunc","tuple_size", + "tuple_to_list","unlink","unregister","whereis"]; + + // ignored for indenting purposes + var ignoreWords = [ + ",", ":", "catch", "after", "of", "cond", "let", "query"]; + + + var smallRE = /[a-z_]/; + var largeRE = /[A-Z_]/; + var digitRE = /[0-9]/; + var octitRE = /[0-7]/; + var anumRE = /[a-z_A-Z0-9]/; + var symbolRE = /[\+\-\*\/<>=\|:]/; + var openParenRE = /[<\(\[\{]/; + var closeParenRE = /[>\)\]\}]/; + var sepRE = /[\->\.,:;]/; + + function isMember(element,list) { + return (-1 < list.indexOf(element)); + } + + function isPrev(stream,string) { + var start = stream.start; + var len = string.length; + if (len <= start) { + var word = stream.string.slice(start-len,start); + return word == string; + }else{ + return false; + } + } + + function tokenize(stream, state) { + if (stream.eatSpace()) { + return rval(state,stream,"whitespace"); + } + + // attributes and type specs + if ((peekToken(state).token == "" || peekToken(state).token == ".") && + stream.peek() == '-') { + stream.next(); + if (stream.eat(smallRE) && stream.eatWhile(anumRE)) { + if (isMember(stream.current(),typeWords)) { + return rval(state,stream,"type"); + }else{ + return rval(state,stream,"attribute"); + } + } + stream.backUp(1); + } + + var ch = stream.next(); + + // comment + if (ch == '%') { + stream.skipToEnd(); + return rval(state,stream,"comment"); + } + + // macro + if (ch == '?') { + stream.eatWhile(anumRE); + return rval(state,stream,"macro"); + } + + // record + if ( ch == "#") { + stream.eatWhile(anumRE); + return rval(state,stream,"record"); + } + + // char + if ( ch == "$") { + if (stream.next() == "\\") { + if (!stream.eatWhile(octitRE)) { + stream.next(); + } + } + return rval(state,stream,"string"); + } + + // quoted atom + if (ch == '\'') { + if (singleQuote(stream)) { + return rval(state,stream,"atom"); + }else{ + return rval(state,stream,"error"); + } + } + + // string + if (ch == '"') { + if (doubleQuote(stream)) { + return rval(state,stream,"string"); + }else{ + return rval(state,stream,"error"); + } + } + + // variable + if (largeRE.test(ch)) { + stream.eatWhile(anumRE); + return rval(state,stream,"variable"); + } + + // atom/keyword/BIF/function + if (smallRE.test(ch)) { + stream.eatWhile(anumRE); + + if (stream.peek() == "/") { + stream.next(); + if (stream.eatWhile(digitRE)) { + return rval(state,stream,"fun"); // f/0 style fun + }else{ + stream.backUp(1); + return rval(state,stream,"atom"); + } + } + + var w = stream.current(); + + if (isMember(w,keywordWords)) { + pushToken(state,stream); + return rval(state,stream,"keyword"); + } + if (stream.peek() == "(") { + // 'put' and 'erlang:put' are bifs, 'foo:put' is not + if (isMember(w,bifWords) && + (!isPrev(stream,":") || isPrev(stream,"erlang:"))) { + return rval(state,stream,"builtin"); + }else{ + return rval(state,stream,"function"); + } + } + if (isMember(w,guardWords)) { + return rval(state,stream,"guard"); + } + if (isMember(w,operatorWords)) { + return rval(state,stream,"operator"); + } + if (stream.peek() == ":") { + if (w == "erlang") { + return rval(state,stream,"builtin"); + } else { + return rval(state,stream,"function"); + } + } + return rval(state,stream,"atom"); + } + + // number + if (digitRE.test(ch)) { + stream.eatWhile(digitRE); + if (stream.eat('#')) { + stream.eatWhile(digitRE); // 16#10 style integer + } else { + if (stream.eat('.')) { // float + stream.eatWhile(digitRE); + } + if (stream.eat(/[eE]/)) { + stream.eat(/[-+]/); // float with exponent + stream.eatWhile(digitRE); + } + } + return rval(state,stream,"number"); // normal integer + } + + // open parens + if (nongreedy(stream,openParenRE,openParenWords)) { + pushToken(state,stream); + return rval(state,stream,"open_paren"); + } + + // close parens + if (nongreedy(stream,closeParenRE,closeParenWords)) { + pushToken(state,stream); + return rval(state,stream,"close_paren"); + } + + // separators + if (greedy(stream,sepRE,separatorWords)) { + // distinguish between "." as terminator and record field operator + if (state.context == false) { + pushToken(state,stream); + } + return rval(state,stream,"separator"); + } + + // operators + if (greedy(stream,symbolRE,symbolWords)) { + return rval(state,stream,"operator"); + } + + return rval(state,stream,null); + } + + function nongreedy(stream,re,words) { + if (stream.current().length == 1 && re.test(stream.current())) { + stream.backUp(1); + while (re.test(stream.peek())) { + stream.next(); + if (isMember(stream.current(),words)) { + return true; + } + } + stream.backUp(stream.current().length-1); + } + return false; + } + + function greedy(stream,re,words) { + if (stream.current().length == 1 && re.test(stream.current())) { + while (re.test(stream.peek())) { + stream.next(); + } + while (0 < stream.current().length) { + if (isMember(stream.current(),words)) { + return true; + }else{ + stream.backUp(1); + } + } + stream.next(); + } + return false; + } + + function doubleQuote(stream) { + return quote(stream, '"', '\\'); + } + + function singleQuote(stream) { + return quote(stream,'\'','\\'); + } + + function quote(stream,quoteChar,escapeChar) { + while (!stream.eol()) { + var ch = stream.next(); + if (ch == quoteChar) { + return true; + }else if (ch == escapeChar) { + stream.next(); + } + } + return false; + } + + function Token(stream) { + this.token = stream ? stream.current() : ""; + this.column = stream ? stream.column() : 0; + this.indent = stream ? stream.indentation() : 0; + } + + function myIndent(state,textAfter) { + var indent = cmCfg.indentUnit; + var outdentWords = ["after","catch"]; + var token = (peekToken(state)).token; + var wordAfter = takewhile(textAfter,/[^a-z]/); + + if (isMember(token,openParenWords)) { + return (peekToken(state)).column+token.length; + }else if (token == "." || token == ""){ + return 0; + }else if (token == "->") { + if (wordAfter == "end") { + return peekToken(state,2).column; + }else if (peekToken(state,2).token == "fun") { + return peekToken(state,2).column+indent; + }else{ + return (peekToken(state)).indent+indent; + } + }else if (isMember(wordAfter,outdentWords)) { + return (peekToken(state)).indent; + }else{ + return (peekToken(state)).column+indent; + } + } + + function takewhile(str,re) { + var m = str.match(re); + return m ? str.slice(0,m.index) : str; + } + + function popToken(state) { + return state.tokenStack.pop(); + } + + function peekToken(state,depth) { + var len = state.tokenStack.length; + var dep = (depth ? depth : 1); + if (len < dep) { + return new Token; + }else{ + return state.tokenStack[len-dep]; + } + } + + function pushToken(state,stream) { + var token = stream.current(); + var prev_token = peekToken(state).token; + if (isMember(token,ignoreWords)) { + return false; + }else if (drop_both(prev_token,token)) { + popToken(state); + return false; + }else if (drop_first(prev_token,token)) { + popToken(state); + return pushToken(state,stream); + }else{ + state.tokenStack.push(new Token(stream)); + return true; + } + } + + function drop_first(open, close) { + switch (open+" "+close) { + case "when ->": return true; + case "-> end": return true; + case "-> .": return true; + case ". .": return true; + default: return false; + } + } + + function drop_both(open, close) { + switch (open+" "+close) { + case "( )": return true; + case "[ ]": return true; + case "{ }": return true; + case "<< >>": return true; + case "begin end": return true; + case "case end": return true; + case "fun end": return true; + case "if end": return true; + case "receive end": return true; + case "try end": return true; + case "-> ;": return true; + default: return false; + } + } + + return { + startState: + function() { + return {tokenStack: [], + context: false, + lastToken: null}; + }, + + token: + function(stream, state) { + return tokenize(stream, state); + }, + + indent: + function(state, textAfter) { +// console.log(state.tokenStack); + return myIndent(state,textAfter); + } + }; +}); diff --git a/modules/files/views/default/assets/mode/erlang/index.html b/modules/files/views/default/assets/mode/erlang/index.html new file mode 100755 index 0000000..fd21521 --- /dev/null +++ b/modules/files/views/default/assets/mode/erlang/index.html @@ -0,0 +1,64 @@ + + + + + CodeMirror: Erlang mode + + + + + + + + + +

      CodeMirror: Erlang mode

      + +
      + + + +

      MIME types defined: text/x-erlang.

      + + diff --git a/modules/files/views/default/assets/mode/gas/gas.js b/modules/files/views/default/assets/mode/gas/gas.js new file mode 100755 index 0000000..6604f01 --- /dev/null +++ b/modules/files/views/default/assets/mode/gas/gas.js @@ -0,0 +1,326 @@ +CodeMirror.defineMode("gas", function(_config, parserConfig) { + 'use strict'; + + // If an architecture is specified, its initialization function may + // populate this array with custom parsing functions which will be + // tried in the event that the standard functions do not find a match. + var custom = []; + + // The symbol used to start a line comment changes based on the target + // architecture. + // If no architecture is pased in "parserConfig" then only multiline + // comments will have syntax support. + var lineCommentStartSymbol = ""; + + // These directives are architecture independent. + // Machine specific directives should go in their respective + // architecture initialization function. + // Reference: + // http://sourceware.org/binutils/docs/as/Pseudo-Ops.html#Pseudo-Ops + var directives = { + ".abort" : "builtin", + ".align" : "builtin", + ".altmacro" : "builtin", + ".ascii" : "builtin", + ".asciz" : "builtin", + ".balign" : "builtin", + ".balignw" : "builtin", + ".balignl" : "builtin", + ".bundle_align_mode" : "builtin", + ".bundle_lock" : "builtin", + ".bundle_unlock" : "builtin", + ".byte" : "builtin", + ".cfi_startproc" : "builtin", + ".comm" : "builtin", + ".data" : "builtin", + ".def" : "builtin", + ".desc" : "builtin", + ".dim" : "builtin", + ".double" : "builtin", + ".eject" : "builtin", + ".else" : "builtin", + ".elseif" : "builtin", + ".end" : "builtin", + ".endef" : "builtin", + ".endfunc" : "builtin", + ".endif" : "builtin", + ".equ" : "builtin", + ".equiv" : "builtin", + ".eqv" : "builtin", + ".err" : "builtin", + ".error" : "builtin", + ".exitm" : "builtin", + ".extern" : "builtin", + ".fail" : "builtin", + ".file" : "builtin", + ".fill" : "builtin", + ".float" : "builtin", + ".func" : "builtin", + ".global" : "builtin", + ".gnu_attribute" : "builtin", + ".hidden" : "builtin", + ".hword" : "builtin", + ".ident" : "builtin", + ".if" : "builtin", + ".incbin" : "builtin", + ".include" : "builtin", + ".int" : "builtin", + ".internal" : "builtin", + ".irp" : "builtin", + ".irpc" : "builtin", + ".lcomm" : "builtin", + ".lflags" : "builtin", + ".line" : "builtin", + ".linkonce" : "builtin", + ".list" : "builtin", + ".ln" : "builtin", + ".loc" : "builtin", + ".loc_mark_labels" : "builtin", + ".local" : "builtin", + ".long" : "builtin", + ".macro" : "builtin", + ".mri" : "builtin", + ".noaltmacro" : "builtin", + ".nolist" : "builtin", + ".octa" : "builtin", + ".offset" : "builtin", + ".org" : "builtin", + ".p2align" : "builtin", + ".popsection" : "builtin", + ".previous" : "builtin", + ".print" : "builtin", + ".protected" : "builtin", + ".psize" : "builtin", + ".purgem" : "builtin", + ".pushsection" : "builtin", + ".quad" : "builtin", + ".reloc" : "builtin", + ".rept" : "builtin", + ".sbttl" : "builtin", + ".scl" : "builtin", + ".section" : "builtin", + ".set" : "builtin", + ".short" : "builtin", + ".single" : "builtin", + ".size" : "builtin", + ".skip" : "builtin", + ".sleb128" : "builtin", + ".space" : "builtin", + ".stab" : "builtin", + ".string" : "builtin", + ".struct" : "builtin", + ".subsection" : "builtin", + ".symver" : "builtin", + ".tag" : "builtin", + ".text" : "builtin", + ".title" : "builtin", + ".type" : "builtin", + ".uleb128" : "builtin", + ".val" : "builtin", + ".version" : "builtin", + ".vtable_entry" : "builtin", + ".vtable_inherit" : "builtin", + ".warning" : "builtin", + ".weak" : "builtin", + ".weakref" : "builtin", + ".word" : "builtin" + }; + + var registers = {}; + + function x86(_parserConfig) { + lineCommentStartSymbol = "#"; + + registers.ax = "variable"; + registers.eax = "variable-2"; + registers.rax = "variable-3"; + + registers.bx = "variable"; + registers.ebx = "variable-2"; + registers.rbx = "variable-3"; + + registers.cx = "variable"; + registers.ecx = "variable-2"; + registers.rcx = "variable-3"; + + registers.dx = "variable"; + registers.edx = "variable-2"; + registers.rdx = "variable-3"; + + registers.si = "variable"; + registers.esi = "variable-2"; + registers.rsi = "variable-3"; + + registers.di = "variable"; + registers.edi = "variable-2"; + registers.rdi = "variable-3"; + + registers.sp = "variable"; + registers.esp = "variable-2"; + registers.rsp = "variable-3"; + + registers.bp = "variable"; + registers.ebp = "variable-2"; + registers.rbp = "variable-3"; + + registers.ip = "variable"; + registers.eip = "variable-2"; + registers.rip = "variable-3"; + + registers.cs = "keyword"; + registers.ds = "keyword"; + registers.ss = "keyword"; + registers.es = "keyword"; + registers.fs = "keyword"; + registers.gs = "keyword"; + } + + function armv6(_parserConfig) { + // Reference: + // http://infocenter.arm.com/help/topic/com.arm.doc.qrc0001l/QRC0001_UAL.pdf + // http://infocenter.arm.com/help/topic/com.arm.doc.ddi0301h/DDI0301H_arm1176jzfs_r0p7_trm.pdf + lineCommentStartSymbol = "@"; + directives.syntax = "builtin"; + + registers.r0 = "variable"; + registers.r1 = "variable"; + registers.r2 = "variable"; + registers.r3 = "variable"; + registers.r4 = "variable"; + registers.r5 = "variable"; + registers.r6 = "variable"; + registers.r7 = "variable"; + registers.r8 = "variable"; + registers.r9 = "variable"; + registers.r10 = "variable"; + registers.r11 = "variable"; + registers.r12 = "variable"; + + registers.sp = "variable-2"; + registers.lr = "variable-2"; + registers.pc = "variable-2"; + registers.r13 = registers.sp; + registers.r14 = registers.lr; + registers.r15 = registers.pc; + + custom.push(function(ch, stream) { + if (ch === '#') { + stream.eatWhile(/\w/); + return "number"; + } + }); + } + + var arch = parserConfig.architecture.toLowerCase(); + if (arch === "x86") { + x86(parserConfig); + } else if (arch === "arm" || arch === "armv6") { + armv6(parserConfig); + } + + function nextUntilUnescaped(stream, end) { + var escaped = false, next; + while ((next = stream.next()) != null) { + if (next === end && !escaped) { + return false; + } + escaped = !escaped && next === "\\"; + } + return escaped; + } + + function clikeComment(stream, state) { + var maybeEnd = false, ch; + while ((ch = stream.next()) != null) { + if (ch === "/" && maybeEnd) { + state.tokenize = null; + break; + } + maybeEnd = (ch === "*"); + } + return "comment"; + } + + return { + startState: function() { + return { + tokenize: null + }; + }, + + token: function(stream, state) { + if (state.tokenize) { + return state.tokenize(stream, state); + } + + if (stream.eatSpace()) { + return null; + } + + var style, cur, ch = stream.next(); + + if (ch === "/") { + if (stream.eat("*")) { + state.tokenize = clikeComment; + return clikeComment(stream, state); + } + } + + if (ch === lineCommentStartSymbol) { + stream.skipToEnd(); + return "comment"; + } + + if (ch === '"') { + nextUntilUnescaped(stream, '"'); + return "string"; + } + + if (ch === '.') { + stream.eatWhile(/\w/); + cur = stream.current().toLowerCase(); + style = directives[cur]; + return style || null; + } + + if (ch === '=') { + stream.eatWhile(/\w/); + return "tag"; + } + + if (ch === '{') { + return "braket"; + } + + if (ch === '}') { + return "braket"; + } + + if (/\d/.test(ch)) { + if (ch === "0" && stream.eat("x")) { + stream.eatWhile(/[0-9a-fA-F]/); + return "number"; + } + stream.eatWhile(/\d/); + return "number"; + } + + if (/\w/.test(ch)) { + stream.eatWhile(/\w/); + if (stream.eat(":")) { + return 'tag'; + } + cur = stream.current().toLowerCase(); + style = registers[cur]; + return style || null; + } + + for (var i = 0; i < custom.length; i++) { + style = custom[i](ch, stream, state); + if (style) { + return style; + } + } + } + }; +}); diff --git a/modules/files/views/default/assets/mode/gas/index.html b/modules/files/views/default/assets/mode/gas/index.html new file mode 100755 index 0000000..7684bc1 --- /dev/null +++ b/modules/files/views/default/assets/mode/gas/index.html @@ -0,0 +1,57 @@ + + + + + CodeMirror: Gas mode + + + + + + + +

      CodeMirror: Gas mode

      + +
      + + + + + +

      Handles AT&T assembler syntax (more specifically this handles + the GNU Assembler (gas) syntax.) + It takes a single optional configuration parameter: + architecture, which can be one of "ARM", + "ARMv6" or "x86". + Including the parameter adds syntax for the registers and special + directives for the supplied architecture. + +

      MIME types defined: text/x-gas

      + + diff --git a/modules/files/views/default/assets/mode/gfm/gfm.js b/modules/files/views/default/assets/mode/gfm/gfm.js new file mode 100755 index 0000000..1179b53 --- /dev/null +++ b/modules/files/views/default/assets/mode/gfm/gfm.js @@ -0,0 +1,96 @@ +CodeMirror.defineMode("gfm", function(config) { + var codeDepth = 0; + function blankLine(state) { + state.code = false; + return null; + } + var gfmOverlay = { + startState: function() { + return { + code: false, + codeBlock: false, + ateSpace: false + }; + }, + copyState: function(s) { + return { + code: s.code, + codeBlock: s.codeBlock, + ateSpace: s.ateSpace + }; + }, + token: function(stream, state) { + // Hack to prevent formatting override inside code blocks (block and inline) + if (state.codeBlock) { + if (stream.match(/^```/)) { + state.codeBlock = false; + return null; + } + stream.skipToEnd(); + return null; + } + if (stream.sol()) { + state.code = false; + } + if (stream.sol() && stream.match(/^```/)) { + stream.skipToEnd(); + state.codeBlock = true; + return null; + } + // If this block is changed, it may need to be updated in Markdown mode + if (stream.peek() === '`') { + stream.next(); + var before = stream.pos; + stream.eatWhile('`'); + var difference = 1 + stream.pos - before; + if (!state.code) { + codeDepth = difference; + state.code = true; + } else { + if (difference === codeDepth) { // Must be exact + state.code = false; + } + } + return null; + } else if (state.code) { + stream.next(); + return null; + } + // Check if space. If so, links can be formatted later on + if (stream.eatSpace()) { + state.ateSpace = true; + return null; + } + if (stream.sol() || state.ateSpace) { + state.ateSpace = false; + if(stream.match(/^(?:[a-zA-Z0-9\-_]+\/)?(?:[a-zA-Z0-9\-_]+@)?(?:[a-f0-9]{7,40}\b)/)) { + // User/Project@SHA + // User@SHA + // SHA + return "link"; + } else if (stream.match(/^(?:[a-zA-Z0-9\-_]+\/)?(?:[a-zA-Z0-9\-_]+)?#[0-9]+\b/)) { + // User/Project#Num + // User#Num + // #Num + return "link"; + } + } + if (stream.match(/^((?:[a-z][\w-]+:(?:\/{1,3}|[a-z0-9%])|www\d{0,3}[.]|[a-z0-9.\-]+[.][a-z]{2,4}\/)(?:[^\s()<>]+|\([^\s()<>]*\))+(?:\([^\s()<>]*\)|[^\s`!()\[\]{};:'".,<>?«»“”‘’]))/i)) { + // URLs + // Taken from http://daringfireball.net/2010/07/improved_regex_for_matching_urls + // And then (issue #1160) simplified to make it not crash the Chrome Regexp engine + return "link"; + } + stream.next(); + return null; + }, + blankLine: blankLine + }; + CodeMirror.defineMIME("gfmBase", { + name: "markdown", + underscoresBreakWords: false, + taskLists: true, + fencedCodeBlocks: true + }); + return CodeMirror.overlayMode(CodeMirror.getMode(config, "gfmBase"), gfmOverlay); +}, "markdown"); diff --git a/modules/files/views/default/assets/mode/gfm/index.html b/modules/files/views/default/assets/mode/gfm/index.html new file mode 100755 index 0000000..826a96d --- /dev/null +++ b/modules/files/views/default/assets/mode/gfm/index.html @@ -0,0 +1,74 @@ + + + + + CodeMirror: GFM mode + + + + + + + + + + + + + + + + + +

      CodeMirror: GFM mode

      + +
      + + + +

      Optionally depends on other modes for properly highlighted code blocks.

      + +

      Parsing/Highlighting Tests: normal, verbose.

      + + + diff --git a/modules/files/views/default/assets/mode/gfm/test.js b/modules/files/views/default/assets/mode/gfm/test.js new file mode 100755 index 0000000..3ccaec5 --- /dev/null +++ b/modules/files/views/default/assets/mode/gfm/test.js @@ -0,0 +1,112 @@ +(function() { + var mode = CodeMirror.getMode({tabSize: 4}, "gfm"); + function MT(name) { test.mode(name, mode, Array.prototype.slice.call(arguments, 1)); } + + MT("emInWordAsterisk", + "foo[em *bar*]hello"); + + MT("emInWordUnderscore", + "foo_bar_hello"); + + MT("emStrongUnderscore", + "[strong __][em&strong _foo__][em _] bar"); + + MT("fencedCodeBlocks", + "[comment ```]", + "[comment foo]", + "", + "[comment ```]", + "bar"); + + MT("fencedCodeBlockModeSwitching", + "[comment ```javascript]", + "[variable foo]", + "", + "[comment ```]", + "bar"); + + MT("taskListAsterisk", + "[variable-2 * []] foo]", // Invalid; must have space or x between [] + "[variable-2 * [ ]]bar]", // Invalid; must have space after ] + "[variable-2 * [x]]hello]", // Invalid; must have space after ] + "[variable-2 * ][meta [ ]]][variable-2 [world]]]", // Valid; tests reference style links + " [variable-3 * ][property [x]]][variable-3 foo]"); // Valid; can be nested + + MT("taskListPlus", + "[variable-2 + []] foo]", // Invalid; must have space or x between [] + "[variable-2 + [ ]]bar]", // Invalid; must have space after ] + "[variable-2 + [x]]hello]", // Invalid; must have space after ] + "[variable-2 + ][meta [ ]]][variable-2 [world]]]", // Valid; tests reference style links + " [variable-3 + ][property [x]]][variable-3 foo]"); // Valid; can be nested + + MT("taskListDash", + "[variable-2 - []] foo]", // Invalid; must have space or x between [] + "[variable-2 - [ ]]bar]", // Invalid; must have space after ] + "[variable-2 - [x]]hello]", // Invalid; must have space after ] + "[variable-2 - ][meta [ ]]][variable-2 [world]]]", // Valid; tests reference style links + " [variable-3 - ][property [x]]][variable-3 foo]"); // Valid; can be nested + + MT("taskListNumber", + "[variable-2 1. []] foo]", // Invalid; must have space or x between [] + "[variable-2 2. [ ]]bar]", // Invalid; must have space after ] + "[variable-2 3. [x]]hello]", // Invalid; must have space after ] + "[variable-2 4. ][meta [ ]]][variable-2 [world]]]", // Valid; tests reference style links + " [variable-3 1. ][property [x]]][variable-3 foo]"); // Valid; can be nested + + MT("SHA", + "foo [link be6a8cc1c1ecfe9489fb51e4869af15a13fc2cd2] bar"); + + MT("shortSHA", + "foo [link be6a8cc] bar"); + + MT("tooShortSHA", + "foo be6a8c bar"); + + MT("longSHA", + "foo be6a8cc1c1ecfe9489fb51e4869af15a13fc2cd22 bar"); + + MT("badSHA", + "foo be6a8cc1c1ecfe9489fb51e4869af15a13fc2cg2 bar"); + + MT("userSHA", + "foo [link bar@be6a8cc1c1ecfe9489fb51e4869af15a13fc2cd2] hello"); + + MT("userProjectSHA", + "foo [link bar/hello@be6a8cc1c1ecfe9489fb51e4869af15a13fc2cd2] world"); + + MT("num", + "foo [link #1] bar"); + + MT("badNum", + "foo #1bar hello"); + + MT("userNum", + "foo [link bar#1] hello"); + + MT("userProjectNum", + "foo [link bar/hello#1] world"); + + MT("vanillaLink", + "foo [link http://www.example.com/] bar"); + + MT("vanillaLinkPunctuation", + "foo [link http://www.example.com/]. bar"); + + MT("vanillaLinkExtension", + "foo [link http://www.example.com/index.html] bar"); + + MT("notALink", + "[comment ```css]", + "[tag foo] {[property color][operator :][keyword black];}", + "[comment ```][link http://www.example.com/]"); + + MT("notALink", + "[comment ``foo `bar` http://www.example.com/``] hello"); + + MT("notALink", + "[comment `foo]", + "[link http://www.example.com/]", + "[comment `foo]", + "", + "[link http://www.example.com/]"); +})(); diff --git a/modules/files/views/default/assets/mode/go/go.js b/modules/files/views/default/assets/mode/go/go.js new file mode 100755 index 0000000..8b84a5c --- /dev/null +++ b/modules/files/views/default/assets/mode/go/go.js @@ -0,0 +1,165 @@ +CodeMirror.defineMode("go", function(config) { + var indentUnit = config.indentUnit; + + var keywords = { + "break":true, "case":true, "chan":true, "const":true, "continue":true, + "default":true, "defer":true, "else":true, "fallthrough":true, "for":true, + "func":true, "go":true, "goto":true, "if":true, "import":true, + "interface":true, "map":true, "package":true, "range":true, "return":true, + "select":true, "struct":true, "switch":true, "type":true, "var":true, + "bool":true, "byte":true, "complex64":true, "complex128":true, + "float32":true, "float64":true, "int8":true, "int16":true, "int32":true, + "int64":true, "string":true, "uint8":true, "uint16":true, "uint32":true, + "uint64":true, "int":true, "uint":true, "uintptr":true + }; + + var atoms = { + "true":true, "false":true, "iota":true, "nil":true, "append":true, + "cap":true, "close":true, "complex":true, "copy":true, "imag":true, + "len":true, "make":true, "new":true, "panic":true, "print":true, + "println":true, "real":true, "recover":true + }; + + var isOperatorChar = /[+\-*&^%:=<>!|\/]/; + + var curPunc; + + function tokenBase(stream, state) { + var ch = stream.next(); + if (ch == '"' || ch == "'" || ch == "`") { + state.tokenize = tokenString(ch); + return state.tokenize(stream, state); + } + if (/[\d\.]/.test(ch)) { + if (ch == ".") { + stream.match(/^[0-9]+([eE][\-+]?[0-9]+)?/); + } else if (ch == "0") { + stream.match(/^[xX][0-9a-fA-F]+/) || stream.match(/^0[0-7]+/); + } else { + stream.match(/^[0-9]*\.?[0-9]*([eE][\-+]?[0-9]+)?/); + } + return "number"; + } + if (/[\[\]{}\(\),;\:\.]/.test(ch)) { + curPunc = ch; + return null; + } + if (ch == "/") { + if (stream.eat("*")) { + state.tokenize = tokenComment; + return tokenComment(stream, state); + } + if (stream.eat("/")) { + stream.skipToEnd(); + return "comment"; + } + } + if (isOperatorChar.test(ch)) { + stream.eatWhile(isOperatorChar); + return "operator"; + } + stream.eatWhile(/[\w\$_]/); + var cur = stream.current(); + if (keywords.propertyIsEnumerable(cur)) { + if (cur == "case" || cur == "default") curPunc = "case"; + return "keyword"; + } + if (atoms.propertyIsEnumerable(cur)) return "atom"; + return "variable"; + } + + function tokenString(quote) { + return function(stream, state) { + var escaped = false, next, end = false; + while ((next = stream.next()) != null) { + if (next == quote && !escaped) {end = true; break;} + escaped = !escaped && next == "\\"; + } + if (end || !(escaped || quote == "`")) + state.tokenize = tokenBase; + return "string"; + }; + } + + function tokenComment(stream, state) { + var maybeEnd = false, ch; + while (ch = stream.next()) { + if (ch == "/" && maybeEnd) { + state.tokenize = tokenBase; + break; + } + maybeEnd = (ch == "*"); + } + return "comment"; + } + + function Context(indented, column, type, align, prev) { + this.indented = indented; + this.column = column; + this.type = type; + this.align = align; + this.prev = prev; + } + function pushContext(state, col, type) { + return state.context = new Context(state.indented, col, type, null, state.context); + } + function popContext(state) { + var t = state.context.type; + if (t == ")" || t == "]" || t == "}") + state.indented = state.context.indented; + return state.context = state.context.prev; + } + + // Interface + + return { + startState: function(basecolumn) { + return { + tokenize: null, + context: new Context((basecolumn || 0) - indentUnit, 0, "top", false), + indented: 0, + startOfLine: true + }; + }, + + token: function(stream, state) { + var ctx = state.context; + if (stream.sol()) { + if (ctx.align == null) ctx.align = false; + state.indented = stream.indentation(); + state.startOfLine = true; + if (ctx.type == "case") ctx.type = "}"; + } + if (stream.eatSpace()) return null; + curPunc = null; + var style = (state.tokenize || tokenBase)(stream, state); + if (style == "comment") return style; + if (ctx.align == null) ctx.align = true; + + if (curPunc == "{") pushContext(state, stream.column(), "}"); + else if (curPunc == "[") pushContext(state, stream.column(), "]"); + else if (curPunc == "(") pushContext(state, stream.column(), ")"); + else if (curPunc == "case") ctx.type = "case"; + else if (curPunc == "}" && ctx.type == "}") ctx = popContext(state); + else if (curPunc == ctx.type) popContext(state); + state.startOfLine = false; + return style; + }, + + indent: function(state, textAfter) { + if (state.tokenize != tokenBase && state.tokenize != null) return 0; + var ctx = state.context, firstChar = textAfter && textAfter.charAt(0); + if (ctx.type == "case" && /^(?:case|default)\b/.test(textAfter)) { + state.context.type = "}"; + return ctx.indented; + } + var closing = firstChar == ctx.type; + if (ctx.align) return ctx.column + (closing ? 0 : 1); + else return ctx.indented + (closing ? 0 : indentUnit); + }, + + electricChars: "{}:" + }; +}); + +CodeMirror.defineMIME("text/x-go", "go"); diff --git a/modules/files/views/default/assets/mode/go/index.html b/modules/files/views/default/assets/mode/go/index.html new file mode 100755 index 0000000..8a6aafc --- /dev/null +++ b/modules/files/views/default/assets/mode/go/index.html @@ -0,0 +1,74 @@ + + + + + CodeMirror: Go mode + + + + + + + + + +

      CodeMirror: Go mode

      + +
      + + + +

      MIME type: text/x-go

      + + diff --git a/modules/files/views/default/assets/mode/groovy/groovy.js b/modules/files/views/default/assets/mode/groovy/groovy.js new file mode 100755 index 0000000..92b9481 --- /dev/null +++ b/modules/files/views/default/assets/mode/groovy/groovy.js @@ -0,0 +1,210 @@ +CodeMirror.defineMode("groovy", function(config) { + function words(str) { + var obj = {}, words = str.split(" "); + for (var i = 0; i < words.length; ++i) obj[words[i]] = true; + return obj; + } + var keywords = words( + "abstract as assert boolean break byte case catch char class const continue def default " + + "do double else enum extends final finally float for goto if implements import in " + + "instanceof int interface long native new package private protected public return " + + "short static strictfp super switch synchronized threadsafe throw throws transient " + + "try void volatile while"); + var blockKeywords = words("catch class do else finally for if switch try while enum interface def"); + var atoms = words("null true false this"); + + var curPunc; + function tokenBase(stream, state) { + var ch = stream.next(); + if (ch == '"' || ch == "'") { + return startString(ch, stream, state); + } + if (/[\[\]{}\(\),;\:\.]/.test(ch)) { + curPunc = ch; + return null; + } + if (/\d/.test(ch)) { + stream.eatWhile(/[\w\.]/); + if (stream.eat(/eE/)) { stream.eat(/\+\-/); stream.eatWhile(/\d/); } + return "number"; + } + if (ch == "/") { + if (stream.eat("*")) { + state.tokenize.push(tokenComment); + return tokenComment(stream, state); + } + if (stream.eat("/")) { + stream.skipToEnd(); + return "comment"; + } + if (expectExpression(state.lastToken)) { + return startString(ch, stream, state); + } + } + if (ch == "-" && stream.eat(">")) { + curPunc = "->"; + return null; + } + if (/[+\-*&%=<>!?|\/~]/.test(ch)) { + stream.eatWhile(/[+\-*&%=<>|~]/); + return "operator"; + } + stream.eatWhile(/[\w\$_]/); + if (ch == "@") { stream.eatWhile(/[\w\$_\.]/); return "meta"; } + if (state.lastToken == ".") return "property"; + if (stream.eat(":")) { curPunc = "proplabel"; return "property"; } + var cur = stream.current(); + if (atoms.propertyIsEnumerable(cur)) { return "atom"; } + if (keywords.propertyIsEnumerable(cur)) { + if (blockKeywords.propertyIsEnumerable(cur)) curPunc = "newstatement"; + return "keyword"; + } + return "variable"; + } + tokenBase.isBase = true; + + function startString(quote, stream, state) { + var tripleQuoted = false; + if (quote != "/" && stream.eat(quote)) { + if (stream.eat(quote)) tripleQuoted = true; + else return "string"; + } + function t(stream, state) { + var escaped = false, next, end = !tripleQuoted; + while ((next = stream.next()) != null) { + if (next == quote && !escaped) { + if (!tripleQuoted) { break; } + if (stream.match(quote + quote)) { end = true; break; } + } + if (quote == '"' && next == "$" && !escaped && stream.eat("{")) { + state.tokenize.push(tokenBaseUntilBrace()); + return "string"; + } + escaped = !escaped && next == "\\"; + } + if (end) state.tokenize.pop(); + return "string"; + } + state.tokenize.push(t); + return t(stream, state); + } + + function tokenBaseUntilBrace() { + var depth = 1; + function t(stream, state) { + if (stream.peek() == "}") { + depth--; + if (depth == 0) { + state.tokenize.pop(); + return state.tokenize[state.tokenize.length-1](stream, state); + } + } else if (stream.peek() == "{") { + depth++; + } + return tokenBase(stream, state); + } + t.isBase = true; + return t; + } + + function tokenComment(stream, state) { + var maybeEnd = false, ch; + while (ch = stream.next()) { + if (ch == "/" && maybeEnd) { + state.tokenize.pop(); + break; + } + maybeEnd = (ch == "*"); + } + return "comment"; + } + + function expectExpression(last) { + return !last || last == "operator" || last == "->" || /[\.\[\{\(,;:]/.test(last) || + last == "newstatement" || last == "keyword" || last == "proplabel"; + } + + function Context(indented, column, type, align, prev) { + this.indented = indented; + this.column = column; + this.type = type; + this.align = align; + this.prev = prev; + } + function pushContext(state, col, type) { + return state.context = new Context(state.indented, col, type, null, state.context); + } + function popContext(state) { + var t = state.context.type; + if (t == ")" || t == "]" || t == "}") + state.indented = state.context.indented; + return state.context = state.context.prev; + } + + // Interface + + return { + startState: function(basecolumn) { + return { + tokenize: [tokenBase], + context: new Context((basecolumn || 0) - config.indentUnit, 0, "top", false), + indented: 0, + startOfLine: true, + lastToken: null + }; + }, + + token: function(stream, state) { + var ctx = state.context; + if (stream.sol()) { + if (ctx.align == null) ctx.align = false; + state.indented = stream.indentation(); + state.startOfLine = true; + // Automatic semicolon insertion + if (ctx.type == "statement" && !expectExpression(state.lastToken)) { + popContext(state); ctx = state.context; + } + } + if (stream.eatSpace()) return null; + curPunc = null; + var style = state.tokenize[state.tokenize.length-1](stream, state); + if (style == "comment") return style; + if (ctx.align == null) ctx.align = true; + + if ((curPunc == ";" || curPunc == ":") && ctx.type == "statement") popContext(state); + // Handle indentation for {x -> \n ... } + else if (curPunc == "->" && ctx.type == "statement" && ctx.prev.type == "}") { + popContext(state); + state.context.align = false; + } + else if (curPunc == "{") pushContext(state, stream.column(), "}"); + else if (curPunc == "[") pushContext(state, stream.column(), "]"); + else if (curPunc == "(") pushContext(state, stream.column(), ")"); + else if (curPunc == "}") { + while (ctx.type == "statement") ctx = popContext(state); + if (ctx.type == "}") ctx = popContext(state); + while (ctx.type == "statement") ctx = popContext(state); + } + else if (curPunc == ctx.type) popContext(state); + else if (ctx.type == "}" || ctx.type == "top" || (ctx.type == "statement" && curPunc == "newstatement")) + pushContext(state, stream.column(), "statement"); + state.startOfLine = false; + state.lastToken = curPunc || style; + return style; + }, + + indent: function(state, textAfter) { + if (!state.tokenize[state.tokenize.length-1].isBase) return 0; + var firstChar = textAfter && textAfter.charAt(0), ctx = state.context; + if (ctx.type == "statement" && !expectExpression(state.lastToken)) ctx = ctx.prev; + var closing = firstChar == ctx.type; + if (ctx.type == "statement") return ctx.indented + (firstChar == "{" ? 0 : config.indentUnit); + else if (ctx.align) return ctx.column + (closing ? 0 : 1); + else return ctx.indented + (closing ? 0 : config.indentUnit); + }, + + electricChars: "{}" + }; +}); + +CodeMirror.defineMIME("text/x-groovy", "groovy"); diff --git a/modules/files/views/default/assets/mode/groovy/index.html b/modules/files/views/default/assets/mode/groovy/index.html new file mode 100755 index 0000000..3d39595 --- /dev/null +++ b/modules/files/views/default/assets/mode/groovy/index.html @@ -0,0 +1,73 @@ + + + + + CodeMirror: Groovy mode + + + + + + + + +

      CodeMirror: Groovy mode

      + +
      + + + +

      MIME types defined: text/x-groovy

      + + diff --git a/modules/files/views/default/assets/mode/haskell/haskell.js b/modules/files/views/default/assets/mode/haskell/haskell.js new file mode 100755 index 0000000..faec08d --- /dev/null +++ b/modules/files/views/default/assets/mode/haskell/haskell.js @@ -0,0 +1,242 @@ +CodeMirror.defineMode("haskell", function() { + + function switchState(source, setState, f) { + setState(f); + return f(source, setState); + } + + // These should all be Unicode extended, as per the Haskell 2010 report + var smallRE = /[a-z_]/; + var largeRE = /[A-Z]/; + var digitRE = /[0-9]/; + var hexitRE = /[0-9A-Fa-f]/; + var octitRE = /[0-7]/; + var idRE = /[a-z_A-Z0-9']/; + var symbolRE = /[-!#$%&*+.\/<=>?@\\^|~:]/; + var specialRE = /[(),;[\]`{}]/; + var whiteCharRE = /[ \t\v\f]/; // newlines are handled in tokenizer + + function normal(source, setState) { + if (source.eatWhile(whiteCharRE)) { + return null; + } + + var ch = source.next(); + if (specialRE.test(ch)) { + if (ch == '{' && source.eat('-')) { + var t = "comment"; + if (source.eat('#')) { + t = "meta"; + } + return switchState(source, setState, ncomment(t, 1)); + } + return null; + } + + if (ch == '\'') { + if (source.eat('\\')) { + source.next(); // should handle other escapes here + } + else { + source.next(); + } + if (source.eat('\'')) { + return "string"; + } + return "error"; + } + + if (ch == '"') { + return switchState(source, setState, stringLiteral); + } + + if (largeRE.test(ch)) { + source.eatWhile(idRE); + if (source.eat('.')) { + return "qualifier"; + } + return "variable-2"; + } + + if (smallRE.test(ch)) { + source.eatWhile(idRE); + return "variable"; + } + + if (digitRE.test(ch)) { + if (ch == '0') { + if (source.eat(/[xX]/)) { + source.eatWhile(hexitRE); // should require at least 1 + return "integer"; + } + if (source.eat(/[oO]/)) { + source.eatWhile(octitRE); // should require at least 1 + return "number"; + } + } + source.eatWhile(digitRE); + var t = "number"; + if (source.eat('.')) { + t = "number"; + source.eatWhile(digitRE); // should require at least 1 + } + if (source.eat(/[eE]/)) { + t = "number"; + source.eat(/[-+]/); + source.eatWhile(digitRE); // should require at least 1 + } + return t; + } + + if (symbolRE.test(ch)) { + if (ch == '-' && source.eat(/-/)) { + source.eatWhile(/-/); + if (!source.eat(symbolRE)) { + source.skipToEnd(); + return "comment"; + } + } + var t = "variable"; + if (ch == ':') { + t = "variable-2"; + } + source.eatWhile(symbolRE); + return t; + } + + return "error"; + } + + function ncomment(type, nest) { + if (nest == 0) { + return normal; + } + return function(source, setState) { + var currNest = nest; + while (!source.eol()) { + var ch = source.next(); + if (ch == '{' && source.eat('-')) { + ++currNest; + } + else if (ch == '-' && source.eat('}')) { + --currNest; + if (currNest == 0) { + setState(normal); + return type; + } + } + } + setState(ncomment(type, currNest)); + return type; + }; + } + + function stringLiteral(source, setState) { + while (!source.eol()) { + var ch = source.next(); + if (ch == '"') { + setState(normal); + return "string"; + } + if (ch == '\\') { + if (source.eol() || source.eat(whiteCharRE)) { + setState(stringGap); + return "string"; + } + if (source.eat('&')) { + } + else { + source.next(); // should handle other escapes here + } + } + } + setState(normal); + return "error"; + } + + function stringGap(source, setState) { + if (source.eat('\\')) { + return switchState(source, setState, stringLiteral); + } + source.next(); + setState(normal); + return "error"; + } + + + var wellKnownWords = (function() { + var wkw = {}; + function setType(t) { + return function () { + for (var i = 0; i < arguments.length; i++) + wkw[arguments[i]] = t; + }; + } + + setType("keyword")( + "case", "class", "data", "default", "deriving", "do", "else", "foreign", + "if", "import", "in", "infix", "infixl", "infixr", "instance", "let", + "module", "newtype", "of", "then", "type", "where", "_"); + + setType("keyword")( + "\.\.", ":", "::", "=", "\\", "\"", "<-", "->", "@", "~", "=>"); + + setType("builtin")( + "!!", "$!", "$", "&&", "+", "++", "-", ".", "/", "/=", "<", "<=", "=<<", + "==", ">", ">=", ">>", ">>=", "^", "^^", "||", "*", "**"); + + setType("builtin")( + "Bool", "Bounded", "Char", "Double", "EQ", "Either", "Enum", "Eq", + "False", "FilePath", "Float", "Floating", "Fractional", "Functor", "GT", + "IO", "IOError", "Int", "Integer", "Integral", "Just", "LT", "Left", + "Maybe", "Monad", "Nothing", "Num", "Ord", "Ordering", "Rational", "Read", + "ReadS", "Real", "RealFloat", "RealFrac", "Right", "Show", "ShowS", + "String", "True"); + + setType("builtin")( + "abs", "acos", "acosh", "all", "and", "any", "appendFile", "asTypeOf", + "asin", "asinh", "atan", "atan2", "atanh", "break", "catch", "ceiling", + "compare", "concat", "concatMap", "const", "cos", "cosh", "curry", + "cycle", "decodeFloat", "div", "divMod", "drop", "dropWhile", "either", + "elem", "encodeFloat", "enumFrom", "enumFromThen", "enumFromThenTo", + "enumFromTo", "error", "even", "exp", "exponent", "fail", "filter", + "flip", "floatDigits", "floatRadix", "floatRange", "floor", "fmap", + "foldl", "foldl1", "foldr", "foldr1", "fromEnum", "fromInteger", + "fromIntegral", "fromRational", "fst", "gcd", "getChar", "getContents", + "getLine", "head", "id", "init", "interact", "ioError", "isDenormalized", + "isIEEE", "isInfinite", "isNaN", "isNegativeZero", "iterate", "last", + "lcm", "length", "lex", "lines", "log", "logBase", "lookup", "map", + "mapM", "mapM_", "max", "maxBound", "maximum", "maybe", "min", "minBound", + "minimum", "mod", "negate", "not", "notElem", "null", "odd", "or", + "otherwise", "pi", "pred", "print", "product", "properFraction", + "putChar", "putStr", "putStrLn", "quot", "quotRem", "read", "readFile", + "readIO", "readList", "readLn", "readParen", "reads", "readsPrec", + "realToFrac", "recip", "rem", "repeat", "replicate", "return", "reverse", + "round", "scaleFloat", "scanl", "scanl1", "scanr", "scanr1", "seq", + "sequence", "sequence_", "show", "showChar", "showList", "showParen", + "showString", "shows", "showsPrec", "significand", "signum", "sin", + "sinh", "snd", "span", "splitAt", "sqrt", "subtract", "succ", "sum", + "tail", "take", "takeWhile", "tan", "tanh", "toEnum", "toInteger", + "toRational", "truncate", "uncurry", "undefined", "unlines", "until", + "unwords", "unzip", "unzip3", "userError", "words", "writeFile", "zip", + "zip3", "zipWith", "zipWith3"); + + return wkw; + })(); + + + + return { + startState: function () { return { f: normal }; }, + copyState: function (s) { return { f: s.f }; }, + + token: function(stream, state) { + var t = state.f(stream, function(s) { state.f = s; }); + var w = stream.current(); + return (w in wellKnownWords) ? wellKnownWords[w] : t; + } + }; + +}); + +CodeMirror.defineMIME("text/x-haskell", "haskell"); diff --git a/modules/files/views/default/assets/mode/haskell/index.html b/modules/files/views/default/assets/mode/haskell/index.html new file mode 100755 index 0000000..56307b8 --- /dev/null +++ b/modules/files/views/default/assets/mode/haskell/index.html @@ -0,0 +1,62 @@ + + + + + CodeMirror: Haskell mode + + + + + + + + + +

      CodeMirror: Haskell mode

      + +
      + + + +

      MIME types defined: text/x-haskell.

      + + diff --git a/modules/files/views/default/assets/mode/haxe/haxe.js b/modules/files/views/default/assets/mode/haxe/haxe.js new file mode 100755 index 0000000..28f9b00 --- /dev/null +++ b/modules/files/views/default/assets/mode/haxe/haxe.js @@ -0,0 +1,429 @@ +CodeMirror.defineMode("haxe", function(config, parserConfig) { + var indentUnit = config.indentUnit; + + // Tokenizer + + var keywords = function(){ + function kw(type) {return {type: type, style: "keyword"};} + var A = kw("keyword a"), B = kw("keyword b"), C = kw("keyword c"); + var operator = kw("operator"), atom = {type: "atom", style: "atom"}, attribute = {type:"attribute", style: "attribute"}; + var type = kw("typedef"); + return { + "if": A, "while": A, "else": B, "do": B, "try": B, + "return": C, "break": C, "continue": C, "new": C, "throw": C, + "var": kw("var"), "inline":attribute, "static": attribute, "using":kw("import"), + "public": attribute, "private": attribute, "cast": kw("cast"), "import": kw("import"), "macro": kw("macro"), + "function": kw("function"), "catch": kw("catch"), "untyped": kw("untyped"), "callback": kw("cb"), + "for": kw("for"), "switch": kw("switch"), "case": kw("case"), "default": kw("default"), + "in": operator, "never": kw("property_access"), "trace":kw("trace"), + "class": type, "enum":type, "interface":type, "typedef":type, "extends":type, "implements":type, "dynamic":type, + "true": atom, "false": atom, "null": atom + }; + }(); + + var isOperatorChar = /[+\-*&%=<>!?|]/; + + function chain(stream, state, f) { + state.tokenize = f; + return f(stream, state); + } + + function nextUntilUnescaped(stream, end) { + var escaped = false, next; + while ((next = stream.next()) != null) { + if (next == end && !escaped) + return false; + escaped = !escaped && next == "\\"; + } + return escaped; + } + + // Used as scratch variables to communicate multiple values without + // consing up tons of objects. + var type, content; + function ret(tp, style, cont) { + type = tp; content = cont; + return style; + } + + function haxeTokenBase(stream, state) { + var ch = stream.next(); + if (ch == '"' || ch == "'") + return chain(stream, state, haxeTokenString(ch)); + else if (/[\[\]{}\(\),;\:\.]/.test(ch)) + return ret(ch); + else if (ch == "0" && stream.eat(/x/i)) { + stream.eatWhile(/[\da-f]/i); + return ret("number", "number"); + } + else if (/\d/.test(ch) || ch == "-" && stream.eat(/\d/)) { + stream.match(/^\d*(?:\.\d*)?(?:[eE][+\-]?\d+)?/); + return ret("number", "number"); + } + else if (state.reAllowed && (ch == "~" && stream.eat(/\//))) { + nextUntilUnescaped(stream, "/"); + stream.eatWhile(/[gimsu]/); + return ret("regexp", "string-2"); + } + else if (ch == "/") { + if (stream.eat("*")) { + return chain(stream, state, haxeTokenComment); + } + else if (stream.eat("/")) { + stream.skipToEnd(); + return ret("comment", "comment"); + } + else { + stream.eatWhile(isOperatorChar); + return ret("operator", null, stream.current()); + } + } + else if (ch == "#") { + stream.skipToEnd(); + return ret("conditional", "meta"); + } + else if (ch == "@") { + stream.eat(/:/); + stream.eatWhile(/[\w_]/); + return ret ("metadata", "meta"); + } + else if (isOperatorChar.test(ch)) { + stream.eatWhile(isOperatorChar); + return ret("operator", null, stream.current()); + } + else { + var word; + if(/[A-Z]/.test(ch)) + { + stream.eatWhile(/[\w_<>]/); + word = stream.current(); + return ret("type", "variable-3", word); + } + else + { + stream.eatWhile(/[\w_]/); + var word = stream.current(), known = keywords.propertyIsEnumerable(word) && keywords[word]; + return (known && state.kwAllowed) ? ret(known.type, known.style, word) : + ret("variable", "variable", word); + } + } + } + + function haxeTokenString(quote) { + return function(stream, state) { + if (!nextUntilUnescaped(stream, quote)) + state.tokenize = haxeTokenBase; + return ret("string", "string"); + }; + } + + function haxeTokenComment(stream, state) { + var maybeEnd = false, ch; + while (ch = stream.next()) { + if (ch == "/" && maybeEnd) { + state.tokenize = haxeTokenBase; + break; + } + maybeEnd = (ch == "*"); + } + return ret("comment", "comment"); + } + + // Parser + + var atomicTypes = {"atom": true, "number": true, "variable": true, "string": true, "regexp": true}; + + function HaxeLexical(indented, column, type, align, prev, info) { + this.indented = indented; + this.column = column; + this.type = type; + this.prev = prev; + this.info = info; + if (align != null) this.align = align; + } + + function inScope(state, varname) { + for (var v = state.localVars; v; v = v.next) + if (v.name == varname) return true; + } + + function parseHaxe(state, style, type, content, stream) { + var cc = state.cc; + // Communicate our context to the combinators. + // (Less wasteful than consing up a hundred closures on every call.) + cx.state = state; cx.stream = stream; cx.marked = null, cx.cc = cc; + + if (!state.lexical.hasOwnProperty("align")) + state.lexical.align = true; + + while(true) { + var combinator = cc.length ? cc.pop() : statement; + if (combinator(type, content)) { + while(cc.length && cc[cc.length - 1].lex) + cc.pop()(); + if (cx.marked) return cx.marked; + if (type == "variable" && inScope(state, content)) return "variable-2"; + if (type == "variable" && imported(state, content)) return "variable-3"; + return style; + } + } + } + + function imported(state, typename) + { + if (/[a-z]/.test(typename.charAt(0))) + return false; + var len = state.importedtypes.length; + for (var i = 0; i= 0; i--) cx.cc.push(arguments[i]); + } + function cont() { + pass.apply(null, arguments); + return true; + } + function register(varname) { + var state = cx.state; + if (state.context) { + cx.marked = "def"; + for (var v = state.localVars; v; v = v.next) + if (v.name == varname) return; + state.localVars = {name: varname, next: state.localVars}; + } + } + + // Combinators + + var defaultVars = {name: "this", next: null}; + function pushcontext() { + if (!cx.state.context) cx.state.localVars = defaultVars; + cx.state.context = {prev: cx.state.context, vars: cx.state.localVars}; + } + function popcontext() { + cx.state.localVars = cx.state.context.vars; + cx.state.context = cx.state.context.prev; + } + function pushlex(type, info) { + var result = function() { + var state = cx.state; + state.lexical = new HaxeLexical(state.indented, cx.stream.column(), type, null, state.lexical, info); + }; + result.lex = true; + return result; + } + function poplex() { + var state = cx.state; + if (state.lexical.prev) { + if (state.lexical.type == ")") + state.indented = state.lexical.indented; + state.lexical = state.lexical.prev; + } + } + poplex.lex = true; + + function expect(wanted) { + return function(type) { + if (type == wanted) return cont(); + else if (wanted == ";") return pass(); + else return cont(arguments.callee); + }; + } + + function statement(type) { + if (type == "@") return cont(metadef); + if (type == "var") return cont(pushlex("vardef"), vardef1, expect(";"), poplex); + if (type == "keyword a") return cont(pushlex("form"), expression, statement, poplex); + if (type == "keyword b") return cont(pushlex("form"), statement, poplex); + if (type == "{") return cont(pushlex("}"), pushcontext, block, poplex, popcontext); + if (type == ";") return cont(); + if (type == "attribute") return cont(maybeattribute); + if (type == "function") return cont(functiondef); + if (type == "for") return cont(pushlex("form"), expect("("), pushlex(")"), forspec1, expect(")"), + poplex, statement, poplex); + if (type == "variable") return cont(pushlex("stat"), maybelabel); + if (type == "switch") return cont(pushlex("form"), expression, pushlex("}", "switch"), expect("{"), + block, poplex, poplex); + if (type == "case") return cont(expression, expect(":")); + if (type == "default") return cont(expect(":")); + if (type == "catch") return cont(pushlex("form"), pushcontext, expect("("), funarg, expect(")"), + statement, poplex, popcontext); + if (type == "import") return cont(importdef, expect(";")); + if (type == "typedef") return cont(typedef); + return pass(pushlex("stat"), expression, expect(";"), poplex); + } + function expression(type) { + if (atomicTypes.hasOwnProperty(type)) return cont(maybeoperator); + if (type == "function") return cont(functiondef); + if (type == "keyword c") return cont(maybeexpression); + if (type == "(") return cont(pushlex(")"), maybeexpression, expect(")"), poplex, maybeoperator); + if (type == "operator") return cont(expression); + if (type == "[") return cont(pushlex("]"), commasep(expression, "]"), poplex, maybeoperator); + if (type == "{") return cont(pushlex("}"), commasep(objprop, "}"), poplex, maybeoperator); + return cont(); + } + function maybeexpression(type) { + if (type.match(/[;\}\)\],]/)) return pass(); + return pass(expression); + } + + function maybeoperator(type, value) { + if (type == "operator" && /\+\+|--/.test(value)) return cont(maybeoperator); + if (type == "operator" || type == ":") return cont(expression); + if (type == ";") return; + if (type == "(") return cont(pushlex(")"), commasep(expression, ")"), poplex, maybeoperator); + if (type == ".") return cont(property, maybeoperator); + if (type == "[") return cont(pushlex("]"), expression, expect("]"), poplex, maybeoperator); + } + + function maybeattribute(type) { + if (type == "attribute") return cont(maybeattribute); + if (type == "function") return cont(functiondef); + if (type == "var") return cont(vardef1); + } + + function metadef(type) { + if(type == ":") return cont(metadef); + if(type == "variable") return cont(metadef); + if(type == "(") return cont(pushlex(")"), comasep(metaargs, ")"), poplex, statement); + } + function metaargs(type) { + if(type == "variable") return cont(); + } + + function importdef (type, value) { + if(type == "variable" && /[A-Z]/.test(value.charAt(0))) { registerimport(value); return cont(); } + else if(type == "variable" || type == "property" || type == ".") return cont(importdef); + } + + function typedef (type, value) + { + if(type == "variable" && /[A-Z]/.test(value.charAt(0))) { registerimport(value); return cont(); } + } + + function maybelabel(type) { + if (type == ":") return cont(poplex, statement); + return pass(maybeoperator, expect(";"), poplex); + } + function property(type) { + if (type == "variable") {cx.marked = "property"; return cont();} + } + function objprop(type) { + if (type == "variable") cx.marked = "property"; + if (atomicTypes.hasOwnProperty(type)) return cont(expect(":"), expression); + } + function commasep(what, end) { + function proceed(type) { + if (type == ",") return cont(what, proceed); + if (type == end) return cont(); + return cont(expect(end)); + } + return function(type) { + if (type == end) return cont(); + else return pass(what, proceed); + }; + } + function block(type) { + if (type == "}") return cont(); + return pass(statement, block); + } + function vardef1(type, value) { + if (type == "variable"){register(value); return cont(typeuse, vardef2);} + return cont(); + } + function vardef2(type, value) { + if (value == "=") return cont(expression, vardef2); + if (type == ",") return cont(vardef1); + } + function forspec1(type, value) { + if (type == "variable") { + register(value); + } + return cont(pushlex(")"), pushcontext, forin, expression, poplex, statement, popcontext); + } + function forin(_type, value) { + if (value == "in") return cont(); + } + function functiondef(type, value) { + if (type == "variable") {register(value); return cont(functiondef);} + if (value == "new") return cont(functiondef); + if (type == "(") return cont(pushlex(")"), pushcontext, commasep(funarg, ")"), poplex, typeuse, statement, popcontext); + } + function typeuse(type) { + if(type == ":") return cont(typestring); + } + function typestring(type) { + if(type == "type") return cont(); + if(type == "variable") return cont(); + if(type == "{") return cont(pushlex("}"), commasep(typeprop, "}"), poplex); + } + function typeprop(type) { + if(type == "variable") return cont(typeuse); + } + function funarg(type, value) { + if (type == "variable") {register(value); return cont(typeuse);} + } + + // Interface + + return { + startState: function(basecolumn) { + var defaulttypes = ["Int", "Float", "String", "Void", "Std", "Bool", "Dynamic", "Array"]; + return { + tokenize: haxeTokenBase, + reAllowed: true, + kwAllowed: true, + cc: [], + lexical: new HaxeLexical((basecolumn || 0) - indentUnit, 0, "block", false), + localVars: parserConfig.localVars, + importedtypes: defaulttypes, + context: parserConfig.localVars && {vars: parserConfig.localVars}, + indented: 0 + }; + }, + + token: function(stream, state) { + if (stream.sol()) { + if (!state.lexical.hasOwnProperty("align")) + state.lexical.align = false; + state.indented = stream.indentation(); + } + if (stream.eatSpace()) return null; + var style = state.tokenize(stream, state); + if (type == "comment") return style; + state.reAllowed = !!(type == "operator" || type == "keyword c" || type.match(/^[\[{}\(,;:]$/)); + state.kwAllowed = type != '.'; + return parseHaxe(state, style, type, content, stream); + }, + + indent: function(state, textAfter) { + if (state.tokenize != haxeTokenBase) return 0; + var firstChar = textAfter && textAfter.charAt(0), lexical = state.lexical; + if (lexical.type == "stat" && firstChar == "}") lexical = lexical.prev; + var type = lexical.type, closing = firstChar == type; + if (type == "vardef") return lexical.indented + 4; + else if (type == "form" && firstChar == "{") return lexical.indented; + else if (type == "stat" || type == "form") return lexical.indented + indentUnit; + else if (lexical.info == "switch" && !closing) + return lexical.indented + (/^(?:case|default)\b/.test(textAfter) ? indentUnit : 2 * indentUnit); + else if (lexical.align) return lexical.column + (closing ? 0 : 1); + else return lexical.indented + (closing ? 0 : indentUnit); + }, + + electricChars: "{}" + }; +}); + +CodeMirror.defineMIME("text/x-haxe", "haxe"); diff --git a/modules/files/views/default/assets/mode/haxe/index.html b/modules/files/views/default/assets/mode/haxe/index.html new file mode 100755 index 0000000..1125741 --- /dev/null +++ b/modules/files/views/default/assets/mode/haxe/index.html @@ -0,0 +1,90 @@ + + + + + CodeMirror: Haxe mode + + + + + + + +

      CodeMirror: Haxe mode

      + +
      + + + +

      MIME types defined: text/x-haxe.

      + + diff --git a/modules/files/views/default/assets/mode/htmlembedded/htmlembedded.js b/modules/files/views/default/assets/mode/htmlembedded/htmlembedded.js new file mode 100755 index 0000000..ff6dfd2 --- /dev/null +++ b/modules/files/views/default/assets/mode/htmlembedded/htmlembedded.js @@ -0,0 +1,73 @@ +CodeMirror.defineMode("htmlembedded", function(config, parserConfig) { + + //config settings + var scriptStartRegex = parserConfig.scriptStartRegex || /^<%/i, + scriptEndRegex = parserConfig.scriptEndRegex || /^%>/i; + + //inner modes + var scriptingMode, htmlMixedMode; + + //tokenizer when in html mode + function htmlDispatch(stream, state) { + if (stream.match(scriptStartRegex, false)) { + state.token=scriptingDispatch; + return scriptingMode.token(stream, state.scriptState); + } + else + return htmlMixedMode.token(stream, state.htmlState); + } + + //tokenizer when in scripting mode + function scriptingDispatch(stream, state) { + if (stream.match(scriptEndRegex, false)) { + state.token=htmlDispatch; + return htmlMixedMode.token(stream, state.htmlState); + } + else + return scriptingMode.token(stream, state.scriptState); + } + + + return { + startState: function() { + scriptingMode = scriptingMode || CodeMirror.getMode(config, parserConfig.scriptingModeSpec); + htmlMixedMode = htmlMixedMode || CodeMirror.getMode(config, "htmlmixed"); + return { + token : parserConfig.startOpen ? scriptingDispatch : htmlDispatch, + htmlState : CodeMirror.startState(htmlMixedMode), + scriptState : CodeMirror.startState(scriptingMode) + }; + }, + + token: function(stream, state) { + return state.token(stream, state); + }, + + indent: function(state, textAfter) { + if (state.token == htmlDispatch) + return htmlMixedMode.indent(state.htmlState, textAfter); + else if (scriptingMode.indent) + return scriptingMode.indent(state.scriptState, textAfter); + }, + + copyState: function(state) { + return { + token : state.token, + htmlState : CodeMirror.copyState(htmlMixedMode, state.htmlState), + scriptState : CodeMirror.copyState(scriptingMode, state.scriptState) + }; + }, + + electricChars: "/{}:", + + innerMode: function(state) { + if (state.token == scriptingDispatch) return {state: state.scriptState, mode: scriptingMode}; + else return {state: state.htmlState, mode: htmlMixedMode}; + } + }; +}, "htmlmixed"); + +CodeMirror.defineMIME("application/x-ejs", { name: "htmlembedded", scriptingModeSpec:"javascript"}); +CodeMirror.defineMIME("application/x-aspx", { name: "htmlembedded", scriptingModeSpec:"text/x-csharp"}); +CodeMirror.defineMIME("application/x-jsp", { name: "htmlembedded", scriptingModeSpec:"text/x-java"}); +CodeMirror.defineMIME("application/x-erb", { name: "htmlembedded", scriptingModeSpec:"ruby"}); diff --git a/modules/files/views/default/assets/mode/htmlembedded/index.html b/modules/files/views/default/assets/mode/htmlembedded/index.html new file mode 100755 index 0000000..5a37dd6 --- /dev/null +++ b/modules/files/views/default/assets/mode/htmlembedded/index.html @@ -0,0 +1,49 @@ + + + + + CodeMirror: Html Embedded Scripts mode + + + + + + + + + + + +

      CodeMirror: Html Embedded Scripts mode

      + +
      + + + +

      Mode for html embedded scripts like JSP and ASP.NET. Depends on HtmlMixed which in turn depends on + JavaScript, CSS and XML.
      Other dependancies include those of the scriping language chosen.

      + +

      MIME types defined: application/x-aspx (ASP.NET), + application/x-ejs (Embedded Javascript), application/x-jsp (JavaServer Pages)

      + + diff --git a/modules/files/views/default/assets/mode/htmlmixed/htmlmixed.js b/modules/files/views/default/assets/mode/htmlmixed/htmlmixed.js new file mode 100755 index 0000000..ec0c21d --- /dev/null +++ b/modules/files/views/default/assets/mode/htmlmixed/htmlmixed.js @@ -0,0 +1,104 @@ +CodeMirror.defineMode("htmlmixed", function(config, parserConfig) { + var htmlMode = CodeMirror.getMode(config, {name: "xml", htmlMode: true}); + var cssMode = CodeMirror.getMode(config, "css"); + + var scriptTypes = [], scriptTypesConf = parserConfig && parserConfig.scriptTypes; + scriptTypes.push({matches: /^(?:text|application)\/(?:x-)?(?:java|ecma)script$|^$/i, + mode: CodeMirror.getMode(config, "javascript")}); + if (scriptTypesConf) for (var i = 0; i < scriptTypesConf.length; ++i) { + var conf = scriptTypesConf[i]; + scriptTypes.push({matches: conf.matches, mode: conf.mode && CodeMirror.getMode(config, conf.mode)}); + } + scriptTypes.push({matches: /./, + mode: CodeMirror.getMode(config, "text/plain")}); + + function html(stream, state) { + var tagName = state.htmlState.tagName; + var style = htmlMode.token(stream, state.htmlState); + if (tagName == "script" && /\btag\b/.test(style) && stream.current() == ">") { + // Script block: mode to change to depends on type attribute + var scriptType = stream.string.slice(Math.max(0, stream.pos - 100), stream.pos).match(/\btype\s*=\s*("[^"]+"|'[^']+'|\S+)[^<]*$/i); + scriptType = scriptType ? scriptType[1] : ""; + if (scriptType && /[\"\']/.test(scriptType.charAt(0))) scriptType = scriptType.slice(1, scriptType.length - 1); + for (var i = 0; i < scriptTypes.length; ++i) { + var tp = scriptTypes[i]; + if (typeof tp.matches == "string" ? scriptType == tp.matches : tp.matches.test(scriptType)) { + if (tp.mode) { + state.token = script; + state.localMode = tp.mode; + state.localState = tp.mode.startState && tp.mode.startState(htmlMode.indent(state.htmlState, "")); + } + break; + } + } + } else if (tagName == "style" && /\btag\b/.test(style) && stream.current() == ">") { + state.token = css; + state.localMode = cssMode; + state.localState = cssMode.startState(htmlMode.indent(state.htmlState, "")); + } + return style; + } + function maybeBackup(stream, pat, style) { + var cur = stream.current(); + var close = cur.search(pat), m; + if (close > -1) stream.backUp(cur.length - close); + else if (m = cur.match(/<\/?$/)) { + stream.backUp(cur.length); + if (!stream.match(pat, false)) stream.match(cur[0]); + } + return style; + } + function script(stream, state) { + if (stream.match(/^<\/\s*script\s*>/i, false)) { + state.token = html; + state.localState = state.localMode = null; + return html(stream, state); + } + return maybeBackup(stream, /<\/\s*script\s*>/, + state.localMode.token(stream, state.localState)); + } + function css(stream, state) { + if (stream.match(/^<\/\s*style\s*>/i, false)) { + state.token = html; + state.localState = state.localMode = null; + return html(stream, state); + } + return maybeBackup(stream, /<\/\s*style\s*>/, + cssMode.token(stream, state.localState)); + } + + return { + startState: function() { + var state = htmlMode.startState(); + return {token: html, localMode: null, localState: null, htmlState: state}; + }, + + copyState: function(state) { + if (state.localState) + var local = CodeMirror.copyState(state.localMode, state.localState); + return {token: state.token, localMode: state.localMode, localState: local, + htmlState: CodeMirror.copyState(htmlMode, state.htmlState)}; + }, + + token: function(stream, state) { + return state.token(stream, state); + }, + + indent: function(state, textAfter) { + if (!state.localMode || /^\s*<\//.test(textAfter)) + return htmlMode.indent(state.htmlState, textAfter); + else if (state.localMode.indent) + return state.localMode.indent(state.localState, textAfter); + else + return CodeMirror.Pass; + }, + + electricChars: "/{}:", + + innerMode: function(state) { + return {state: state.localState || state.htmlState, mode: state.localMode || htmlMode}; + } + }; +}, "xml", "javascript", "css"); + +CodeMirror.defineMIME("text/html", "htmlmixed"); diff --git a/modules/files/views/default/assets/mode/htmlmixed/index.html b/modules/files/views/default/assets/mode/htmlmixed/index.html new file mode 100755 index 0000000..c56559e --- /dev/null +++ b/modules/files/views/default/assets/mode/htmlmixed/index.html @@ -0,0 +1,73 @@ + + + + + CodeMirror: HTML mixed mode + + + + + + + + + + + +

      CodeMirror: HTML mixed mode

      +
      + + +

      The HTML mixed mode depends on the XML, JavaScript, and CSS modes.

      + +

      It takes an optional mode configuration + option, scriptTypes, which can be used to add custom + behavior for specific <script type="..."> tags. If + given, it should hold an array of {matches, mode} + objects, where matches is a string or regexp that + matches the script type, and mode is + either null, for script types that should stay in + HTML mode, or a mode + spec corresponding to the mode that should be used for the + script.

      + +

      MIME types defined: text/html + (redefined, only takes effect if you load this parser after the + XML parser).

      + + + diff --git a/modules/files/views/default/assets/mode/http/http.js b/modules/files/views/default/assets/mode/http/http.js new file mode 100755 index 0000000..5a51636 --- /dev/null +++ b/modules/files/views/default/assets/mode/http/http.js @@ -0,0 +1,98 @@ +CodeMirror.defineMode("http", function() { + function failFirstLine(stream, state) { + stream.skipToEnd(); + state.cur = header; + return "error"; + } + + function start(stream, state) { + if (stream.match(/^HTTP\/\d\.\d/)) { + state.cur = responseStatusCode; + return "keyword"; + } else if (stream.match(/^[A-Z]+/) && /[ \t]/.test(stream.peek())) { + state.cur = requestPath; + return "keyword"; + } else { + return failFirstLine(stream, state); + } + } + + function responseStatusCode(stream, state) { + var code = stream.match(/^\d+/); + if (!code) return failFirstLine(stream, state); + + state.cur = responseStatusText; + var status = Number(code[0]); + if (status >= 100 && status < 200) { + return "positive informational"; + } else if (status >= 200 && status < 300) { + return "positive success"; + } else if (status >= 300 && status < 400) { + return "positive redirect"; + } else if (status >= 400 && status < 500) { + return "negative client-error"; + } else if (status >= 500 && status < 600) { + return "negative server-error"; + } else { + return "error"; + } + } + + function responseStatusText(stream, state) { + stream.skipToEnd(); + state.cur = header; + return null; + } + + function requestPath(stream, state) { + stream.eatWhile(/\S/); + state.cur = requestProtocol; + return "string-2"; + } + + function requestProtocol(stream, state) { + if (stream.match(/^HTTP\/\d\.\d$/)) { + state.cur = header; + return "keyword"; + } else { + return failFirstLine(stream, state); + } + } + + function header(stream) { + if (stream.sol() && !stream.eat(/[ \t]/)) { + if (stream.match(/^.*?:/)) { + return "atom"; + } else { + stream.skipToEnd(); + return "error"; + } + } else { + stream.skipToEnd(); + return "string"; + } + } + + function body(stream) { + stream.skipToEnd(); + return null; + } + + return { + token: function(stream, state) { + var cur = state.cur; + if (cur != header && cur != body && stream.eatSpace()) return null; + return cur(stream, state); + }, + + blankLine: function(state) { + state.cur = body; + }, + + startState: function() { + return {cur: start}; + } + }; +}); + +CodeMirror.defineMIME("message/http", "http"); diff --git a/modules/files/views/default/assets/mode/http/index.html b/modules/files/views/default/assets/mode/http/index.html new file mode 100755 index 0000000..124eb84 --- /dev/null +++ b/modules/files/views/default/assets/mode/http/index.html @@ -0,0 +1,32 @@ + + + + + CodeMirror: HTTP mode + + + + + + + +

      CodeMirror: HTTP mode

      + +
      + + + +

      MIME types defined: message/http.

      + + diff --git a/modules/files/views/default/assets/mode/javascript/index.html b/modules/files/views/default/assets/mode/javascript/index.html new file mode 100755 index 0000000..dd0ca22 --- /dev/null +++ b/modules/files/views/default/assets/mode/javascript/index.html @@ -0,0 +1,92 @@ + + + + + CodeMirror: JavaScript mode + + + + + + + + + +

      CodeMirror: JavaScript mode

      + +
      + + + +

      + JavaScript mode supports a two configuration + options: +

        +
      • json which will set the mode to expect JSON + data rather than a JavaScript program.
        • +
      • typescript which will activate additional + syntax highlighting and some other things for TypeScript code + (demo).
        • +
      • statementIndent which (given a number) will + determine the amount of indentation to use for statements + continued on a new line.
        • +
      +

      + +

      MIME types defined: text/javascript, application/json, text/typescript, application/typescript.

      + + diff --git a/modules/files/views/default/assets/mode/javascript/javascript.js b/modules/files/views/default/assets/mode/javascript/javascript.js new file mode 100755 index 0000000..08c1cb1 --- /dev/null +++ b/modules/files/views/default/assets/mode/javascript/javascript.js @@ -0,0 +1,467 @@ +// TODO actually recognize syntax of TypeScript constructs + +CodeMirror.defineMode("javascript", function(config, parserConfig) { + var indentUnit = config.indentUnit; + var jsonMode = parserConfig.json; + var isTS = parserConfig.typescript; + + // Tokenizer + + var keywords = function(){ + function kw(type) {return {type: type, style: "keyword"};} + var A = kw("keyword a"), B = kw("keyword b"), C = kw("keyword c"); + var operator = kw("operator"), atom = {type: "atom", style: "atom"}; + + var jsKeywords = { + "if": kw("if"), "while": A, "with": A, "else": B, "do": B, "try": B, "finally": B, + "return": C, "break": C, "continue": C, "new": C, "delete": C, "throw": C, + "var": kw("var"), "const": kw("var"), "let": kw("var"), + "function": kw("function"), "catch": kw("catch"), + "for": kw("for"), "switch": kw("switch"), "case": kw("case"), "default": kw("default"), + "in": operator, "typeof": operator, "instanceof": operator, + "true": atom, "false": atom, "null": atom, "undefined": atom, "NaN": atom, "Infinity": atom, + "this": kw("this") + }; + + // Extend the 'normal' keywords with the TypeScript language extensions + if (isTS) { + var type = {type: "variable", style: "variable-3"}; + var tsKeywords = { + // object-like things + "interface": kw("interface"), + "class": kw("class"), + "extends": kw("extends"), + "constructor": kw("constructor"), + + // scope modifiers + "public": kw("public"), + "private": kw("private"), + "protected": kw("protected"), + "static": kw("static"), + + "super": kw("super"), + + // types + "string": type, "number": type, "bool": type, "any": type + }; + + for (var attr in tsKeywords) { + jsKeywords[attr] = tsKeywords[attr]; + } + } + + return jsKeywords; + }(); + + var isOperatorChar = /[+\-*&%=<>!?|~^]/; + + function chain(stream, state, f) { + state.tokenize = f; + return f(stream, state); + } + + function nextUntilUnescaped(stream, end) { + var escaped = false, next; + while ((next = stream.next()) != null) { + if (next == end && !escaped) + return false; + escaped = !escaped && next == "\\"; + } + return escaped; + } + + // Used as scratch variables to communicate multiple values without + // consing up tons of objects. + var type, content; + function ret(tp, style, cont) { + type = tp; content = cont; + return style; + } + + function jsTokenBase(stream, state) { + var ch = stream.next(); + if (ch == '"' || ch == "'") + return chain(stream, state, jsTokenString(ch)); + else if (/[\[\]{}\(\),;\:\.]/.test(ch)) + return ret(ch); + else if (ch == "0" && stream.eat(/x/i)) { + stream.eatWhile(/[\da-f]/i); + return ret("number", "number"); + } + else if (/\d/.test(ch) || ch == "-" && stream.eat(/\d/)) { + stream.match(/^\d*(?:\.\d*)?(?:[eE][+\-]?\d+)?/); + return ret("number", "number"); + } + else if (ch == "/") { + if (stream.eat("*")) { + return chain(stream, state, jsTokenComment); + } + else if (stream.eat("/")) { + stream.skipToEnd(); + return ret("comment", "comment"); + } + else if (state.lastType == "operator" || state.lastType == "keyword c" || + /^[\[{}\(,;:]$/.test(state.lastType)) { + nextUntilUnescaped(stream, "/"); + stream.eatWhile(/[gimy]/); // 'y' is "sticky" option in Mozilla + return ret("regexp", "string-2"); + } + else { + stream.eatWhile(isOperatorChar); + return ret("operator", null, stream.current()); + } + } + else if (ch == "#") { + stream.skipToEnd(); + return ret("error", "error"); + } + else if (isOperatorChar.test(ch)) { + stream.eatWhile(isOperatorChar); + return ret("operator", null, stream.current()); + } + else { + stream.eatWhile(/[\w\$_]/); + var word = stream.current(), known = keywords.propertyIsEnumerable(word) && keywords[word]; + return (known && state.lastType != ".") ? ret(known.type, known.style, word) : + ret("variable", "variable", word); + } + } + + function jsTokenString(quote) { + return function(stream, state) { + if (!nextUntilUnescaped(stream, quote)) + state.tokenize = jsTokenBase; + return ret("string", "string"); + }; + } + + function jsTokenComment(stream, state) { + var maybeEnd = false, ch; + while (ch = stream.next()) { + if (ch == "/" && maybeEnd) { + state.tokenize = jsTokenBase; + break; + } + maybeEnd = (ch == "*"); + } + return ret("comment", "comment"); + } + + // Parser + + var atomicTypes = {"atom": true, "number": true, "variable": true, "string": true, "regexp": true, "this": true}; + + function JSLexical(indented, column, type, align, prev, info) { + this.indented = indented; + this.column = column; + this.type = type; + this.prev = prev; + this.info = info; + if (align != null) this.align = align; + } + + function inScope(state, varname) { + for (var v = state.localVars; v; v = v.next) + if (v.name == varname) return true; + } + + function parseJS(state, style, type, content, stream) { + var cc = state.cc; + // Communicate our context to the combinators. + // (Less wasteful than consing up a hundred closures on every call.) + cx.state = state; cx.stream = stream; cx.marked = null, cx.cc = cc; + + if (!state.lexical.hasOwnProperty("align")) + state.lexical.align = true; + + while(true) { + var combinator = cc.length ? cc.pop() : jsonMode ? expression : statement; + if (combinator(type, content)) { + while(cc.length && cc[cc.length - 1].lex) + cc.pop()(); + if (cx.marked) return cx.marked; + if (type == "variable" && inScope(state, content)) return "variable-2"; + return style; + } + } + } + + // Combinator utils + + var cx = {state: null, column: null, marked: null, cc: null}; + function pass() { + for (var i = arguments.length - 1; i >= 0; i--) cx.cc.push(arguments[i]); + } + function cont() { + pass.apply(null, arguments); + return true; + } + function register(varname) { + function inList(list) { + for (var v = list; v; v = v.next) + if (v.name == varname) return true; + return false; + } + var state = cx.state; + if (state.context) { + cx.marked = "def"; + if (inList(state.localVars)) return; + state.localVars = {name: varname, next: state.localVars}; + } else { + if (inList(state.globalVars)) return; + state.globalVars = {name: varname, next: state.globalVars}; + } + } + + // Combinators + + var defaultVars = {name: "this", next: {name: "arguments"}}; + function pushcontext() { + cx.state.context = {prev: cx.state.context, vars: cx.state.localVars}; + cx.state.localVars = defaultVars; + } + function popcontext() { + cx.state.localVars = cx.state.context.vars; + cx.state.context = cx.state.context.prev; + } + function pushlex(type, info) { + var result = function() { + var state = cx.state; + state.lexical = new JSLexical(state.indented, cx.stream.column(), type, null, state.lexical, info); + }; + result.lex = true; + return result; + } + function poplex() { + var state = cx.state; + if (state.lexical.prev) { + if (state.lexical.type == ")") + state.indented = state.lexical.indented; + state.lexical = state.lexical.prev; + } + } + poplex.lex = true; + + function expect(wanted) { + return function(type) { + if (type == wanted) return cont(); + else if (wanted == ";") return pass(); + else return cont(arguments.callee); + }; + } + + function statement(type) { + if (type == "var") return cont(pushlex("vardef"), vardef1, expect(";"), poplex); + if (type == "keyword a") return cont(pushlex("form"), expression, statement, poplex); + if (type == "keyword b") return cont(pushlex("form"), statement, poplex); + if (type == "{") return cont(pushlex("}"), block, poplex); + if (type == ";") return cont(); + if (type == "if") return cont(pushlex("form"), expression, statement, poplex, maybeelse(cx.state.indented)); + if (type == "function") return cont(functiondef); + if (type == "for") return cont(pushlex("form"), expect("("), pushlex(")"), forspec1, expect(")"), + poplex, statement, poplex); + if (type == "variable") return cont(pushlex("stat"), maybelabel); + if (type == "switch") return cont(pushlex("form"), expression, pushlex("}", "switch"), expect("{"), + block, poplex, poplex); + if (type == "case") return cont(expression, expect(":")); + if (type == "default") return cont(expect(":")); + if (type == "catch") return cont(pushlex("form"), pushcontext, expect("("), funarg, expect(")"), + statement, poplex, popcontext); + return pass(pushlex("stat"), expression, expect(";"), poplex); + } + function expression(type) { + return expressionInner(type, maybeoperatorComma); + } + function expressionNoComma(type) { + return expressionInner(type, maybeoperatorNoComma); + } + function expressionInner(type, maybeop) { + if (atomicTypes.hasOwnProperty(type)) return cont(maybeop); + if (type == "function") return cont(functiondef); + if (type == "keyword c") return cont(maybeexpression); + if (type == "(") return cont(pushlex(")"), maybeexpression, expect(")"), poplex, maybeop); + if (type == "operator") return cont(expression); + if (type == "[") return cont(pushlex("]"), commasep(expressionNoComma, "]"), poplex, maybeop); + if (type == "{") return cont(pushlex("}"), commasep(objprop, "}"), poplex, maybeop); + return cont(); + } + function maybeexpression(type) { + if (type.match(/[;\}\)\],]/)) return pass(); + return pass(expression); + } + + function maybeoperatorComma(type, value) { + if (type == ",") return cont(expression); + return maybeoperatorNoComma(type, value, maybeoperatorComma); + } + function maybeoperatorNoComma(type, value, me) { + if (!me) me = maybeoperatorNoComma; + if (type == "operator") { + if (/\+\+|--/.test(value)) return cont(me); + if (value == "?") return cont(expression, expect(":"), expression); + return cont(expression); + } + if (type == ";") return; + if (type == "(") return cont(pushlex(")", "call"), commasep(expressionNoComma, ")"), poplex, me); + if (type == ".") return cont(property, me); + if (type == "[") return cont(pushlex("]"), expression, expect("]"), poplex, me); + } + function maybelabel(type) { + if (type == ":") return cont(poplex, statement); + return pass(maybeoperatorComma, expect(";"), poplex); + } + function property(type) { + if (type == "variable") {cx.marked = "property"; return cont();} + } + function objprop(type, value) { + if (type == "variable") { + cx.marked = "property"; + if (value == "get" || value == "set") return cont(getterSetter); + } else if (type == "number" || type == "string") { + cx.marked = type + " property"; + } + if (atomicTypes.hasOwnProperty(type)) return cont(expect(":"), expressionNoComma); + } + function getterSetter(type) { + if (type == ":") return cont(expression); + if (type != "variable") return cont(expect(":"), expression); + cx.marked = "property"; + return cont(functiondef); + } + function commasep(what, end) { + function proceed(type) { + if (type == ",") { + var lex = cx.state.lexical; + if (lex.info == "call") lex.pos = (lex.pos || 0) + 1; + return cont(what, proceed); + } + if (type == end) return cont(); + return cont(expect(end)); + } + return function(type) { + if (type == end) return cont(); + else return pass(what, proceed); + }; + } + function block(type) { + if (type == "}") return cont(); + return pass(statement, block); + } + function maybetype(type) { + if (type == ":") return cont(typedef); + return pass(); + } + function typedef(type) { + if (type == "variable"){cx.marked = "variable-3"; return cont();} + return pass(); + } + function vardef1(type, value) { + if (type == "variable") { + register(value); + return isTS ? cont(maybetype, vardef2) : cont(vardef2); + } + return pass(); + } + function vardef2(type, value) { + if (value == "=") return cont(expressionNoComma, vardef2); + if (type == ",") return cont(vardef1); + } + function maybeelse(indent) { + return function(type, value) { + if (type == "keyword b" && value == "else") { + cx.state.lexical = new JSLexical(indent, 0, "form", null, cx.state.lexical); + return cont(statement, poplex); + } + return pass(); + }; + } + function forspec1(type) { + if (type == "var") return cont(vardef1, expect(";"), forspec2); + if (type == ";") return cont(forspec2); + if (type == "variable") return cont(formaybein); + return pass(expression, expect(";"), forspec2); + } + function formaybein(_type, value) { + if (value == "in") return cont(expression); + return cont(maybeoperatorComma, forspec2); + } + function forspec2(type, value) { + if (type == ";") return cont(forspec3); + if (value == "in") return cont(expression); + return pass(expression, expect(";"), forspec3); + } + function forspec3(type) { + if (type != ")") cont(expression); + } + function functiondef(type, value) { + if (type == "variable") {register(value); return cont(functiondef);} + if (type == "(") return cont(pushlex(")"), pushcontext, commasep(funarg, ")"), poplex, statement, popcontext); + } + function funarg(type, value) { + if (type == "variable") {register(value); return isTS ? cont(maybetype) : cont();} + } + + // Interface + + return { + startState: function(basecolumn) { + return { + tokenize: jsTokenBase, + lastType: null, + cc: [], + lexical: new JSLexical((basecolumn || 0) - indentUnit, 0, "block", false), + localVars: parserConfig.localVars, + globalVars: parserConfig.globalVars, + context: parserConfig.localVars && {vars: parserConfig.localVars}, + indented: 0 + }; + }, + + token: function(stream, state) { + if (stream.sol()) { + if (!state.lexical.hasOwnProperty("align")) + state.lexical.align = false; + state.indented = stream.indentation(); + } + if (state.tokenize != jsTokenComment && stream.eatSpace()) return null; + var style = state.tokenize(stream, state); + if (type == "comment") return style; + state.lastType = type == "operator" && (content == "++" || content == "--") ? "incdec" : type; + return parseJS(state, style, type, content, stream); + }, + + indent: function(state, textAfter) { + if (state.tokenize == jsTokenComment) return CodeMirror.Pass; + if (state.tokenize != jsTokenBase) return 0; + var firstChar = textAfter && textAfter.charAt(0), lexical = state.lexical; + if (lexical.type == "stat" && firstChar == "}") lexical = lexical.prev; + var type = lexical.type, closing = firstChar == type; + if (parserConfig.statementIndent != null) { + if (type == ")" && lexical.prev && lexical.prev.type == "stat") lexical = lexical.prev; + if (lexical.type == "stat") return lexical.indented + parserConfig.statementIndent; + } + + if (type == "vardef") return lexical.indented + (state.lastType == "operator" || state.lastType == "," ? 4 : 0); + else if (type == "form" && firstChar == "{") return lexical.indented; + else if (type == "form") return lexical.indented + indentUnit; + else if (type == "stat") + return lexical.indented + (state.lastType == "operator" || state.lastType == "," ? indentUnit : 0); + else if (lexical.info == "switch" && !closing) + return lexical.indented + (/^(?:case|default)\b/.test(textAfter) ? indentUnit : 2 * indentUnit); + else if (lexical.align) return lexical.column + (closing ? 0 : 1); + else return lexical.indented + (closing ? 0 : indentUnit); + }, + + electricChars: ":{}", + + jsonMode: jsonMode + }; +}); + +CodeMirror.defineMIME("text/javascript", "javascript"); +CodeMirror.defineMIME("text/ecmascript", "javascript"); +CodeMirror.defineMIME("application/javascript", "javascript"); +CodeMirror.defineMIME("application/ecmascript", "javascript"); +CodeMirror.defineMIME("application/json", {name: "javascript", json: true}); +CodeMirror.defineMIME("text/typescript", { name: "javascript", typescript: true }); +CodeMirror.defineMIME("application/typescript", { name: "javascript", typescript: true }); diff --git a/modules/files/views/default/assets/mode/javascript/typescript.html b/modules/files/views/default/assets/mode/javascript/typescript.html new file mode 100755 index 0000000..58315e7 --- /dev/null +++ b/modules/files/views/default/assets/mode/javascript/typescript.html @@ -0,0 +1,48 @@ + + + + + CodeMirror: TypeScript mode + + + + + + + +

      CodeMirror: TypeScript mode

      + +
      + + + +

      This is a specialization of the JavaScript mode.

      + + diff --git a/modules/files/views/default/assets/mode/jinja2/index.html b/modules/files/views/default/assets/mode/jinja2/index.html new file mode 100755 index 0000000..7cd1da2 --- /dev/null +++ b/modules/files/views/default/assets/mode/jinja2/index.html @@ -0,0 +1,38 @@ + + + + + CodeMirror: Jinja2 mode + + + + + + + +

      CodeMirror: Jinja2 mode

      +
      + + + diff --git a/modules/files/views/default/assets/mode/jinja2/jinja2.js b/modules/files/views/default/assets/mode/jinja2/jinja2.js new file mode 100755 index 0000000..16b06c4 --- /dev/null +++ b/modules/files/views/default/assets/mode/jinja2/jinja2.js @@ -0,0 +1,42 @@ +CodeMirror.defineMode("jinja2", function() { + var keywords = ["block", "endblock", "for", "endfor", "in", "true", "false", + "loop", "none", "self", "super", "if", "as", "not", "and", + "else", "import", "with", "without", "context"]; + keywords = new RegExp("^((" + keywords.join(")|(") + "))\\b"); + + function tokenBase (stream, state) { + var ch = stream.next(); + if (ch == "{") { + if (ch = stream.eat(/\{|%|#/)) { + stream.eat("-"); + state.tokenize = inTag(ch); + return "tag"; + } + } + } + function inTag (close) { + if (close == "{") { + close = "}"; + } + return function (stream, state) { + var ch = stream.next(); + if ((ch == close || (ch == "-" && stream.eat(close))) + && stream.eat("}")) { + state.tokenize = tokenBase; + return "tag"; + } + if (stream.match(keywords)) { + return "keyword"; + } + return close == "#" ? "comment" : "string"; + }; + } + return { + startState: function () { + return {tokenize: tokenBase}; + }, + token: function (stream, state) { + return state.tokenize(stream, state); + } + }; +}); diff --git a/modules/files/views/default/assets/mode/less/index.html b/modules/files/views/default/assets/mode/less/index.html new file mode 100755 index 0000000..78c1e53 --- /dev/null +++ b/modules/files/views/default/assets/mode/less/index.html @@ -0,0 +1,741 @@ + + + + + CodeMirror: LESS mode + + + + + + + + + +

      CodeMirror: LESS mode

      +
      + + +

      MIME types defined: text/x-less, text/css (if not previously defined).

      + + diff --git a/modules/files/views/default/assets/mode/less/less.js b/modules/files/views/default/assets/mode/less/less.js new file mode 100755 index 0000000..6df4790 --- /dev/null +++ b/modules/files/views/default/assets/mode/less/less.js @@ -0,0 +1,266 @@ +/* + LESS mode - http://www.lesscss.org/ + Ported to CodeMirror by Peter Kroon + Report bugs/issues here: https://github.com/marijnh/CodeMirror/issues GitHub: @peterkroon +*/ + +CodeMirror.defineMode("less", function(config) { + var indentUnit = config.indentUnit, type; + function ret(style, tp) {type = tp; return style;} + //html tags + var tags = "a abbr acronym address applet area article aside audio b base basefont bdi bdo big blockquote body br button canvas caption cite code col colgroup command datalist dd del details dfn dir div dl dt em embed fieldset figcaption figure font footer form frame frameset h1 h2 h3 h4 h5 h6 head header hgroup hr html i iframe img input ins keygen kbd label legend li link map mark menu meta meter nav noframes noscript object ol optgroup option output p param pre progress q rp rt ruby s samp script section select small source span strike strong style sub summary sup table tbody td textarea tfoot th thead time title tr track tt u ul var video wbr".split(' '); + + function inTagsArray(val){ + for(var i=0; i*\/]/.test(ch)) { + if(stream.peek() == "=" || type == "a")return ret("string", "string"); + return ret(null, "select-op"); + } + else if (/[;{}:\[\]()~\|]/.test(ch)) { + if(ch == ":"){ + stream.eatWhile(/[a-z\\\-]/); + if( selectors.test(stream.current()) ){ + return ret("tag", "tag"); + }else if(stream.peek() == ":"){//::-webkit-search-decoration + stream.next(); + stream.eatWhile(/[a-z\\\-]/); + if(stream.current().match(/\:\:\-(o|ms|moz|webkit)\-/))return ret("string", "string"); + if( selectors.test(stream.current().substring(1)) )return ret("tag", "tag"); + return ret(null, ch); + }else{ + return ret(null, ch); + } + }else if(ch == "~"){ + if(type == "r")return ret("string", "string"); + }else{ + return ret(null, ch); + } + } + else if (ch == ".") { + if(type == "(" || type == "string")return ret("string", "string"); // allow url(../image.png) + stream.eatWhile(/[\a-zA-Z0-9\-_]/); + if(stream.peek() == " ")stream.eatSpace(); + if(stream.peek() == ")")return ret("number", "unit");//rgba(0,0,0,.25); + return ret("tag", "tag"); + } + else if (ch == "#") { + //we don't eat white-space, we want the hex color and or id only + stream.eatWhile(/[A-Za-z0-9]/); + //check if there is a proper hex color length e.g. #eee || #eeeEEE + if(stream.current().length == 4 || stream.current().length == 7){ + if(stream.current().match(/[A-Fa-f0-9]{6}|[A-Fa-f0-9]{3}/,false) != null){//is there a valid hex color value present in the current stream + //when not a valid hex value, parse as id + if(stream.current().substring(1) != stream.current().match(/[A-Fa-f0-9]{6}|[A-Fa-f0-9]{3}/,false))return ret("atom", "tag"); + //eat white-space + stream.eatSpace(); + //when hex value declaration doesn't end with [;,] but is does with a slash/cc comment treat it as an id, just like the other hex values that don't end with[;,] + if( /[\/<>.(){!$%^&*_\-\\?=+\|#'~`]/.test(stream.peek()) )return ret("atom", "tag"); + //#time { color: #aaa } + else if(stream.peek() == "}" )return ret("number", "unit"); + //we have a valid hex color value, parse as id whenever an element/class is defined after the hex(id) value e.g. #eee aaa || #eee .aaa + else if( /[a-zA-Z\\]/.test(stream.peek()) )return ret("atom", "tag"); + //when a hex value is on the end of a line, parse as id + else if(stream.eol())return ret("atom", "tag"); + //default + else return ret("number", "unit"); + }else{//when not a valid hexvalue in the current stream e.g. #footer + stream.eatWhile(/[\w\\\-]/); + return ret("atom", "tag"); + } + }else{//when not a valid hexvalue length + stream.eatWhile(/[\w\\\-]/); + return ret("atom", "tag"); + } + } + else if (ch == "&") { + stream.eatWhile(/[\w\-]/); + return ret(null, ch); + } + else { + stream.eatWhile(/[\w\\\-_%.{]/); + if(type == "string"){ + return ret("string", "string"); + }else if(stream.current().match(/(^http$|^https$)/) != null){ + stream.eatWhile(/[\w\\\-_%.{:\/]/); + return ret("string", "string"); + }else if(stream.peek() == "<" || stream.peek() == ">"){ + return ret("tag", "tag"); + }else if( /\(/.test(stream.peek()) ){ + return ret(null, ch); + }else if (stream.peek() == "/" && state.stack[state.stack.length-1] != undefined){ // url(dir/center/image.png) + return ret("string", "string"); + }else if( stream.current().match(/\-\d|\-.\d/) ){ // match e.g.: -5px -0.4 etc... only colorize the minus sign + //commment out these 2 comment if you want the minus sign to be parsed as null -500px + //stream.backUp(stream.current().length-1); + //return ret(null, ch); //console.log( stream.current() ); + return ret("number", "unit"); + }else if( inTagsArray(stream.current().toLowerCase()) ){ // match html tags + return ret("tag", "tag"); + }else if( /\/|[\s\)]/.test(stream.peek() || stream.eol() || (stream.eatSpace() && stream.peek() == "/")) && stream.current().indexOf(".") !== -1){ + if(stream.current().substring(stream.current().length-1,stream.current().length) == "{"){ + stream.backUp(1); + return ret("tag", "tag"); + }//end if + stream.eatSpace(); + if( /[{<>.a-zA-Z\/]/.test(stream.peek()) || stream.eol() )return ret("tag", "tag"); // e.g. button.icon-plus + return ret("string", "string"); // let url(/images/logo.png) without quotes return as string + }else if( stream.eol() || stream.peek() == "[" || stream.peek() == "#" || type == "tag" ){ + if(stream.current().substring(stream.current().length-1,stream.current().length) == "{")stream.backUp(1); + return ret("tag", "tag"); + }else if(type == "compare" || type == "a" || type == "("){ + return ret("string", "string"); + }else if(type == "|" || stream.current() == "-" || type == "["){ + return ret(null, ch); + }else if(stream.peek() == ":") { + stream.next(); + var t_v = stream.peek() == ":" ? true : false; + if(!t_v){ + var old_pos = stream.pos; + var sc = stream.current().length; + stream.eatWhile(/[a-z\\\-]/); + var new_pos = stream.pos; + if(stream.current().substring(sc-1).match(selectors) != null){ + stream.backUp(new_pos-(old_pos-1)); + return ret("tag", "tag"); + } else stream.backUp(new_pos-(old_pos-1)); + }else{ + stream.backUp(1); + } + if(t_v)return ret("tag", "tag"); else return ret("variable", "variable"); + }else{ + return ret("variable", "variable"); + } + } + } + + function tokenSComment(stream, state) { // SComment = Slash comment + stream.skipToEnd(); + state.tokenize = tokenBase; + return ret("comment", "comment"); + } + + function tokenCComment(stream, state) { + var maybeEnd = false, ch; + while ((ch = stream.next()) != null) { + if (maybeEnd && ch == "/") { + state.tokenize = tokenBase; + break; + } + maybeEnd = (ch == "*"); + } + return ret("comment", "comment"); + } + + function tokenSGMLComment(stream, state) { + var dashes = 0, ch; + while ((ch = stream.next()) != null) { + if (dashes >= 2 && ch == ">") { + state.tokenize = tokenBase; + break; + } + dashes = (ch == "-") ? dashes + 1 : 0; + } + return ret("comment", "comment"); + } + + function tokenString(quote) { + return function(stream, state) { + var escaped = false, ch; + while ((ch = stream.next()) != null) { + if (ch == quote && !escaped) + break; + escaped = !escaped && ch == "\\"; + } + if (!escaped) state.tokenize = tokenBase; + return ret("string", "string"); + }; + } + + return { + startState: function(base) { + return {tokenize: tokenBase, + baseIndent: base || 0, + stack: []}; + }, + + token: function(stream, state) { + if (stream.eatSpace()) return null; + var style = state.tokenize(stream, state); + + var context = state.stack[state.stack.length-1]; + if (type == "hash" && context == "rule") style = "atom"; + else if (style == "variable") { + if (context == "rule") style = null; //"tag" + else if (!context || context == "@media{") { + style = stream.current() == "when" ? "variable" : + /[\s,|\s\)|\s]/.test(stream.peek()) ? "tag" : type; + } + } + + if (context == "rule" && /^[\{\};]$/.test(type)) + state.stack.pop(); + if (type == "{") { + if (context == "@media") state.stack[state.stack.length-1] = "@media{"; + else state.stack.push("{"); + } + else if (type == "}") state.stack.pop(); + else if (type == "@media") state.stack.push("@media"); + else if (context == "{" && type != "comment") state.stack.push("rule"); + return style; + }, + + indent: function(state, textAfter) { + var n = state.stack.length; + if (/^\}/.test(textAfter)) + n -= state.stack[state.stack.length-1] == "rule" ? 2 : 1; + return state.baseIndent + n * indentUnit; + }, + + electricChars: "}" + }; +}); + +CodeMirror.defineMIME("text/x-less", "less"); +if (!CodeMirror.mimeModes.hasOwnProperty("text/css")) + CodeMirror.defineMIME("text/css", "less"); diff --git a/modules/files/views/default/assets/mode/livescript/LICENSE b/modules/files/views/default/assets/mode/livescript/LICENSE new file mode 100755 index 0000000..a675c40 --- /dev/null +++ b/modules/files/views/default/assets/mode/livescript/LICENSE @@ -0,0 +1,23 @@ +The MIT License + +Copyright (c) 2013 Kenneth Bentley +Modified from the CoffeeScript CodeMirror mode, Copyright (c) 2011 Jeff Pickhardt +Modified from the Python CodeMirror mode, Copyright (c) 2010 Timothy Farrell + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/modules/files/views/default/assets/mode/livescript/index.html b/modules/files/views/default/assets/mode/livescript/index.html new file mode 100755 index 0000000..3054e35 --- /dev/null +++ b/modules/files/views/default/assets/mode/livescript/index.html @@ -0,0 +1,446 @@ + + + + CodeMirror: LiveScript mode + + + + + + + + +

      CodeMirror: LiveScript mode

      +
      + + +

      MIME types defined: text/x-livescript.

      + +

      The LiveScript mode was written by Kenneth Bentley (license).

      + + + diff --git a/modules/files/views/default/assets/mode/livescript/livescript.js b/modules/files/views/default/assets/mode/livescript/livescript.js new file mode 100755 index 0000000..c000324 --- /dev/null +++ b/modules/files/views/default/assets/mode/livescript/livescript.js @@ -0,0 +1,267 @@ +/** + * Link to the project's GitHub page: + * https://github.com/duralog/CodeMirror + */ +(function() { + CodeMirror.defineMode('livescript', function(){ + var tokenBase, external; + tokenBase = function(stream, state){ + var next_rule, nr, i$, len$, r, m; + if (next_rule = state.next || 'start') { + state.next = state.next; + if (Array.isArray(nr = Rules[next_rule])) { + for (i$ = 0, len$ = nr.length; i$ < len$; ++i$) { + r = nr[i$]; + if (r.regex && (m = stream.match(r.regex))) { + state.next = r.next; + return r.token; + } + } + stream.next(); + return 'error'; + } + if (stream.match(r = Rules[next_rule])) { + if (r.regex && stream.match(r.regex)) { + state.next = r.next; + return r.token; + } else { + stream.next(); + return 'error'; + } + } + } + stream.next(); + return 'error'; + }; + external = { + startState: function(){ + return { + next: 'start', + lastToken: null + }; + }, + token: function(stream, state){ + var style; + style = tokenBase(stream, state); + state.lastToken = { + style: style, + indent: stream.indentation(), + content: stream.current() + }; + return style.replace(/\./g, ' '); + }, + indent: function(state){ + var indentation; + indentation = state.lastToken.indent; + if (state.lastToken.content.match(indenter)) { + indentation += 2; + } + return indentation; + } + }; + return external; + }); + + var identifier = '(?![\\d\\s])[$\\w\\xAA-\\uFFDC](?:(?!\\s)[$\\w\\xAA-\\uFFDC]|-[A-Za-z])*'; + var indenter = RegExp('(?:[({[=:]|[-~]>|\\b(?:e(?:lse|xport)|d(?:o|efault)|t(?:ry|hen)|finally|import(?:\\s*all)?|const|var|let|new|catch(?:\\s*' + identifier + ')?))\\s*$'); + var keywordend = '(?![$\\w]|-[A-Za-z]|\\s*:(?![:=]))'; + var stringfill = { + token: 'string', + regex: '.+' + }; + var Rules = { + start: [ + { + token: 'comment.doc', + regex: '/\\*', + next: 'comment' + }, { + token: 'comment', + regex: '#.*' + }, { + token: 'keyword', + regex: '(?:t(?:h(?:is|row|en)|ry|ypeof!?)|c(?:on(?:tinue|st)|a(?:se|tch)|lass)|i(?:n(?:stanceof)?|mp(?:ort(?:\\s+all)?|lements)|[fs])|d(?:e(?:fault|lete|bugger)|o)|f(?:or(?:\\s+own)?|inally|unction)|s(?:uper|witch)|e(?:lse|x(?:tends|port)|val)|a(?:nd|rguments)|n(?:ew|ot)|un(?:less|til)|w(?:hile|ith)|o[fr]|return|break|let|var|loop)' + keywordend + }, { + token: 'constant.language', + regex: '(?:true|false|yes|no|on|off|null|void|undefined)' + keywordend + }, { + token: 'invalid.illegal', + regex: '(?:p(?:ackage|r(?:ivate|otected)|ublic)|i(?:mplements|nterface)|enum|static|yield)' + keywordend + }, { + token: 'language.support.class', + regex: '(?:R(?:e(?:gExp|ferenceError)|angeError)|S(?:tring|yntaxError)|E(?:rror|valError)|Array|Boolean|Date|Function|Number|Object|TypeError|URIError)' + keywordend + }, { + token: 'language.support.function', + regex: '(?:is(?:NaN|Finite)|parse(?:Int|Float)|Math|JSON|(?:en|de)codeURI(?:Component)?)' + keywordend + }, { + token: 'variable.language', + regex: '(?:t(?:hat|il|o)|f(?:rom|allthrough)|it|by|e)' + keywordend + }, { + token: 'identifier', + regex: identifier + '\\s*:(?![:=])' + }, { + token: 'variable', + regex: identifier + }, { + token: 'keyword.operator', + regex: '(?:\\.{3}|\\s+\\?)' + }, { + token: 'keyword.variable', + regex: '(?:@+|::|\\.\\.)', + next: 'key' + }, { + token: 'keyword.operator', + regex: '\\.\\s*', + next: 'key' + }, { + token: 'string', + regex: '\\\\\\S[^\\s,;)}\\]]*' + }, { + token: 'string.doc', + regex: '\'\'\'', + next: 'qdoc' + }, { + token: 'string.doc', + regex: '"""', + next: 'qqdoc' + }, { + token: 'string', + regex: '\'', + next: 'qstring' + }, { + token: 'string', + regex: '"', + next: 'qqstring' + }, { + token: 'string', + regex: '`', + next: 'js' + }, { + token: 'string', + regex: '<\\[', + next: 'words' + }, { + token: 'string.regex', + regex: '//', + next: 'heregex' + }, { + token: 'string.regex', + regex: '\\/(?:[^[\\/\\n\\\\]*(?:(?:\\\\.|\\[[^\\]\\n\\\\]*(?:\\\\.[^\\]\\n\\\\]*)*\\])[^[\\/\\n\\\\]*)*)\\/[gimy$]{0,4}', + next: 'key' + }, { + token: 'constant.numeric', + regex: '(?:0x[\\da-fA-F][\\da-fA-F_]*|(?:[2-9]|[12]\\d|3[0-6])r[\\da-zA-Z][\\da-zA-Z_]*|(?:\\d[\\d_]*(?:\\.\\d[\\d_]*)?|\\.\\d[\\d_]*)(?:e[+-]?\\d[\\d_]*)?[\\w$]*)' + }, { + token: 'lparen', + regex: '[({[]' + }, { + token: 'rparen', + regex: '[)}\\]]', + next: 'key' + }, { + token: 'keyword.operator', + regex: '\\S+' + }, { + token: 'text', + regex: '\\s+' + } + ], + heregex: [ + { + token: 'string.regex', + regex: '.*?//[gimy$?]{0,4}', + next: 'start' + }, { + token: 'string.regex', + regex: '\\s*#{' + }, { + token: 'comment.regex', + regex: '\\s+(?:#.*)?' + }, { + token: 'string.regex', + regex: '\\S+' + } + ], + key: [ + { + token: 'keyword.operator', + regex: '[.?@!]+' + }, { + token: 'identifier', + regex: identifier, + next: 'start' + }, { + token: 'text', + regex: '.', + next: 'start' + } + ], + comment: [ + { + token: 'comment.doc', + regex: '.*?\\*/', + next: 'start' + }, { + token: 'comment.doc', + regex: '.+' + } + ], + qdoc: [ + { + token: 'string', + regex: ".*?'''", + next: 'key' + }, stringfill + ], + qqdoc: [ + { + token: 'string', + regex: '.*?"""', + next: 'key' + }, stringfill + ], + qstring: [ + { + token: 'string', + regex: '[^\\\\\']*(?:\\\\.[^\\\\\']*)*\'', + next: 'key' + }, stringfill + ], + qqstring: [ + { + token: 'string', + regex: '[^\\\\"]*(?:\\\\.[^\\\\"]*)*"', + next: 'key' + }, stringfill + ], + js: [ + { + token: 'string', + regex: '[^\\\\`]*(?:\\\\.[^\\\\`]*)*`', + next: 'key' + }, stringfill + ], + words: [ + { + token: 'string', + regex: '.*?\\]>', + next: 'key' + }, stringfill + ] + }; + for (var idx in Rules) { + var r = Rules[idx]; + if (Array.isArray(r)) { + for (var i = 0, len = r.length; i < len; ++i) { + var rr = r[i]; + if (rr.regex) { + Rules[idx][i].regex = new RegExp('^' + rr.regex); + } + } + } else if (r.regex) { + Rules[idx].regex = new RegExp('^' + r.regex); + } + } +})(); + +CodeMirror.defineMIME('text/x-livescript', 'livescript'); diff --git a/modules/files/views/default/assets/mode/livescript/livescript.ls b/modules/files/views/default/assets/mode/livescript/livescript.ls new file mode 100755 index 0000000..0652423 --- /dev/null +++ b/modules/files/views/default/assets/mode/livescript/livescript.ls @@ -0,0 +1,266 @@ +/** + * Link to the project's GitHub page: + * https://github.com/duralog/CodeMirror + */ +CodeMirror.defineMode 'livescript', (conf) -> + tokenBase = (stream, state) -> + #indent = + if next_rule = state.next or \start + state.next = state.next + if Array.isArray nr = Rules[next_rule] + for r in nr + if r.regex and m = stream.match r.regex + state.next = r.next + return r.token + stream.next! + return \error + if stream.match r = Rules[next_rule] + if r.regex and stream.match r.regex + state.next = r.next + return r.token + else + stream.next! + return \error + stream.next! + return 'error' + external = { + startState: (basecolumn) -> + { + next: \start + lastToken: null + } + token: (stream, state) -> + style = tokenBase stream, state #tokenLexer stream, state + state.lastToken = { + style: style + indent: stream.indentation! + content: stream.current! + } + style.replace /\./g, ' ' + indent: (state, textAfter) -> + # XXX this won't work with backcalls + indentation = state.lastToken.indent + if state.lastToken.content.match indenter then indentation += 2 + return indentation + } + external + +### Highlight Rules +# taken from mode-ls.ls + +indenter = // (? + : [({[=:] + | [-~]> + | \b (?: e(?:lse|xport) | d(?:o|efault) | t(?:ry|hen) | finally | + import (?:\s* all)? | const | var | + let | new | catch (?:\s* #identifier)? ) + ) \s* $ // + +identifier = /(?![\d\s])[$\w\xAA-\uFFDC](?:(?!\s)[$\w\xAA-\uFFDC]|-[A-Za-z])*/$ +keywordend = /(?![$\w]|-[A-Za-z]|\s*:(?![:=]))/$ +stringfill = token: \string, regex: '.+' + +Rules = + start: + * token: \comment.doc + regex: '/\\*' + next : \comment + + * token: \comment + regex: '#.*' + + * token: \keyword + regex: //(? + :t(?:h(?:is|row|en)|ry|ypeof!?) + |c(?:on(?:tinue|st)|a(?:se|tch)|lass) + |i(?:n(?:stanceof)?|mp(?:ort(?:\s+all)?|lements)|[fs]) + |d(?:e(?:fault|lete|bugger)|o) + |f(?:or(?:\s+own)?|inally|unction) + |s(?:uper|witch) + |e(?:lse|x(?:tends|port)|val) + |a(?:nd|rguments) + |n(?:ew|ot) + |un(?:less|til) + |w(?:hile|ith) + |o[fr]|return|break|let|var|loop + )//$ + keywordend + + * token: \constant.language + regex: '(?:true|false|yes|no|on|off|null|void|undefined)' + keywordend + + * token: \invalid.illegal + regex: '(? + :p(?:ackage|r(?:ivate|otected)|ublic) + |i(?:mplements|nterface) + |enum|static|yield + )' + keywordend + + * token: \language.support.class + regex: '(? + :R(?:e(?:gExp|ferenceError)|angeError) + |S(?:tring|yntaxError) + |E(?:rror|valError) + |Array|Boolean|Date|Function|Number|Object|TypeError|URIError + )' + keywordend + + * token: \language.support.function + regex: '(? + :is(?:NaN|Finite) + |parse(?:Int|Float) + |Math|JSON + |(?:en|de)codeURI(?:Component)? + )' + keywordend + + * token: \variable.language + regex: '(?:t(?:hat|il|o)|f(?:rom|allthrough)|it|by|e)' + keywordend + + * token: \identifier + regex: identifier + /\s*:(?![:=])/$ + + * token: \variable + regex: identifier + + * token: \keyword.operator + regex: /(?:\.{3}|\s+\?)/$ + + * token: \keyword.variable + regex: /(?:@+|::|\.\.)/$ + next : \key + + * token: \keyword.operator + regex: /\.\s*/$ + next : \key + + * token: \string + regex: /\\\S[^\s,;)}\]]*/$ + + * token: \string.doc + regex: \''' + next : \qdoc + + * token: \string.doc + regex: \""" + next : \qqdoc + + * token: \string + regex: \' + next : \qstring + + * token: \string + regex: \" + next : \qqstring + + * token: \string + regex: \` + next : \js + + * token: \string + regex: '<\\[' + next : \words + + * token: \string.regex + regex: \// + next : \heregex + + * token: \string.regex + regex: // + /(?: [^ [ / \n \\ ]* + (?: (?: \\. + | \[ [^\]\n\\]* (?:\\.[^\]\n\\]*)* \] + ) [^ [ / \n \\ ]* + )* + )/ [gimy$]{0,4} + //$ + next : \key + + * token: \constant.numeric + regex: '(?:0x[\\da-fA-F][\\da-fA-F_]* + |(?:[2-9]|[12]\\d|3[0-6])r[\\da-zA-Z][\\da-zA-Z_]* + |(?:\\d[\\d_]*(?:\\.\\d[\\d_]*)?|\\.\\d[\\d_]*) + (?:e[+-]?\\d[\\d_]*)?[\\w$]*)' + + * token: \lparen + regex: '[({[]' + + * token: \rparen + regex: '[)}\\]]' + next : \key + + * token: \keyword.operator + regex: \\\S+ + + * token: \text + regex: \\\s+ + + heregex: + * token: \string.regex + regex: '.*?//[gimy$?]{0,4}' + next : \start + * token: \string.regex + regex: '\\s*#{' + * token: \comment.regex + regex: '\\s+(?:#.*)?' + * token: \string.regex + regex: '\\S+' + + key: + * token: \keyword.operator + regex: '[.?@!]+' + * token: \identifier + regex: identifier + next : \start + * token: \text + regex: '.' + next : \start + + comment: + * token: \comment.doc + regex: '.*?\\*/' + next : \start + * token: \comment.doc + regex: '.+' + + qdoc: + token: \string + regex: ".*?'''" + next : \key + stringfill + + qqdoc: + token: \string + regex: '.*?"""' + next : \key + stringfill + + qstring: + token: \string + regex: /[^\\']*(?:\\.[^\\']*)*'/$ + next : \key + stringfill + + qqstring: + token: \string + regex: /[^\\"]*(?:\\.[^\\"]*)*"/$ + next : \key + stringfill + + js: + token: \string + regex: /[^\\`]*(?:\\.[^\\`]*)*`/$ + next : \key + stringfill + + words: + token: \string + regex: '.*?\\]>' + next : \key + stringfill + +# for optimization, precompile the regexps +for idx, r of Rules + if Array.isArray r + for rr, i in r + if rr.regex then Rules[idx][i].regex = new RegExp '^'+rr.regex + else if r.regex then Rules[idx].regex = new RegExp '^'+r.regex + +CodeMirror.defineMIME 'text/x-livescript', 'livescript' diff --git a/modules/files/views/default/assets/mode/lua/index.html b/modules/files/views/default/assets/mode/lua/index.html new file mode 100755 index 0000000..a0a42d9 --- /dev/null +++ b/modules/files/views/default/assets/mode/lua/index.html @@ -0,0 +1,74 @@ + + + + + CodeMirror: Lua mode + + + + + + + + + +

      CodeMirror: Lua mode

      +
      + + +

      Loosely based on Franciszek + Wawrzak's CodeMirror + 1 mode. One configuration parameter is + supported, specials, to which you can provide an + array of strings to have those identifiers highlighted with + the lua-special style.

      +

      MIME types defined: text/x-lua.

      + + + diff --git a/modules/files/views/default/assets/mode/lua/lua.js b/modules/files/views/default/assets/mode/lua/lua.js new file mode 100755 index 0000000..90761e2 --- /dev/null +++ b/modules/files/views/default/assets/mode/lua/lua.js @@ -0,0 +1,140 @@ +// LUA mode. Ported to CodeMirror 2 from Franciszek Wawrzak's +// CodeMirror 1 mode. +// highlights keywords, strings, comments (no leveling supported! ("[==[")), tokens, basic indenting + +CodeMirror.defineMode("lua", function(config, parserConfig) { + var indentUnit = config.indentUnit; + + function prefixRE(words) { + return new RegExp("^(?:" + words.join("|") + ")", "i"); + } + function wordRE(words) { + return new RegExp("^(?:" + words.join("|") + ")$", "i"); + } + var specials = wordRE(parserConfig.specials || []); + + // long list of standard functions from lua manual + var builtins = wordRE([ + "_G","_VERSION","assert","collectgarbage","dofile","error","getfenv","getmetatable","ipairs","load", + "loadfile","loadstring","module","next","pairs","pcall","print","rawequal","rawget","rawset","require", + "select","setfenv","setmetatable","tonumber","tostring","type","unpack","xpcall", + + "coroutine.create","coroutine.resume","coroutine.running","coroutine.status","coroutine.wrap","coroutine.yield", + + "debug.debug","debug.getfenv","debug.gethook","debug.getinfo","debug.getlocal","debug.getmetatable", + "debug.getregistry","debug.getupvalue","debug.setfenv","debug.sethook","debug.setlocal","debug.setmetatable", + "debug.setupvalue","debug.traceback", + + "close","flush","lines","read","seek","setvbuf","write", + + "io.close","io.flush","io.input","io.lines","io.open","io.output","io.popen","io.read","io.stderr","io.stdin", + "io.stdout","io.tmpfile","io.type","io.write", + + "math.abs","math.acos","math.asin","math.atan","math.atan2","math.ceil","math.cos","math.cosh","math.deg", + "math.exp","math.floor","math.fmod","math.frexp","math.huge","math.ldexp","math.log","math.log10","math.max", + "math.min","math.modf","math.pi","math.pow","math.rad","math.random","math.randomseed","math.sin","math.sinh", + "math.sqrt","math.tan","math.tanh", + + "os.clock","os.date","os.difftime","os.execute","os.exit","os.getenv","os.remove","os.rename","os.setlocale", + "os.time","os.tmpname", + + "package.cpath","package.loaded","package.loaders","package.loadlib","package.path","package.preload", + "package.seeall", + + "string.byte","string.char","string.dump","string.find","string.format","string.gmatch","string.gsub", + "string.len","string.lower","string.match","string.rep","string.reverse","string.sub","string.upper", + + "table.concat","table.insert","table.maxn","table.remove","table.sort" + ]); + var keywords = wordRE(["and","break","elseif","false","nil","not","or","return", + "true","function", "end", "if", "then", "else", "do", + "while", "repeat", "until", "for", "in", "local" ]); + + var indentTokens = wordRE(["function", "if","repeat","do", "\\(", "{"]); + var dedentTokens = wordRE(["end", "until", "\\)", "}"]); + var dedentPartial = prefixRE(["end", "until", "\\)", "}", "else", "elseif"]); + + function readBracket(stream) { + var level = 0; + while (stream.eat("=")) ++level; + stream.eat("["); + return level; + } + + function normal(stream, state) { + var ch = stream.next(); + if (ch == "-" && stream.eat("-")) { + if (stream.eat("[") && stream.eat("[")) + return (state.cur = bracketed(readBracket(stream), "comment"))(stream, state); + stream.skipToEnd(); + return "comment"; + } + if (ch == "\"" || ch == "'") + return (state.cur = string(ch))(stream, state); + if (ch == "[" && /[\[=]/.test(stream.peek())) + return (state.cur = bracketed(readBracket(stream), "string"))(stream, state); + if (/\d/.test(ch)) { + stream.eatWhile(/[\w.%]/); + return "number"; + } + if (/[\w_]/.test(ch)) { + stream.eatWhile(/[\w\\\-_.]/); + return "variable"; + } + return null; + } + + function bracketed(level, style) { + return function(stream, state) { + var curlev = null, ch; + while ((ch = stream.next()) != null) { + if (curlev == null) {if (ch == "]") curlev = 0;} + else if (ch == "=") ++curlev; + else if (ch == "]" && curlev == level) { state.cur = normal; break; } + else curlev = null; + } + return style; + }; + } + + function string(quote) { + return function(stream, state) { + var escaped = false, ch; + while ((ch = stream.next()) != null) { + if (ch == quote && !escaped) break; + escaped = !escaped && ch == "\\"; + } + if (!escaped) state.cur = normal; + return "string"; + }; + } + + return { + startState: function(basecol) { + return {basecol: basecol || 0, indentDepth: 0, cur: normal}; + }, + + token: function(stream, state) { + if (stream.eatSpace()) return null; + var style = state.cur(stream, state); + var word = stream.current(); + if (style == "variable") { + if (keywords.test(word)) style = "keyword"; + else if (builtins.test(word)) style = "builtin"; + else if (specials.test(word)) style = "variable-2"; + } + if ((style != "comment") && (style != "string")){ + if (indentTokens.test(word)) ++state.indentDepth; + else if (dedentTokens.test(word)) --state.indentDepth; + } + return style; + }, + + indent: function(state, textAfter) { + var closing = dedentPartial.test(textAfter); + return state.basecol + indentUnit * (state.indentDepth - (closing ? 1 : 0)); + } + }; +}); + +CodeMirror.defineMIME("text/x-lua", "lua"); diff --git a/modules/files/views/default/assets/mode/markdown/index.html b/modules/files/views/default/assets/mode/markdown/index.html new file mode 100755 index 0000000..6f97b10 --- /dev/null +++ b/modules/files/views/default/assets/mode/markdown/index.html @@ -0,0 +1,344 @@ + + + + + CodeMirror: Markdown mode + + + + + + + + + +

      CodeMirror: Markdown mode

      + + +
      + + + +

      Optionally depends on the XML mode for properly highlighted inline XML blocks.

      + +

      MIME types defined: text/x-markdown.

      + +

      Parsing/Highlighting Tests: normal, verbose.

      + + + diff --git a/modules/files/views/default/assets/mode/markdown/markdown.js b/modules/files/views/default/assets/mode/markdown/markdown.js new file mode 100755 index 0000000..c0be494 --- /dev/null +++ b/modules/files/views/default/assets/mode/markdown/markdown.js @@ -0,0 +1,526 @@ +CodeMirror.defineMode("markdown", function(cmCfg, modeCfg) { + + var htmlFound = CodeMirror.mimeModes.hasOwnProperty("text/html"); + var htmlMode = CodeMirror.getMode(cmCfg, htmlFound ? "text/html" : "text/plain"); + var aliases = { + html: "htmlmixed", + js: "javascript", + json: "application/json", + c: "text/x-csrc", + "c++": "text/x-c++src", + java: "text/x-java", + csharp: "text/x-csharp", + "c#": "text/x-csharp", + scala: "text/x-scala" + }; + + var getMode = (function () { + var i, modes = {}, mimes = {}, mime; + + var list = []; + for (var m in CodeMirror.modes) + if (CodeMirror.modes.propertyIsEnumerable(m)) list.push(m); + for (i = 0; i < list.length; i++) { + modes[list[i]] = list[i]; + } + var mimesList = []; + for (var m in CodeMirror.mimeModes) + if (CodeMirror.mimeModes.propertyIsEnumerable(m)) + mimesList.push({mime: m, mode: CodeMirror.mimeModes[m]}); + for (i = 0; i < mimesList.length; i++) { + mime = mimesList[i].mime; + mimes[mime] = mimesList[i].mime; + } + + for (var a in aliases) { + if (aliases[a] in modes || aliases[a] in mimes) + modes[a] = aliases[a]; + } + + return function (lang) { + return modes[lang] ? CodeMirror.getMode(cmCfg, modes[lang]) : null; + }; + }()); + + // Should underscores in words open/close em/strong? + if (modeCfg.underscoresBreakWords === undefined) + modeCfg.underscoresBreakWords = true; + + // Turn on fenced code blocks? ("```" to start/end) + if (modeCfg.fencedCodeBlocks === undefined) modeCfg.fencedCodeBlocks = false; + + // Turn on task lists? ("- [ ] " and "- [x] ") + if (modeCfg.taskLists === undefined) modeCfg.taskLists = false; + + var codeDepth = 0; + + var header = 'header' + , code = 'comment' + , quote1 = 'atom' + , quote2 = 'number' + , list1 = 'variable-2' + , list2 = 'variable-3' + , list3 = 'keyword' + , hr = 'hr' + , image = 'tag' + , linkinline = 'link' + , linkemail = 'link' + , linktext = 'link' + , linkhref = 'string' + , em = 'em' + , strong = 'strong'; + + var hrRE = /^([*\-=_])(?:\s*\1){2,}\s*$/ + , ulRE = /^[*\-+]\s+/ + , olRE = /^[0-9]+\.\s+/ + , taskListRE = /^\[(x| )\](?=\s)/ // Must follow ulRE or olRE + , headerRE = /^(?:\={1,}|-{1,})$/ + , textRE = /^[^!\[\]*_\\<>` "'(]+/; + + function switchInline(stream, state, f) { + state.f = state.inline = f; + return f(stream, state); + } + + function switchBlock(stream, state, f) { + state.f = state.block = f; + return f(stream, state); + } + + + // Blocks + + function blankLine(state) { + // Reset linkTitle state + state.linkTitle = false; + // Reset EM state + state.em = false; + // Reset STRONG state + state.strong = false; + // Reset state.quote + state.quote = 0; + if (!htmlFound && state.f == htmlBlock) { + state.f = inlineNormal; + state.block = blockNormal; + } + // Mark this line as blank + state.thisLineHasContent = false; + return null; + } + + function blockNormal(stream, state) { + + var prevLineIsList = (state.list !== false); + if (state.list !== false && state.indentationDiff >= 0) { // Continued list + if (state.indentationDiff < 4) { // Only adjust indentation if *not* a code block + state.indentation -= state.indentationDiff; + } + state.list = null; + } else if (state.list !== false && state.indentation > 0) { + state.list = null; + state.listDepth = Math.floor(state.indentation / 4); + } else if (state.list !== false) { // No longer a list + state.list = false; + state.listDepth = 0; + } + + if (state.indentationDiff >= 4) { + state.indentation -= 4; + stream.skipToEnd(); + return code; + } else if (stream.eatSpace()) { + return null; + } else if (stream.peek() === '#' || (state.prevLineHasContent && stream.match(headerRE)) ) { + state.header = true; + } else if (stream.eat('>')) { + state.indentation++; + state.quote = 1; + stream.eatSpace(); + while (stream.eat('>')) { + stream.eatSpace(); + state.quote++; + } + } else if (stream.peek() === '[') { + return switchInline(stream, state, footnoteLink); + } else if (stream.match(hrRE, true)) { + return hr; + } else if ((!state.prevLineHasContent || prevLineIsList) && (stream.match(ulRE, true) || stream.match(olRE, true))) { + state.indentation += 4; + state.list = true; + state.listDepth++; + if (modeCfg.taskLists && stream.match(taskListRE, false)) { + state.taskList = true; + } + } else if (modeCfg.fencedCodeBlocks && stream.match(/^```([\w+#]*)/, true)) { + // try switching mode + state.localMode = getMode(RegExp.$1); + if (state.localMode) state.localState = state.localMode.startState(); + switchBlock(stream, state, local); + return code; + } + + return switchInline(stream, state, state.inline); + } + + function htmlBlock(stream, state) { + var style = htmlMode.token(stream, state.htmlState); + if (htmlFound && style === 'tag' && state.htmlState.type !== 'openTag' && !state.htmlState.context) { + state.f = inlineNormal; + state.block = blockNormal; + } + if (state.md_inside && stream.current().indexOf(">")!=-1) { + state.f = inlineNormal; + state.block = blockNormal; + state.htmlState.context = undefined; + } + return style; + } + + function local(stream, state) { + if (stream.sol() && stream.match(/^```/, true)) { + state.localMode = state.localState = null; + state.f = inlineNormal; + state.block = blockNormal; + return code; + } else if (state.localMode) { + return state.localMode.token(stream, state.localState); + } else { + stream.skipToEnd(); + return code; + } + } + + // Inline + function getType(state) { + var styles = []; + + if (state.taskOpen) { return "meta"; } + if (state.taskClosed) { return "property"; } + + if (state.strong) { styles.push(strong); } + if (state.em) { styles.push(em); } + + if (state.linkText) { styles.push(linktext); } + + if (state.code) { styles.push(code); } + + if (state.header) { styles.push(header); } + if (state.quote) { styles.push(state.quote % 2 ? quote1 : quote2); } + if (state.list !== false) { + var listMod = (state.listDepth - 1) % 3; + if (!listMod) { + styles.push(list1); + } else if (listMod === 1) { + styles.push(list2); + } else { + styles.push(list3); + } + } + + return styles.length ? styles.join(' ') : null; + } + + function handleText(stream, state) { + if (stream.match(textRE, true)) { + return getType(state); + } + return undefined; + } + + function inlineNormal(stream, state) { + var style = state.text(stream, state); + if (typeof style !== 'undefined') + return style; + + if (state.list) { // List marker (*, +, -, 1., etc) + state.list = null; + return getType(state); + } + + if (state.taskList) { + var taskOpen = stream.match(taskListRE, true)[1] !== "x"; + if (taskOpen) state.taskOpen = true; + else state.taskClosed = true; + state.taskList = false; + return getType(state); + } + + state.taskOpen = false; + state.taskClosed = false; + + var ch = stream.next(); + + if (ch === '\\') { + stream.next(); + return getType(state); + } + + // Matches link titles present on next line + if (state.linkTitle) { + state.linkTitle = false; + var matchCh = ch; + if (ch === '(') { + matchCh = ')'; + } + matchCh = (matchCh+'').replace(/([.?*+^$[\]\\(){}|-])/g, "\\$1"); + var regex = '^\\s*(?:[^' + matchCh + '\\\\]+|\\\\\\\\|\\\\.)' + matchCh; + if (stream.match(new RegExp(regex), true)) { + return linkhref; + } + } + + // If this block is changed, it may need to be updated in GFM mode + if (ch === '`') { + var t = getType(state); + var before = stream.pos; + stream.eatWhile('`'); + var difference = 1 + stream.pos - before; + if (!state.code) { + codeDepth = difference; + state.code = true; + return getType(state); + } else { + if (difference === codeDepth) { // Must be exact + state.code = false; + return t; + } + return getType(state); + } + } else if (state.code) { + return getType(state); + } + + if (ch === '!' && stream.match(/\[[^\]]*\] ?(?:\(|\[)/, false)) { + stream.match(/\[[^\]]*\]/); + state.inline = state.f = linkHref; + return image; + } + + if (ch === '[' && stream.match(/.*\](\(| ?\[)/, false)) { + state.linkText = true; + return getType(state); + } + + if (ch === ']' && state.linkText) { + var type = getType(state); + state.linkText = false; + state.inline = state.f = linkHref; + return type; + } + + if (ch === '<' && stream.match(/^(https?|ftps?):\/\/(?:[^\\>]|\\.)+>/, true)) { + return switchInline(stream, state, inlineElement(linkinline, '>')); + } + + if (ch === '<' && stream.match(/^[^> \\]+@(?:[^\\>]|\\.)+>/, true)) { + return switchInline(stream, state, inlineElement(linkemail, '>')); + } + + if (ch === '<' && stream.match(/^\w/, false)) { + if (stream.string.indexOf(">")!=-1) { + var atts = stream.string.substring(1,stream.string.indexOf(">")); + if (/markdown\s*=\s*('|"){0,1}1('|"){0,1}/.test(atts)) { + state.md_inside = true; + } + } + stream.backUp(1); + return switchBlock(stream, state, htmlBlock); + } + + if (ch === '<' && stream.match(/^\/\w*?>/)) { + state.md_inside = false; + return "tag"; + } + + var ignoreUnderscore = false; + if (!modeCfg.underscoresBreakWords) { + if (ch === '_' && stream.peek() !== '_' && stream.match(/(\w)/, false)) { + var prevPos = stream.pos - 2; + if (prevPos >= 0) { + var prevCh = stream.string.charAt(prevPos); + if (prevCh !== '_' && prevCh.match(/(\w)/, false)) { + ignoreUnderscore = true; + } + } + } + } + var t = getType(state); + if (ch === '*' || (ch === '_' && !ignoreUnderscore)) { + if (state.strong === ch && stream.eat(ch)) { // Remove STRONG + state.strong = false; + return t; + } else if (!state.strong && stream.eat(ch)) { // Add STRONG + state.strong = ch; + return getType(state); + } else if (state.em === ch) { // Remove EM + state.em = false; + return t; + } else if (!state.em) { // Add EM + state.em = ch; + return getType(state); + } + } else if (ch === ' ') { + if (stream.eat('*') || stream.eat('_')) { // Probably surrounded by spaces + if (stream.peek() === ' ') { // Surrounded by spaces, ignore + return getType(state); + } else { // Not surrounded by spaces, back up pointer + stream.backUp(1); + } + } + } + + return getType(state); + } + + function linkHref(stream, state) { + // Check if space, and return NULL if so (to avoid marking the space) + if(stream.eatSpace()){ + return null; + } + var ch = stream.next(); + if (ch === '(' || ch === '[') { + return switchInline(stream, state, inlineElement(linkhref, ch === '(' ? ')' : ']')); + } + return 'error'; + } + + function footnoteLink(stream, state) { + if (stream.match(/^[^\]]*\]:/, true)) { + state.f = footnoteUrl; + return linktext; + } + return switchInline(stream, state, inlineNormal); + } + + function footnoteUrl(stream, state) { + // Check if space, and return NULL if so (to avoid marking the space) + if(stream.eatSpace()){ + return null; + } + // Match URL + stream.match(/^[^\s]+/, true); + // Check for link title + if (stream.peek() === undefined) { // End of line, set flag to check next line + state.linkTitle = true; + } else { // More content on line, check if link title + stream.match(/^(?:\s+(?:"(?:[^"\\]|\\\\|\\.)+"|'(?:[^'\\]|\\\\|\\.)+'|\((?:[^)\\]|\\\\|\\.)+\)))?/, true); + } + state.f = state.inline = inlineNormal; + return linkhref; + } + + var savedInlineRE = []; + function inlineRE(endChar) { + if (!savedInlineRE[endChar]) { + // Escape endChar for RegExp (taken from http://stackoverflow.com/a/494122/526741) + endChar = (endChar+'').replace(/([.?*+^$[\]\\(){}|-])/g, "\\$1"); + // Match any non-endChar, escaped character, as well as the closing + // endChar. + savedInlineRE[endChar] = new RegExp('^(?:[^\\\\]|\\\\.)*?(' + endChar + ')'); + } + return savedInlineRE[endChar]; + } + + function inlineElement(type, endChar, next) { + next = next || inlineNormal; + return function(stream, state) { + stream.match(inlineRE(endChar)); + state.inline = state.f = next; + return type; + }; + } + + return { + startState: function() { + return { + f: blockNormal, + + prevLineHasContent: false, + thisLineHasContent: false, + + block: blockNormal, + htmlState: CodeMirror.startState(htmlMode), + indentation: 0, + + inline: inlineNormal, + text: handleText, + + linkText: false, + linkTitle: false, + em: false, + strong: false, + header: false, + taskList: false, + list: false, + listDepth: 0, + quote: 0 + }; + }, + + copyState: function(s) { + return { + f: s.f, + + prevLineHasContent: s.prevLineHasContent, + thisLineHasContent: s.thisLineHasContent, + + block: s.block, + htmlState: CodeMirror.copyState(htmlMode, s.htmlState), + indentation: s.indentation, + + localMode: s.localMode, + localState: s.localMode ? CodeMirror.copyState(s.localMode, s.localState) : null, + + inline: s.inline, + text: s.text, + linkTitle: s.linkTitle, + em: s.em, + strong: s.strong, + header: s.header, + taskList: s.taskList, + list: s.list, + listDepth: s.listDepth, + quote: s.quote, + md_inside: s.md_inside + }; + }, + + token: function(stream, state) { + if (stream.sol()) { + if (stream.match(/^\s*$/, true)) { + state.prevLineHasContent = false; + return blankLine(state); + } else { + state.prevLineHasContent = state.thisLineHasContent; + state.thisLineHasContent = true; + } + + // Reset state.header + state.header = false; + + // Reset state.taskList + state.taskList = false; + + // Reset state.code + state.code = false; + + state.f = state.block; + var indentation = stream.match(/^\s*/, true)[0].replace(/\t/g, ' ').length; + var difference = Math.floor((indentation - state.indentation) / 4) * 4; + if (difference > 4) difference = 4; + var adjustedIndentation = state.indentation + difference; + state.indentationDiff = adjustedIndentation - state.indentation; + state.indentation = adjustedIndentation; + if (indentation > 0) return null; + } + return state.f(stream, state); + }, + + blankLine: blankLine, + + getType: getType + }; + +}, "xml"); + +CodeMirror.defineMIME("text/x-markdown", "markdown"); diff --git a/modules/files/views/default/assets/mode/markdown/test.js b/modules/files/views/default/assets/mode/markdown/test.js new file mode 100755 index 0000000..c451412 --- /dev/null +++ b/modules/files/views/default/assets/mode/markdown/test.js @@ -0,0 +1,636 @@ +(function() { + var mode = CodeMirror.getMode({tabSize: 4}, "markdown"); + function MT(name) { test.mode(name, mode, Array.prototype.slice.call(arguments, 1)); } + + MT("plainText", + "foo"); + + // Code blocks using 4 spaces (regardless of CodeMirror.tabSize value) + MT("codeBlocksUsing4Spaces", + " [comment foo]"); + + // Code blocks using 4 spaces with internal indentation + MT("codeBlocksUsing4SpacesIndentation", + " [comment bar]", + " [comment hello]", + " [comment world]", + " [comment foo]", + "bar"); + + // Code blocks using 4 spaces with internal indentation + MT("codeBlocksUsing4SpacesIndentation", + " foo", + " [comment bar]", + " [comment hello]", + " [comment world]"); + + // Code blocks using 1 tab (regardless of CodeMirror.indentWithTabs value) + MT("codeBlocksUsing1Tab", + "\t[comment foo]"); + + // Inline code using backticks + MT("inlineCodeUsingBackticks", + "foo [comment `bar`]"); + + // Block code using single backtick (shouldn't work) + MT("blockCodeSingleBacktick", + "[comment `]", + "foo", + "[comment `]"); + + // Unclosed backticks + // Instead of simply marking as CODE, it would be nice to have an + // incomplete flag for CODE, that is styled slightly different. + MT("unclosedBackticks", + "foo [comment `bar]"); + + // Per documentation: "To include a literal backtick character within a + // code span, you can use multiple backticks as the opening and closing + // delimiters" + MT("doubleBackticks", + "[comment ``foo ` bar``]"); + + // Tests based on Dingus + // http://daringfireball.net/projects/markdown/dingus + // + // Multiple backticks within an inline code block + MT("consecutiveBackticks", + "[comment `foo```bar`]"); + + // Multiple backticks within an inline code block with a second code block + MT("consecutiveBackticks", + "[comment `foo```bar`] hello [comment `world`]"); + + // Unclosed with several different groups of backticks + MT("unclosedBackticks", + "[comment ``foo ``` bar` hello]"); + + // Closed with several different groups of backticks + MT("closedBackticks", + "[comment ``foo ``` bar` hello``] world"); + + // atx headers + // http://daringfireball.net/projects/markdown/syntax#header + + MT("atxH1", + "[header # foo]"); + + MT("atxH2", + "[header ## foo]"); + + MT("atxH3", + "[header ### foo]"); + + MT("atxH4", + "[header #### foo]"); + + MT("atxH5", + "[header ##### foo]"); + + MT("atxH6", + "[header ###### foo]"); + + // H6 - 7x '#' should still be H6, per Dingus + // http://daringfireball.net/projects/markdown/dingus + MT("atxH6NotH7", + "[header ####### foo]"); + + // Setext headers - H1, H2 + // Per documentation, "Any number of underlining =’s or -’s will work." + // http://daringfireball.net/projects/markdown/syntax#header + // Ideally, the text would be marked as `header` as well, but this is + // not really feasible at the moment. So, instead, we're testing against + // what works today, to avoid any regressions. + // + // Check if single underlining = works + MT("setextH1", + "foo", + "[header =]"); + + // Check if 3+ ='s work + MT("setextH1", + "foo", + "[header ===]"); + + // Check if single underlining - works + MT("setextH2", + "foo", + "[header -]"); + + // Check if 3+ -'s work + MT("setextH2", + "foo", + "[header ---]"); + + // Single-line blockquote with trailing space + MT("blockquoteSpace", + "[atom > foo]"); + + // Single-line blockquote + MT("blockquoteNoSpace", + "[atom >foo]"); + + // No blank line before blockquote + MT("blockquoteNoBlankLine", + "foo", + "[atom > bar]"); + + // Nested blockquote + MT("blockquoteSpace", + "[atom > foo]", + "[number > > foo]", + "[atom > > > foo]"); + + // Single-line blockquote followed by normal paragraph + MT("blockquoteThenParagraph", + "[atom >foo]", + "", + "bar"); + + // Multi-line blockquote (lazy mode) + MT("multiBlockquoteLazy", + "[atom >foo]", + "[atom bar]"); + + // Multi-line blockquote followed by normal paragraph (lazy mode) + MT("multiBlockquoteLazyThenParagraph", + "[atom >foo]", + "[atom bar]", + "", + "hello"); + + // Multi-line blockquote (non-lazy mode) + MT("multiBlockquote", + "[atom >foo]", + "[atom >bar]"); + + // Multi-line blockquote followed by normal paragraph (non-lazy mode) + MT("multiBlockquoteThenParagraph", + "[atom >foo]", + "[atom >bar]", + "", + "hello"); + + // Check list types + + MT("listAsterisk", + "foo", + "bar", + "", + "[variable-2 * foo]", + "[variable-2 * bar]"); + + MT("listPlus", + "foo", + "bar", + "", + "[variable-2 + foo]", + "[variable-2 + bar]"); + + MT("listDash", + "foo", + "bar", + "", + "[variable-2 - foo]", + "[variable-2 - bar]"); + + MT("listNumber", + "foo", + "bar", + "", + "[variable-2 1. foo]", + "[variable-2 2. bar]"); + + // Lists require a preceding blank line (per Dingus) + MT("listBogus", + "foo", + "1. bar", + "2. hello"); + + // Formatting in lists (*) + MT("listAsteriskFormatting", + "[variable-2 * ][variable-2&em *foo*][variable-2 bar]", + "[variable-2 * ][variable-2&strong **foo**][variable-2 bar]", + "[variable-2 * ][variable-2&strong **][variable-2&em&strong *foo**][variable-2&em *][variable-2 bar]", + "[variable-2 * ][variable-2&comment `foo`][variable-2 bar]"); + + // Formatting in lists (+) + MT("listPlusFormatting", + "[variable-2 + ][variable-2&em *foo*][variable-2 bar]", + "[variable-2 + ][variable-2&strong **foo**][variable-2 bar]", + "[variable-2 + ][variable-2&strong **][variable-2&em&strong *foo**][variable-2&em *][variable-2 bar]", + "[variable-2 + ][variable-2&comment `foo`][variable-2 bar]"); + + // Formatting in lists (-) + MT("listDashFormatting", + "[variable-2 - ][variable-2&em *foo*][variable-2 bar]", + "[variable-2 - ][variable-2&strong **foo**][variable-2 bar]", + "[variable-2 - ][variable-2&strong **][variable-2&em&strong *foo**][variable-2&em *][variable-2 bar]", + "[variable-2 - ][variable-2&comment `foo`][variable-2 bar]"); + + // Formatting in lists (1.) + MT("listNumberFormatting", + "[variable-2 1. ][variable-2&em *foo*][variable-2 bar]", + "[variable-2 2. ][variable-2&strong **foo**][variable-2 bar]", + "[variable-2 3. ][variable-2&strong **][variable-2&em&strong *foo**][variable-2&em *][variable-2 bar]", + "[variable-2 4. ][variable-2&comment `foo`][variable-2 bar]"); + + // Paragraph lists + MT("listParagraph", + "[variable-2 * foo]", + "", + "[variable-2 * bar]"); + + // Multi-paragraph lists + // + // 4 spaces + MT("listMultiParagraph", + "[variable-2 * foo]", + "", + "[variable-2 * bar]", + "", + " [variable-2 hello]"); + + // 4 spaces, extra blank lines (should still be list, per Dingus) + MT("listMultiParagraphExtra", + "[variable-2 * foo]", + "", + "[variable-2 * bar]", + "", + "", + " [variable-2 hello]"); + + // 4 spaces, plus 1 space (should still be list, per Dingus) + MT("listMultiParagraphExtraSpace", + "[variable-2 * foo]", + "", + "[variable-2 * bar]", + "", + " [variable-2 hello]", + "", + " [variable-2 world]"); + + // 1 tab + MT("listTab", + "[variable-2 * foo]", + "", + "[variable-2 * bar]", + "", + "\t[variable-2 hello]"); + + // No indent + MT("listNoIndent", + "[variable-2 * foo]", + "", + "[variable-2 * bar]", + "", + "hello"); + + // Blockquote + MT("blockquote", + "[variable-2 * foo]", + "", + "[variable-2 * bar]", + "", + " [variable-2&atom > hello]"); + + // Code block + MT("blockquoteCode", + "[variable-2 * foo]", + "", + "[variable-2 * bar]", + "", + " [comment > hello]", + "", + " [variable-2 world]"); + + // Code block followed by text + MT("blockquoteCodeText", + "[variable-2 * foo]", + "", + " [variable-2 bar]", + "", + " [comment hello]", + "", + " [variable-2 world]"); + + // Nested list + + MT("listAsteriskNested", + "[variable-2 * foo]", + "", + " [variable-3 * bar]"); + + MT("listPlusNested", + "[variable-2 + foo]", + "", + " [variable-3 + bar]"); + + MT("listDashNested", + "[variable-2 - foo]", + "", + " [variable-3 - bar]"); + + MT("listNumberNested", + "[variable-2 1. foo]", + "", + " [variable-3 2. bar]"); + + MT("listMixed", + "[variable-2 * foo]", + "", + " [variable-3 + bar]", + "", + " [keyword - hello]", + "", + " [variable-2 1. world]"); + + MT("listBlockquote", + "[variable-2 * foo]", + "", + " [variable-3 + bar]", + "", + " [atom&variable-3 > hello]"); + + MT("listCode", + "[variable-2 * foo]", + "", + " [variable-3 + bar]", + "", + " [comment hello]"); + + // Code with internal indentation + MT("listCodeIndentation", + "[variable-2 * foo]", + "", + " [comment bar]", + " [comment hello]", + " [comment world]", + " [comment foo]", + " [variable-2 bar]"); + + // List nesting edge cases + MT("listNested", + "[variable-2 * foo]", + "", + " [variable-3 * bar]", + "", + " [variable-2 hello]" + ); + MT("listNested", + "[variable-2 * foo]", + "", + " [variable-3 * bar]", + "", + " [variable-3 * foo]" + ); + + // Code followed by text + MT("listCodeText", + "[variable-2 * foo]", + "", + " [comment bar]", + "", + "hello"); + + // Following tests directly from official Markdown documentation + // http://daringfireball.net/projects/markdown/syntax#hr + + MT("hrSpace", + "[hr * * *]"); + + MT("hr", + "[hr ***]"); + + MT("hrLong", + "[hr *****]"); + + MT("hrSpaceDash", + "[hr - - -]"); + + MT("hrDashLong", + "[hr ---------------------------------------]"); + + // Inline link with title + MT("linkTitle", + "[link [[foo]]][string (http://example.com/ \"bar\")] hello"); + + // Inline link without title + MT("linkNoTitle", + "[link [[foo]]][string (http://example.com/)] bar"); + + // Inline link with image + MT("linkImage", + "[link [[][tag ![[foo]]][string (http://example.com/)][link ]]][string (http://example.com/)] bar"); + + // Inline link with Em + MT("linkEm", + "[link [[][link&em *foo*][link ]]][string (http://example.com/)] bar"); + + // Inline link with Strong + MT("linkStrong", + "[link [[][link&strong **foo**][link ]]][string (http://example.com/)] bar"); + + // Inline link with EmStrong + MT("linkEmStrong", + "[link [[][link&strong **][link&em&strong *foo**][link&em *][link ]]][string (http://example.com/)] bar"); + + // Image with title + MT("imageTitle", + "[tag ![[foo]]][string (http://example.com/ \"bar\")] hello"); + + // Image without title + MT("imageNoTitle", + "[tag ![[foo]]][string (http://example.com/)] bar"); + + // Image with asterisks + MT("imageAsterisks", + "[tag ![[*foo*]]][string (http://example.com/)] bar"); + + // Not a link. Should be normal text due to square brackets being used + // regularly in text, especially in quoted material, and no space is allowed + // between square brackets and parentheses (per Dingus). + MT("notALink", + "[[foo]] (bar)"); + + // Reference-style links + MT("linkReference", + "[link [[foo]]][string [[bar]]] hello"); + + // Reference-style links with Em + MT("linkReferenceEm", + "[link [[][link&em *foo*][link ]]][string [[bar]]] hello"); + + // Reference-style links with Strong + MT("linkReferenceStrong", + "[link [[][link&strong **foo**][link ]]][string [[bar]]] hello"); + + // Reference-style links with EmStrong + MT("linkReferenceEmStrong", + "[link [[][link&strong **][link&em&strong *foo**][link&em *][link ]]][string [[bar]]] hello"); + + // Reference-style links with optional space separator (per docuentation) + // "You can optionally use a space to separate the sets of brackets" + MT("linkReferenceSpace", + "[link [[foo]]] [string [[bar]]] hello"); + + // Should only allow a single space ("...use *a* space...") + MT("linkReferenceDoubleSpace", + "[[foo]] [[bar]] hello"); + + // Reference-style links with implicit link name + MT("linkImplicit", + "[link [[foo]]][string [[]]] hello"); + + // @todo It would be nice if, at some point, the document was actually + // checked to see if the referenced link exists + + // Link label, for reference-style links (taken from documentation) + + MT("labelNoTitle", + "[link [[foo]]:] [string http://example.com/]"); + + MT("labelIndented", + " [link [[foo]]:] [string http://example.com/]"); + + MT("labelSpaceTitle", + "[link [[foo bar]]:] [string http://example.com/ \"hello\"]"); + + MT("labelDoubleTitle", + "[link [[foo bar]]:] [string http://example.com/ \"hello\"] \"world\""); + + MT("labelTitleDoubleQuotes", + "[link [[foo]]:] [string http://example.com/ \"bar\"]"); + + MT("labelTitleSingleQuotes", + "[link [[foo]]:] [string http://example.com/ 'bar']"); + + MT("labelTitleParenthese", + "[link [[foo]]:] [string http://example.com/ (bar)]"); + + MT("labelTitleInvalid", + "[link [[foo]]:] [string http://example.com/] bar"); + + MT("labelLinkAngleBrackets", + "[link [[foo]]:] [string \"bar\"]"); + + MT("labelTitleNextDoubleQuotes", + "[link [[foo]]:] [string http://example.com/]", + "[string \"bar\"] hello"); + + MT("labelTitleNextSingleQuotes", + "[link [[foo]]:] [string http://example.com/]", + "[string 'bar'] hello"); + + MT("labelTitleNextParenthese", + "[link [[foo]]:] [string http://example.com/]", + "[string (bar)] hello"); + + MT("labelTitleNextMixed", + "[link [[foo]]:] [string http://example.com/]", + "(bar\" hello"); + + MT("linkWeb", + "[link ] foo"); + + MT("linkEmail", + "[link ] foo"); + + MT("emAsterisk", + "[em *foo*] bar"); + + MT("emUnderscore", + "[em _foo_] bar"); + + MT("emInWordAsterisk", + "foo[em *bar*]hello"); + + MT("emInWordUnderscore", + "foo[em _bar_]hello"); + + // Per documentation: "...surround an * or _ with spaces, it’ll be + // treated as a literal asterisk or underscore." + + MT("emEscapedBySpaceIn", + "foo [em _bar _ hello_] world"); + + MT("emEscapedBySpaceOut", + "foo _ bar[em _hello_]world"); + + // Unclosed emphasis characters + // Instead of simply marking as EM / STRONG, it would be nice to have an + // incomplete flag for EM and STRONG, that is styled slightly different. + MT("emIncompleteAsterisk", + "foo [em *bar]"); + + MT("emIncompleteUnderscore", + "foo [em _bar]"); + + MT("strongAsterisk", + "[strong **foo**] bar"); + + MT("strongUnderscore", + "[strong __foo__] bar"); + + MT("emStrongAsterisk", + "[em *foo][em&strong **bar*][strong hello**] world"); + + MT("emStrongUnderscore", + "[em _foo][em&strong __bar_][strong hello__] world"); + + // "...same character must be used to open and close an emphasis span."" + MT("emStrongMixed", + "[em _foo][em&strong **bar*hello__ world]"); + + MT("emStrongMixed", + "[em *foo][em&strong __bar_hello** world]"); + + // These characters should be escaped: + // \ backslash + // ` backtick + // * asterisk + // _ underscore + // {} curly braces + // [] square brackets + // () parentheses + // # hash mark + // + plus sign + // - minus sign (hyphen) + // . dot + // ! exclamation mark + + MT("escapeBacktick", + "foo \\`bar\\`"); + + MT("doubleEscapeBacktick", + "foo \\\\[comment `bar\\\\`]"); + + MT("escapeAsterisk", + "foo \\*bar\\*"); + + MT("doubleEscapeAsterisk", + "foo \\\\[em *bar\\\\*]"); + + MT("escapeUnderscore", + "foo \\_bar\\_"); + + MT("doubleEscapeUnderscore", + "foo \\\\[em _bar\\\\_]"); + + MT("escapeHash", + "\\# foo"); + + MT("doubleEscapeHash", + "\\\\# foo"); + + + // Tests to make sure GFM-specific things aren't getting through + + MT("taskList", + "[variable-2 * [ ]] bar]"); + + MT("fencedCodeBlocks", + "[comment ```]", + "foo", + "[comment ```]"); +})(); diff --git a/modules/files/views/default/assets/mode/meta.js b/modules/files/views/default/assets/mode/meta.js new file mode 100755 index 0000000..87000c4 --- /dev/null +++ b/modules/files/views/default/assets/mode/meta.js @@ -0,0 +1,75 @@ +CodeMirror.modeInfo = [ + {name: 'APL', mime: 'text/apl', mode: 'apl'}, + {name: 'Asterisk', mime: 'text/x-asterisk', mode: 'asterisk'}, + {name: 'C', mime: 'text/x-csrc', mode: 'clike'}, + {name: 'C++', mime: 'text/x-c++src', mode: 'clike'}, + {name: 'Java', mime: 'text/x-java', mode: 'clike'}, + {name: 'C#', mime: 'text/x-csharp', mode: 'clike'}, + {name: 'Scala', mime: 'text/x-scala', mode: 'clike'}, + {name: 'Clojure', mime: 'text/x-clojure', mode: 'clojure'}, + {name: 'CoffeeScript', mime: 'text/x-coffeescript', mode: 'coffeescript'}, + {name: 'Common Lisp', mime: 'text/x-common-lisp', mode: 'commonlisp'}, + {name: 'CSS', mime: 'text/css', mode: 'css'}, + {name: 'D', mime: 'text/x-d', mode: 'd'}, + {name: 'diff', mime: 'text/x-diff', mode: 'diff'}, + {name: 'ECL', mime: 'text/x-ecl', mode: 'ecl'}, + {name: 'Erlang', mime: 'text/x-erlang', mode: 'erlang'}, + {name: 'Gas', mime: 'text/x-gas', mode: 'gas'}, + {name: 'GitHub Flavored Markdown', mode: 'gfm'}, + {name: 'GO', mime: 'text/x-go', mode: 'go'}, + {name: 'Groovy', mime: 'text/x-groovy', mode: 'groovy'}, + {name: 'Haskell', mime: 'text/x-haskell', mode: 'haskell'}, + {name: 'Haxe', mime: 'text/x-haxe', mode: 'haxe'}, + {name: 'ASP.NET', mime: 'application/x-aspx', mode: 'htmlembedded'}, + {name: 'Embedded Javascript', mime: 'application/x-ejs', mode: 'htmlembedded'}, + {name: 'JavaServer Pages', mime: 'application/x-jsp', mode: 'htmlembedded'}, + {name: 'HTML', mime: 'text/html', mode: 'htmlmixed'}, + {name: 'HTTP', mime: 'message/http', mode: 'http'}, + {name: 'JavaScript', mime: 'text/javascript', mode: 'javascript'}, + {name: 'JSON', mime: 'application/json', mode: 'javascript'}, + {name: 'TypeScript', mime: 'application/typescript', mode: 'javascript'}, + {name: 'Jinja2', mime: 'jinja2', mode: 'jinja2'}, + {name: 'LESS', mime: 'text/x-less', mode: 'less'}, + {name: 'LiveScript', mime: 'text/x-livescript', mode: 'livescript'}, + {name: 'Lua', mime: 'text/x-lua', mode: 'lua'}, + {name: 'Markdown (GitHub-flavour)', mime: 'text/x-markdown', mode: 'markdown'}, + {name: 'mIRC', mime: 'text/mirc', mode: 'mirc'}, + {name: 'NTriples', mime: 'text/n-triples', mode: 'ntriples'}, + {name: 'OCaml', mime: 'text/x-ocaml', mode: 'ocaml'}, + {name: 'Pascal', mime: 'text/x-pascal', mode: 'pascal'}, + {name: 'Perl', mime: 'text/x-perl', mode: 'perl'}, + {name: 'PHP', mime: 'text/x-php', mode: 'php'}, + {name: 'PHP(HTML)', mime: 'application/x-httpd-php', mode: 'php'}, + {name: 'Pig', mime: 'text/x-pig', mode: 'pig'}, + {name: 'Plain Text', mime: 'text/plain', mode: 'null'}, + {name: 'Properties files', mime: 'text/x-properties', mode: 'clike'}, + {name: 'Python', mime: 'text/x-python', mode: 'python'}, + {name: 'R', mime: 'text/x-rsrc', mode: 'r'}, + {name: 'reStructuredText', mime: 'text/x-rst', mode: 'rst'}, + {name: 'Ruby', mime: 'text/x-ruby', mode: 'ruby'}, + {name: 'Rust', mime: 'text/x-rustsrc', mode: 'rust'}, + {name: 'Sass', mime: 'text/x-sass', mode: 'sass'}, + {name: 'Scheme', mime: 'text/x-scheme', mode: 'scheme'}, + {name: 'SCSS', mime: 'text/x-scss', mode: 'css'}, + {name: 'Shell', mime: 'text/x-sh', mode: 'shell'}, + {name: 'Sieve', mime: 'application/sieve', mode: 'sieve'}, + {name: 'Smalltalk', mime: 'text/x-stsrc', mode: 'smalltalk'}, + {name: 'Smarty', mime: 'text/x-smarty', mode: 'smarty'}, + {name: 'SPARQL', mime: 'application/x-sparql-query', mode: 'sparql'}, + {name: 'SQL', mime: 'text/x-sql', mode: 'sql'}, + {name: 'MariaDB', mime: 'text/x-mariadb', mode: 'sql'}, + {name: 'sTeX', mime: 'text/x-stex', mode: 'stex'}, + {name: 'LaTeX', mime: 'text/x-latex', mode: 'stex'}, + {name: 'Tcl', mime: 'text/x-tcl', mode: 'tcl'}, + {name: 'TiddlyWiki ', mime: 'text/x-tiddlywiki', mode: 'tiddlywiki'}, + {name: 'Tiki wiki', mime: 'text/tiki', mode: 'tiki'}, + {name: 'VB.NET', mime: 'text/x-vb', mode: 'vb'}, + {name: 'VBScript', mime: 'text/vbscript', mode: 'vbscript'}, + {name: 'Velocity', mime: 'text/velocity', mode: 'velocity'}, + {name: 'Verilog', mime: 'text/x-verilog', mode: 'verilog'}, + {name: 'XML', mime: 'application/xml', mode: 'xml'}, + {name: 'HTML', mime: 'text/html', mode: 'xml'}, + {name: 'XQuery', mime: 'application/xquery', mode: 'xquery'}, + {name: 'YAML', mime: 'text/x-yaml', mode: 'yaml'}, + {name: 'Z80', mime: 'text/x-z80', mode: 'z80'} +]; diff --git a/modules/files/views/default/assets/mode/mirc/index.html b/modules/files/views/default/assets/mode/mirc/index.html new file mode 100755 index 0000000..0ff5ec9 --- /dev/null +++ b/modules/files/views/default/assets/mode/mirc/index.html @@ -0,0 +1,149 @@ + + + + + CodeMirror: mIRC mode + + + + + + + + +

      CodeMirror: mIRC mode

      +
      + + +

      MIME types defined: text/mirc.

      + + + diff --git a/modules/files/views/default/assets/mode/mirc/mirc.js b/modules/files/views/default/assets/mode/mirc/mirc.js new file mode 100755 index 0000000..fc88bc5 --- /dev/null +++ b/modules/files/views/default/assets/mode/mirc/mirc.js @@ -0,0 +1,177 @@ +//mIRC mode by Ford_Lawnmower :: Based on Velocity mode by Steve O'Hara +CodeMirror.defineMIME("text/mirc", "mirc"); +CodeMirror.defineMode("mirc", function() { + function parseWords(str) { + var obj = {}, words = str.split(" "); + for (var i = 0; i < words.length; ++i) obj[words[i]] = true; + return obj; + } + var specials = parseWords("$! $$ $& $? $+ $abook $abs $active $activecid " + + "$activewid $address $addtok $agent $agentname $agentstat $agentver " + + "$alias $and $anick $ansi2mirc $aop $appactive $appstate $asc $asctime " + + "$asin $atan $avoice $away $awaymsg $awaytime $banmask $base $bfind " + + "$binoff $biton $bnick $bvar $bytes $calc $cb $cd $ceil $chan $chanmodes " + + "$chantypes $chat $chr $cid $clevel $click $cmdbox $cmdline $cnick $color " + + "$com $comcall $comchan $comerr $compact $compress $comval $cos $count " + + "$cr $crc $creq $crlf $ctime $ctimer $ctrlenter $date $day $daylight " + + "$dbuh $dbuw $dccignore $dccport $dde $ddename $debug $decode $decompress " + + "$deltok $devent $dialog $did $didreg $didtok $didwm $disk $dlevel $dll " + + "$dllcall $dname $dns $duration $ebeeps $editbox $emailaddr $encode $error " + + "$eval $event $exist $feof $ferr $fgetc $file $filename $filtered $finddir " + + "$finddirn $findfile $findfilen $findtok $fline $floor $fopen $fread $fserve " + + "$fulladdress $fulldate $fullname $fullscreen $get $getdir $getdot $gettok $gmt " + + "$group $halted $hash $height $hfind $hget $highlight $hnick $hotline " + + "$hotlinepos $ial $ialchan $ibl $idle $iel $ifmatch $ignore $iif $iil " + + "$inelipse $ini $inmidi $inpaste $inpoly $input $inrect $inroundrect " + + "$insong $instok $int $inwave $ip $isalias $isbit $isdde $isdir $isfile " + + "$isid $islower $istok $isupper $keychar $keyrpt $keyval $knick $lactive " + + "$lactivecid $lactivewid $left $len $level $lf $line $lines $link $lock " + + "$lock $locked $log $logstamp $logstampfmt $longfn $longip $lower $ltimer " + + "$maddress $mask $matchkey $matchtok $md5 $me $menu $menubar $menucontext " + + "$menutype $mid $middir $mircdir $mircexe $mircini $mklogfn $mnick $mode " + + "$modefirst $modelast $modespl $mouse $msfile $network $newnick $nick $nofile " + + "$nopath $noqt $not $notags $notify $null $numeric $numok $oline $onpoly " + + "$opnick $or $ord $os $passivedcc $pic $play $pnick $port $portable $portfree " + + "$pos $prefix $prop $protect $puttok $qt $query $rand $r $rawmsg $read $readomo " + + "$readn $regex $regml $regsub $regsubex $remove $remtok $replace $replacex " + + "$reptok $result $rgb $right $round $scid $scon $script $scriptdir $scriptline " + + "$sdir $send $server $serverip $sfile $sha1 $shortfn $show $signal $sin " + + "$site $sline $snick $snicks $snotify $sock $sockbr $sockerr $sockname " + + "$sorttok $sound $sqrt $ssl $sreq $sslready $status $strip $str $stripped " + + "$syle $submenu $switchbar $tan $target $ticks $time $timer $timestamp " + + "$timestampfmt $timezone $tip $titlebar $toolbar $treebar $trust $ulevel " + + "$ulist $upper $uptime $url $usermode $v1 $v2 $var $vcmd $vcmdstat $vcmdver " + + "$version $vnick $vol $wid $width $wildsite $wildtok $window $wrap $xor"); + var keywords = parseWords("abook ajinvite alias aline ame amsg anick aop auser autojoin avoice " + + "away background ban bcopy beep bread break breplace bset btrunc bunset bwrite " + + "channel clear clearall cline clipboard close cnick color comclose comopen " + + "comreg continue copy creq ctcpreply ctcps dcc dccserver dde ddeserver " + + "debug dec describe dialog did didtok disable disconnect dlevel dline dll " + + "dns dqwindow drawcopy drawdot drawfill drawline drawpic drawrect drawreplace " + + "drawrot drawsave drawscroll drawtext ebeeps echo editbox emailaddr enable " + + "events exit fclose filter findtext finger firewall flash flist flood flush " + + "flushini font fopen fseek fsend fserve fullname fwrite ghide gload gmove " + + "gopts goto gplay gpoint gqreq groups gshow gsize gstop gtalk gunload hadd " + + "halt haltdef hdec hdel help hfree hinc hload hmake hop hsave ial ialclear " + + "ialmark identd if ignore iline inc invite iuser join kick linesep links list " + + "load loadbuf localinfo log mdi me menubar mkdir mnick mode msg nick noop notice " + + "notify omsg onotice part partall pdcc perform play playctrl pop protect pvoice " + + "qme qmsg query queryn quit raw reload remini remote remove rename renwin " + + "reseterror resetidle return rlevel rline rmdir run ruser save savebuf saveini " + + "say scid scon server set showmirc signam sline sockaccept sockclose socklist " + + "socklisten sockmark sockopen sockpause sockread sockrename sockudp sockwrite " + + "sound speak splay sreq strip switchbar timer timestamp titlebar tnick tokenize " + + "toolbar topic tray treebar ulist unload unset unsetall updatenl url uwho " + + "var vcadd vcmd vcrem vol while whois window winhelp write writeint if isalnum " + + "isalpha isaop isavoice isban ischan ishop isignore isin isincs isletter islower " + + "isnotify isnum ison isop isprotect isreg isupper isvoice iswm iswmcs " + + "elseif else goto menu nicklist status title icon size option text edit " + + "button check radio box scroll list combo link tab item"); + var functions = parseWords("if elseif else and not or eq ne in ni for foreach while switch"); + var isOperatorChar = /[+\-*&%=<>!?^\/\|]/; + function chain(stream, state, f) { + state.tokenize = f; + return f(stream, state); + } + function tokenBase(stream, state) { + var beforeParams = state.beforeParams; + state.beforeParams = false; + var ch = stream.next(); + if (/[\[\]{}\(\),\.]/.test(ch)) { + if (ch == "(" && beforeParams) state.inParams = true; + else if (ch == ")") state.inParams = false; + return null; + } + else if (/\d/.test(ch)) { + stream.eatWhile(/[\w\.]/); + return "number"; + } + else if (ch == "\\") { + stream.eat("\\"); + stream.eat(/./); + return "number"; + } + else if (ch == "/" && stream.eat("*")) { + return chain(stream, state, tokenComment); + } + else if (ch == ";" && stream.match(/ *\( *\(/)) { + return chain(stream, state, tokenUnparsed); + } + else if (ch == ";" && !state.inParams) { + stream.skipToEnd(); + return "comment"; + } + else if (ch == '"') { + stream.eat(/"/); + return "keyword"; + } + else if (ch == "$") { + stream.eatWhile(/[$_a-z0-9A-Z\.:]/); + if (specials && specials.propertyIsEnumerable(stream.current().toLowerCase())) { + return "keyword"; + } + else { + state.beforeParams = true; + return "builtin"; + } + } + else if (ch == "%") { + stream.eatWhile(/[^,^\s^\(^\)]/); + state.beforeParams = true; + return "string"; + } + else if (isOperatorChar.test(ch)) { + stream.eatWhile(isOperatorChar); + return "operator"; + } + else { + stream.eatWhile(/[\w\$_{}]/); + var word = stream.current().toLowerCase(); + if (keywords && keywords.propertyIsEnumerable(word)) + return "keyword"; + if (functions && functions.propertyIsEnumerable(word)) { + state.beforeParams = true; + return "keyword"; + } + return null; + } + } + function tokenComment(stream, state) { + var maybeEnd = false, ch; + while (ch = stream.next()) { + if (ch == "/" && maybeEnd) { + state.tokenize = tokenBase; + break; + } + maybeEnd = (ch == "*"); + } + return "comment"; + } + function tokenUnparsed(stream, state) { + var maybeEnd = 0, ch; + while (ch = stream.next()) { + if (ch == ";" && maybeEnd == 2) { + state.tokenize = tokenBase; + break; + } + if (ch == ")") + maybeEnd++; + else if (ch != " ") + maybeEnd = 0; + } + return "meta"; + } + return { + startState: function() { + return { + tokenize: tokenBase, + beforeParams: false, + inParams: false + }; + }, + token: function(stream, state) { + if (stream.eatSpace()) return null; + return state.tokenize(stream, state); + } + }; +}); diff --git a/modules/files/views/default/assets/mode/ntriples/index.html b/modules/files/views/default/assets/mode/ntriples/index.html new file mode 100755 index 0000000..052a53d --- /dev/null +++ b/modules/files/views/default/assets/mode/ntriples/index.html @@ -0,0 +1,33 @@ + + + + + CodeMirror: NTriples mode + + + + + + + +

      CodeMirror: NTriples mode

      +
      + + + + +

      MIME types defined: text/n-triples.

      + + diff --git a/modules/files/views/default/assets/mode/ntriples/ntriples.js b/modules/files/views/default/assets/mode/ntriples/ntriples.js new file mode 100755 index 0000000..ed0cee3 --- /dev/null +++ b/modules/files/views/default/assets/mode/ntriples/ntriples.js @@ -0,0 +1,170 @@ +/********************************************************** +* This script provides syntax highlighting support for +* the Ntriples format. +* Ntriples format specification: +* http://www.w3.org/TR/rdf-testcases/#ntriples +***********************************************************/ + +/* + The following expression defines the defined ASF grammar transitions. + + pre_subject -> + { + ( writing_subject_uri | writing_bnode_uri ) + -> pre_predicate + -> writing_predicate_uri + -> pre_object + -> writing_object_uri | writing_object_bnode | + ( + writing_object_literal + -> writing_literal_lang | writing_literal_type + ) + -> post_object + -> BEGIN + } otherwise { + -> ERROR + } +*/ +CodeMirror.defineMode("ntriples", function() { + + var Location = { + PRE_SUBJECT : 0, + WRITING_SUB_URI : 1, + WRITING_BNODE_URI : 2, + PRE_PRED : 3, + WRITING_PRED_URI : 4, + PRE_OBJ : 5, + WRITING_OBJ_URI : 6, + WRITING_OBJ_BNODE : 7, + WRITING_OBJ_LITERAL : 8, + WRITING_LIT_LANG : 9, + WRITING_LIT_TYPE : 10, + POST_OBJ : 11, + ERROR : 12 + }; + function transitState(currState, c) { + var currLocation = currState.location; + var ret; + + // Opening. + if (currLocation == Location.PRE_SUBJECT && c == '<') ret = Location.WRITING_SUB_URI; + else if(currLocation == Location.PRE_SUBJECT && c == '_') ret = Location.WRITING_BNODE_URI; + else if(currLocation == Location.PRE_PRED && c == '<') ret = Location.WRITING_PRED_URI; + else if(currLocation == Location.PRE_OBJ && c == '<') ret = Location.WRITING_OBJ_URI; + else if(currLocation == Location.PRE_OBJ && c == '_') ret = Location.WRITING_OBJ_BNODE; + else if(currLocation == Location.PRE_OBJ && c == '"') ret = Location.WRITING_OBJ_LITERAL; + + // Closing. + else if(currLocation == Location.WRITING_SUB_URI && c == '>') ret = Location.PRE_PRED; + else if(currLocation == Location.WRITING_BNODE_URI && c == ' ') ret = Location.PRE_PRED; + else if(currLocation == Location.WRITING_PRED_URI && c == '>') ret = Location.PRE_OBJ; + else if(currLocation == Location.WRITING_OBJ_URI && c == '>') ret = Location.POST_OBJ; + else if(currLocation == Location.WRITING_OBJ_BNODE && c == ' ') ret = Location.POST_OBJ; + else if(currLocation == Location.WRITING_OBJ_LITERAL && c == '"') ret = Location.POST_OBJ; + else if(currLocation == Location.WRITING_LIT_LANG && c == ' ') ret = Location.POST_OBJ; + else if(currLocation == Location.WRITING_LIT_TYPE && c == '>') ret = Location.POST_OBJ; + + // Closing typed and language literal. + else if(currLocation == Location.WRITING_OBJ_LITERAL && c == '@') ret = Location.WRITING_LIT_LANG; + else if(currLocation == Location.WRITING_OBJ_LITERAL && c == '^') ret = Location.WRITING_LIT_TYPE; + + // Spaces. + else if( c == ' ' && + ( + currLocation == Location.PRE_SUBJECT || + currLocation == Location.PRE_PRED || + currLocation == Location.PRE_OBJ || + currLocation == Location.POST_OBJ + ) + ) ret = currLocation; + + // Reset. + else if(currLocation == Location.POST_OBJ && c == '.') ret = Location.PRE_SUBJECT; + + // Error + else ret = Location.ERROR; + + currState.location=ret; + } + + return { + startState: function() { + return { + location : Location.PRE_SUBJECT, + uris : [], + anchors : [], + bnodes : [], + langs : [], + types : [] + }; + }, + token: function(stream, state) { + var ch = stream.next(); + if(ch == '<') { + transitState(state, ch); + var parsedURI = ''; + stream.eatWhile( function(c) { if( c != '#' && c != '>' ) { parsedURI += c; return true; } return false;} ); + state.uris.push(parsedURI); + if( stream.match('#', false) ) return 'variable'; + stream.next(); + transitState(state, '>'); + return 'variable'; + } + if(ch == '#') { + var parsedAnchor = ''; + stream.eatWhile(function(c) { if(c != '>' && c != ' ') { parsedAnchor+= c; return true; } return false;}); + state.anchors.push(parsedAnchor); + return 'variable-2'; + } + if(ch == '>') { + transitState(state, '>'); + return 'variable'; + } + if(ch == '_') { + transitState(state, ch); + var parsedBNode = ''; + stream.eatWhile(function(c) { if( c != ' ' ) { parsedBNode += c; return true; } return false;}); + state.bnodes.push(parsedBNode); + stream.next(); + transitState(state, ' '); + return 'builtin'; + } + if(ch == '"') { + transitState(state, ch); + stream.eatWhile( function(c) { return c != '"'; } ); + stream.next(); + if( stream.peek() != '@' && stream.peek() != '^' ) { + transitState(state, '"'); + } + return 'string'; + } + if( ch == '@' ) { + transitState(state, '@'); + var parsedLang = ''; + stream.eatWhile(function(c) { if( c != ' ' ) { parsedLang += c; return true; } return false;}); + state.langs.push(parsedLang); + stream.next(); + transitState(state, ' '); + return 'string-2'; + } + if( ch == '^' ) { + stream.next(); + transitState(state, '^'); + var parsedType = ''; + stream.eatWhile(function(c) { if( c != '>' ) { parsedType += c; return true; } return false;} ); + state.types.push(parsedType); + stream.next(); + transitState(state, '>'); + return 'variable'; + } + if( ch == ' ' ) { + transitState(state, ch); + } + if( ch == '.' ) { + transitState(state, ch); + } + } + }; +}); + +CodeMirror.defineMIME("text/n-triples", "ntriples"); diff --git a/modules/files/views/default/assets/mode/ocaml/index.html b/modules/files/views/default/assets/mode/ocaml/index.html new file mode 100755 index 0000000..c10a84f --- /dev/null +++ b/modules/files/views/default/assets/mode/ocaml/index.html @@ -0,0 +1,131 @@ + + +CodeMirror: OCaml mode + + + + + + + + + + +

      CodeMirror: OCaml mode

      + + + + + +

      MIME types defined: text/x-ocaml.

      diff --git a/modules/files/views/default/assets/mode/ocaml/ocaml.js b/modules/files/views/default/assets/mode/ocaml/ocaml.js new file mode 100755 index 0000000..7dc3d28 --- /dev/null +++ b/modules/files/views/default/assets/mode/ocaml/ocaml.js @@ -0,0 +1,113 @@ +CodeMirror.defineMode('ocaml', function() { + + var words = { + 'true': 'atom', + 'false': 'atom', + 'let': 'keyword', + 'rec': 'keyword', + 'in': 'keyword', + 'of': 'keyword', + 'and': 'keyword', + 'succ': 'keyword', + 'if': 'keyword', + 'then': 'keyword', + 'else': 'keyword', + 'for': 'keyword', + 'to': 'keyword', + 'while': 'keyword', + 'do': 'keyword', + 'done': 'keyword', + 'fun': 'keyword', + 'function': 'keyword', + 'val': 'keyword', + 'type': 'keyword', + 'mutable': 'keyword', + 'match': 'keyword', + 'with': 'keyword', + 'try': 'keyword', + 'raise': 'keyword', + 'begin': 'keyword', + 'end': 'keyword', + 'open': 'builtin', + 'trace': 'builtin', + 'ignore': 'builtin', + 'exit': 'builtin', + 'print_string': 'builtin', + 'print_endline': 'builtin' + }; + + function tokenBase(stream, state) { + var ch = stream.next(); + + if (ch === '"') { + state.tokenize = tokenString; + return state.tokenize(stream, state); + } + if (ch === '(') { + if (stream.eat('*')) { + state.commentLevel++; + state.tokenize = tokenComment; + return state.tokenize(stream, state); + } + } + if (ch === '~') { + stream.eatWhile(/\w/); + return 'variable-2'; + } + if (ch === '`') { + stream.eatWhile(/\w/); + return 'quote'; + } + if (/\d/.test(ch)) { + stream.eatWhile(/[\d]/); + if (stream.eat('.')) { + stream.eatWhile(/[\d]/); + } + return 'number'; + } + if ( /[+\-*&%=<>!?|]/.test(ch)) { + return 'operator'; + } + stream.eatWhile(/\w/); + var cur = stream.current(); + return words[cur] || 'variable'; + } + + function tokenString(stream, state) { + var next, end = false, escaped = false; + while ((next = stream.next()) != null) { + if (next === '"' && !escaped) { + end = true; + break; + } + escaped = !escaped && next === '\\'; + } + if (end && !escaped) { + state.tokenize = tokenBase; + } + return 'string'; + }; + + function tokenComment(stream, state) { + var prev, next; + while(state.commentLevel > 0 && (next = stream.next()) != null) { + if (prev === '(' && next === '*') state.commentLevel++; + if (prev === '*' && next === ')') state.commentLevel--; + prev = next; + } + if (state.commentLevel <= 0) { + state.tokenize = tokenBase; + } + return 'comment'; + } + + return { + startState: function() {return {tokenize: tokenBase, commentLevel: 0};}, + token: function(stream, state) { + if (stream.eatSpace()) return null; + return state.tokenize(stream, state); + } + }; +}); + +CodeMirror.defineMIME('text/x-ocaml', 'ocaml'); diff --git a/modules/files/views/default/assets/mode/pascal/LICENSE b/modules/files/views/default/assets/mode/pascal/LICENSE new file mode 100755 index 0000000..8e3747e --- /dev/null +++ b/modules/files/views/default/assets/mode/pascal/LICENSE @@ -0,0 +1,7 @@ +Copyright (c) 2011 souceLair + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/modules/files/views/default/assets/mode/pascal/index.html b/modules/files/views/default/assets/mode/pascal/index.html new file mode 100755 index 0000000..b3016af --- /dev/null +++ b/modules/files/views/default/assets/mode/pascal/index.html @@ -0,0 +1,48 @@ + + + + + CodeMirror: Pascal mode + + + + + + + +

      CodeMirror: Pascal mode

      + +
      + + + +

      MIME types defined: text/x-pascal.

      + + diff --git a/modules/files/views/default/assets/mode/pascal/pascal.js b/modules/files/views/default/assets/mode/pascal/pascal.js new file mode 100755 index 0000000..09d9b06 --- /dev/null +++ b/modules/files/views/default/assets/mode/pascal/pascal.js @@ -0,0 +1,94 @@ +CodeMirror.defineMode("pascal", function() { + function words(str) { + var obj = {}, words = str.split(" "); + for (var i = 0; i < words.length; ++i) obj[words[i]] = true; + return obj; + } + var keywords = words("and array begin case const div do downto else end file for forward integer " + + "boolean char function goto if in label mod nil not of or packed procedure " + + "program record repeat set string then to type until var while with"); + var atoms = {"null": true}; + + var isOperatorChar = /[+\-*&%=<>!?|\/]/; + + function tokenBase(stream, state) { + var ch = stream.next(); + if (ch == "#" && state.startOfLine) { + stream.skipToEnd(); + return "meta"; + } + if (ch == '"' || ch == "'") { + state.tokenize = tokenString(ch); + return state.tokenize(stream, state); + } + if (ch == "(" && stream.eat("*")) { + state.tokenize = tokenComment; + return tokenComment(stream, state); + } + if (/[\[\]{}\(\),;\:\.]/.test(ch)) { + return null; + } + if (/\d/.test(ch)) { + stream.eatWhile(/[\w\.]/); + return "number"; + } + if (ch == "/") { + if (stream.eat("/")) { + stream.skipToEnd(); + return "comment"; + } + } + if (isOperatorChar.test(ch)) { + stream.eatWhile(isOperatorChar); + return "operator"; + } + stream.eatWhile(/[\w\$_]/); + var cur = stream.current(); + if (keywords.propertyIsEnumerable(cur)) return "keyword"; + if (atoms.propertyIsEnumerable(cur)) return "atom"; + return "variable"; + } + + function tokenString(quote) { + return function(stream, state) { + var escaped = false, next, end = false; + while ((next = stream.next()) != null) { + if (next == quote && !escaped) {end = true; break;} + escaped = !escaped && next == "\\"; + } + if (end || !escaped) state.tokenize = null; + return "string"; + }; + } + + function tokenComment(stream, state) { + var maybeEnd = false, ch; + while (ch = stream.next()) { + if (ch == ")" && maybeEnd) { + state.tokenize = null; + break; + } + maybeEnd = (ch == "*"); + } + return "comment"; + } + + // Interface + + return { + startState: function() { + return {tokenize: null}; + }, + + token: function(stream, state) { + if (stream.eatSpace()) return null; + var style = (state.tokenize || tokenBase)(stream, state); + if (style == "comment" || style == "meta") return style; + return style; + }, + + electricChars: "{}" + }; +}); + +CodeMirror.defineMIME("text/x-pascal", "pascal"); diff --git a/modules/files/views/default/assets/mode/perl/LICENSE b/modules/files/views/default/assets/mode/perl/LICENSE new file mode 100755 index 0000000..96f4115 --- /dev/null +++ b/modules/files/views/default/assets/mode/perl/LICENSE @@ -0,0 +1,19 @@ +Copyright (C) 2011 by Sabaca under the MIT license. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/modules/files/views/default/assets/mode/perl/index.html b/modules/files/views/default/assets/mode/perl/index.html new file mode 100755 index 0000000..13c7af6 --- /dev/null +++ b/modules/files/views/default/assets/mode/perl/index.html @@ -0,0 +1,62 @@ + + + + + CodeMirror: Perl mode + + + + + + + +

      CodeMirror: Perl mode

      + +
      + + + +

      MIME types defined: text/x-perl.

      + + diff --git a/modules/files/views/default/assets/mode/perl/perl.js b/modules/files/views/default/assets/mode/perl/perl.js new file mode 100755 index 0000000..5954b1a --- /dev/null +++ b/modules/files/views/default/assets/mode/perl/perl.js @@ -0,0 +1,816 @@ +// CodeMirror2 mode/perl/perl.js (text/x-perl) beta 0.10 (2011-11-08) +// This is a part of CodeMirror from https://github.com/sabaca/CodeMirror_mode_perl (mail@sabaca.com) +CodeMirror.defineMode("perl",function(){ + // http://perldoc.perl.org + var PERL={ // null - magic touch + // 1 - keyword + // 2 - def + // 3 - atom + // 4 - operator + // 5 - variable-2 (predefined) + // [x,y] - x=1,2,3; y=must be defined if x{...} + // PERL operators + '->' : 4, + '++' : 4, + '--' : 4, + '**' : 4, + // ! ~ \ and unary + and - + '=~' : 4, + '!~' : 4, + '*' : 4, + '/' : 4, + '%' : 4, + 'x' : 4, + '+' : 4, + '-' : 4, + '.' : 4, + '<<' : 4, + '>>' : 4, + // named unary operators + '<' : 4, + '>' : 4, + '<=' : 4, + '>=' : 4, + 'lt' : 4, + 'gt' : 4, + 'le' : 4, + 'ge' : 4, + '==' : 4, + '!=' : 4, + '<=>' : 4, + 'eq' : 4, + 'ne' : 4, + 'cmp' : 4, + '~~' : 4, + '&' : 4, + '|' : 4, + '^' : 4, + '&&' : 4, + '||' : 4, + '//' : 4, + '..' : 4, + '...' : 4, + '?' : 4, + ':' : 4, + '=' : 4, + '+=' : 4, + '-=' : 4, + '*=' : 4, // etc. ??? + ',' : 4, + '=>' : 4, + '::' : 4, + // list operators (rightward) + 'not' : 4, + 'and' : 4, + 'or' : 4, + 'xor' : 4, + // PERL predefined variables (I know, what this is a paranoid idea, but may be needed for people, who learn PERL, and for me as well, ...and may be for you?;) + 'BEGIN' : [5,1], + 'END' : [5,1], + 'PRINT' : [5,1], + 'PRINTF' : [5,1], + 'GETC' : [5,1], + 'READ' : [5,1], + 'READLINE' : [5,1], + 'DESTROY' : [5,1], + 'TIE' : [5,1], + 'TIEHANDLE' : [5,1], + 'UNTIE' : [5,1], + 'STDIN' : 5, + 'STDIN_TOP' : 5, + 'STDOUT' : 5, + 'STDOUT_TOP' : 5, + 'STDERR' : 5, + 'STDERR_TOP' : 5, + '$ARG' : 5, + '$_' : 5, + '@ARG' : 5, + '@_' : 5, + '$LIST_SEPARATOR' : 5, + '$"' : 5, + '$PROCESS_ID' : 5, + '$PID' : 5, + '$$' : 5, + '$REAL_GROUP_ID' : 5, + '$GID' : 5, + '$(' : 5, + '$EFFECTIVE_GROUP_ID' : 5, + '$EGID' : 5, + '$)' : 5, + '$PROGRAM_NAME' : 5, + '$0' : 5, + '$SUBSCRIPT_SEPARATOR' : 5, + '$SUBSEP' : 5, + '$;' : 5, + '$REAL_USER_ID' : 5, + '$UID' : 5, + '$<' : 5, + '$EFFECTIVE_USER_ID' : 5, + '$EUID' : 5, + '$>' : 5, + '$a' : 5, + '$b' : 5, + '$COMPILING' : 5, + '$^C' : 5, + '$DEBUGGING' : 5, + '$^D' : 5, + '${^ENCODING}' : 5, + '$ENV' : 5, + '%ENV' : 5, + '$SYSTEM_FD_MAX' : 5, + '$^F' : 5, + '@F' : 5, + '${^GLOBAL_PHASE}' : 5, + '$^H' : 5, + '%^H' : 5, + '@INC' : 5, + '%INC' : 5, + '$INPLACE_EDIT' : 5, + '$^I' : 5, + '$^M' : 5, + '$OSNAME' : 5, + '$^O' : 5, + '${^OPEN}' : 5, + '$PERLDB' : 5, + '$^P' : 5, + '$SIG' : 5, + '%SIG' : 5, + '$BASETIME' : 5, + '$^T' : 5, + '${^TAINT}' : 5, + '${^UNICODE}' : 5, + '${^UTF8CACHE}' : 5, + '${^UTF8LOCALE}' : 5, + '$PERL_VERSION' : 5, + '$^V' : 5, + '${^WIN32_SLOPPY_STAT}' : 5, + '$EXECUTABLE_NAME' : 5, + '$^X' : 5, + '$1' : 5, // - regexp $1, $2... + '$MATCH' : 5, + '$&' : 5, + '${^MATCH}' : 5, + '$PREMATCH' : 5, + '$`' : 5, + '${^PREMATCH}' : 5, + '$POSTMATCH' : 5, + "$'" : 5, + '${^POSTMATCH}' : 5, + '$LAST_PAREN_MATCH' : 5, + '$+' : 5, + '$LAST_SUBMATCH_RESULT' : 5, + '$^N' : 5, + '@LAST_MATCH_END' : 5, + '@+' : 5, + '%LAST_PAREN_MATCH' : 5, + '%+' : 5, + '@LAST_MATCH_START' : 5, + '@-' : 5, + '%LAST_MATCH_START' : 5, + '%-' : 5, + '$LAST_REGEXP_CODE_RESULT' : 5, + '$^R' : 5, + '${^RE_DEBUG_FLAGS}' : 5, + '${^RE_TRIE_MAXBUF}' : 5, + '$ARGV' : 5, + '@ARGV' : 5, + 'ARGV' : 5, + 'ARGVOUT' : 5, + '$OUTPUT_FIELD_SEPARATOR' : 5, + '$OFS' : 5, + '$,' : 5, + '$INPUT_LINE_NUMBER' : 5, + '$NR' : 5, + '$.' : 5, + '$INPUT_RECORD_SEPARATOR' : 5, + '$RS' : 5, + '$/' : 5, + '$OUTPUT_RECORD_SEPARATOR' : 5, + '$ORS' : 5, + '$\\' : 5, + '$OUTPUT_AUTOFLUSH' : 5, + '$|' : 5, + '$ACCUMULATOR' : 5, + '$^A' : 5, + '$FORMAT_FORMFEED' : 5, + '$^L' : 5, + '$FORMAT_PAGE_NUMBER' : 5, + '$%' : 5, + '$FORMAT_LINES_LEFT' : 5, + '$-' : 5, + '$FORMAT_LINE_BREAK_CHARACTERS' : 5, + '$:' : 5, + '$FORMAT_LINES_PER_PAGE' : 5, + '$=' : 5, + '$FORMAT_TOP_NAME' : 5, + '$^' : 5, + '$FORMAT_NAME' : 5, + '$~' : 5, + '${^CHILD_ERROR_NATIVE}' : 5, + '$EXTENDED_OS_ERROR' : 5, + '$^E' : 5, + '$EXCEPTIONS_BEING_CAUGHT' : 5, + '$^S' : 5, + '$WARNING' : 5, + '$^W' : 5, + '${^WARNING_BITS}' : 5, + '$OS_ERROR' : 5, + '$ERRNO' : 5, + '$!' : 5, + '%OS_ERROR' : 5, + '%ERRNO' : 5, + '%!' : 5, + '$CHILD_ERROR' : 5, + '$?' : 5, + '$EVAL_ERROR' : 5, + '$@' : 5, + '$OFMT' : 5, + '$#' : 5, + '$*' : 5, + '$ARRAY_BASE' : 5, + '$[' : 5, + '$OLD_PERL_VERSION' : 5, + '$]' : 5, + // PERL blocks + 'if' :[1,1], + elsif :[1,1], + 'else' :[1,1], + 'while' :[1,1], + unless :[1,1], + 'for' :[1,1], + foreach :[1,1], + // PERL functions + 'abs' :1, // - absolute value function + accept :1, // - accept an incoming socket connect + alarm :1, // - schedule a SIGALRM + 'atan2' :1, // - arctangent of Y/X in the range -PI to PI + bind :1, // - binds an address to a socket + binmode :1, // - prepare binary files for I/O + bless :1, // - create an object + bootstrap :1, // + 'break' :1, // - break out of a "given" block + caller :1, // - get context of the current subroutine call + chdir :1, // - change your current working directory + chmod :1, // - changes the permissions on a list of files + chomp :1, // - remove a trailing record separator from a string + chop :1, // - remove the last character from a string + chown :1, // - change the owership on a list of files + chr :1, // - get character this number represents + chroot :1, // - make directory new root for path lookups + close :1, // - close file (or pipe or socket) handle + closedir :1, // - close directory handle + connect :1, // - connect to a remote socket + 'continue' :[1,1], // - optional trailing block in a while or foreach + 'cos' :1, // - cosine function + crypt :1, // - one-way passwd-style encryption + dbmclose :1, // - breaks binding on a tied dbm file + dbmopen :1, // - create binding on a tied dbm file + 'default' :1, // + defined :1, // - test whether a value, variable, or function is defined + 'delete' :1, // - deletes a value from a hash + die :1, // - raise an exception or bail out + 'do' :1, // - turn a BLOCK into a TERM + dump :1, // - create an immediate core dump + each :1, // - retrieve the next key/value pair from a hash + endgrent :1, // - be done using group file + endhostent :1, // - be done using hosts file + endnetent :1, // - be done using networks file + endprotoent :1, // - be done using protocols file + endpwent :1, // - be done using passwd file + endservent :1, // - be done using services file + eof :1, // - test a filehandle for its end + 'eval' :1, // - catch exceptions or compile and run code + 'exec' :1, // - abandon this program to run another + exists :1, // - test whether a hash key is present + exit :1, // - terminate this program + 'exp' :1, // - raise I to a power + fcntl :1, // - file control system call + fileno :1, // - return file descriptor from filehandle + flock :1, // - lock an entire file with an advisory lock + fork :1, // - create a new process just like this one + format :1, // - declare a picture format with use by the write() function + formline :1, // - internal function used for formats + getc :1, // - get the next character from the filehandle + getgrent :1, // - get next group record + getgrgid :1, // - get group record given group user ID + getgrnam :1, // - get group record given group name + gethostbyaddr :1, // - get host record given its address + gethostbyname :1, // - get host record given name + gethostent :1, // - get next hosts record + getlogin :1, // - return who logged in at this tty + getnetbyaddr :1, // - get network record given its address + getnetbyname :1, // - get networks record given name + getnetent :1, // - get next networks record + getpeername :1, // - find the other end of a socket connection + getpgrp :1, // - get process group + getppid :1, // - get parent process ID + getpriority :1, // - get current nice value + getprotobyname :1, // - get protocol record given name + getprotobynumber :1, // - get protocol record numeric protocol + getprotoent :1, // - get next protocols record + getpwent :1, // - get next passwd record + getpwnam :1, // - get passwd record given user login name + getpwuid :1, // - get passwd record given user ID + getservbyname :1, // - get services record given its name + getservbyport :1, // - get services record given numeric port + getservent :1, // - get next services record + getsockname :1, // - retrieve the sockaddr for a given socket + getsockopt :1, // - get socket options on a given socket + given :1, // + glob :1, // - expand filenames using wildcards + gmtime :1, // - convert UNIX time into record or string using Greenwich time + 'goto' :1, // - create spaghetti code + grep :1, // - locate elements in a list test true against a given criterion + hex :1, // - convert a string to a hexadecimal number + 'import' :1, // - patch a module's namespace into your own + index :1, // - find a substring within a string + 'int' :1, // - get the integer portion of a number + ioctl :1, // - system-dependent device control system call + 'join' :1, // - join a list into a string using a separator + keys :1, // - retrieve list of indices from a hash + kill :1, // - send a signal to a process or process group + last :1, // - exit a block prematurely + lc :1, // - return lower-case version of a string + lcfirst :1, // - return a string with just the next letter in lower case + length :1, // - return the number of bytes in a string + 'link' :1, // - create a hard link in the filesytem + listen :1, // - register your socket as a server + local : 2, // - create a temporary value for a global variable (dynamic scoping) + localtime :1, // - convert UNIX time into record or string using local time + lock :1, // - get a thread lock on a variable, subroutine, or method + 'log' :1, // - retrieve the natural logarithm for a number + lstat :1, // - stat a symbolic link + m :null, // - match a string with a regular expression pattern + map :1, // - apply a change to a list to get back a new list with the changes + mkdir :1, // - create a directory + msgctl :1, // - SysV IPC message control operations + msgget :1, // - get SysV IPC message queue + msgrcv :1, // - receive a SysV IPC message from a message queue + msgsnd :1, // - send a SysV IPC message to a message queue + my : 2, // - declare and assign a local variable (lexical scoping) + 'new' :1, // + next :1, // - iterate a block prematurely + no :1, // - unimport some module symbols or semantics at compile time + oct :1, // - convert a string to an octal number + open :1, // - open a file, pipe, or descriptor + opendir :1, // - open a directory + ord :1, // - find a character's numeric representation + our : 2, // - declare and assign a package variable (lexical scoping) + pack :1, // - convert a list into a binary representation + 'package' :1, // - declare a separate global namespace + pipe :1, // - open a pair of connected filehandles + pop :1, // - remove the last element from an array and return it + pos :1, // - find or set the offset for the last/next m//g search + print :1, // - output a list to a filehandle + printf :1, // - output a formatted list to a filehandle + prototype :1, // - get the prototype (if any) of a subroutine + push :1, // - append one or more elements to an array + q :null, // - singly quote a string + qq :null, // - doubly quote a string + qr :null, // - Compile pattern + quotemeta :null, // - quote regular expression magic characters + qw :null, // - quote a list of words + qx :null, // - backquote quote a string + rand :1, // - retrieve the next pseudorandom number + read :1, // - fixed-length buffered input from a filehandle + readdir :1, // - get a directory from a directory handle + readline :1, // - fetch a record from a file + readlink :1, // - determine where a symbolic link is pointing + readpipe :1, // - execute a system command and collect standard output + recv :1, // - receive a message over a Socket + redo :1, // - start this loop iteration over again + ref :1, // - find out the type of thing being referenced + rename :1, // - change a filename + require :1, // - load in external functions from a library at runtime + reset :1, // - clear all variables of a given name + 'return' :1, // - get out of a function early + reverse :1, // - flip a string or a list + rewinddir :1, // - reset directory handle + rindex :1, // - right-to-left substring search + rmdir :1, // - remove a directory + s :null, // - replace a pattern with a string + say :1, // - print with newline + scalar :1, // - force a scalar context + seek :1, // - reposition file pointer for random-access I/O + seekdir :1, // - reposition directory pointer + select :1, // - reset default output or do I/O multiplexing + semctl :1, // - SysV semaphore control operations + semget :1, // - get set of SysV semaphores + semop :1, // - SysV semaphore operations + send :1, // - send a message over a socket + setgrent :1, // - prepare group file for use + sethostent :1, // - prepare hosts file for use + setnetent :1, // - prepare networks file for use + setpgrp :1, // - set the process group of a process + setpriority :1, // - set a process's nice value + setprotoent :1, // - prepare protocols file for use + setpwent :1, // - prepare passwd file for use + setservent :1, // - prepare services file for use + setsockopt :1, // - set some socket options + shift :1, // - remove the first element of an array, and return it + shmctl :1, // - SysV shared memory operations + shmget :1, // - get SysV shared memory segment identifier + shmread :1, // - read SysV shared memory + shmwrite :1, // - write SysV shared memory + shutdown :1, // - close down just half of a socket connection + 'sin' :1, // - return the sine of a number + sleep :1, // - block for some number of seconds + socket :1, // - create a socket + socketpair :1, // - create a pair of sockets + 'sort' :1, // - sort a list of values + splice :1, // - add or remove elements anywhere in an array + 'split' :1, // - split up a string using a regexp delimiter + sprintf :1, // - formatted print into a string + 'sqrt' :1, // - square root function + srand :1, // - seed the random number generator + stat :1, // - get a file's status information + state :1, // - declare and assign a state variable (persistent lexical scoping) + study :1, // - optimize input data for repeated searches + 'sub' :1, // - declare a subroutine, possibly anonymously + 'substr' :1, // - get or alter a portion of a stirng + symlink :1, // - create a symbolic link to a file + syscall :1, // - execute an arbitrary system call + sysopen :1, // - open a file, pipe, or descriptor + sysread :1, // - fixed-length unbuffered input from a filehandle + sysseek :1, // - position I/O pointer on handle used with sysread and syswrite + system :1, // - run a separate program + syswrite :1, // - fixed-length unbuffered output to a filehandle + tell :1, // - get current seekpointer on a filehandle + telldir :1, // - get current seekpointer on a directory handle + tie :1, // - bind a variable to an object class + tied :1, // - get a reference to the object underlying a tied variable + time :1, // - return number of seconds since 1970 + times :1, // - return elapsed time for self and child processes + tr :null, // - transliterate a string + truncate :1, // - shorten a file + uc :1, // - return upper-case version of a string + ucfirst :1, // - return a string with just the next letter in upper case + umask :1, // - set file creation mode mask + undef :1, // - remove a variable or function definition + unlink :1, // - remove one link to a file + unpack :1, // - convert binary structure into normal perl variables + unshift :1, // - prepend more elements to the beginning of a list + untie :1, // - break a tie binding to a variable + use :1, // - load in a module at compile time + utime :1, // - set a file's last access and modify times + values :1, // - return a list of the values in a hash + vec :1, // - test or set particular bits in a string + wait :1, // - wait for any child process to die + waitpid :1, // - wait for a particular child process to die + wantarray :1, // - get void vs scalar vs list context of current subroutine call + warn :1, // - print debugging info + when :1, // + write :1, // - print a picture record + y :null}; // - transliterate a string + + var RXstyle="string-2"; + var RXmodifiers=/[goseximacplud]/; // NOTE: "m", "s", "y" and "tr" need to correct real modifiers for each regexp type + + function tokenChain(stream,state,chain,style,tail){ // NOTE: chain.length > 2 is not working now (it's for s[...][...]geos;) + state.chain=null; // 12 3tail + state.style=null; + state.tail=null; + state.tokenize=function(stream,state){ + var e=false,c,i=0; + while(c=stream.next()){ + if(c===chain[i]&&!e){ + if(chain[++i]!==undefined){ + state.chain=chain[i]; + state.style=style; + state.tail=tail;} + else if(tail) + stream.eatWhile(tail); + state.tokenize=tokenPerl; + return style;} + e=!e&&c=="\\";} + return style;}; + return state.tokenize(stream,state);} + + function tokenSOMETHING(stream,state,string){ + state.tokenize=function(stream,state){ + if(stream.string==string) + state.tokenize=tokenPerl; + stream.skipToEnd(); + return "string";}; + return state.tokenize(stream,state);} + + function tokenPerl(stream,state){ + if(stream.eatSpace()) + return null; + if(state.chain) + return tokenChain(stream,state,state.chain,state.style,state.tail); + if(stream.match(/^\-?[\d\.]/,false)) + if(stream.match(/^(\-?(\d*\.\d+(e[+-]?\d+)?|\d+\.\d*)|0x[\da-fA-F]+|0b[01]+|\d+(e[+-]?\d+)?)/)) + return 'number'; + if(stream.match(/^<<(?=\w)/)){ // NOTE: <"],RXstyle,RXmodifiers);} + if(/[\^'"!~\/]/.test(c)){ + stream.eatSuffix(1); + return tokenChain(stream,state,[stream.eat(c)],RXstyle,RXmodifiers);}} + else if(c=="q"){ + c=stream.look(1); + if(c=="("){ + stream.eatSuffix(2); + return tokenChain(stream,state,[")"],"string");} + if(c=="["){ + stream.eatSuffix(2); + return tokenChain(stream,state,["]"],"string");} + if(c=="{"){ +stream.eatSuffix(2); + return tokenChain(stream,state,["}"],"string");} + if(c=="<"){ + stream.eatSuffix(2); + return tokenChain(stream,state,[">"],"string");} + if(/[\^'"!~\/]/.test(c)){ + stream.eatSuffix(1); + return tokenChain(stream,state,[stream.eat(c)],"string");}} + else if(c=="w"){ + c=stream.look(1); + if(c=="("){ + stream.eatSuffix(2); + return tokenChain(stream,state,[")"],"bracket");} + if(c=="["){ + stream.eatSuffix(2); + return tokenChain(stream,state,["]"],"bracket");} + if(c=="{"){ + stream.eatSuffix(2); + return tokenChain(stream,state,["}"],"bracket");} + if(c=="<"){ + stream.eatSuffix(2); + return tokenChain(stream,state,[">"],"bracket");} + if(/[\^'"!~\/]/.test(c)){ + stream.eatSuffix(1); + return tokenChain(stream,state,[stream.eat(c)],"bracket");}} + else if(c=="r"){ + c=stream.look(1); + if(c=="("){ + stream.eatSuffix(2); + return tokenChain(stream,state,[")"],RXstyle,RXmodifiers);} + if(c=="["){ + stream.eatSuffix(2); + return tokenChain(stream,state,["]"],RXstyle,RXmodifiers);} + if(c=="{"){ + stream.eatSuffix(2); + return tokenChain(stream,state,["}"],RXstyle,RXmodifiers);} + if(c=="<"){ + stream.eatSuffix(2); + return tokenChain(stream,state,[">"],RXstyle,RXmodifiers);} + if(/[\^'"!~\/]/.test(c)){ + stream.eatSuffix(1); + return tokenChain(stream,state,[stream.eat(c)],RXstyle,RXmodifiers);}} + else if(/[\^'"!~\/(\[{<]/.test(c)){ + if(c=="("){ + stream.eatSuffix(1); + return tokenChain(stream,state,[")"],"string");} + if(c=="["){ + stream.eatSuffix(1); + return tokenChain(stream,state,["]"],"string");} + if(c=="{"){ + stream.eatSuffix(1); + return tokenChain(stream,state,["}"],"string");} + if(c=="<"){ + stream.eatSuffix(1); + return tokenChain(stream,state,[">"],"string");} + if(/[\^'"!~\/]/.test(c)){ + return tokenChain(stream,state,[stream.eat(c)],"string");}}}} + if(ch=="m"){ + var c=stream.look(-2); + if(!(c&&/\w/.test(c))){ + c=stream.eat(/[(\[{<\^'"!~\/]/); + if(c){ + if(/[\^'"!~\/]/.test(c)){ + return tokenChain(stream,state,[c],RXstyle,RXmodifiers);} + if(c=="("){ + return tokenChain(stream,state,[")"],RXstyle,RXmodifiers);} + if(c=="["){ + return tokenChain(stream,state,["]"],RXstyle,RXmodifiers);} + if(c=="{"){ + return tokenChain(stream,state,["}"],RXstyle,RXmodifiers);} + if(c=="<"){ + return tokenChain(stream,state,[">"],RXstyle,RXmodifiers);}}}} + if(ch=="s"){ + var c=/[\/>\]})\w]/.test(stream.look(-2)); + if(!c){ + c=stream.eat(/[(\[{<\^'"!~\/]/); + if(c){ + if(c=="[") + return tokenChain(stream,state,["]","]"],RXstyle,RXmodifiers); + if(c=="{") + return tokenChain(stream,state,["}","}"],RXstyle,RXmodifiers); + if(c=="<") + return tokenChain(stream,state,[">",">"],RXstyle,RXmodifiers); + if(c=="(") + return tokenChain(stream,state,[")",")"],RXstyle,RXmodifiers); + return tokenChain(stream,state,[c,c],RXstyle,RXmodifiers);}}} + if(ch=="y"){ + var c=/[\/>\]})\w]/.test(stream.look(-2)); + if(!c){ + c=stream.eat(/[(\[{<\^'"!~\/]/); + if(c){ + if(c=="[") + return tokenChain(stream,state,["]","]"],RXstyle,RXmodifiers); + if(c=="{") + return tokenChain(stream,state,["}","}"],RXstyle,RXmodifiers); + if(c=="<") + return tokenChain(stream,state,[">",">"],RXstyle,RXmodifiers); + if(c=="(") + return tokenChain(stream,state,[")",")"],RXstyle,RXmodifiers); + return tokenChain(stream,state,[c,c],RXstyle,RXmodifiers);}}} + if(ch=="t"){ + var c=/[\/>\]})\w]/.test(stream.look(-2)); + if(!c){ + c=stream.eat("r");if(c){ + c=stream.eat(/[(\[{<\^'"!~\/]/); + if(c){ + if(c=="[") + return tokenChain(stream,state,["]","]"],RXstyle,RXmodifiers); + if(c=="{") + return tokenChain(stream,state,["}","}"],RXstyle,RXmodifiers); + if(c=="<") + return tokenChain(stream,state,[">",">"],RXstyle,RXmodifiers); + if(c=="(") + return tokenChain(stream,state,[")",")"],RXstyle,RXmodifiers); + return tokenChain(stream,state,[c,c],RXstyle,RXmodifiers);}}}} + if(ch=="`"){ + return tokenChain(stream,state,[ch],"variable-2");} + if(ch=="/"){ + if(!/~\s*$/.test(stream.prefix())) + return "operator"; + else + return tokenChain(stream,state,[ch],RXstyle,RXmodifiers);} + if(ch=="$"){ + var p=stream.pos; + if(stream.eatWhile(/\d/)||stream.eat("{")&&stream.eatWhile(/\d/)&&stream.eat("}")) + return "variable-2"; + else + stream.pos=p;} + if(/[$@%]/.test(ch)){ + var p=stream.pos; + if(stream.eat("^")&&stream.eat(/[A-Z]/)||!/[@$%&]/.test(stream.look(-2))&&stream.eat(/[=|\\\-#?@;:&`~\^!\[\]*'"$+.,\/<>()]/)){ + var c=stream.current(); + if(PERL[c]) + return "variable-2";} + stream.pos=p;} + if(/[$@%&]/.test(ch)){ + if(stream.eatWhile(/[\w$\[\]]/)||stream.eat("{")&&stream.eatWhile(/[\w$\[\]]/)&&stream.eat("}")){ + var c=stream.current(); + if(PERL[c]) + return "variable-2"; + else + return "variable";}} + if(ch=="#"){ + if(stream.look(-2)!="$"){ + stream.skipToEnd(); + return "comment";}} + if(/[:+\-\^*$&%@=<>!?|\/~\.]/.test(ch)){ + var p=stream.pos; + stream.eatWhile(/[:+\-\^*$&%@=<>!?|\/~\.]/); + if(PERL[stream.current()]) + return "operator"; + else + stream.pos=p;} + if(ch=="_"){ + if(stream.pos==1){ + if(stream.suffix(6)=="_END__"){ + return tokenChain(stream,state,['\0'],"comment");} + else if(stream.suffix(7)=="_DATA__"){ + return tokenChain(stream,state,['\0'],"variable-2");} + else if(stream.suffix(7)=="_C__"){ + return tokenChain(stream,state,['\0'],"string");}}} + if(/\w/.test(ch)){ + var p=stream.pos; + if(stream.look(-2)=="{"&&(stream.look(0)=="}"||stream.eatWhile(/\w/)&&stream.look(0)=="}")) + return "string"; + else + stream.pos=p;} + if(/[A-Z]/.test(ch)){ + var l=stream.look(-2); + var p=stream.pos; + stream.eatWhile(/[A-Z_]/); + if(/[\da-z]/.test(stream.look(0))){ + stream.pos=p;} + else{ + var c=PERL[stream.current()]; + if(!c) + return "meta"; + if(c[1]) + c=c[0]; + if(l!=":"){ + if(c==1) + return "keyword"; + else if(c==2) + return "def"; + else if(c==3) + return "atom"; + else if(c==4) + return "operator"; + else if(c==5) + return "variable-2"; + else + return "meta";} + else + return "meta";}} + if(/[a-zA-Z_]/.test(ch)){ + var l=stream.look(-2); + stream.eatWhile(/\w/); + var c=PERL[stream.current()]; + if(!c) + return "meta"; + if(c[1]) + c=c[0]; + if(l!=":"){ + if(c==1) + return "keyword"; + else if(c==2) + return "def"; + else if(c==3) + return "atom"; + else if(c==4) + return "operator"; + else if(c==5) + return "variable-2"; + else + return "meta";} + else + return "meta";} + return null;} + + return{ + startState:function(){ + return{ + tokenize:tokenPerl, + chain:null, + style:null, + tail:null};}, + token:function(stream,state){ + return (state.tokenize||tokenPerl)(stream,state);}, + electricChars:"{}"};}); + +CodeMirror.defineMIME("text/x-perl", "perl"); + +// it's like "peek", but need for look-ahead or look-behind if index < 0 +CodeMirror.StringStream.prototype.look=function(c){ + return this.string.charAt(this.pos+(c||0));}; + +// return a part of prefix of current stream from current position +CodeMirror.StringStream.prototype.prefix=function(c){ + if(c){ + var x=this.pos-c; + return this.string.substr((x>=0?x:0),c);} + else{ + return this.string.substr(0,this.pos-1);}}; + +// return a part of suffix of current stream from current position +CodeMirror.StringStream.prototype.suffix=function(c){ + var y=this.string.length; + var x=y-this.pos+1; + return this.string.substr(this.pos,(c&&c=(y=this.string.length-1)) + this.pos=y; + else + this.pos=x;}; diff --git a/modules/files/views/default/assets/mode/php/index.html b/modules/files/views/default/assets/mode/php/index.html new file mode 100755 index 0000000..3d4c336 --- /dev/null +++ b/modules/files/views/default/assets/mode/php/index.html @@ -0,0 +1,51 @@ + + + + + CodeMirror: PHP mode + + + + + + + + + + + + + +

      CodeMirror: PHP mode

      + +
      + + + +

      Simple HTML/PHP mode based on + the C-like mode. Depends on XML, + JavaScript, CSS, HTMLMixed, and C-like modes.

      + +

      MIME types defined: application/x-httpd-php (HTML with PHP code), text/x-php (plain, non-wrapped PHP code).

      + + diff --git a/modules/files/views/default/assets/mode/php/php.js b/modules/files/views/default/assets/mode/php/php.js new file mode 100755 index 0000000..56497ed --- /dev/null +++ b/modules/files/views/default/assets/mode/php/php.js @@ -0,0 +1,129 @@ +(function() { + function keywords(str) { + var obj = {}, words = str.split(" "); + for (var i = 0; i < words.length; ++i) obj[words[i]] = true; + return obj; + } + function heredoc(delim) { + return function(stream, state) { + if (stream.match(delim)) state.tokenize = null; + else stream.skipToEnd(); + return "string"; + }; + } + var phpConfig = { + name: "clike", + keywords: keywords("abstract and array as break case catch class clone const continue declare default " + + "do else elseif enddeclare endfor endforeach endif endswitch endwhile extends final " + + "for foreach function global goto if implements interface instanceof namespace " + + "new or private protected public static switch throw trait try use var while xor " + + "die echo empty exit eval include include_once isset list require require_once return " + + "print unset __halt_compiler self static parent"), + blockKeywords: keywords("catch do else elseif for foreach if switch try while"), + atoms: keywords("true false null TRUE FALSE NULL __CLASS__ __DIR__ __FILE__ __LINE__ __METHOD__ __FUNCTION__ __NAMESPACE__"), + builtin: keywords("func_num_args func_get_arg func_get_args strlen strcmp strncmp strcasecmp strncasecmp each error_reporting define defined trigger_error user_error set_error_handler restore_error_handler get_declared_classes get_loaded_extensions extension_loaded get_extension_funcs debug_backtrace constant bin2hex sleep usleep time mktime gmmktime strftime gmstrftime strtotime date gmdate getdate localtime checkdate flush wordwrap htmlspecialchars htmlentities html_entity_decode md5 md5_file crc32 getimagesize image_type_to_mime_type phpinfo phpversion phpcredits strnatcmp strnatcasecmp substr_count strspn strcspn strtok strtoupper strtolower strpos strrpos strrev hebrev hebrevc nl2br basename dirname pathinfo stripslashes stripcslashes strstr stristr strrchr str_shuffle str_word_count strcoll substr substr_replace quotemeta ucfirst ucwords strtr addslashes addcslashes rtrim str_replace str_repeat count_chars chunk_split trim ltrim strip_tags similar_text explode implode setlocale localeconv parse_str str_pad chop strchr sprintf printf vprintf vsprintf sscanf fscanf parse_url urlencode urldecode rawurlencode rawurldecode readlink linkinfo link unlink exec system escapeshellcmd escapeshellarg passthru shell_exec proc_open proc_close rand srand getrandmax mt_rand mt_srand mt_getrandmax base64_decode base64_encode abs ceil floor round is_finite is_nan is_infinite bindec hexdec octdec decbin decoct dechex base_convert number_format fmod ip2long long2ip getenv putenv getopt microtime gettimeofday getrusage uniqid quoted_printable_decode set_time_limit get_cfg_var magic_quotes_runtime set_magic_quotes_runtime get_magic_quotes_gpc get_magic_quotes_runtime import_request_variables error_log serialize unserialize memory_get_usage var_dump var_export debug_zval_dump print_r highlight_file show_source highlight_string ini_get ini_get_all ini_set ini_alter ini_restore get_include_path set_include_path restore_include_path setcookie header headers_sent connection_aborted connection_status ignore_user_abort parse_ini_file is_uploaded_file move_uploaded_file intval floatval doubleval strval gettype settype is_null is_resource is_bool is_long is_float is_int is_integer is_double is_real is_numeric is_string is_array is_object is_scalar ereg ereg_replace eregi eregi_replace split spliti join sql_regcase dl pclose popen readfile rewind rmdir umask fclose feof fgetc fgets fgetss fread fopen fpassthru ftruncate fstat fseek ftell fflush fwrite fputs mkdir rename copy tempnam tmpfile file file_get_contents stream_select stream_context_create stream_context_set_params stream_context_set_option stream_context_get_options stream_filter_prepend stream_filter_append fgetcsv flock get_meta_tags stream_set_write_buffer set_file_buffer set_socket_blocking stream_set_blocking socket_set_blocking stream_get_meta_data stream_register_wrapper stream_wrapper_register stream_set_timeout socket_set_timeout socket_get_status realpath fnmatch fsockopen pfsockopen pack unpack get_browser crypt opendir closedir chdir getcwd rewinddir readdir dir glob fileatime filectime filegroup fileinode filemtime fileowner fileperms filesize filetype file_exists is_writable is_writeable is_readable is_executable is_file is_dir is_link stat lstat chown touch clearstatcache mail ob_start ob_flush ob_clean ob_end_flush ob_end_clean ob_get_flush ob_get_clean ob_get_length ob_get_level ob_get_status ob_get_contents ob_implicit_flush ob_list_handlers ksort krsort natsort natcasesort asort arsort sort rsort usort uasort uksort shuffle array_walk count end prev next reset current key min max in_array array_search extract compact array_fill range array_multisort array_push array_pop array_shift array_unshift array_splice array_slice array_merge array_merge_recursive array_keys array_values array_count_values array_reverse array_reduce array_pad array_flip array_change_key_case array_rand array_unique array_intersect array_intersect_assoc array_diff array_diff_assoc array_sum array_filter array_map array_chunk array_key_exists pos sizeof key_exists assert assert_options version_compare ftok str_rot13 aggregate session_name session_module_name session_save_path session_id session_regenerate_id session_decode session_register session_unregister session_is_registered session_encode session_start session_destroy session_unset session_set_save_handler session_cache_limiter session_cache_expire session_set_cookie_params session_get_cookie_params session_write_close preg_match preg_match_all preg_replace preg_replace_callback preg_split preg_quote preg_grep overload ctype_alnum ctype_alpha ctype_cntrl ctype_digit ctype_lower ctype_graph ctype_print ctype_punct ctype_space ctype_upper ctype_xdigit virtual apache_request_headers apache_note apache_lookup_uri apache_child_terminate apache_setenv apache_response_headers apache_get_version getallheaders mysql_connect mysql_pconnect mysql_close mysql_select_db mysql_create_db mysql_drop_db mysql_query mysql_unbuffered_query mysql_db_query mysql_list_dbs mysql_list_tables mysql_list_fields mysql_list_processes mysql_error mysql_errno mysql_affected_rows mysql_insert_id mysql_result mysql_num_rows mysql_num_fields mysql_fetch_row mysql_fetch_array mysql_fetch_assoc mysql_fetch_object mysql_data_seek mysql_fetch_lengths mysql_fetch_field mysql_field_seek mysql_free_result mysql_field_name mysql_field_table mysql_field_len mysql_field_type mysql_field_flags mysql_escape_string mysql_real_escape_string mysql_stat mysql_thread_id mysql_client_encoding mysql_get_client_info mysql_get_host_info mysql_get_proto_info mysql_get_server_info mysql_info mysql mysql_fieldname mysql_fieldtable mysql_fieldlen mysql_fieldtype mysql_fieldflags mysql_selectdb mysql_createdb mysql_dropdb mysql_freeresult mysql_numfields mysql_numrows mysql_listdbs mysql_listtables mysql_listfields mysql_db_name mysql_dbname mysql_tablename mysql_table_name pg_connect pg_pconnect pg_close pg_connection_status pg_connection_busy pg_connection_reset pg_host pg_dbname pg_port pg_tty pg_options pg_ping pg_query pg_send_query pg_cancel_query pg_fetch_result pg_fetch_row pg_fetch_assoc pg_fetch_array pg_fetch_object pg_fetch_all pg_affected_rows pg_get_result pg_result_seek pg_result_status pg_free_result pg_last_oid pg_num_rows pg_num_fields pg_field_name pg_field_num pg_field_size pg_field_type pg_field_prtlen pg_field_is_null pg_get_notify pg_get_pid pg_result_error pg_last_error pg_last_notice pg_put_line pg_end_copy pg_copy_to pg_copy_from pg_trace pg_untrace pg_lo_create pg_lo_unlink pg_lo_open pg_lo_close pg_lo_read pg_lo_write pg_lo_read_all pg_lo_import pg_lo_export pg_lo_seek pg_lo_tell pg_escape_string pg_escape_bytea pg_unescape_bytea pg_client_encoding pg_set_client_encoding pg_meta_data pg_convert pg_insert pg_update pg_delete pg_select pg_exec pg_getlastoid pg_cmdtuples pg_errormessage pg_numrows pg_numfields pg_fieldname pg_fieldsize pg_fieldtype pg_fieldnum pg_fieldprtlen pg_fieldisnull pg_freeresult pg_result pg_loreadall pg_locreate pg_lounlink pg_loopen pg_loclose pg_loread pg_lowrite pg_loimport pg_loexport echo print global static exit array empty eval isset unset die include require include_once require_once"), + multiLineStrings: true, + hooks: { + "$": function(stream) { + stream.eatWhile(/[\w\$_]/); + return "variable-2"; + }, + "<": function(stream, state) { + if (stream.match(/<", false)) stream.next(); + return "comment"; + }, + "/": function(stream) { + if (stream.eat("/")) { + while (!stream.eol() && !stream.match("?>", false)) stream.next(); + return "comment"; + } + return false; + } + } + }; + + CodeMirror.defineMode("php", function(config, parserConfig) { + var htmlMode = CodeMirror.getMode(config, "text/html"); + var phpMode = CodeMirror.getMode(config, phpConfig); + + function dispatch(stream, state) { + var isPHP = state.curMode == phpMode; + if (stream.sol() && state.pending != '"') state.pending = null; + if (!isPHP) { + if (stream.match(/^<\?\w*/)) { + state.curMode = phpMode; + state.curState = state.php; + return "meta"; + } + if (state.pending == '"') { + while (!stream.eol() && stream.next() != '"') {} + var style = "string"; + } else if (state.pending && stream.pos < state.pending.end) { + stream.pos = state.pending.end; + var style = state.pending.style; + } else { + var style = htmlMode.token(stream, state.curState); + } + state.pending = null; + var cur = stream.current(), openPHP = cur.search(/<\?/); + if (openPHP != -1) { + if (style == "string" && /\"$/.test(cur) && !/\?>/.test(cur)) state.pending = '"'; + else state.pending = {end: stream.pos, style: style}; + stream.backUp(cur.length - openPHP); + } + return style; + } else if (isPHP && state.php.tokenize == null && stream.match("?>")) { + state.curMode = htmlMode; + state.curState = state.html; + return "meta"; + } else { + return phpMode.token(stream, state.curState); + } + } + + return { + startState: function() { + var html = CodeMirror.startState(htmlMode), php = CodeMirror.startState(phpMode); + return {html: html, + php: php, + curMode: parserConfig.startOpen ? phpMode : htmlMode, + curState: parserConfig.startOpen ? php : html, + pending: null}; + }, + + copyState: function(state) { + var html = state.html, htmlNew = CodeMirror.copyState(htmlMode, html), + php = state.php, phpNew = CodeMirror.copyState(phpMode, php), cur; + if (state.curMode == htmlMode) cur = htmlNew; + else cur = phpNew; + return {html: htmlNew, php: phpNew, curMode: state.curMode, curState: cur, + pending: state.pending}; + }, + + token: dispatch, + + indent: function(state, textAfter) { + if ((state.curMode != phpMode && /^\s*<\//.test(textAfter)) || + (state.curMode == phpMode && /^\?>/.test(textAfter))) + return htmlMode.indent(state.html, textAfter); + return state.curMode.indent(state.curState, textAfter); + }, + + electricChars: "/{}:", + + innerMode: function(state) { return {state: state.curState, mode: state.curMode}; } + }; + }, "htmlmixed", "clike"); + + CodeMirror.defineMIME("application/x-httpd-php", "php"); + CodeMirror.defineMIME("application/x-httpd-php-open", {name: "php", startOpen: true}); + CodeMirror.defineMIME("text/x-php", phpConfig); +})(); diff --git a/modules/files/views/default/assets/mode/pig/index.html b/modules/files/views/default/assets/mode/pig/index.html new file mode 100755 index 0000000..1b0c602 --- /dev/null +++ b/modules/files/views/default/assets/mode/pig/index.html @@ -0,0 +1,42 @@ + + + + + CodeMirror: Pig Latin mode + + + + + + + +

      CodeMirror: Pig Latin mode

      + +
      + + + +

      + Simple mode that handles Pig Latin language. +

      + +

      MIME type defined: text/x-pig + (PIG code) + diff --git a/modules/files/views/default/assets/mode/pig/pig.js b/modules/files/views/default/assets/mode/pig/pig.js new file mode 100755 index 0000000..c2f611a --- /dev/null +++ b/modules/files/views/default/assets/mode/pig/pig.js @@ -0,0 +1,171 @@ +/* + * Pig Latin Mode for CodeMirror 2 + * @author Prasanth Jayachandran + * @link https://github.com/prasanthj/pig-codemirror-2 + * This implementation is adapted from PL/SQL mode in CodeMirror 2. + */ +CodeMirror.defineMode("pig", function(_config, parserConfig) { + var keywords = parserConfig.keywords, + builtins = parserConfig.builtins, + types = parserConfig.types, + multiLineStrings = parserConfig.multiLineStrings; + + var isOperatorChar = /[*+\-%<>=&?:\/!|]/; + + function chain(stream, state, f) { + state.tokenize = f; + return f(stream, state); + } + + var type; + function ret(tp, style) { + type = tp; + return style; + } + + function tokenComment(stream, state) { + var isEnd = false; + var ch; + while(ch = stream.next()) { + if(ch == "/" && isEnd) { + state.tokenize = tokenBase; + break; + } + isEnd = (ch == "*"); + } + return ret("comment", "comment"); + } + + function tokenString(quote) { + return function(stream, state) { + var escaped = false, next, end = false; + while((next = stream.next()) != null) { + if (next == quote && !escaped) { + end = true; break; + } + escaped = !escaped && next == "\\"; + } + if (end || !(escaped || multiLineStrings)) + state.tokenize = tokenBase; + return ret("string", "error"); + }; + } + + function tokenBase(stream, state) { + var ch = stream.next(); + + // is a start of string? + if (ch == '"' || ch == "'") + return chain(stream, state, tokenString(ch)); + // is it one of the special chars + else if(/[\[\]{}\(\),;\.]/.test(ch)) + return ret(ch); + // is it a number? + else if(/\d/.test(ch)) { + stream.eatWhile(/[\w\.]/); + return ret("number", "number"); + } + // multi line comment or operator + else if (ch == "/") { + if (stream.eat("*")) { + return chain(stream, state, tokenComment); + } + else { + stream.eatWhile(isOperatorChar); + return ret("operator", "operator"); + } + } + // single line comment or operator + else if (ch=="-") { + if(stream.eat("-")){ + stream.skipToEnd(); + return ret("comment", "comment"); + } + else { + stream.eatWhile(isOperatorChar); + return ret("operator", "operator"); + } + } + // is it an operator + else if (isOperatorChar.test(ch)) { + stream.eatWhile(isOperatorChar); + return ret("operator", "operator"); + } + else { + // get the while word + stream.eatWhile(/[\w\$_]/); + // is it one of the listed keywords? + if (keywords && keywords.propertyIsEnumerable(stream.current().toUpperCase())) { + if (stream.eat(")") || stream.eat(".")) { + //keywords can be used as variables like flatten(group), group.$0 etc.. + } + else { + return ("keyword", "keyword"); + } + } + // is it one of the builtin functions? + if (builtins && builtins.propertyIsEnumerable(stream.current().toUpperCase())) + { + return ("keyword", "variable-2"); + } + // is it one of the listed types? + if (types && types.propertyIsEnumerable(stream.current().toUpperCase())) + return ("keyword", "variable-3"); + // default is a 'variable' + return ret("variable", "pig-word"); + } + } + + // Interface + return { + startState: function() { + return { + tokenize: tokenBase, + startOfLine: true + }; + }, + + token: function(stream, state) { + if(stream.eatSpace()) return null; + var style = state.tokenize(stream, state); + return style; + } + }; +}); + +(function() { + function keywords(str) { + var obj = {}, words = str.split(" "); + for (var i = 0; i < words.length; ++i) obj[words[i]] = true; + return obj; + } + + // builtin funcs taken from trunk revision 1303237 + var pBuiltins = "ABS ACOS ARITY ASIN ATAN AVG BAGSIZE BINSTORAGE BLOOM BUILDBLOOM CBRT CEIL " + + "CONCAT COR COS COSH COUNT COUNT_STAR COV CONSTANTSIZE CUBEDIMENSIONS DIFF DISTINCT DOUBLEABS " + + "DOUBLEAVG DOUBLEBASE DOUBLEMAX DOUBLEMIN DOUBLEROUND DOUBLESUM EXP FLOOR FLOATABS FLOATAVG " + + "FLOATMAX FLOATMIN FLOATROUND FLOATSUM GENERICINVOKER INDEXOF INTABS INTAVG INTMAX INTMIN " + + "INTSUM INVOKEFORDOUBLE INVOKEFORFLOAT INVOKEFORINT INVOKEFORLONG INVOKEFORSTRING INVOKER " + + "ISEMPTY JSONLOADER JSONMETADATA JSONSTORAGE LAST_INDEX_OF LCFIRST LOG LOG10 LOWER LONGABS " + + "LONGAVG LONGMAX LONGMIN LONGSUM MAX MIN MAPSIZE MONITOREDUDF NONDETERMINISTIC OUTPUTSCHEMA " + + "PIGSTORAGE PIGSTREAMING RANDOM REGEX_EXTRACT REGEX_EXTRACT_ALL REPLACE ROUND SIN SINH SIZE " + + "SQRT STRSPLIT SUBSTRING SUM STRINGCONCAT STRINGMAX STRINGMIN STRINGSIZE TAN TANH TOBAG " + + "TOKENIZE TOMAP TOP TOTUPLE TRIM TEXTLOADER TUPLESIZE UCFIRST UPPER UTF8STORAGECONVERTER "; + + // taken from QueryLexer.g + var pKeywords = "VOID IMPORT RETURNS DEFINE LOAD FILTER FOREACH ORDER CUBE DISTINCT COGROUP " + + "JOIN CROSS UNION SPLIT INTO IF OTHERWISE ALL AS BY USING INNER OUTER ONSCHEMA PARALLEL " + + "PARTITION GROUP AND OR NOT GENERATE FLATTEN ASC DESC IS STREAM THROUGH STORE MAPREDUCE " + + "SHIP CACHE INPUT OUTPUT STDERROR STDIN STDOUT LIMIT SAMPLE LEFT RIGHT FULL EQ GT LT GTE LTE " + + "NEQ MATCHES TRUE FALSE "; + + // data types + var pTypes = "BOOLEAN INT LONG FLOAT DOUBLE CHARARRAY BYTEARRAY BAG TUPLE MAP "; + + CodeMirror.defineMIME("text/x-pig", { + name: "pig", + builtins: keywords(pBuiltins), + keywords: keywords(pKeywords), + types: keywords(pTypes) + }); +}()); diff --git a/modules/files/views/default/assets/mode/properties/index.html b/modules/files/views/default/assets/mode/properties/index.html new file mode 100755 index 0000000..e21e02a --- /dev/null +++ b/modules/files/views/default/assets/mode/properties/index.html @@ -0,0 +1,41 @@ + + + + + CodeMirror: Properties files mode + + + + + + + +

      CodeMirror: Properties files mode

      +
      + + +

      MIME types defined: text/x-properties, + text/x-ini.

      + + + diff --git a/modules/files/views/default/assets/mode/properties/properties.js b/modules/files/views/default/assets/mode/properties/properties.js new file mode 100755 index 0000000..d3a13c7 --- /dev/null +++ b/modules/files/views/default/assets/mode/properties/properties.js @@ -0,0 +1,63 @@ +CodeMirror.defineMode("properties", function() { + return { + token: function(stream, state) { + var sol = stream.sol() || state.afterSection; + var eol = stream.eol(); + + state.afterSection = false; + + if (sol) { + if (state.nextMultiline) { + state.inMultiline = true; + state.nextMultiline = false; + } else { + state.position = "def"; + } + } + + if (eol && ! state.nextMultiline) { + state.inMultiline = false; + state.position = "def"; + } + + if (sol) { + while(stream.eatSpace()); + } + + var ch = stream.next(); + + if (sol && (ch === "#" || ch === "!" || ch === ";")) { + state.position = "comment"; + stream.skipToEnd(); + return "comment"; + } else if (sol && ch === "[") { + state.afterSection = true; + stream.skipTo("]"); stream.eat("]"); + return "header"; + } else if (ch === "=" || ch === ":") { + state.position = "quote"; + return null; + } else if (ch === "\\" && state.position === "quote") { + if (stream.next() !== "u") { // u = Unicode sequence \u1234 + // Multiline value + state.nextMultiline = true; + } + } + + return state.position; + }, + + startState: function() { + return { + position : "def", // Current position, "def", "quote" or "comment" + nextMultiline : false, // Is the next line multiline value + inMultiline : false, // Is the current line a multiline value + afterSection : false // Did we just open a section + }; + } + + }; +}); + +CodeMirror.defineMIME("text/x-properties", "properties"); +CodeMirror.defineMIME("text/x-ini", "properties"); diff --git a/modules/files/views/default/assets/mode/python/LICENSE.txt b/modules/files/views/default/assets/mode/python/LICENSE.txt new file mode 100755 index 0000000..918866b --- /dev/null +++ b/modules/files/views/default/assets/mode/python/LICENSE.txt @@ -0,0 +1,21 @@ +The MIT License + +Copyright (c) 2010 Timothy Farrell + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. \ No newline at end of file diff --git a/modules/files/views/default/assets/mode/python/index.html b/modules/files/views/default/assets/mode/python/index.html new file mode 100755 index 0000000..4244c6f --- /dev/null +++ b/modules/files/views/default/assets/mode/python/index.html @@ -0,0 +1,135 @@ + + + + + CodeMirror: Python mode + + + + + + + + +

      CodeMirror: Python mode

      + +
      + +

      Configuration Options:

      +
        +
      • version - 2/3 - The version of Python to recognize. Default is 2.
        • +
      • singleLineStringErrors - true/false - If you have a single-line string that is not terminated at the end of the line, this will show subsequent lines as errors if true, otherwise it will consider the newline as the end of the string. Default is false.
        • +
      +

      Advanced Configuration Options:

      +

      Usefull for superset of python syntax like Enthought enaml, IPython magics and questionmark help

      +
        +
      • singleOperators - RegEx - Regular Expression for single operator matching, default : 
        ^[\\+\\-\\*/%&|\\^~<>!]
        • +
      • singleDelimiters - RegEx - Regular Expression for single delimiter matching, default : 
        ^[\\(\\)\\[\\]\\{\\}@,:`=;\\.]
        • +
      • doubleOperators - RegEx - Regular Expression for double operators matching, default : 
        ^((==)|(!=)|(<=)|(>=)|(<>)|(<<)|(>>)|(//)|(\\*\\*))
        • +
      • doubleDelimiters - RegEx - Regular Expressoin for double delimiters matching, default : 
        ^((\\+=)|(\\-=)|(\\*=)|(%=)|(/=)|(&=)|(\\|=)|(\\^=))
        • +
      • tripleDelimiters - RegEx - Regular Expression for triple delimiters matching, default : 
        ^((//=)|(>>=)|(<<=)|(\\*\\*=))
        • +
      • identifiers - RegEx - Regular Expression for identifier, default : 
        ^[_A-Za-z][_A-Za-z0-9]*
        • +
      + + +

      MIME types defined: text/x-python.

      + + diff --git a/modules/files/views/default/assets/mode/python/python.js b/modules/files/views/default/assets/mode/python/python.js new file mode 100755 index 0000000..d69ef83 --- /dev/null +++ b/modules/files/views/default/assets/mode/python/python.js @@ -0,0 +1,340 @@ +CodeMirror.defineMode("python", function(conf, parserConf) { + var ERRORCLASS = 'error'; + + function wordRegexp(words) { + return new RegExp("^((" + words.join(")|(") + "))\\b"); + } + + var singleOperators = parserConf.singleOperators || new RegExp("^[\\+\\-\\*/%&|\\^~<>!]"); + var singleDelimiters = parserConf.singleDelimiters || new RegExp('^[\\(\\)\\[\\]\\{\\}@,:`=;\\.]'); + var doubleOperators = parserConf.doubleOperators || new RegExp("^((==)|(!=)|(<=)|(>=)|(<>)|(<<)|(>>)|(//)|(\\*\\*))"); + var doubleDelimiters = parserConf.doubleDelimiters || new RegExp("^((\\+=)|(\\-=)|(\\*=)|(%=)|(/=)|(&=)|(\\|=)|(\\^=))"); + var tripleDelimiters = parserConf.tripleDelimiters || new RegExp("^((//=)|(>>=)|(<<=)|(\\*\\*=))"); + var identifiers = parserConf.identifiers|| new RegExp("^[_A-Za-z][_A-Za-z0-9]*"); + + var wordOperators = wordRegexp(['and', 'or', 'not', 'is', 'in']); + var commonkeywords = ['as', 'assert', 'break', 'class', 'continue', + 'def', 'del', 'elif', 'else', 'except', 'finally', + 'for', 'from', 'global', 'if', 'import', + 'lambda', 'pass', 'raise', 'return', + 'try', 'while', 'with', 'yield']; + var commonBuiltins = ['abs', 'all', 'any', 'bin', 'bool', 'bytearray', 'callable', 'chr', + 'classmethod', 'compile', 'complex', 'delattr', 'dict', 'dir', 'divmod', + 'enumerate', 'eval', 'filter', 'float', 'format', 'frozenset', + 'getattr', 'globals', 'hasattr', 'hash', 'help', 'hex', 'id', + 'input', 'int', 'isinstance', 'issubclass', 'iter', 'len', + 'list', 'locals', 'map', 'max', 'memoryview', 'min', 'next', + 'object', 'oct', 'open', 'ord', 'pow', 'property', 'range', + 'repr', 'reversed', 'round', 'set', 'setattr', 'slice', + 'sorted', 'staticmethod', 'str', 'sum', 'super', 'tuple', + 'type', 'vars', 'zip', '__import__', 'NotImplemented', + 'Ellipsis', '__debug__']; + var py2 = {'builtins': ['apply', 'basestring', 'buffer', 'cmp', 'coerce', 'execfile', + 'file', 'intern', 'long', 'raw_input', 'reduce', 'reload', + 'unichr', 'unicode', 'xrange', 'False', 'True', 'None'], + 'keywords': ['exec', 'print']}; + var py3 = {'builtins': ['ascii', 'bytes', 'exec', 'print'], + 'keywords': ['nonlocal', 'False', 'True', 'None']}; + + if (!!parserConf.version && parseInt(parserConf.version, 10) === 3) { + commonkeywords = commonkeywords.concat(py3.keywords); + commonBuiltins = commonBuiltins.concat(py3.builtins); + var stringPrefixes = new RegExp("^(([rb]|(br))?('{3}|\"{3}|['\"]))", "i"); + } else { + commonkeywords = commonkeywords.concat(py2.keywords); + commonBuiltins = commonBuiltins.concat(py2.builtins); + var stringPrefixes = new RegExp("^(([rub]|(ur)|(br))?('{3}|\"{3}|['\"]))", "i"); + } + var keywords = wordRegexp(commonkeywords); + var builtins = wordRegexp(commonBuiltins); + + var indentInfo = null; + + // tokenizers + function tokenBase(stream, state) { + // Handle scope changes + if (stream.sol()) { + var scopeOffset = state.scopes[0].offset; + if (stream.eatSpace()) { + var lineOffset = stream.indentation(); + if (lineOffset > scopeOffset) { + indentInfo = 'indent'; + } else if (lineOffset < scopeOffset) { + indentInfo = 'dedent'; + } + return null; + } else { + if (scopeOffset > 0) { + dedent(stream, state); + } + } + } + if (stream.eatSpace()) { + return null; + } + + var ch = stream.peek(); + + // Handle Comments + if (ch === '#') { + stream.skipToEnd(); + return 'comment'; + } + + // Handle Number Literals + if (stream.match(/^[0-9\.]/, false)) { + var floatLiteral = false; + // Floats + if (stream.match(/^\d*\.\d+(e[\+\-]?\d+)?/i)) { floatLiteral = true; } + if (stream.match(/^\d+\.\d*/)) { floatLiteral = true; } + if (stream.match(/^\.\d+/)) { floatLiteral = true; } + if (floatLiteral) { + // Float literals may be "imaginary" + stream.eat(/J/i); + return 'number'; + } + // Integers + var intLiteral = false; + // Hex + if (stream.match(/^0x[0-9a-f]+/i)) { intLiteral = true; } + // Binary + if (stream.match(/^0b[01]+/i)) { intLiteral = true; } + // Octal + if (stream.match(/^0o[0-7]+/i)) { intLiteral = true; } + // Decimal + if (stream.match(/^[1-9]\d*(e[\+\-]?\d+)?/)) { + // Decimal literals may be "imaginary" + stream.eat(/J/i); + // TODO - Can you have imaginary longs? + intLiteral = true; + } + // Zero by itself with no other piece of number. + if (stream.match(/^0(?![\dx])/i)) { intLiteral = true; } + if (intLiteral) { + // Integer literals may be "long" + stream.eat(/L/i); + return 'number'; + } + } + + // Handle Strings + if (stream.match(stringPrefixes)) { + state.tokenize = tokenStringFactory(stream.current()); + return state.tokenize(stream, state); + } + + // Handle operators and Delimiters + if (stream.match(tripleDelimiters) || stream.match(doubleDelimiters)) { + return null; + } + if (stream.match(doubleOperators) + || stream.match(singleOperators) + || stream.match(wordOperators)) { + return 'operator'; + } + if (stream.match(singleDelimiters)) { + return null; + } + + if (stream.match(keywords)) { + return 'keyword'; + } + + if (stream.match(builtins)) { + return 'builtin'; + } + + if (stream.match(identifiers)) { + return 'variable'; + } + + // Handle non-detected items + stream.next(); + return ERRORCLASS; + } + + function tokenStringFactory(delimiter) { + while ('rub'.indexOf(delimiter.charAt(0).toLowerCase()) >= 0) { + delimiter = delimiter.substr(1); + } + var singleline = delimiter.length == 1; + var OUTCLASS = 'string'; + + function tokenString(stream, state) { + while (!stream.eol()) { + stream.eatWhile(/[^'"\\]/); + if (stream.eat('\\')) { + stream.next(); + if (singleline && stream.eol()) { + return OUTCLASS; + } + } else if (stream.match(delimiter)) { + state.tokenize = tokenBase; + return OUTCLASS; + } else { + stream.eat(/['"]/); + } + } + if (singleline) { + if (parserConf.singleLineStringErrors) { + return ERRORCLASS; + } else { + state.tokenize = tokenBase; + } + } + return OUTCLASS; + } + tokenString.isString = true; + return tokenString; + } + + function indent(stream, state, type) { + type = type || 'py'; + var indentUnit = 0; + if (type === 'py') { + if (state.scopes[0].type !== 'py') { + state.scopes[0].offset = stream.indentation(); + return; + } + for (var i = 0; i < state.scopes.length; ++i) { + if (state.scopes[i].type === 'py') { + indentUnit = state.scopes[i].offset + conf.indentUnit; + break; + } + } + } else { + indentUnit = stream.column() + stream.current().length; + } + state.scopes.unshift({ + offset: indentUnit, + type: type + }); + } + + function dedent(stream, state, type) { + type = type || 'py'; + if (state.scopes.length == 1) return; + if (state.scopes[0].type === 'py') { + var _indent = stream.indentation(); + var _indent_index = -1; + for (var i = 0; i < state.scopes.length; ++i) { + if (_indent === state.scopes[i].offset) { + _indent_index = i; + break; + } + } + if (_indent_index === -1) { + return true; + } + while (state.scopes[0].offset !== _indent) { + state.scopes.shift(); + } + return false; + } else { + if (type === 'py') { + state.scopes[0].offset = stream.indentation(); + return false; + } else { + if (state.scopes[0].type != type) { + return true; + } + state.scopes.shift(); + return false; + } + } + } + + function tokenLexer(stream, state) { + indentInfo = null; + var style = state.tokenize(stream, state); + var current = stream.current(); + + // Handle '.' connected identifiers + if (current === '.') { + style = stream.match(identifiers, false) ? null : ERRORCLASS; + if (style === null && state.lastToken === 'meta') { + // Apply 'meta' style to '.' connected identifiers when + // appropriate. + style = 'meta'; + } + return style; + } + + // Handle decorators + if (current === '@') { + return stream.match(identifiers, false) ? 'meta' : ERRORCLASS; + } + + if ((style === 'variable' || style === 'builtin') + && state.lastToken === 'meta') { + style = 'meta'; + } + + // Handle scope changes. + if (current === 'pass' || current === 'return') { + state.dedent += 1; + } + if (current === 'lambda') state.lambda = true; + if ((current === ':' && !state.lambda && state.scopes[0].type == 'py') + || indentInfo === 'indent') { + indent(stream, state); + } + var delimiter_index = '[({'.indexOf(current); + if (delimiter_index !== -1) { + indent(stream, state, '])}'.slice(delimiter_index, delimiter_index+1)); + } + if (indentInfo === 'dedent') { + if (dedent(stream, state)) { + return ERRORCLASS; + } + } + delimiter_index = '])}'.indexOf(current); + if (delimiter_index !== -1) { + if (dedent(stream, state, current)) { + return ERRORCLASS; + } + } + if (state.dedent > 0 && stream.eol() && state.scopes[0].type == 'py') { + if (state.scopes.length > 1) state.scopes.shift(); + state.dedent -= 1; + } + + return style; + } + + var external = { + startState: function(basecolumn) { + return { + tokenize: tokenBase, + scopes: [{offset:basecolumn || 0, type:'py'}], + lastToken: null, + lambda: false, + dedent: 0 + }; + }, + + token: function(stream, state) { + var style = tokenLexer(stream, state); + + state.lastToken = style; + + if (stream.eol() && stream.lambda) { + state.lambda = false; + } + + return style; + }, + + indent: function(state) { + if (state.tokenize != tokenBase) { + return state.tokenize.isString ? CodeMirror.Pass : 0; + } + + return state.scopes[0].offset; + } + + }; + return external; +}); + +CodeMirror.defineMIME("text/x-python", "python"); diff --git a/modules/files/views/default/assets/mode/q/index.html b/modules/files/views/default/assets/mode/q/index.html new file mode 100755 index 0000000..303ec1d --- /dev/null +++ b/modules/files/views/default/assets/mode/q/index.html @@ -0,0 +1,131 @@ + + + + + CodeMirror: Q mode + + + + + + + + +

      CodeMirror: Q mode

      + +
      + + + +

      MIME type defined: text/x-q.

      + + diff --git a/modules/files/views/default/assets/mode/q/q.js b/modules/files/views/default/assets/mode/q/q.js new file mode 100755 index 0000000..56017e3 --- /dev/null +++ b/modules/files/views/default/assets/mode/q/q.js @@ -0,0 +1,124 @@ +CodeMirror.defineMode("q",function(config){ + var indentUnit=config.indentUnit, + curPunc, + keywords=buildRE(["abs","acos","aj","aj0","all","and","any","asc","asin","asof","atan","attr","avg","avgs","bin","by","ceiling","cols","cor","cos","count","cov","cross","csv","cut","delete","deltas","desc","dev","differ","distinct","div","do","each","ej","enlist","eval","except","exec","exit","exp","fby","fills","first","fkeys","flip","floor","from","get","getenv","group","gtime","hclose","hcount","hdel","hopen","hsym","iasc","idesc","if","ij","in","insert","inter","inv","key","keys","last","like","list","lj","load","log","lower","lsq","ltime","ltrim","mavg","max","maxs","mcount","md5","mdev","med","meta","min","mins","mmax","mmin","mmu","mod","msum","neg","next","not","null","or","over","parse","peach","pj","plist","prd","prds","prev","prior","rand","rank","ratios","raze","read0","read1","reciprocal","reverse","rload","rotate","rsave","rtrim","save","scan","select","set","setenv","show","signum","sin","sqrt","ss","ssr","string","sublist","sum","sums","sv","system","tables","tan","til","trim","txf","type","uj","ungroup","union","update","upper","upsert","value","var","view","views","vs","wavg","where","where","while","within","wj","wj1","wsum","xasc","xbar","xcol","xcols","xdesc","xexp","xgroup","xkey","xlog","xprev","xrank"]), + E=/[|/&^!+:\\\-*%$=~#;@><,?_\'\"\[\(\]\)\s{}]/; + function buildRE(w){return new RegExp("^("+w.join("|")+")$");} + function tokenBase(stream,state){ + var sol=stream.sol(),c=stream.next(); + curPunc=null; + if(sol) + if(c=="/") + return(state.tokenize=tokenLineComment)(stream,state); + else if(c=="\\"){ + if(stream.eol()||/\s/.test(stream.peek())) + return stream.skipToEnd(),/^\\\s*$/.test(stream.current())?(state.tokenize=tokenCommentToEOF)(stream, state):state.tokenize=tokenBase,"comment"; + else + return state.tokenize=tokenBase,"builtin"; + } + if(/\s/.test(c)) + return stream.peek()=="/"?(stream.skipToEnd(),"comment"):"whitespace"; + if(c=='"') + return(state.tokenize=tokenString)(stream,state); + if(c=='`') + return stream.eatWhile(/[A-Z|a-z|\d|_|:|\/|\.]/),"symbol"; + if(("."==c&&/\d/.test(stream.peek()))||/\d/.test(c)){ + var t=null; + stream.backUp(1); + if(stream.match(/^\d{4}\.\d{2}(m|\.\d{2}([D|T](\d{2}(:\d{2}(:\d{2}(\.\d{1,9})?)?)?)?)?)/) + || stream.match(/^\d+D(\d{2}(:\d{2}(:\d{2}(\.\d{1,9})?)?)?)/) + || stream.match(/^\d{2}:\d{2}(:\d{2}(\.\d{1,9})?)?/) + || stream.match(/^\d+[ptuv]{1}/)) + t="temporal"; + else if(stream.match(/^0[NwW]{1}/) + || stream.match(/^0x[\d|a-f|A-F]*/) + || stream.match(/^[0|1]+[b]{1}/) + || stream.match(/^\d+[chijn]{1}/) + || stream.match(/-?\d*(\.\d*)?(e[+\-]?\d+)?(e|f)?/)) + t="number"; + return(t&&(!(c=stream.peek())||E.test(c)))?t:(stream.next(),"error"); + } + if(/[A-Z|a-z]|\./.test(c)) + return stream.eatWhile(/[A-Z|a-z|\.|_|\d]/),keywords.test(stream.current())?"keyword":"variable"; + if(/[|/&^!+:\\\-*%$=~#;@><\.,?_\']/.test(c)) + return null; + if(/[{}\(\[\]\)]/.test(c)) + return null; + return"error"; + } + function tokenLineComment(stream,state){ + return stream.skipToEnd(),/\/\s*$/.test(stream.current())?(state.tokenize=tokenBlockComment)(stream,state):(state.tokenize=tokenBase),"comment"; + } + function tokenBlockComment(stream,state){ + var f=stream.sol()&&stream.peek()=="\\"; + stream.skipToEnd(); + if(f&&/^\\\s*$/.test(stream.current())) + state.tokenize=tokenBase; + return"comment"; + } + function tokenCommentToEOF(stream){return stream.skipToEnd(),"comment";} + function tokenString(stream,state){ + var escaped=false,next,end=false; + while((next=stream.next())){ + if(next=="\""&&!escaped){end=true;break;} + escaped=!escaped&&next=="\\"; + } + if(end)state.tokenize=tokenBase; + return"string"; + } + function pushContext(state,type,col){state.context={prev:state.context,indent:state.indent,col:col,type:type};} + function popContext(state){state.indent=state.context.indent;state.context=state.context.prev;} + return{ + startState:function(){ + return{tokenize:tokenBase, + context:null, + indent:0, + col:0}; + }, + token:function(stream,state){ + if(stream.sol()){ + if(state.context&&state.context.align==null) + state.context.align=false; + state.indent=stream.indentation(); + } + //if (stream.eatSpace()) return null; + var style=state.tokenize(stream,state); + if(style!="comment"&&state.context&&state.context.align==null&&state.context.type!="pattern"){ + state.context.align=true; + } + if(curPunc=="(")pushContext(state,")",stream.column()); + else if(curPunc=="[")pushContext(state,"]",stream.column()); + else if(curPunc=="{")pushContext(state,"}",stream.column()); + else if(/[\]\}\)]/.test(curPunc)){ + while(state.context&&state.context.type=="pattern")popContext(state); + if(state.context&&curPunc==state.context.type)popContext(state); + } + else if(curPunc=="."&&state.context&&state.context.type=="pattern")popContext(state); + else if(/atom|string|variable/.test(style)&&state.context){ + if(/[\}\]]/.test(state.context.type)) + pushContext(state,"pattern",stream.column()); + else if(state.context.type=="pattern"&&!state.context.align){ + state.context.align=true; + state.context.col=stream.column(); + } + } + return style; + }, + indent:function(state,textAfter){ + var firstChar=textAfter&&textAfter.charAt(0); + var context=state.context; + if(/[\]\}]/.test(firstChar)) + while (context&&context.type=="pattern")context=context.prev; + var closing=context&&firstChar==context.type; + if(!context) + return 0; + else if(context.type=="pattern") + return context.col; + else if(context.align) + return context.col+(closing?0:1); + else + return context.indent+(closing?0:indentUnit); + } + }; +}); +CodeMirror.defineMIME("text/x-q","q"); diff --git a/modules/files/views/default/assets/mode/r/LICENSE b/modules/files/views/default/assets/mode/r/LICENSE new file mode 100755 index 0000000..2510ae1 --- /dev/null +++ b/modules/files/views/default/assets/mode/r/LICENSE @@ -0,0 +1,24 @@ +Copyright (c) 2011, Ubalo, Inc. +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + * Neither the name of the Ubalo, Inc nor the names of its + contributors may be used to endorse or promote products derived + from this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND +ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +DISCLAIMED. IN NO EVENT SHALL UBALO, INC BE LIABLE FOR ANY +DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/modules/files/views/default/assets/mode/r/index.html b/modules/files/views/default/assets/mode/r/index.html new file mode 100755 index 0000000..1281955 --- /dev/null +++ b/modules/files/views/default/assets/mode/r/index.html @@ -0,0 +1,74 @@ + + + + + CodeMirror: R mode + + + + + + + +

      CodeMirror: R mode

      +
      + + +

      MIME types defined: text/x-rsrc.

      + +

      Development of the CodeMirror R mode was kindly sponsored + by Ubalo, who hold + the license.

      + + + diff --git a/modules/files/views/default/assets/mode/r/r.js b/modules/files/views/default/assets/mode/r/r.js new file mode 100755 index 0000000..6410efb --- /dev/null +++ b/modules/files/views/default/assets/mode/r/r.js @@ -0,0 +1,141 @@ +CodeMirror.defineMode("r", function(config) { + function wordObj(str) { + var words = str.split(" "), res = {}; + for (var i = 0; i < words.length; ++i) res[words[i]] = true; + return res; + } + var atoms = wordObj("NULL NA Inf NaN NA_integer_ NA_real_ NA_complex_ NA_character_"); + var builtins = wordObj("list quote bquote eval return call parse deparse"); + var keywords = wordObj("if else repeat while function for in next break"); + var blockkeywords = wordObj("if else repeat while function for"); + var opChars = /[+\-*\/^<>=!&|~$:]/; + var curPunc; + + function tokenBase(stream, state) { + curPunc = null; + var ch = stream.next(); + if (ch == "#") { + stream.skipToEnd(); + return "comment"; + } else if (ch == "0" && stream.eat("x")) { + stream.eatWhile(/[\da-f]/i); + return "number"; + } else if (ch == "." && stream.eat(/\d/)) { + stream.match(/\d*(?:e[+\-]?\d+)?/); + return "number"; + } else if (/\d/.test(ch)) { + stream.match(/\d*(?:\.\d+)?(?:e[+\-]\d+)?L?/); + return "number"; + } else if (ch == "'" || ch == '"') { + state.tokenize = tokenString(ch); + return "string"; + } else if (ch == "." && stream.match(/.[.\d]+/)) { + return "keyword"; + } else if (/[\w\.]/.test(ch) && ch != "_") { + stream.eatWhile(/[\w\.]/); + var word = stream.current(); + if (atoms.propertyIsEnumerable(word)) return "atom"; + if (keywords.propertyIsEnumerable(word)) { + if (blockkeywords.propertyIsEnumerable(word)) curPunc = "block"; + return "keyword"; + } + if (builtins.propertyIsEnumerable(word)) return "builtin"; + return "variable"; + } else if (ch == "%") { + if (stream.skipTo("%")) stream.next(); + return "variable-2"; + } else if (ch == "<" && stream.eat("-")) { + return "arrow"; + } else if (ch == "=" && state.ctx.argList) { + return "arg-is"; + } else if (opChars.test(ch)) { + if (ch == "$") return "dollar"; + stream.eatWhile(opChars); + return "operator"; + } else if (/[\(\){}\[\];]/.test(ch)) { + curPunc = ch; + if (ch == ";") return "semi"; + return null; + } else { + return null; + } + } + + function tokenString(quote) { + return function(stream, state) { + if (stream.eat("\\")) { + var ch = stream.next(); + if (ch == "x") stream.match(/^[a-f0-9]{2}/i); + else if ((ch == "u" || ch == "U") && stream.eat("{") && stream.skipTo("}")) stream.next(); + else if (ch == "u") stream.match(/^[a-f0-9]{4}/i); + else if (ch == "U") stream.match(/^[a-f0-9]{8}/i); + else if (/[0-7]/.test(ch)) stream.match(/^[0-7]{1,2}/); + return "string-2"; + } else { + var next; + while ((next = stream.next()) != null) { + if (next == quote) { state.tokenize = tokenBase; break; } + if (next == "\\") { stream.backUp(1); break; } + } + return "string"; + } + }; + } + + function push(state, type, stream) { + state.ctx = {type: type, + indent: state.indent, + align: null, + column: stream.column(), + prev: state.ctx}; + } + function pop(state) { + state.indent = state.ctx.indent; + state.ctx = state.ctx.prev; + } + + return { + startState: function() { + return {tokenize: tokenBase, + ctx: {type: "top", + indent: -config.indentUnit, + align: false}, + indent: 0, + afterIdent: false}; + }, + + token: function(stream, state) { + if (stream.sol()) { + if (state.ctx.align == null) state.ctx.align = false; + state.indent = stream.indentation(); + } + if (stream.eatSpace()) return null; + var style = state.tokenize(stream, state); + if (style != "comment" && state.ctx.align == null) state.ctx.align = true; + + var ctype = state.ctx.type; + if ((curPunc == ";" || curPunc == "{" || curPunc == "}") && ctype == "block") pop(state); + if (curPunc == "{") push(state, "}", stream); + else if (curPunc == "(") { + push(state, ")", stream); + if (state.afterIdent) state.ctx.argList = true; + } + else if (curPunc == "[") push(state, "]", stream); + else if (curPunc == "block") push(state, "block", stream); + else if (curPunc == ctype) pop(state); + state.afterIdent = style == "variable" || style == "keyword"; + return style; + }, + + indent: function(state, textAfter) { + if (state.tokenize != tokenBase) return 0; + var firstChar = textAfter && textAfter.charAt(0), ctx = state.ctx, + closing = firstChar == ctx.type; + if (ctx.type == "block") return ctx.indent + (firstChar == "{" ? 0 : config.indentUnit); + else if (ctx.align) return ctx.column + (closing ? 0 : 1); + else return ctx.indent + (closing ? 0 : config.indentUnit); + } + }; +}); + +CodeMirror.defineMIME("text/x-rsrc", "r"); diff --git a/modules/files/views/default/assets/mode/rpm/changes/changes.js b/modules/files/views/default/assets/mode/rpm/changes/changes.js new file mode 100755 index 0000000..14a08d9 --- /dev/null +++ b/modules/files/views/default/assets/mode/rpm/changes/changes.js @@ -0,0 +1,19 @@ +CodeMirror.defineMode("changes", function() { + var headerSeperator = /^-+$/; + var headerLine = /^(Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ?\d{1,2} \d{2}:\d{2}(:\d{2})? [A-Z]{3,4} \d{4} - /; + var simpleEmail = /^[\w+.-]+@[\w.-]+/; + + return { + token: function(stream) { + if (stream.sol()) { + if (stream.match(headerSeperator)) { return 'tag'; } + if (stream.match(headerLine)) { return 'tag'; } + } + if (stream.match(simpleEmail)) { return 'string'; } + stream.next(); + return null; + } + }; +}); + +CodeMirror.defineMIME("text/x-rpm-changes", "changes"); diff --git a/modules/files/views/default/assets/mode/rpm/changes/index.html b/modules/files/views/default/assets/mode/rpm/changes/index.html new file mode 100755 index 0000000..e0e2d87 --- /dev/null +++ b/modules/files/views/default/assets/mode/rpm/changes/index.html @@ -0,0 +1,53 @@ + + + + + CodeMirror: RPM changes mode + + + + + + + +

      CodeMirror: RPM changes mode

      + +
      + + +

      MIME types defined: text/x-rpm-changes.

      + + diff --git a/modules/files/views/default/assets/mode/rpm/spec/index.html b/modules/files/views/default/assets/mode/rpm/spec/index.html new file mode 100755 index 0000000..8be98b6 --- /dev/null +++ b/modules/files/views/default/assets/mode/rpm/spec/index.html @@ -0,0 +1,99 @@ + + + + + CodeMirror: RPM spec mode + + + + + + + + +

      CodeMirror: RPM spec mode

      + +
      + + +

      MIME types defined: text/x-rpm-spec.

      + + diff --git a/modules/files/views/default/assets/mode/rpm/spec/spec.css b/modules/files/views/default/assets/mode/rpm/spec/spec.css new file mode 100755 index 0000000..d0a5d43 --- /dev/null +++ b/modules/files/views/default/assets/mode/rpm/spec/spec.css @@ -0,0 +1,5 @@ +.cm-s-default span.cm-preamble {color: #b26818; font-weight: bold;} +.cm-s-default span.cm-macro {color: #b218b2;} +.cm-s-default span.cm-section {color: green; font-weight: bold;} +.cm-s-default span.cm-script {color: red;} +.cm-s-default span.cm-issue {color: yellow;} diff --git a/modules/files/views/default/assets/mode/rpm/spec/spec.js b/modules/files/views/default/assets/mode/rpm/spec/spec.js new file mode 100755 index 0000000..9f339c2 --- /dev/null +++ b/modules/files/views/default/assets/mode/rpm/spec/spec.js @@ -0,0 +1,66 @@ +// Quick and dirty spec file highlighting + +CodeMirror.defineMode("spec", function() { + var arch = /^(i386|i586|i686|x86_64|ppc64|ppc|ia64|s390x|s390|sparc64|sparcv9|sparc|noarch|alphaev6|alpha|hppa|mipsel)/; + + var preamble = /^(Name|Version|Release|License|Summary|Url|Group|Source|BuildArch|BuildRequires|BuildRoot|AutoReqProv|Provides|Requires(\(\w+\))?|Obsoletes|Conflicts|Recommends|Source\d*|Patch\d*|ExclusiveArch|NoSource|Supplements):/; + var section = /^%(debug_package|package|description|prep|build|install|files|clean|changelog|preun|postun|pre|post|triggerin|triggerun|pretrans|posttrans|verifyscript|check|triggerpostun|triggerprein|trigger)/; + var control_flow_complex = /^%(ifnarch|ifarch|if)/; // rpm control flow macros + var control_flow_simple = /^%(else|endif)/; // rpm control flow macros + var operators = /^(\!|\?|\<\=|\<|\>\=|\>|\=\=|\&\&|\|\|)/; // operators in control flow macros + + return { + startState: function () { + return { + controlFlow: false, + macroParameters: false, + section: false + }; + }, + token: function (stream, state) { + var ch = stream.peek(); + if (ch == "#") { stream.skipToEnd(); return "comment"; } + + if (stream.sol()) { + if (stream.match(preamble)) { return "preamble"; } + if (stream.match(section)) { return "section"; } + } + + if (stream.match(/^\$\w+/)) { return "def"; } // Variables like '$RPM_BUILD_ROOT' + if (stream.match(/^\$\{\w+\}/)) { return "def"; } // Variables like '${RPM_BUILD_ROOT}' + + if (stream.match(control_flow_simple)) { return "keyword"; } + if (stream.match(control_flow_complex)) { + state.controlFlow = true; + return "keyword"; + } + if (state.controlFlow) { + if (stream.match(operators)) { return "operator"; } + if (stream.match(/^(\d+)/)) { return "number"; } + if (stream.eol()) { state.controlFlow = false; } + } + + if (stream.match(arch)) { return "number"; } + + // Macros like '%make_install' or '%attr(0775,root,root)' + if (stream.match(/^%[\w]+/)) { + if (stream.match(/^\(/)) { state.macroParameters = true; } + return "macro"; + } + if (state.macroParameters) { + if (stream.match(/^\d+/)) { return "number";} + if (stream.match(/^\)/)) { + state.macroParameters = false; + return "macro"; + } + } + if (stream.match(/^%\{\??[\w \-]+\}/)) { return "macro"; } // Macros like '%{defined fedora}' + + //TODO: Include bash script sub-parser (CodeMirror supports that) + stream.next(); + return null; + } + }; +}); + +CodeMirror.defineMIME("text/x-rpm-spec", "spec"); diff --git a/modules/files/views/default/assets/mode/rst/LICENSE.txt b/modules/files/views/default/assets/mode/rst/LICENSE.txt new file mode 100755 index 0000000..39484fa --- /dev/null +++ b/modules/files/views/default/assets/mode/rst/LICENSE.txt @@ -0,0 +1,21 @@ +The MIT License + +Copyright (c) 2013 Hasan Karahan + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. \ No newline at end of file diff --git a/modules/files/views/default/assets/mode/rst/index.html b/modules/files/views/default/assets/mode/rst/index.html new file mode 100755 index 0000000..b3ab64b --- /dev/null +++ b/modules/files/views/default/assets/mode/rst/index.html @@ -0,0 +1,524 @@ + + + + + CodeMirror: reStructuredText mode + + + + + + + +

      CodeMirror: reStructuredText mode

      + +
      + + +

      + The python mode will be used for highlighting blocks + containing Python/IPython terminal sessions: blocks starting with + >>> (for Python) or In [num]: (for + IPython). + + Further, the stex mode will be used for highlighting + blocks containing LaTex code. +

      + +

      MIME types defined: text/x-rst.

      + + + diff --git a/modules/files/views/default/assets/mode/rst/rst.js b/modules/files/views/default/assets/mode/rst/rst.js new file mode 100755 index 0000000..8de9d75 --- /dev/null +++ b/modules/files/views/default/assets/mode/rst/rst.js @@ -0,0 +1,550 @@ +CodeMirror.defineMode('rst-base', function (config) { + + /////////////////////////////////////////////////////////////////////////// + /////////////////////////////////////////////////////////////////////////// + + function format(string) { + var args = Array.prototype.slice.call(arguments, 1); + return string.replace(/{(\d+)}/g, function (match, n) { + return typeof args[n] != 'undefined' ? args[n] : match; + }); + } + + function AssertException(message) { + this.message = message; + } + + AssertException.prototype.toString = function () { + return 'AssertException: ' + this.message; + }; + + function assert(expression, message) { + if (!expression) throw new AssertException(message); + return expression; + } + + /////////////////////////////////////////////////////////////////////////// + /////////////////////////////////////////////////////////////////////////// + + var mode_python = CodeMirror.getMode(config, 'python'); + var mode_stex = CodeMirror.getMode(config, 'stex'); + + /////////////////////////////////////////////////////////////////////////// + /////////////////////////////////////////////////////////////////////////// + + var SEPA = "\\s+"; + var TAIL = "(?:\\s*|\\W|$)", + rx_TAIL = new RegExp(format('^{0}', TAIL)); + + var NAME = "(?:[^\\W\\d_](?:[\\w\\+\\.\\-:]*[^\\W_])?)", + rx_NAME = new RegExp(format('^{0}', NAME)); + var NAME_WWS = "(?:[^\\W\\d_](?:[\\w\\s\\+\\.\\-:]*[^\\W_])?)"; + var REF_NAME = format('(?:{0}|`{1}`)', NAME, NAME_WWS); + + var TEXT1 = "(?:[^\\s\\|](?:[^\\|]*[^\\s\\|])?)"; + var TEXT2 = "(?:[^\\`]+)", + rx_TEXT2 = new RegExp(format('^{0}', TEXT2)); + + var rx_section = new RegExp( + "^([!'#$%&\"()*+,-./:;<=>?@\\[\\\\\\]^_`{|}~])\\1{3,}\\s*$"); + var rx_explicit = new RegExp( + format('^\\.\\.{0}', SEPA)); + var rx_link = new RegExp( + format('^_{0}:{1}|^__:{1}', REF_NAME, TAIL)); + var rx_directive = new RegExp( + format('^{0}::{1}', REF_NAME, TAIL)); + var rx_substitution = new RegExp( + format('^\\|{0}\\|{1}{2}::{3}', TEXT1, SEPA, REF_NAME, TAIL)); + var rx_footnote = new RegExp( + format('^\\[(?:\\d+|#{0}?|\\*)]{1}', REF_NAME, TAIL)); + var rx_citation = new RegExp( + format('^\\[{0}\\]{1}', REF_NAME, TAIL)); + + var rx_substitution_ref = new RegExp( + format('^\\|{0}\\|', TEXT1)); + var rx_footnote_ref = new RegExp( + format('^\\[(?:\\d+|#{0}?|\\*)]_', REF_NAME)); + var rx_citation_ref = new RegExp( + format('^\\[{0}\\]_', REF_NAME)); + var rx_link_ref1 = new RegExp( + format('^{0}__?', REF_NAME)); + var rx_link_ref2 = new RegExp( + format('^`{0}`_', TEXT2)); + + var rx_role_pre = new RegExp( + format('^:{0}:`{1}`{2}', NAME, TEXT2, TAIL)); + var rx_role_suf = new RegExp( + format('^`{1}`:{0}:{2}', NAME, TEXT2, TAIL)); + var rx_role = new RegExp( + format('^:{0}:{1}', NAME, TAIL)); + + var rx_directive_name = new RegExp(format('^{0}', REF_NAME)); + var rx_directive_tail = new RegExp(format('^::{0}', TAIL)); + var rx_substitution_text = new RegExp(format('^\\|{0}\\|', TEXT1)); + var rx_substitution_sepa = new RegExp(format('^{0}', SEPA)); + var rx_substitution_name = new RegExp(format('^{0}', REF_NAME)); + var rx_substitution_tail = new RegExp(format('^::{0}', TAIL)); + var rx_link_head = new RegExp("^_"); + var rx_link_name = new RegExp(format('^{0}|_', REF_NAME)); + var rx_link_tail = new RegExp(format('^:{0}', TAIL)); + + var rx_verbatim = new RegExp('^::\\s*$'); + var rx_examples = new RegExp('^\\s+(?:>>>|In \\[\\d+\\]:)\\s'); + + /////////////////////////////////////////////////////////////////////////// + /////////////////////////////////////////////////////////////////////////// + + function to_normal(stream, state) { + var token = null; + + if (stream.sol() && stream.match(rx_examples, false)) { + change(state, to_mode, { + mode: mode_python, local: mode_python.startState() + }); + } else if (stream.sol() && stream.match(rx_explicit)) { + change(state, to_explicit); + token = 'meta'; + } else if (stream.sol() && stream.match(rx_section)) { + change(state, to_normal); + token = 'header'; + } else if (phase(state) == rx_role_pre || + stream.match(rx_role_pre, false)) { + + switch (stage(state)) { + case 0: + change(state, to_normal, context(rx_role_pre, 1)); + assert(stream.match(/^:/)); + token = 'meta'; + break; + case 1: + change(state, to_normal, context(rx_role_pre, 2)); + assert(stream.match(rx_NAME)); + token = 'keyword'; + + if (stream.current().match(/^(?:math|latex)/)) { + state.tmp = { + mode: mode_stex, local: mode_stex.startState() + }; + } + break; + case 2: + change(state, to_normal, context(rx_role_pre, 3)); + assert(stream.match(/^:`/)); + token = 'meta'; + break; + case 3: + if (state.tmp) { + if (stream.peek() == '`') { + change(state, to_normal, context(rx_role_pre, 4)); + state.tmp = undefined; + break; + } + + token = state.tmp.mode.token(stream, state.tmp.local); + break; + } + + change(state, to_normal, context(rx_role_pre, 4)); + assert(stream.match(rx_TEXT2)); + token = 'string'; + break; + case 4: + change(state, to_normal, context(rx_role_pre, 5)); + assert(stream.match(/^`/)); + token = 'meta'; + break; + case 5: + change(state, to_normal, context(rx_role_pre, 6)); + assert(stream.match(rx_TAIL)); + break; + default: + change(state, to_normal); + assert(stream.current() == ''); + } + } else if (phase(state) == rx_role_suf || + stream.match(rx_role_suf, false)) { + + switch (stage(state)) { + case 0: + change(state, to_normal, context(rx_role_suf, 1)); + assert(stream.match(/^`/)); + token = 'meta'; + break; + case 1: + change(state, to_normal, context(rx_role_suf, 2)); + assert(stream.match(rx_TEXT2)); + token = 'string'; + break; + case 2: + change(state, to_normal, context(rx_role_suf, 3)); + assert(stream.match(/^`:/)); + token = 'meta'; + break; + case 3: + change(state, to_normal, context(rx_role_suf, 4)); + assert(stream.match(rx_NAME)); + token = 'keyword'; + break; + case 4: + change(state, to_normal, context(rx_role_suf, 5)); + assert(stream.match(/^:/)); + token = 'meta'; + break; + case 5: + change(state, to_normal, context(rx_role_suf, 6)); + assert(stream.match(rx_TAIL)); + break; + default: + change(state, to_normal); + assert(stream.current() == ''); + } + } else if (phase(state) == rx_role || stream.match(rx_role, false)) { + + switch (stage(state)) { + case 0: + change(state, to_normal, context(rx_role, 1)); + assert(stream.match(/^:/)); + token = 'meta'; + break; + case 1: + change(state, to_normal, context(rx_role, 2)); + assert(stream.match(rx_NAME)); + token = 'keyword'; + break; + case 2: + change(state, to_normal, context(rx_role, 3)); + assert(stream.match(/^:/)); + token = 'meta'; + break; + case 3: + change(state, to_normal, context(rx_role, 4)); + assert(stream.match(rx_TAIL)); + break; + default: + change(state, to_normal); + assert(stream.current() == ''); + } + } else if (phase(state) == rx_substitution_ref || + stream.match(rx_substitution_ref, false)) { + + switch (stage(state)) { + case 0: + change(state, to_normal, context(rx_substitution_ref, 1)); + assert(stream.match(rx_substitution_text)); + token = 'variable-2'; + break; + case 1: + change(state, to_normal, context(rx_substitution_ref, 2)); + if (stream.match(/^_?_?/)) token = 'link'; + break; + default: + change(state, to_normal); + assert(stream.current() == ''); + } + } else if (stream.match(rx_footnote_ref)) { + change(state, to_normal); + token = 'quote'; + } else if (stream.match(rx_citation_ref)) { + change(state, to_normal); + token = 'quote'; + } else if (stream.match(rx_link_ref1)) { + change(state, to_normal); + if (!stream.peek() || stream.peek().match(/^\W$/)) { + token = 'link'; + } + } else if (phase(state) == rx_link_ref2 || + stream.match(rx_link_ref2, false)) { + + switch (stage(state)) { + case 0: + if (!stream.peek() || stream.peek().match(/^\W$/)) { + change(state, to_normal, context(rx_link_ref2, 1)); + } else { + stream.match(rx_link_ref2); + } + break; + case 1: + change(state, to_normal, context(rx_link_ref2, 2)); + assert(stream.match(/^`/)); + token = 'link'; + break; + case 2: + change(state, to_normal, context(rx_link_ref2, 3)); + assert(stream.match(rx_TEXT2)); + break; + case 3: + change(state, to_normal, context(rx_link_ref2, 4)); + assert(stream.match(/^`_/)); + token = 'link'; + break; + default: + change(state, to_normal); + assert(stream.current() == ''); + } + } else if (stream.match(rx_verbatim)) { + change(state, to_verbatim); + } + + else { + if (stream.next()) change(state, to_normal); + } + + return token; + } + + /////////////////////////////////////////////////////////////////////////// + /////////////////////////////////////////////////////////////////////////// + + function to_explicit(stream, state) { + var token = null; + + if (phase(state) == rx_substitution || + stream.match(rx_substitution, false)) { + + switch (stage(state)) { + case 0: + change(state, to_explicit, context(rx_substitution, 1)); + assert(stream.match(rx_substitution_text)); + token = 'variable-2'; + break; + case 1: + change(state, to_explicit, context(rx_substitution, 2)); + assert(stream.match(rx_substitution_sepa)); + break; + case 2: + change(state, to_explicit, context(rx_substitution, 3)); + assert(stream.match(rx_substitution_name)); + token = 'keyword'; + break; + case 3: + change(state, to_explicit, context(rx_substitution, 4)); + assert(stream.match(rx_substitution_tail)); + token = 'meta'; + break; + default: + change(state, to_normal); + assert(stream.current() == ''); + } + } else if (phase(state) == rx_directive || + stream.match(rx_directive, false)) { + + switch (stage(state)) { + case 0: + change(state, to_explicit, context(rx_directive, 1)); + assert(stream.match(rx_directive_name)); + token = 'keyword'; + + if (stream.current().match(/^(?:math|latex)/)) + state.tmp_stex = true; + else if (stream.current().match(/^python/)) + state.tmp_py = true; + break; + case 1: + change(state, to_explicit, context(rx_directive, 2)); + assert(stream.match(rx_directive_tail)); + token = 'meta'; + break; + default: + if (stream.match(/^latex\s*$/) || state.tmp_stex) { + state.tmp_stex = undefined; + change(state, to_mode, { + mode: mode_stex, local: mode_stex.startState() + }); + } else if (stream.match(/^python\s*$/) || state.tmp_py) { + state.tmp_py = undefined; + change(state, to_mode, { + mode: mode_python, local: mode_python.startState() + }); + } + + else { + change(state, to_normal); + assert(stream.current() == ''); + } + } + } else if (phase(state) == rx_link || stream.match(rx_link, false)) { + + switch (stage(state)) { + case 0: + change(state, to_explicit, context(rx_link, 1)); + assert(stream.match(rx_link_head)); + assert(stream.match(rx_link_name)); + token = 'link'; + break; + case 1: + change(state, to_explicit, context(rx_link, 2)); + assert(stream.match(rx_link_tail)); + token = 'meta'; + break; + default: + change(state, to_normal); + assert(stream.current() == ''); + } + } else if (stream.match(rx_footnote)) { + change(state, to_normal); + token = 'quote'; + } else if (stream.match(rx_citation)) { + change(state, to_normal); + token = 'quote'; + } + + else { + stream.eatSpace(); + if (stream.eol()) { + change(state, to_normal); + } else { + stream.skipToEnd(); + change(state, to_comment); + token = 'comment'; + } + } + + return token; + } + + /////////////////////////////////////////////////////////////////////////// + /////////////////////////////////////////////////////////////////////////// + + function to_comment(stream, state) { + return as_block(stream, state, 'comment'); + } + + function to_verbatim(stream, state) { + return as_block(stream, state, 'meta'); + } + + function as_block(stream, state, token) { + if (stream.eol() || stream.eatSpace()) { + stream.skipToEnd(); + return token; + } else { + change(state, to_normal); + return null; + } + } + + /////////////////////////////////////////////////////////////////////////// + /////////////////////////////////////////////////////////////////////////// + + function to_mode(stream, state) { + + if (state.ctx.mode && state.ctx.local) { + + if (stream.sol()) { + if (!stream.eatSpace()) change(state, to_normal); + return null; + } + + try { + return state.ctx.mode.token(stream, state.ctx.local); + } catch (ex) { + change(state, to_normal); + return null; + } + } + + change(state, to_normal); + return null; + } + + /////////////////////////////////////////////////////////////////////////// + /////////////////////////////////////////////////////////////////////////// + + function context(phase, stage, mode, local) { + return {phase: phase, stage: stage, mode: mode, local: local}; + } + + function change(state, tok, ctx) { + state.tok = tok; + state.ctx = ctx || {}; + } + + function stage(state) { + return state.ctx.stage || 0; + } + + function phase(state) { + return state.ctx.phase; + } + + /////////////////////////////////////////////////////////////////////////// + /////////////////////////////////////////////////////////////////////////// + + return { + startState: function () { + return {tok: to_normal, ctx: context(undefined, 0)}; + }, + + copyState: function (state) { + return {tok: state.tok, ctx: state.ctx}; + }, + + innerMode: function (state) { + return {state: state.ctx.local, mode: state.ctx.mode}; + }, + + token: function (stream, state) { + return state.tok(stream, state); + } + }; +}, 'python', 'stex'); + +/////////////////////////////////////////////////////////////////////////////// +/////////////////////////////////////////////////////////////////////////////// + +CodeMirror.defineMode('rst', function (config, options) { + + var rx_uri_protocol = "[Hh][Tt][Tt][Pp][Ss]?://"; + var rx_uri_domain = "(?:[\\d\\w.-]+)\\.(?:\\w{2,6})"; + var rx_uri_path = "(?:/[\\d\\w\\#\\%\\&\\-\\.\\,\\/\\:\\=\\?\\~]+)*"; + var rx_uri = new RegExp("^" + + rx_uri_protocol + rx_uri_domain + rx_uri_path + ); + + var rx_strong = /^\*\*[^\*\s](?:[^\*]*[^\*\s])?\*\*(\s+|$)/; + var rx_emphasis = /^[^\*]\*[^\*\s](?:[^\*]*[^\*\s])?\*(\s+|$)/; + var rx_literal = /^``[^`\s](?:[^`]*[^`\s])``(\s+|$)/; + + var rx_number = /^(?:[\d]+(?:[\.,]\d+)*)/; + var rx_positive = /^(?:\s\+[\d]+(?:[\.,]\d+)*)/; + var rx_negative = /^(?:\s\-[\d]+(?:[\.,]\d+)*)/; + + var overlay = { + token: function (stream) { + + if (stream.match(rx_uri)) return 'link'; + if (stream.match(rx_strong)) return 'strong'; + if (stream.match(rx_emphasis)) return 'em'; + if (stream.match(rx_literal)) return 'string-2'; + if (stream.match(rx_number)) return 'number'; + if (stream.match(rx_positive)) return 'positive'; + if (stream.match(rx_negative)) return 'negative'; + + while (stream.next() != null) { + if (stream.match(rx_uri, false)) break; + if (stream.match(rx_strong, false)) break; + if (stream.match(rx_emphasis, false)) break; + if (stream.match(rx_literal, false)) break; + if (stream.match(rx_number, false)) break; + if (stream.match(rx_positive, false)) break; + if (stream.match(rx_negative, false)) break; + } + + return null; + } + }; + + var mode = CodeMirror.getMode( + config, options.backdrop || 'rst-base' + ); + + return CodeMirror.overlayMode(mode, overlay, true); // combine +}, 'python', 'stex'); + +/////////////////////////////////////////////////////////////////////////////// +/////////////////////////////////////////////////////////////////////////////// + +CodeMirror.defineMIME('text/x-rst', 'rst'); + +/////////////////////////////////////////////////////////////////////////////// +/////////////////////////////////////////////////////////////////////////////// diff --git a/modules/files/views/default/assets/mode/ruby/LICENSE b/modules/files/views/default/assets/mode/ruby/LICENSE new file mode 100755 index 0000000..ac09fc4 --- /dev/null +++ b/modules/files/views/default/assets/mode/ruby/LICENSE @@ -0,0 +1,24 @@ +Copyright (c) 2011, Ubalo, Inc. +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + * Neither the name of the Ubalo, Inc. nor the names of its + contributors may be used to endorse or promote products derived + from this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND +ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +DISCLAIMED. IN NO EVENT SHALL UBALO, INC BE LIABLE FOR ANY +DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/modules/files/views/default/assets/mode/ruby/index.html b/modules/files/views/default/assets/mode/ruby/index.html new file mode 100755 index 0000000..64cfe5e --- /dev/null +++ b/modules/files/views/default/assets/mode/ruby/index.html @@ -0,0 +1,173 @@ + + + + + CodeMirror: Ruby mode + + + + + + + + +

      CodeMirror: Ruby mode

      +
      + + +

      MIME types defined: text/x-ruby.

      + +

      Development of the CodeMirror Ruby mode was kindly sponsored + by Ubalo, who hold + the license.

      + + + diff --git a/modules/files/views/default/assets/mode/ruby/ruby.js b/modules/files/views/default/assets/mode/ruby/ruby.js new file mode 100755 index 0000000..d106a54 --- /dev/null +++ b/modules/files/views/default/assets/mode/ruby/ruby.js @@ -0,0 +1,195 @@ +CodeMirror.defineMode("ruby", function(config) { + function wordObj(words) { + var o = {}; + for (var i = 0, e = words.length; i < e; ++i) o[words[i]] = true; + return o; + } + var keywords = wordObj([ + "alias", "and", "BEGIN", "begin", "break", "case", "class", "def", "defined?", "do", "else", + "elsif", "END", "end", "ensure", "false", "for", "if", "in", "module", "next", "not", "or", + "redo", "rescue", "retry", "return", "self", "super", "then", "true", "undef", "unless", + "until", "when", "while", "yield", "nil", "raise", "throw", "catch", "fail", "loop", "callcc", + "caller", "lambda", "proc", "public", "protected", "private", "require", "load", + "require_relative", "extend", "autoload" + ]); + var indentWords = wordObj(["def", "class", "case", "for", "while", "do", "module", "then", + "catch", "loop", "proc", "begin"]); + var dedentWords = wordObj(["end", "until"]); + var matching = {"[": "]", "{": "}", "(": ")"}; + var curPunc; + + function chain(newtok, stream, state) { + state.tokenize.push(newtok); + return newtok(stream, state); + } + + function tokenBase(stream, state) { + curPunc = null; + if (stream.sol() && stream.match("=begin") && stream.eol()) { + state.tokenize.push(readBlockComment); + return "comment"; + } + if (stream.eatSpace()) return null; + var ch = stream.next(), m; + if (ch == "`" || ch == "'" || ch == '"' || + (ch == "/" && !stream.eol() && stream.peek() != " ")) { + return chain(readQuoted(ch, "string", ch == '"' || ch == "`"), stream, state); + } else if (ch == "%") { + var style, embed = false; + if (stream.eat("s")) style = "atom"; + else if (stream.eat(/[WQ]/)) { style = "string"; embed = true; } + else if (stream.eat(/[wxqr]/)) style = "string"; + var delim = stream.eat(/[^\w\s]/); + if (!delim) return "operator"; + if (matching.propertyIsEnumerable(delim)) delim = matching[delim]; + return chain(readQuoted(delim, style, embed, true), stream, state); + } else if (ch == "#") { + stream.skipToEnd(); + return "comment"; + } else if (ch == "<" && (m = stream.match(/^<-?[\`\"\']?([a-zA-Z_?]\w*)[\`\"\']?(?:;|$)/))) { + return chain(readHereDoc(m[1]), stream, state); + } else if (ch == "0") { + if (stream.eat("x")) stream.eatWhile(/[\da-fA-F]/); + else if (stream.eat("b")) stream.eatWhile(/[01]/); + else stream.eatWhile(/[0-7]/); + return "number"; + } else if (/\d/.test(ch)) { + stream.match(/^[\d_]*(?:\.[\d_]+)?(?:[eE][+\-]?[\d_]+)?/); + return "number"; + } else if (ch == "?") { + while (stream.match(/^\\[CM]-/)) {} + if (stream.eat("\\")) stream.eatWhile(/\w/); + else stream.next(); + return "string"; + } else if (ch == ":") { + if (stream.eat("'")) return chain(readQuoted("'", "atom", false), stream, state); + if (stream.eat('"')) return chain(readQuoted('"', "atom", true), stream, state); + stream.eatWhile(/[\w\?]/); + return "atom"; + } else if (ch == "@") { + stream.eat("@"); + stream.eatWhile(/[\w\?]/); + return "variable-2"; + } else if (ch == "$") { + stream.next(); + stream.eatWhile(/[\w\?]/); + return "variable-3"; + } else if (/\w/.test(ch)) { + stream.eatWhile(/[\w\?]/); + if (stream.eat(":")) return "atom"; + return "ident"; + } else if (ch == "|" && (state.varList || state.lastTok == "{" || state.lastTok == "do")) { + curPunc = "|"; + return null; + } else if (/[\(\)\[\]{}\\;]/.test(ch)) { + curPunc = ch; + return null; + } else if (ch == "-" && stream.eat(">")) { + return "arrow"; + } else if (/[=+\-\/*:\.^%<>~|]/.test(ch)) { + stream.eatWhile(/[=+\-\/*:\.^%<>~|]/); + return "operator"; + } else { + return null; + } + } + + function tokenBaseUntilBrace() { + var depth = 1; + return function(stream, state) { + if (stream.peek() == "}") { + depth--; + if (depth == 0) { + state.tokenize.pop(); + return state.tokenize[state.tokenize.length-1](stream, state); + } + } else if (stream.peek() == "{") { + depth++; + } + return tokenBase(stream, state); + }; + } + function readQuoted(quote, style, embed, unescaped) { + return function(stream, state) { + var escaped = false, ch; + while ((ch = stream.next()) != null) { + if (ch == quote && (unescaped || !escaped)) { + state.tokenize.pop(); + break; + } + if (embed && ch == "#" && !escaped && stream.eat("{")) { + state.tokenize.push(tokenBaseUntilBrace(arguments.callee)); + break; + } + escaped = !escaped && ch == "\\"; + } + return style; + }; + } + function readHereDoc(phrase) { + return function(stream, state) { + if (stream.match(phrase)) state.tokenize.pop(); + else stream.skipToEnd(); + return "string"; + }; + } + function readBlockComment(stream, state) { + if (stream.sol() && stream.match("=end") && stream.eol()) + state.tokenize.pop(); + stream.skipToEnd(); + return "comment"; + } + + return { + startState: function() { + return {tokenize: [tokenBase], + indented: 0, + context: {type: "top", indented: -config.indentUnit}, + continuedLine: false, + lastTok: null, + varList: false}; + }, + + token: function(stream, state) { + if (stream.sol()) state.indented = stream.indentation(); + var style = state.tokenize[state.tokenize.length-1](stream, state), kwtype; + if (style == "ident") { + var word = stream.current(); + style = keywords.propertyIsEnumerable(stream.current()) ? "keyword" + : /^[A-Z]/.test(word) ? "tag" + : (state.lastTok == "def" || state.lastTok == "class" || state.varList) ? "def" + : "variable"; + if (indentWords.propertyIsEnumerable(word)) kwtype = "indent"; + else if (dedentWords.propertyIsEnumerable(word)) kwtype = "dedent"; + else if ((word == "if" || word == "unless") && stream.column() == stream.indentation()) + kwtype = "indent"; + } + if (curPunc || (style && style != "comment")) state.lastTok = word || curPunc || style; + if (curPunc == "|") state.varList = !state.varList; + + if (kwtype == "indent" || /[\(\[\{]/.test(curPunc)) + state.context = {prev: state.context, type: curPunc || style, indented: state.indented}; + else if ((kwtype == "dedent" || /[\)\]\}]/.test(curPunc)) && state.context.prev) + state.context = state.context.prev; + + if (stream.eol()) + state.continuedLine = (curPunc == "\\" || style == "operator"); + return style; + }, + + indent: function(state, textAfter) { + if (state.tokenize[state.tokenize.length-1] != tokenBase) return 0; + var firstChar = textAfter && textAfter.charAt(0); + var ct = state.context; + var closing = ct.type == matching[firstChar] || + ct.type == "keyword" && /^(?:end|until|else|elsif|when|rescue)\b/.test(textAfter); + return ct.indented + (closing ? 0 : config.indentUnit) + + (state.continuedLine ? config.indentUnit : 0); + }, + electricChars: "}de" // enD and rescuE + + }; +}); + +CodeMirror.defineMIME("text/x-ruby", "ruby"); + diff --git a/modules/files/views/default/assets/mode/rust/index.html b/modules/files/views/default/assets/mode/rust/index.html new file mode 100755 index 0000000..a6d47fe --- /dev/null +++ b/modules/files/views/default/assets/mode/rust/index.html @@ -0,0 +1,48 @@ + + + + + CodeMirror: Rust mode + + + + + + + +

      CodeMirror: Rust mode

      + +
      + + + +

      MIME types defined: text/x-rustsrc.

      + + diff --git a/modules/files/views/default/assets/mode/rust/rust.js b/modules/files/views/default/assets/mode/rust/rust.js new file mode 100755 index 0000000..ea3005c --- /dev/null +++ b/modules/files/views/default/assets/mode/rust/rust.js @@ -0,0 +1,432 @@ +CodeMirror.defineMode("rust", function() { + var indentUnit = 4, altIndentUnit = 2; + var valKeywords = { + "if": "if-style", "while": "if-style", "else": "else-style", + "do": "else-style", "ret": "else-style", "fail": "else-style", + "break": "atom", "cont": "atom", "const": "let", "resource": "fn", + "let": "let", "fn": "fn", "for": "for", "alt": "alt", "iface": "iface", + "impl": "impl", "type": "type", "enum": "enum", "mod": "mod", + "as": "op", "true": "atom", "false": "atom", "assert": "op", "check": "op", + "claim": "op", "native": "ignore", "unsafe": "ignore", "import": "else-style", + "export": "else-style", "copy": "op", "log": "op", "log_err": "op", + "use": "op", "bind": "op", "self": "atom" + }; + var typeKeywords = function() { + var keywords = {"fn": "fn", "block": "fn", "obj": "obj"}; + var atoms = "bool uint int i8 i16 i32 i64 u8 u16 u32 u64 float f32 f64 str char".split(" "); + for (var i = 0, e = atoms.length; i < e; ++i) keywords[atoms[i]] = "atom"; + return keywords; + }(); + var operatorChar = /[+\-*&%=<>!?|\.@]/; + + // Tokenizer + + // Used as scratch variable to communicate multiple values without + // consing up tons of objects. + var tcat, content; + function r(tc, style) { + tcat = tc; + return style; + } + + function tokenBase(stream, state) { + var ch = stream.next(); + if (ch == '"') { + state.tokenize = tokenString; + return state.tokenize(stream, state); + } + if (ch == "'") { + tcat = "atom"; + if (stream.eat("\\")) { + if (stream.skipTo("'")) { stream.next(); return "string"; } + else { return "error"; } + } else { + stream.next(); + return stream.eat("'") ? "string" : "error"; + } + } + if (ch == "/") { + if (stream.eat("/")) { stream.skipToEnd(); return "comment"; } + if (stream.eat("*")) { + state.tokenize = tokenComment(1); + return state.tokenize(stream, state); + } + } + if (ch == "#") { + if (stream.eat("[")) { tcat = "open-attr"; return null; } + stream.eatWhile(/\w/); + return r("macro", "meta"); + } + if (ch == ":" && stream.match(":<")) { + return r("op", null); + } + if (ch.match(/\d/) || (ch == "." && stream.eat(/\d/))) { + var flp = false; + if (!stream.match(/^x[\da-f]+/i) && !stream.match(/^b[01]+/)) { + stream.eatWhile(/\d/); + if (stream.eat(".")) { flp = true; stream.eatWhile(/\d/); } + if (stream.match(/^e[+\-]?\d+/i)) { flp = true; } + } + if (flp) stream.match(/^f(?:32|64)/); + else stream.match(/^[ui](?:8|16|32|64)/); + return r("atom", "number"); + } + if (ch.match(/[()\[\]{}:;,]/)) return r(ch, null); + if (ch == "-" && stream.eat(">")) return r("->", null); + if (ch.match(operatorChar)) { + stream.eatWhile(operatorChar); + return r("op", null); + } + stream.eatWhile(/\w/); + content = stream.current(); + if (stream.match(/^::\w/)) { + stream.backUp(1); + return r("prefix", "variable-2"); + } + if (state.keywords.propertyIsEnumerable(content)) + return r(state.keywords[content], content.match(/true|false/) ? "atom" : "keyword"); + return r("name", "variable"); + } + + function tokenString(stream, state) { + var ch, escaped = false; + while (ch = stream.next()) { + if (ch == '"' && !escaped) { + state.tokenize = tokenBase; + return r("atom", "string"); + } + escaped = !escaped && ch == "\\"; + } + // Hack to not confuse the parser when a string is split in + // pieces. + return r("op", "string"); + } + + function tokenComment(depth) { + return function(stream, state) { + var lastCh = null, ch; + while (ch = stream.next()) { + if (ch == "/" && lastCh == "*") { + if (depth == 1) { + state.tokenize = tokenBase; + break; + } else { + state.tokenize = tokenComment(depth - 1); + return state.tokenize(stream, state); + } + } + if (ch == "*" && lastCh == "/") { + state.tokenize = tokenComment(depth + 1); + return state.tokenize(stream, state); + } + lastCh = ch; + } + return "comment"; + }; + } + + // Parser + + var cx = {state: null, stream: null, marked: null, cc: null}; + function pass() { + for (var i = arguments.length - 1; i >= 0; i--) cx.cc.push(arguments[i]); + } + function cont() { + pass.apply(null, arguments); + return true; + } + + function pushlex(type, info) { + var result = function() { + var state = cx.state; + state.lexical = {indented: state.indented, column: cx.stream.column(), + type: type, prev: state.lexical, info: info}; + }; + result.lex = true; + return result; + } + function poplex() { + var state = cx.state; + if (state.lexical.prev) { + if (state.lexical.type == ")") + state.indented = state.lexical.indented; + state.lexical = state.lexical.prev; + } + } + function typecx() { cx.state.keywords = typeKeywords; } + function valcx() { cx.state.keywords = valKeywords; } + poplex.lex = typecx.lex = valcx.lex = true; + + function commasep(comb, end) { + function more(type) { + if (type == ",") return cont(comb, more); + if (type == end) return cont(); + return cont(more); + } + return function(type) { + if (type == end) return cont(); + return pass(comb, more); + }; + } + + function stat_of(comb, tag) { + return cont(pushlex("stat", tag), comb, poplex, block); + } + function block(type) { + if (type == "}") return cont(); + if (type == "let") return stat_of(letdef1, "let"); + if (type == "fn") return stat_of(fndef); + if (type == "type") return cont(pushlex("stat"), tydef, endstatement, poplex, block); + if (type == "enum") return stat_of(enumdef); + if (type == "mod") return stat_of(mod); + if (type == "iface") return stat_of(iface); + if (type == "impl") return stat_of(impl); + if (type == "open-attr") return cont(pushlex("]"), commasep(expression, "]"), poplex); + if (type == "ignore" || type.match(/[\]\);,]/)) return cont(block); + return pass(pushlex("stat"), expression, poplex, endstatement, block); + } + function endstatement(type) { + if (type == ";") return cont(); + return pass(); + } + function expression(type) { + if (type == "atom" || type == "name") return cont(maybeop); + if (type == "{") return cont(pushlex("}"), exprbrace, poplex); + if (type.match(/[\[\(]/)) return matchBrackets(type, expression); + if (type.match(/[\]\)\};,]/)) return pass(); + if (type == "if-style") return cont(expression, expression); + if (type == "else-style" || type == "op") return cont(expression); + if (type == "for") return cont(pattern, maybetype, inop, expression, expression); + if (type == "alt") return cont(expression, altbody); + if (type == "fn") return cont(fndef); + if (type == "macro") return cont(macro); + return cont(); + } + function maybeop(type) { + if (content == ".") return cont(maybeprop); + if (content == "::<"){return cont(typarams, maybeop);} + if (type == "op" || content == ":") return cont(expression); + if (type == "(" || type == "[") return matchBrackets(type, expression); + return pass(); + } + function maybeprop() { + if (content.match(/^\w+$/)) {cx.marked = "variable"; return cont(maybeop);} + return pass(expression); + } + function exprbrace(type) { + if (type == "op") { + if (content == "|") return cont(blockvars, poplex, pushlex("}", "block"), block); + if (content == "||") return cont(poplex, pushlex("}", "block"), block); + } + if (content == "mutable" || (content.match(/^\w+$/) && cx.stream.peek() == ":" + && !cx.stream.match("::", false))) + return pass(record_of(expression)); + return pass(block); + } + function record_of(comb) { + function ro(type) { + if (content == "mutable" || content == "with") {cx.marked = "keyword"; return cont(ro);} + if (content.match(/^\w*$/)) {cx.marked = "variable"; return cont(ro);} + if (type == ":") return cont(comb, ro); + if (type == "}") return cont(); + return cont(ro); + } + return ro; + } + function blockvars(type) { + if (type == "name") {cx.marked = "def"; return cont(blockvars);} + if (type == "op" && content == "|") return cont(); + return cont(blockvars); + } + + function letdef1(type) { + if (type.match(/[\]\)\};]/)) return cont(); + if (content == "=") return cont(expression, letdef2); + if (type == ",") return cont(letdef1); + return pass(pattern, maybetype, letdef1); + } + function letdef2(type) { + if (type.match(/[\]\)\};,]/)) return pass(letdef1); + else return pass(expression, letdef2); + } + function maybetype(type) { + if (type == ":") return cont(typecx, rtype, valcx); + return pass(); + } + function inop(type) { + if (type == "name" && content == "in") {cx.marked = "keyword"; return cont();} + return pass(); + } + function fndef(type) { + if (content == "@" || content == "~") {cx.marked = "keyword"; return cont(fndef);} + if (type == "name") {cx.marked = "def"; return cont(fndef);} + if (content == "<") return cont(typarams, fndef); + if (type == "{") return pass(expression); + if (type == "(") return cont(pushlex(")"), commasep(argdef, ")"), poplex, fndef); + if (type == "->") return cont(typecx, rtype, valcx, fndef); + if (type == ";") return cont(); + return cont(fndef); + } + function tydef(type) { + if (type == "name") {cx.marked = "def"; return cont(tydef);} + if (content == "<") return cont(typarams, tydef); + if (content == "=") return cont(typecx, rtype, valcx); + return cont(tydef); + } + function enumdef(type) { + if (type == "name") {cx.marked = "def"; return cont(enumdef);} + if (content == "<") return cont(typarams, enumdef); + if (content == "=") return cont(typecx, rtype, valcx, endstatement); + if (type == "{") return cont(pushlex("}"), typecx, enumblock, valcx, poplex); + return cont(enumdef); + } + function enumblock(type) { + if (type == "}") return cont(); + if (type == "(") return cont(pushlex(")"), commasep(rtype, ")"), poplex, enumblock); + if (content.match(/^\w+$/)) cx.marked = "def"; + return cont(enumblock); + } + function mod(type) { + if (type == "name") {cx.marked = "def"; return cont(mod);} + if (type == "{") return cont(pushlex("}"), block, poplex); + return pass(); + } + function iface(type) { + if (type == "name") {cx.marked = "def"; return cont(iface);} + if (content == "<") return cont(typarams, iface); + if (type == "{") return cont(pushlex("}"), block, poplex); + return pass(); + } + function impl(type) { + if (content == "<") return cont(typarams, impl); + if (content == "of" || content == "for") {cx.marked = "keyword"; return cont(rtype, impl);} + if (type == "name") {cx.marked = "def"; return cont(impl);} + if (type == "{") return cont(pushlex("}"), block, poplex); + return pass(); + } + function typarams() { + if (content == ">") return cont(); + if (content == ",") return cont(typarams); + if (content == ":") return cont(rtype, typarams); + return pass(rtype, typarams); + } + function argdef(type) { + if (type == "name") {cx.marked = "def"; return cont(argdef);} + if (type == ":") return cont(typecx, rtype, valcx); + return pass(); + } + function rtype(type) { + if (type == "name") {cx.marked = "variable-3"; return cont(rtypemaybeparam); } + if (content == "mutable") {cx.marked = "keyword"; return cont(rtype);} + if (type == "atom") return cont(rtypemaybeparam); + if (type == "op" || type == "obj") return cont(rtype); + if (type == "fn") return cont(fntype); + if (type == "{") return cont(pushlex("{"), record_of(rtype), poplex); + return matchBrackets(type, rtype); + } + function rtypemaybeparam() { + if (content == "<") return cont(typarams); + return pass(); + } + function fntype(type) { + if (type == "(") return cont(pushlex("("), commasep(rtype, ")"), poplex, fntype); + if (type == "->") return cont(rtype); + return pass(); + } + function pattern(type) { + if (type == "name") {cx.marked = "def"; return cont(patternmaybeop);} + if (type == "atom") return cont(patternmaybeop); + if (type == "op") return cont(pattern); + if (type.match(/[\]\)\};,]/)) return pass(); + return matchBrackets(type, pattern); + } + function patternmaybeop(type) { + if (type == "op" && content == ".") return cont(); + if (content == "to") {cx.marked = "keyword"; return cont(pattern);} + else return pass(); + } + function altbody(type) { + if (type == "{") return cont(pushlex("}", "alt"), altblock1, poplex); + return pass(); + } + function altblock1(type) { + if (type == "}") return cont(); + if (type == "|") return cont(altblock1); + if (content == "when") {cx.marked = "keyword"; return cont(expression, altblock2);} + if (type.match(/[\]\);,]/)) return cont(altblock1); + return pass(pattern, altblock2); + } + function altblock2(type) { + if (type == "{") return cont(pushlex("}", "alt"), block, poplex, altblock1); + else return pass(altblock1); + } + + function macro(type) { + if (type.match(/[\[\(\{]/)) return matchBrackets(type, expression); + return pass(); + } + function matchBrackets(type, comb) { + if (type == "[") return cont(pushlex("]"), commasep(comb, "]"), poplex); + if (type == "(") return cont(pushlex(")"), commasep(comb, ")"), poplex); + if (type == "{") return cont(pushlex("}"), commasep(comb, "}"), poplex); + return cont(); + } + + function parse(state, stream, style) { + var cc = state.cc; + // Communicate our context to the combinators. + // (Less wasteful than consing up a hundred closures on every call.) + cx.state = state; cx.stream = stream; cx.marked = null, cx.cc = cc; + + while (true) { + var combinator = cc.length ? cc.pop() : block; + if (combinator(tcat)) { + while(cc.length && cc[cc.length - 1].lex) + cc.pop()(); + return cx.marked || style; + } + } + } + + return { + startState: function() { + return { + tokenize: tokenBase, + cc: [], + lexical: {indented: -indentUnit, column: 0, type: "top", align: false}, + keywords: valKeywords, + indented: 0 + }; + }, + + token: function(stream, state) { + if (stream.sol()) { + if (!state.lexical.hasOwnProperty("align")) + state.lexical.align = false; + state.indented = stream.indentation(); + } + if (stream.eatSpace()) return null; + tcat = content = null; + var style = state.tokenize(stream, state); + if (style == "comment") return style; + if (!state.lexical.hasOwnProperty("align")) + state.lexical.align = true; + if (tcat == "prefix") return style; + if (!content) content = stream.current(); + return parse(state, stream, style); + }, + + indent: function(state, textAfter) { + if (state.tokenize != tokenBase) return 0; + var firstChar = textAfter && textAfter.charAt(0), lexical = state.lexical, + type = lexical.type, closing = firstChar == type; + if (type == "stat") return lexical.indented + indentUnit; + if (lexical.align) return lexical.column + (closing ? 0 : 1); + return lexical.indented + (closing ? 0 : (lexical.info == "alt" ? altIndentUnit : indentUnit)); + }, + + electricChars: "{}" + }; +}); + +CodeMirror.defineMIME("text/x-rustsrc", "rust"); diff --git a/modules/files/views/default/assets/mode/sass/index.html b/modules/files/views/default/assets/mode/sass/index.html new file mode 100755 index 0000000..3af7bff --- /dev/null +++ b/modules/files/views/default/assets/mode/sass/index.html @@ -0,0 +1,54 @@ + + + + + CodeMirror: Sass mode + + + + + + + + +

      CodeMirror: Sass mode

      +
      + + +

      MIME types defined: text/x-sass.

      + + diff --git a/modules/files/views/default/assets/mode/sass/sass.js b/modules/files/views/default/assets/mode/sass/sass.js new file mode 100755 index 0000000..e5c82e4 --- /dev/null +++ b/modules/files/views/default/assets/mode/sass/sass.js @@ -0,0 +1,349 @@ +CodeMirror.defineMode("sass", function(config) { + var tokenRegexp = function(words){ + return new RegExp("^" + words.join("|")); + }; + + var tags = ["&", "a","abbr","acronym","address","applet","area","article","aside","audio","b","base","basefont","bdi","bdo","big","blockquote","body","br","button","canvas","caption","cite","code","col","colgroup","command","datalist","dd","del","details","dfn","dir","div","dl","dt","em","embed","fieldset","figcaption","figure","font","footer","form","frame","frameset","h1","h2","h3","h4","h5","h6","head","header","hgroup","hr","html","i","iframe","img","input","ins","keygen","kbd","label","legend","li","link","map","mark","menu","meta","meter","nav","noframes","noscript","object","ol","optgroup","option","output","p","param","pre","progress","q","rp","rt","ruby","s","samp","script","section","select","small","source","span","strike","strong","style","sub","summary","sup","table","tbody","td","textarea","tfoot","th","thead","time","title","tr","track","tt","u","ul","var","video","wbr"]; + var keywords = ["true", "false", "null", "auto"]; + var keywordsRegexp = new RegExp("^" + keywords.join("|")); + + var operators = ["\\(", "\\)", "=", ">", "<", "==", ">=", "<=", "\\+", "-", "\\!=", "/", "\\*", "%", "and", "or", "not"]; + var opRegexp = tokenRegexp(operators); + + function htmlTag(val){ + for(var i=0; i + + + + CodeMirror: Scheme mode + + + + + + + +

      CodeMirror: Scheme mode

      +
      + + +

      MIME types defined: text/x-scheme.

      + + + diff --git a/modules/files/views/default/assets/mode/scheme/scheme.js b/modules/files/views/default/assets/mode/scheme/scheme.js new file mode 100755 index 0000000..2ed0a24 --- /dev/null +++ b/modules/files/views/default/assets/mode/scheme/scheme.js @@ -0,0 +1,230 @@ +/** + * Author: Koh Zi Han, based on implementation by Koh Zi Chun + */ +CodeMirror.defineMode("scheme", function () { + var BUILTIN = "builtin", COMMENT = "comment", STRING = "string", + ATOM = "atom", NUMBER = "number", BRACKET = "bracket"; + var INDENT_WORD_SKIP = 2; + + function makeKeywords(str) { + var obj = {}, words = str.split(" "); + for (var i = 0; i < words.length; ++i) obj[words[i]] = true; + return obj; + } + + var keywords = makeKeywords("λ case-lambda call/cc class define-class exit-handler field import inherit init-field interface let*-values let-values let/ec mixin opt-lambda override protect provide public rename require require-for-syntax syntax syntax-case syntax-error unit/sig unless when with-syntax and begin call-with-current-continuation call-with-input-file call-with-output-file case cond define define-syntax delay do dynamic-wind else for-each if lambda let let* let-syntax letrec letrec-syntax map or syntax-rules abs acos angle append apply asin assoc assq assv atan boolean? caar cadr call-with-input-file call-with-output-file call-with-values car cdddar cddddr cdr ceiling char->integer char-alphabetic? char-ci<=? char-ci=? char-ci>? char-downcase char-lower-case? char-numeric? char-ready? char-upcase char-upper-case? char-whitespace? char<=? char=? char>? char? close-input-port close-output-port complex? cons cos current-input-port current-output-port denominator display eof-object? eq? equal? eqv? eval even? exact->inexact exact? exp expt #f floor force gcd imag-part inexact->exact inexact? input-port? integer->char integer? interaction-environment lcm length list list->string list->vector list-ref list-tail list? load log magnitude make-polar make-rectangular make-string make-vector max member memq memv min modulo negative? newline not null-environment null? number->string number? numerator odd? open-input-file open-output-file output-port? pair? peek-char port? positive? procedure? quasiquote quote quotient rational? rationalize read read-char real-part real? remainder reverse round scheme-report-environment set! set-car! set-cdr! sin sqrt string string->list string->number string->symbol string-append string-ci<=? string-ci=? string-ci>? string-copy string-fill! string-length string-ref string-set! string<=? string=? string>? string? substring symbol->string symbol? #t tan transcript-off transcript-on truncate values vector vector->list vector-fill! vector-length vector-ref vector-set! with-input-from-file with-output-to-file write write-char zero?"); + var indentKeys = makeKeywords("define let letrec let* lambda"); + + function stateStack(indent, type, prev) { // represents a state stack object + this.indent = indent; + this.type = type; + this.prev = prev; + } + + function pushStack(state, indent, type) { + state.indentStack = new stateStack(indent, type, state.indentStack); + } + + function popStack(state) { + state.indentStack = state.indentStack.prev; + } + + var binaryMatcher = new RegExp(/^(?:[-+]i|[-+][01]+#*(?:\/[01]+#*)?i|[-+]?[01]+#*(?:\/[01]+#*)?@[-+]?[01]+#*(?:\/[01]+#*)?|[-+]?[01]+#*(?:\/[01]+#*)?[-+](?:[01]+#*(?:\/[01]+#*)?)?i|[-+]?[01]+#*(?:\/[01]+#*)?)(?=[()\s;"]|$)/i); + var octalMatcher = new RegExp(/^(?:[-+]i|[-+][0-7]+#*(?:\/[0-7]+#*)?i|[-+]?[0-7]+#*(?:\/[0-7]+#*)?@[-+]?[0-7]+#*(?:\/[0-7]+#*)?|[-+]?[0-7]+#*(?:\/[0-7]+#*)?[-+](?:[0-7]+#*(?:\/[0-7]+#*)?)?i|[-+]?[0-7]+#*(?:\/[0-7]+#*)?)(?=[()\s;"]|$)/i); + var hexMatcher = new RegExp(/^(?:[-+]i|[-+][\da-f]+#*(?:\/[\da-f]+#*)?i|[-+]?[\da-f]+#*(?:\/[\da-f]+#*)?@[-+]?[\da-f]+#*(?:\/[\da-f]+#*)?|[-+]?[\da-f]+#*(?:\/[\da-f]+#*)?[-+](?:[\da-f]+#*(?:\/[\da-f]+#*)?)?i|[-+]?[\da-f]+#*(?:\/[\da-f]+#*)?)(?=[()\s;"]|$)/i); + var decimalMatcher = new RegExp(/^(?:[-+]i|[-+](?:(?:(?:\d+#+\.?#*|\d+\.\d*#*|\.\d+#*|\d+)(?:[esfdl][-+]?\d+)?)|\d+#*\/\d+#*)i|[-+]?(?:(?:(?:\d+#+\.?#*|\d+\.\d*#*|\.\d+#*|\d+)(?:[esfdl][-+]?\d+)?)|\d+#*\/\d+#*)@[-+]?(?:(?:(?:\d+#+\.?#*|\d+\.\d*#*|\.\d+#*|\d+)(?:[esfdl][-+]?\d+)?)|\d+#*\/\d+#*)|[-+]?(?:(?:(?:\d+#+\.?#*|\d+\.\d*#*|\.\d+#*|\d+)(?:[esfdl][-+]?\d+)?)|\d+#*\/\d+#*)[-+](?:(?:(?:\d+#+\.?#*|\d+\.\d*#*|\.\d+#*|\d+)(?:[esfdl][-+]?\d+)?)|\d+#*\/\d+#*)?i|(?:(?:(?:\d+#+\.?#*|\d+\.\d*#*|\.\d+#*|\d+)(?:[esfdl][-+]?\d+)?)|\d+#*\/\d+#*))(?=[()\s;"]|$)/i); + + function isBinaryNumber (stream) { + return stream.match(binaryMatcher); + } + + function isOctalNumber (stream) { + return stream.match(octalMatcher); + } + + function isDecimalNumber (stream, backup) { + if (backup === true) { + stream.backUp(1); + } + return stream.match(decimalMatcher); + } + + function isHexNumber (stream) { + return stream.match(hexMatcher); + } + + return { + startState: function () { + return { + indentStack: null, + indentation: 0, + mode: false, + sExprComment: false + }; + }, + + token: function (stream, state) { + if (state.indentStack == null && stream.sol()) { + // update indentation, but only if indentStack is empty + state.indentation = stream.indentation(); + } + + // skip spaces + if (stream.eatSpace()) { + return null; + } + var returnType = null; + + switch(state.mode){ + case "string": // multi-line string parsing mode + var next, escaped = false; + while ((next = stream.next()) != null) { + if (next == "\"" && !escaped) { + + state.mode = false; + break; + } + escaped = !escaped && next == "\\"; + } + returnType = STRING; // continue on in scheme-string mode + break; + case "comment": // comment parsing mode + var next, maybeEnd = false; + while ((next = stream.next()) != null) { + if (next == "#" && maybeEnd) { + + state.mode = false; + break; + } + maybeEnd = (next == "|"); + } + returnType = COMMENT; + break; + case "s-expr-comment": // s-expr commenting mode + state.mode = false; + if(stream.peek() == "(" || stream.peek() == "["){ + // actually start scheme s-expr commenting mode + state.sExprComment = 0; + }else{ + // if not we just comment the entire of the next token + stream.eatWhile(/[^/s]/); // eat non spaces + returnType = COMMENT; + break; + } + default: // default parsing mode + var ch = stream.next(); + + if (ch == "\"") { + state.mode = "string"; + returnType = STRING; + + } else if (ch == "'") { + returnType = ATOM; + } else if (ch == '#') { + if (stream.eat("|")) { // Multi-line comment + state.mode = "comment"; // toggle to comment mode + returnType = COMMENT; + } else if (stream.eat(/[tf]/i)) { // #t/#f (atom) + returnType = ATOM; + } else if (stream.eat(';')) { // S-Expr comment + state.mode = "s-expr-comment"; + returnType = COMMENT; + } else { + var numTest = null, hasExactness = false, hasRadix = true; + if (stream.eat(/[ei]/i)) { + hasExactness = true; + } else { + stream.backUp(1); // must be radix specifier + } + if (stream.match(/^#b/i)) { + numTest = isBinaryNumber; + } else if (stream.match(/^#o/i)) { + numTest = isOctalNumber; + } else if (stream.match(/^#x/i)) { + numTest = isHexNumber; + } else if (stream.match(/^#d/i)) { + numTest = isDecimalNumber; + } else if (stream.match(/^[-+0-9.]/, false)) { + hasRadix = false; + numTest = isDecimalNumber; + // re-consume the intial # if all matches failed + } else if (!hasExactness) { + stream.eat('#'); + } + if (numTest != null) { + if (hasRadix && !hasExactness) { + // consume optional exactness after radix + stream.match(/^#[ei]/i); + } + if (numTest(stream)) + returnType = NUMBER; + } + } + } else if (/^[-+0-9.]/.test(ch) && isDecimalNumber(stream, true)) { // match non-prefixed number, must be decimal + returnType = NUMBER; + } else if (ch == ";") { // comment + stream.skipToEnd(); // rest of the line is a comment + returnType = COMMENT; + } else if (ch == "(" || ch == "[") { + var keyWord = ''; var indentTemp = stream.column(), letter; + /** + Either + (indent-word .. + (non-indent-word .. + (;something else, bracket, etc. + */ + + while ((letter = stream.eat(/[^\s\(\[\;\)\]]/)) != null) { + keyWord += letter; + } + + if (keyWord.length > 0 && indentKeys.propertyIsEnumerable(keyWord)) { // indent-word + + pushStack(state, indentTemp + INDENT_WORD_SKIP, ch); + } else { // non-indent word + // we continue eating the spaces + stream.eatSpace(); + if (stream.eol() || stream.peek() == ";") { + // nothing significant after + // we restart indentation 1 space after + pushStack(state, indentTemp + 1, ch); + } else { + pushStack(state, indentTemp + stream.current().length, ch); // else we match + } + } + stream.backUp(stream.current().length - 1); // undo all the eating + + if(typeof state.sExprComment == "number") state.sExprComment++; + + returnType = BRACKET; + } else if (ch == ")" || ch == "]") { + returnType = BRACKET; + if (state.indentStack != null && state.indentStack.type == (ch == ")" ? "(" : "[")) { + popStack(state); + + if(typeof state.sExprComment == "number"){ + if(--state.sExprComment == 0){ + returnType = COMMENT; // final closing bracket + state.sExprComment = false; // turn off s-expr commenting mode + } + } + } + } else { + stream.eatWhile(/[\w\$_\-!$%&*+\.\/:<=>?@\^~]/); + + if (keywords && keywords.propertyIsEnumerable(stream.current())) { + returnType = BUILTIN; + } else returnType = "variable"; + } + } + return (typeof state.sExprComment == "number") ? COMMENT : returnType; + }, + + indent: function (state) { + if (state.indentStack == null) return state.indentation; + return state.indentStack.indent; + } + }; +}); + +CodeMirror.defineMIME("text/x-scheme", "scheme"); diff --git a/modules/files/views/default/assets/mode/shell/index.html b/modules/files/views/default/assets/mode/shell/index.html new file mode 100755 index 0000000..9a2ef7c --- /dev/null +++ b/modules/files/views/default/assets/mode/shell/index.html @@ -0,0 +1,51 @@ + + +CodeMirror: Shell mode + + + + + + + + + + +

      CodeMirror: Shell mode

      + + + + + +

      MIME types defined: text/x-sh.

      diff --git a/modules/files/views/default/assets/mode/shell/shell.js b/modules/files/views/default/assets/mode/shell/shell.js new file mode 100755 index 0000000..abfd214 --- /dev/null +++ b/modules/files/views/default/assets/mode/shell/shell.js @@ -0,0 +1,118 @@ +CodeMirror.defineMode('shell', function() { + + var words = {}; + function define(style, string) { + var split = string.split(' '); + for(var i = 0; i < split.length; i++) { + words[split[i]] = style; + } + }; + + // Atoms + define('atom', 'true false'); + + // Keywords + define('keyword', 'if then do else elif while until for in esac fi fin ' + + 'fil done exit set unset export function'); + + // Commands + define('builtin', 'ab awk bash beep cat cc cd chown chmod chroot clear cp ' + + 'curl cut diff echo find gawk gcc get git grep kill killall ln ls make ' + + 'mkdir openssl mv nc node npm ping ps restart rm rmdir sed service sh ' + + 'shopt shred source sort sleep ssh start stop su sudo tee telnet top ' + + 'touch vi vim wall wc wget who write yes zsh'); + + function tokenBase(stream, state) { + + var sol = stream.sol(); + var ch = stream.next(); + + if (ch === '\'' || ch === '"' || ch === '`') { + state.tokens.unshift(tokenString(ch)); + return tokenize(stream, state); + } + if (ch === '#') { + if (sol && stream.eat('!')) { + stream.skipToEnd(); + return 'meta'; // 'comment'? + } + stream.skipToEnd(); + return 'comment'; + } + if (ch === '$') { + state.tokens.unshift(tokenDollar); + return tokenize(stream, state); + } + if (ch === '+' || ch === '=') { + return 'operator'; + } + if (ch === '-') { + stream.eat('-'); + stream.eatWhile(/\w/); + return 'attribute'; + } + if (/\d/.test(ch)) { + stream.eatWhile(/\d/); + if(!/\w/.test(stream.peek())) { + return 'number'; + } + } + stream.eatWhile(/[\w-]/); + var cur = stream.current(); + if (stream.peek() === '=' && /\w+/.test(cur)) return 'def'; + return words.hasOwnProperty(cur) ? words[cur] : null; + } + + function tokenString(quote) { + return function(stream, state) { + var next, end = false, escaped = false; + while ((next = stream.next()) != null) { + if (next === quote && !escaped) { + end = true; + break; + } + if (next === '$' && !escaped && quote !== '\'') { + escaped = true; + stream.backUp(1); + state.tokens.unshift(tokenDollar); + break; + } + escaped = !escaped && next === '\\'; + } + if (end || !escaped) { + state.tokens.shift(); + } + return (quote === '`' || quote === ')' ? 'quote' : 'string'); + }; + }; + + var tokenDollar = function(stream, state) { + if (state.tokens.length > 1) stream.eat('$'); + var ch = stream.next(), hungry = /\w/; + if (ch === '{') hungry = /[^}]/; + if (ch === '(') { + state.tokens[0] = tokenString(')'); + return tokenize(stream, state); + } + if (!/\d/.test(ch)) { + stream.eatWhile(hungry); + stream.eat('}'); + } + state.tokens.shift(); + return 'def'; + }; + + function tokenize(stream, state) { + return (state.tokens[0] || tokenBase) (stream, state); + }; + + return { + startState: function() {return {tokens:[]};}, + token: function(stream, state) { + if (stream.eatSpace()) return null; + return tokenize(stream, state); + } + }; +}); + +CodeMirror.defineMIME('text/x-sh', 'shell'); diff --git a/modules/files/views/default/assets/mode/sieve/LICENSE b/modules/files/views/default/assets/mode/sieve/LICENSE new file mode 100755 index 0000000..8a74612 --- /dev/null +++ b/modules/files/views/default/assets/mode/sieve/LICENSE @@ -0,0 +1,19 @@ +Copyright (C) 2012 Thomas Schmid + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/modules/files/views/default/assets/mode/sieve/index.html b/modules/files/views/default/assets/mode/sieve/index.html new file mode 100755 index 0000000..8b54981 --- /dev/null +++ b/modules/files/views/default/assets/mode/sieve/index.html @@ -0,0 +1,81 @@ + + + + + CodeMirror: Sieve (RFC5228) mode + + + + + + + +

      CodeMirror: Sieve (RFC5228) mode

      +
      + + +

      MIME types defined: application/sieve.

      + + + diff --git a/modules/files/views/default/assets/mode/sieve/sieve.js b/modules/files/views/default/assets/mode/sieve/sieve.js new file mode 100755 index 0000000..8ca2a4c --- /dev/null +++ b/modules/files/views/default/assets/mode/sieve/sieve.js @@ -0,0 +1,183 @@ +/* + * See LICENSE in this directory for the license under which this code + * is released. + */ + +CodeMirror.defineMode("sieve", function(config) { + function words(str) { + var obj = {}, words = str.split(" "); + for (var i = 0; i < words.length; ++i) obj[words[i]] = true; + return obj; + } + + var keywords = words("if elsif else stop require"); + var atoms = words("true false not"); + var indentUnit = config.indentUnit; + + function tokenBase(stream, state) { + + var ch = stream.next(); + if (ch == "/" && stream.eat("*")) { + state.tokenize = tokenCComment; + return tokenCComment(stream, state); + } + + if (ch === '#') { + stream.skipToEnd(); + return "comment"; + } + + if (ch == "\"") { + state.tokenize = tokenString(ch); + return state.tokenize(stream, state); + } + + if (ch == "(") { + state._indent.push("("); + // add virtual angel wings so that editor behaves... + // ...more sane incase of broken brackets + state._indent.push("{"); + return null; + } + + if (ch === "{") { + state._indent.push("{"); + return null; + } + + if (ch == ")") { + state._indent.pop(); + state._indent.pop(); + } + + if (ch === "}") { + state._indent.pop(); + return null; + } + + if (ch == ",") + return null; + + if (ch == ";") + return null; + + + if (/[{}\(\),;]/.test(ch)) + return null; + + // 1*DIGIT "K" / "M" / "G" + if (/\d/.test(ch)) { + stream.eatWhile(/[\d]/); + stream.eat(/[KkMmGg]/); + return "number"; + } + + // ":" (ALPHA / "_") *(ALPHA / DIGIT / "_") + if (ch == ":") { + stream.eatWhile(/[a-zA-Z_]/); + stream.eatWhile(/[a-zA-Z0-9_]/); + + return "operator"; + } + + stream.eatWhile(/\w/); + var cur = stream.current(); + + // "text:" *(SP / HTAB) (hash-comment / CRLF) + // *(multiline-literal / multiline-dotstart) + // "." CRLF + if ((cur == "text") && stream.eat(":")) + { + state.tokenize = tokenMultiLineString; + return "string"; + } + + if (keywords.propertyIsEnumerable(cur)) + return "keyword"; + + if (atoms.propertyIsEnumerable(cur)) + return "atom"; + + return null; + } + + function tokenMultiLineString(stream, state) + { + state._multiLineString = true; + // the first line is special it may contain a comment + if (!stream.sol()) { + stream.eatSpace(); + + if (stream.peek() == "#") { + stream.skipToEnd(); + return "comment"; + } + + stream.skipToEnd(); + return "string"; + } + + if ((stream.next() == ".") && (stream.eol())) + { + state._multiLineString = false; + state.tokenize = tokenBase; + } + + return "string"; + } + + function tokenCComment(stream, state) { + var maybeEnd = false, ch; + while ((ch = stream.next()) != null) { + if (maybeEnd && ch == "/") { + state.tokenize = tokenBase; + break; + } + maybeEnd = (ch == "*"); + } + return "comment"; + } + + function tokenString(quote) { + return function(stream, state) { + var escaped = false, ch; + while ((ch = stream.next()) != null) { + if (ch == quote && !escaped) + break; + escaped = !escaped && ch == "\\"; + } + if (!escaped) state.tokenize = tokenBase; + return "string"; + }; + } + + return { + startState: function(base) { + return {tokenize: tokenBase, + baseIndent: base || 0, + _indent: []}; + }, + + token: function(stream, state) { + if (stream.eatSpace()) + return null; + + return (state.tokenize || tokenBase)(stream, state);; + }, + + indent: function(state, _textAfter) { + var length = state._indent.length; + if (_textAfter && (_textAfter[0] == "}")) + length--; + + if (length <0) + length = 0; + + return length * indentUnit; + }, + + electricChars: "}" + }; +}); + +CodeMirror.defineMIME("application/sieve", "sieve"); diff --git a/modules/files/views/default/assets/mode/smalltalk/index.html b/modules/files/views/default/assets/mode/smalltalk/index.html new file mode 100755 index 0000000..b7aebdb --- /dev/null +++ b/modules/files/views/default/assets/mode/smalltalk/index.html @@ -0,0 +1,57 @@ + + + + + CodeMirror: Smalltalk mode + + + + + + + + +

      CodeMirror: Smalltalk mode

      + +
      + + + +

      Simple Smalltalk mode.

      + +

      MIME types defined: text/x-stsrc.

      + + diff --git a/modules/files/views/default/assets/mode/smalltalk/smalltalk.js b/modules/files/views/default/assets/mode/smalltalk/smalltalk.js new file mode 100755 index 0000000..f8c9026 --- /dev/null +++ b/modules/files/views/default/assets/mode/smalltalk/smalltalk.js @@ -0,0 +1,139 @@ +CodeMirror.defineMode('smalltalk', function(config) { + + var specialChars = /[+\-\/\\*~<>=@%|&?!.:;^]/; + var keywords = /true|false|nil|self|super|thisContext/; + + var Context = function(tokenizer, parent) { + this.next = tokenizer; + this.parent = parent; + }; + + var Token = function(name, context, eos) { + this.name = name; + this.context = context; + this.eos = eos; + }; + + var State = function() { + this.context = new Context(next, null); + this.expectVariable = true; + this.indentation = 0; + this.userIndentationDelta = 0; + }; + + State.prototype.userIndent = function(indentation) { + this.userIndentationDelta = indentation > 0 ? (indentation / config.indentUnit - this.indentation) : 0; + }; + + var next = function(stream, context, state) { + var token = new Token(null, context, false); + var aChar = stream.next(); + + if (aChar === '"') { + token = nextComment(stream, new Context(nextComment, context)); + + } else if (aChar === '\'') { + token = nextString(stream, new Context(nextString, context)); + + } else if (aChar === '#') { + stream.eatWhile(/[^ .]/); + token.name = 'string-2'; + + } else if (aChar === '$') { + stream.eatWhile(/[^ ]/); + token.name = 'string-2'; + + } else if (aChar === '|' && state.expectVariable) { + token.context = new Context(nextTemporaries, context); + + } else if (/[\[\]{}()]/.test(aChar)) { + token.name = 'bracket'; + token.eos = /[\[{(]/.test(aChar); + + if (aChar === '[') { + state.indentation++; + } else if (aChar === ']') { + state.indentation = Math.max(0, state.indentation - 1); + } + + } else if (specialChars.test(aChar)) { + stream.eatWhile(specialChars); + token.name = 'operator'; + token.eos = aChar !== ';'; // ; cascaded message expression + + } else if (/\d/.test(aChar)) { + stream.eatWhile(/[\w\d]/); + token.name = 'number'; + + } else if (/[\w_]/.test(aChar)) { + stream.eatWhile(/[\w\d_]/); + token.name = state.expectVariable ? (keywords.test(stream.current()) ? 'keyword' : 'variable') : null; + + } else { + token.eos = state.expectVariable; + } + + return token; + }; + + var nextComment = function(stream, context) { + stream.eatWhile(/[^"]/); + return new Token('comment', stream.eat('"') ? context.parent : context, true); + }; + + var nextString = function(stream, context) { + stream.eatWhile(/[^']/); + return new Token('string', stream.eat('\'') ? context.parent : context, false); + }; + + var nextTemporaries = function(stream, context) { + var token = new Token(null, context, false); + var aChar = stream.next(); + + if (aChar === '|') { + token.context = context.parent; + token.eos = true; + + } else { + stream.eatWhile(/[^|]/); + token.name = 'variable'; + } + + return token; + }; + + return { + startState: function() { + return new State; + }, + + token: function(stream, state) { + state.userIndent(stream.indentation()); + + if (stream.eatSpace()) { + return null; + } + + var token = state.context.next(stream, state.context, state); + state.context = token.context; + state.expectVariable = token.eos; + + state.lastToken = token; + return token.name; + }, + + blankLine: function(state) { + state.userIndent(0); + }, + + indent: function(state, textAfter) { + var i = state.context.next === next && textAfter && textAfter.charAt(0) === ']' ? -1 : state.userIndentationDelta; + return (state.indentation + i) * config.indentUnit; + }, + + electricChars: ']' + }; + +}); + +CodeMirror.defineMIME('text/x-stsrc', {name: 'smalltalk'}); diff --git a/modules/files/views/default/assets/mode/smarty/index.html b/modules/files/views/default/assets/mode/smarty/index.html new file mode 100755 index 0000000..6b7debe --- /dev/null +++ b/modules/files/views/default/assets/mode/smarty/index.html @@ -0,0 +1,83 @@ + + + + + CodeMirror: Smarty mode + + + + + + + +

      CodeMirror: Smarty mode

      + +
      + + + +
      + +
      + + + +

      A plain text/Smarty mode which allows for custom delimiter tags (defaults to { and }).

      + +

      MIME types defined: text/x-smarty

      + + diff --git a/modules/files/views/default/assets/mode/smarty/smarty.js b/modules/files/views/default/assets/mode/smarty/smarty.js new file mode 100755 index 0000000..7d7e62f --- /dev/null +++ b/modules/files/views/default/assets/mode/smarty/smarty.js @@ -0,0 +1,148 @@ +CodeMirror.defineMode("smarty", function(config) { + var keyFuncs = ["debug", "extends", "function", "include", "literal"]; + var last; + var regs = { + operatorChars: /[+\-*&%=<>!?]/, + validIdentifier: /[a-zA-Z0-9\_]/, + stringChar: /[\'\"]/ + }; + var leftDelim = (typeof config.mode.leftDelimiter != 'undefined') ? config.mode.leftDelimiter : "{"; + var rightDelim = (typeof config.mode.rightDelimiter != 'undefined') ? config.mode.rightDelimiter : "}"; + function ret(style, lst) { last = lst; return style; } + + + function tokenizer(stream, state) { + function chain(parser) { + state.tokenize = parser; + return parser(stream, state); + } + + if (stream.match(leftDelim, true)) { + if (stream.eat("*")) { + return chain(inBlock("comment", "*" + rightDelim)); + } + else { + state.tokenize = inSmarty; + return "tag"; + } + } + else { + // I'd like to do an eatWhile() here, but I can't get it to eat only up to the rightDelim string/char + stream.next(); + return null; + } + } + + function inSmarty(stream, state) { + if (stream.match(rightDelim, true)) { + state.tokenize = tokenizer; + return ret("tag", null); + } + + var ch = stream.next(); + if (ch == "$") { + stream.eatWhile(regs.validIdentifier); + return ret("variable-2", "variable"); + } + else if (ch == ".") { + return ret("operator", "property"); + } + else if (regs.stringChar.test(ch)) { + state.tokenize = inAttribute(ch); + return ret("string", "string"); + } + else if (regs.operatorChars.test(ch)) { + stream.eatWhile(regs.operatorChars); + return ret("operator", "operator"); + } + else if (ch == "[" || ch == "]") { + return ret("bracket", "bracket"); + } + else if (/\d/.test(ch)) { + stream.eatWhile(/\d/); + return ret("number", "number"); + } + else { + if (state.last == "variable") { + if (ch == "@") { + stream.eatWhile(regs.validIdentifier); + return ret("property", "property"); + } + else if (ch == "|") { + stream.eatWhile(regs.validIdentifier); + return ret("qualifier", "modifier"); + } + } + else if (state.last == "whitespace") { + stream.eatWhile(regs.validIdentifier); + return ret("attribute", "modifier"); + } + else if (state.last == "property") { + stream.eatWhile(regs.validIdentifier); + return ret("property", null); + } + else if (/\s/.test(ch)) { + last = "whitespace"; + return null; + } + + var str = ""; + if (ch != "/") { + str += ch; + } + var c = ""; + while ((c = stream.eat(regs.validIdentifier))) { + str += c; + } + var i, j; + for (i=0, j=keyFuncs.length; i + + + + CodeMirror: SPARQL mode + + + + + + + + +

      CodeMirror: SPARQL mode

      +
      + + +

      MIME types defined: application/x-sparql-query.

      + + + diff --git a/modules/files/views/default/assets/mode/sparql/sparql.js b/modules/files/views/default/assets/mode/sparql/sparql.js new file mode 100755 index 0000000..f723769 --- /dev/null +++ b/modules/files/views/default/assets/mode/sparql/sparql.js @@ -0,0 +1,143 @@ +CodeMirror.defineMode("sparql", function(config) { + var indentUnit = config.indentUnit; + var curPunc; + + function wordRegexp(words) { + return new RegExp("^(?:" + words.join("|") + ")$", "i"); + } + var ops = wordRegexp(["str", "lang", "langmatches", "datatype", "bound", "sameterm", "isiri", "isuri", + "isblank", "isliteral", "union", "a"]); + var keywords = wordRegexp(["base", "prefix", "select", "distinct", "reduced", "construct", "describe", + "ask", "from", "named", "where", "order", "limit", "offset", "filter", "optional", + "graph", "by", "asc", "desc"]); + var operatorChars = /[*+\-<>=&|]/; + + function tokenBase(stream, state) { + var ch = stream.next(); + curPunc = null; + if (ch == "$" || ch == "?") { + stream.match(/^[\w\d]*/); + return "variable-2"; + } + else if (ch == "<" && !stream.match(/^[\s\u00a0=]/, false)) { + stream.match(/^[^\s\u00a0>]*>?/); + return "atom"; + } + else if (ch == "\"" || ch == "'") { + state.tokenize = tokenLiteral(ch); + return state.tokenize(stream, state); + } + else if (/[{}\(\),\.;\[\]]/.test(ch)) { + curPunc = ch; + return null; + } + else if (ch == "#") { + stream.skipToEnd(); + return "comment"; + } + else if (operatorChars.test(ch)) { + stream.eatWhile(operatorChars); + return null; + } + else if (ch == ":") { + stream.eatWhile(/[\w\d\._\-]/); + return "atom"; + } + else { + stream.eatWhile(/[_\w\d]/); + if (stream.eat(":")) { + stream.eatWhile(/[\w\d_\-]/); + return "atom"; + } + var word = stream.current(); + if (ops.test(word)) + return null; + else if (keywords.test(word)) + return "keyword"; + else + return "variable"; + } + } + + function tokenLiteral(quote) { + return function(stream, state) { + var escaped = false, ch; + while ((ch = stream.next()) != null) { + if (ch == quote && !escaped) { + state.tokenize = tokenBase; + break; + } + escaped = !escaped && ch == "\\"; + } + return "string"; + }; + } + + function pushContext(state, type, col) { + state.context = {prev: state.context, indent: state.indent, col: col, type: type}; + } + function popContext(state) { + state.indent = state.context.indent; + state.context = state.context.prev; + } + + return { + startState: function() { + return {tokenize: tokenBase, + context: null, + indent: 0, + col: 0}; + }, + + token: function(stream, state) { + if (stream.sol()) { + if (state.context && state.context.align == null) state.context.align = false; + state.indent = stream.indentation(); + } + if (stream.eatSpace()) return null; + var style = state.tokenize(stream, state); + + if (style != "comment" && state.context && state.context.align == null && state.context.type != "pattern") { + state.context.align = true; + } + + if (curPunc == "(") pushContext(state, ")", stream.column()); + else if (curPunc == "[") pushContext(state, "]", stream.column()); + else if (curPunc == "{") pushContext(state, "}", stream.column()); + else if (/[\]\}\)]/.test(curPunc)) { + while (state.context && state.context.type == "pattern") popContext(state); + if (state.context && curPunc == state.context.type) popContext(state); + } + else if (curPunc == "." && state.context && state.context.type == "pattern") popContext(state); + else if (/atom|string|variable/.test(style) && state.context) { + if (/[\}\]]/.test(state.context.type)) + pushContext(state, "pattern", stream.column()); + else if (state.context.type == "pattern" && !state.context.align) { + state.context.align = true; + state.context.col = stream.column(); + } + } + + return style; + }, + + indent: function(state, textAfter) { + var firstChar = textAfter && textAfter.charAt(0); + var context = state.context; + if (/[\]\}]/.test(firstChar)) + while (context && context.type == "pattern") context = context.prev; + + var closing = context && firstChar == context.type; + if (!context) + return 0; + else if (context.type == "pattern") + return context.col; + else if (context.align) + return context.col + (closing ? 0 : 1); + else + return context.indent + (closing ? 0 : indentUnit); + } + }; +}); + +CodeMirror.defineMIME("application/x-sparql-query", "sparql"); diff --git a/modules/files/views/default/assets/mode/sql/index.html b/modules/files/views/default/assets/mode/sql/index.html new file mode 100755 index 0000000..7ec938a --- /dev/null +++ b/modules/files/views/default/assets/mode/sql/index.html @@ -0,0 +1,68 @@ + + + + + SQL Mode for CodeMirror + + + + + + + + + + +

      SQL Mode for CodeMirror

      +
      + + +

      MIME types defined: + text/x-sql, + text/x-mysql, + text/x-mariadb, + text/x-plsql. +

      +

      + Tests: + normal, + verbose. +

      + + diff --git a/modules/files/views/default/assets/mode/sql/sql.js b/modules/files/views/default/assets/mode/sql/sql.js new file mode 100755 index 0000000..4ff847f --- /dev/null +++ b/modules/files/views/default/assets/mode/sql/sql.js @@ -0,0 +1,268 @@ +CodeMirror.defineMode("sql", function(config, parserConfig) { + "use strict"; + + var client = parserConfig.client || {}, + atoms = parserConfig.atoms || {"false": true, "true": true, "null": true}, + builtin = parserConfig.builtin || {}, + keywords = parserConfig.keywords || {}, + operatorChars = parserConfig.operatorChars || /^[*+\-%<>!=&|~^]/, + support = parserConfig.support || {}, + hooks = parserConfig.hooks || {}, + dateSQL = parserConfig.dateSQL || {"date" : true, "time" : true, "timestamp" : true}; + + function tokenBase(stream, state) { + var ch = stream.next(); + + // call hooks from the mime type + if (hooks[ch]) { + var result = hooks[ch](stream, state); + if (result !== false) return result; + } + + if ((ch == "0" && stream.match(/^[xX][0-9a-fA-F]+/)) + || (ch == "x" || ch == "X") && stream.match(/^'[0-9a-fA-F]+'/)) { + // hex + return "number"; + } else if (((ch == "b" || ch == "B") && stream.match(/^'[01]+'/)) + || (ch == "0" && stream.match(/^b[01]+/))) { + // bitstring + return "number"; + } else if (ch.charCodeAt(0) > 47 && ch.charCodeAt(0) < 58) { + // numbers + stream.match(/^[0-9]*\.?[0-9]+([eE][-+]?[0-9]+)?/); + return "number"; + } else if (ch == "?" && (stream.eatSpace() || stream.eol() || stream.eat(";"))) { + // placeholders + return "variable-3"; + } else if (ch == '"' || ch == "'") { + // strings + state.tokenize = tokenLiteral(ch); + return state.tokenize(stream, state); + } else if (/^[\(\),\;\[\]]/.test(ch)) { + // no highlightning + return null; + } else if (ch == "#" || (ch == "-" && stream.eat("-") && stream.eat(" "))) { + // 1-line comments + stream.skipToEnd(); + return "comment"; + } else if (ch == "/" && stream.eat("*")) { + // multi-line comments + state.tokenize = tokenComment; + return state.tokenize(stream, state); + } else if (ch == ".") { + // .1 for 0.1 + if (stream.match(/^[0-9eE]+/) && support.zerolessFloat == true) { + return "number"; + } + // .table_name (ODBC) + if (stream.match(/^[a-zA-Z_]+/) && support.ODBCdotTable == true) { + return "variable-2"; + } + } else if (operatorChars.test(ch)) { + // operators + stream.eatWhile(operatorChars); + return null; + } else if (ch == '{' && + (stream.match(/^( )*(d|D|t|T|ts|TS)( )*'[^']*'( )*}/) || stream.match(/^( )*(d|D|t|T|ts|TS)( )*"[^"]*"( )*}/))) { + // dates (weird ODBC syntax) + return "number"; + } else { + stream.eatWhile(/^[_\w\d]/); + var word = stream.current().toLowerCase(); + // dates (standard SQL syntax) + if (dateSQL.hasOwnProperty(word) && (stream.match(/^( )+'[^']*'/) || stream.match(/^( )+"[^"]*"/))) + return "number"; + if (atoms.hasOwnProperty(word)) return "atom"; + if (builtin.hasOwnProperty(word)) return "builtin"; + if (keywords.hasOwnProperty(word)) return "keyword"; + if (client.hasOwnProperty(word)) return "string-2"; + return null; + } + } + + // 'string', with char specified in quote escaped by '\' + function tokenLiteral(quote) { + return function(stream, state) { + var escaped = false, ch; + while ((ch = stream.next()) != null) { + if (ch == quote && !escaped) { + state.tokenize = tokenBase; + break; + } + escaped = !escaped && ch == "\\"; + } + return "string"; + }; + } + function tokenComment(stream, state) { + while (true) { + if (stream.skipTo("*")) { + stream.next(); + if (stream.eat("/")) { + state.tokenize = tokenBase; + break; + } + } else { + stream.skipToEnd(); + break; + } + } + return "comment"; + } + + function pushContext(stream, state, type) { + state.context = { + prev: state.context, + indent: stream.indentation(), + col: stream.column(), + type: type + }; + } + + function popContext(state) { + state.indent = state.context.indent; + state.context = state.context.prev; + } + + return { + startState: function() { + return {tokenize: tokenBase, context: null}; + }, + + token: function(stream, state) { + if (stream.sol()) { + if (state.context && state.context.align == null) + state.context.align = false; + } + if (stream.eatSpace()) return null; + + var style = state.tokenize(stream, state); + if (style == "comment") return style; + + if (state.context && state.context.align == null) + state.context.align = true; + + var tok = stream.current(); + if (tok == "(") + pushContext(stream, state, ")"); + else if (tok == "[") + pushContext(stream, state, "]"); + else if (state.context && state.context.type == tok) + popContext(state); + return style; + }, + + indent: function(state, textAfter) { + var cx = state.context; + if (!cx) return CodeMirror.Pass; + if (cx.align) return cx.col + (textAfter.charAt(0) == cx.type ? 0 : 1); + else return cx.indent + config.indentUnit; + } + }; +}); + +(function() { + "use strict"; + + // `identifier` + function hookIdentifier(stream) { + var escaped = false, ch; + while ((ch = stream.next()) != null) { + if (ch == "`" && !escaped) return "variable-2"; + escaped = !escaped && ch == "`"; + } + return null; + } + + // variable token + function hookVar(stream) { + // variables + // @@ and prefix + if (stream.eat("@")) { + stream.match(/^session\./); + stream.match(/^local\./); + stream.match(/^global\./); + } + + if (stream.eat("'")) { + stream.match(/^.*'/); + return "variable-2"; + } else if (stream.eat('"')) { + stream.match(/^.*"/); + return "variable-2"; + } else if (stream.eat("`")) { + stream.match(/^.*`/); + return "variable-2"; + } else if (stream.match(/^[0-9a-zA-Z$\.\_]+/)) { + return "variable-2"; + } + return null; + }; + + // short client keyword token + function hookClient(stream) { + // \g, etc + return stream.match(/^[a-zA-Z]\b/) ? "variable-2" : null; + } + + var sqlKeywords = "alter and as asc between by count create delete desc distinct drop from having in insert into is join like not on or order select set table union update values where "; + + function set(str) { + var obj = {}, words = str.split(" "); + for (var i = 0; i < words.length; ++i) obj[words[i]] = true; + return obj; + } + + CodeMirror.defineMIME("text/x-sql", { + name: "sql", + keywords: set(sqlKeywords + "begin"), + builtin: set("bool boolean bit blob enum long longblob longtext medium mediumblob mediumint mediumtext time timestamp tinyblob tinyint tinytext text bigint int int1 int2 int3 int4 int8 integer float float4 float8 double char varbinary varchar varcharacter precision real date datetime year unsigned signed decimal numeric"), + atoms: set("false true null unknown"), + operatorChars: /^[*+\-%<>!=]/, + dateSQL: set("date time timestamp"), + support: set("ODBCdotTable") + }); + + CodeMirror.defineMIME("text/x-mysql", { + name: "sql", + client: set("charset clear connect edit ego exit go help nopager notee nowarning pager print prompt quit rehash source status system tee"), + keywords: set(sqlKeywords + "accessible action add after algorithm all analyze asensitive at authors auto_increment autocommit avg avg_row_length before binary binlog both btree cache call cascade cascaded case catalog_name chain change changed character check checkpoint checksum class_origin client_statistics close coalesce code collate collation collations column columns comment commit committed completion concurrent condition connection consistent constraint contains continue contributors convert cross current_date current_time current_timestamp current_user cursor data database databases day_hour day_microsecond day_minute day_second deallocate dec declare default delay_key_write delayed delimiter des_key_file describe deterministic dev_pop dev_samp deviance directory disable discard distinctrow div dual dumpfile each elseif enable enclosed end ends engine engines enum errors escape escaped even event events every execute exists exit explain extended fast fetch field fields first flush for force foreign found_rows full fulltext function general global grant grants group groupby_concat handler hash help high_priority hosts hour_microsecond hour_minute hour_second if ignore ignore_server_ids import index index_statistics infile inner innodb inout insensitive insert_method install interval invoker isolation iterate key keys kill language last leading leave left level limit linear lines list load local localtime localtimestamp lock logs low_priority master master_heartbeat_period master_ssl_verify_server_cert masters match max max_rows maxvalue message_text middleint migrate min min_rows minute_microsecond minute_second mod mode modifies modify mutex mysql_errno natural next no no_write_to_binlog offline offset one online open optimize option optionally out outer outfile pack_keys parser partition partitions password phase plugin plugins prepare preserve prev primary privileges procedure processlist profile profiles purge query quick range read read_write reads real rebuild recover references regexp relaylog release remove rename reorganize repair repeatable replace require resignal restrict resume return returns revoke right rlike rollback rollup row row_format rtree savepoint schedule schema schema_name schemas second_microsecond security sensitive separator serializable server session share show signal slave slow smallint snapshot soname spatial specific sql sql_big_result sql_buffer_result sql_cache sql_calc_found_rows sql_no_cache sql_small_result sqlexception sqlstate sqlwarning ssl start starting starts status std stddev stddev_pop stddev_samp storage straight_join subclass_origin sum suspend table_name table_statistics tables tablespace temporary terminated to trailing transaction trigger triggers truncate uncommitted undo uninstall unique unlock upgrade usage use use_frm user user_resources user_statistics using utc_date utc_time utc_timestamp value variables varying view views warnings when while with work write xa xor year_month zerofill begin do then else loop repeat"), + builtin: set("bool boolean bit blob decimal double enum float long longblob longtext medium mediumblob mediumint mediumtext time timestamp tinyblob tinyint tinytext text bigint int int1 int2 int3 int4 int8 integer float float4 float8 double char varbinary varchar varcharacter precision date datetime year unsigned signed numeric"), + atoms: set("false true null unknown"), + operatorChars: /^[*+\-%<>!=&|^]/, + dateSQL: set("date time timestamp"), + support: set("ODBCdotTable zerolessFloat"), + hooks: { + "@": hookVar, + "`": hookIdentifier, + "\\": hookClient + } + }); + + CodeMirror.defineMIME("text/x-mariadb", { + name: "sql", + client: set("charset clear connect edit ego exit go help nopager notee nowarning pager print prompt quit rehash source status system tee"), + keywords: set(sqlKeywords + "accessible action add after algorithm all always analyze asensitive at authors auto_increment autocommit avg avg_row_length before binary binlog both btree cache call cascade cascaded case catalog_name chain change changed character check checkpoint checksum class_origin client_statistics close coalesce code collate collation collations column columns comment commit committed completion concurrent condition connection consistent constraint contains continue contributors convert cross current_date current_time current_timestamp current_user cursor data database databases day_hour day_microsecond day_minute day_second deallocate dec declare default delay_key_write delayed delimiter des_key_file describe deterministic dev_pop dev_samp deviance directory disable discard distinctrow div dual dumpfile each elseif enable enclosed end ends engine engines enum errors escape escaped even event events every execute exists exit explain extended fast fetch field fields first flush for force foreign found_rows full fulltext function general generated global grant grants group groupby_concat handler hard hash help high_priority hosts hour_microsecond hour_minute hour_second if ignore ignore_server_ids import index index_statistics infile inner innodb inout insensitive insert_method install interval invoker isolation iterate key keys kill language last leading leave left level limit linear lines list load local localtime localtimestamp lock logs low_priority master master_heartbeat_period master_ssl_verify_server_cert masters match max max_rows maxvalue message_text middleint migrate min min_rows minute_microsecond minute_second mod mode modifies modify mutex mysql_errno natural next no no_write_to_binlog offline offset one online open optimize option optionally out outer outfile pack_keys parser partition partitions password persistent phase plugin plugins prepare preserve prev primary privileges procedure processlist profile profiles purge query quick range read read_write reads real rebuild recover references regexp relaylog release remove rename reorganize repair repeatable replace require resignal restrict resume return returns revoke right rlike rollback rollup row row_format rtree savepoint schedule schema schema_name schemas second_microsecond security sensitive separator serializable server session share show signal slave slow smallint snapshot soft soname spatial specific sql sql_big_result sql_buffer_result sql_cache sql_calc_found_rows sql_no_cache sql_small_result sqlexception sqlstate sqlwarning ssl start starting starts status std stddev stddev_pop stddev_samp storage straight_join subclass_origin sum suspend table_name table_statistics tables tablespace temporary terminated to trailing transaction trigger triggers truncate uncommitted undo uninstall unique unlock upgrade usage use use_frm user user_resources user_statistics using utc_date utc_time utc_timestamp value variables varying view views virtual warnings when while with work write xa xor year_month zerofill begin do then else loop repeat"), + builtin: set("bool boolean bit blob decimal double enum float long longblob longtext medium mediumblob mediumint mediumtext time timestamp tinyblob tinyint tinytext text bigint int int1 int2 int3 int4 int8 integer float float4 float8 double char varbinary varchar varcharacter precision date datetime year unsigned signed numeric"), + atoms: set("false true null unknown"), + operatorChars: /^[*+\-%<>!=&|^]/, + dateSQL: set("date time timestamp"), + support: set("ODBCdotTable zerolessFloat"), + hooks: { + "@": hookVar, + "`": hookIdentifier, + "\\": hookClient + } + }); + + // this is based on Peter Raganitsch's 'plsql' mode + CodeMirror.defineMIME("text/x-plsql", { + name: "sql", + client: set("appinfo arraysize autocommit autoprint autorecovery autotrace blockterminator break btitle cmdsep colsep compatibility compute concat copycommit copytypecheck define describe echo editfile embedded escape exec execute feedback flagger flush heading headsep instance linesize lno loboffset logsource long longchunksize markup native newpage numformat numwidth pagesize pause pno recsep recsepchar release repfooter repheader serveroutput shiftinout show showmode size spool sqlblanklines sqlcase sqlcode sqlcontinue sqlnumber sqlpluscompatibility sqlprefix sqlprompt sqlterminator suffix tab term termout time timing trimout trimspool ttitle underline verify version wrap"), + keywords: set("abort accept access add all alter and any array arraylen as asc assert assign at attributes audit authorization avg base_table begin between binary_integer body boolean by case cast char char_base check close cluster clusters colauth column comment commit compress connect connected constant constraint crash create current currval cursor data_base database date dba deallocate debugoff debugon decimal declare default definition delay delete desc digits dispose distinct do drop else elsif enable end entry escape exception exception_init exchange exclusive exists exit external fast fetch file for force form from function generic goto grant group having identified if immediate in increment index indexes indicator initial initrans insert interface intersect into is key level library like limited local lock log logging long loop master maxextents maxtrans member minextents minus mislabel mode modify multiset new next no noaudit nocompress nologging noparallel not nowait number_base object of off offline on online only open option or order out package parallel partition pctfree pctincrease pctused pls_integer positive positiven pragma primary prior private privileges procedure public raise range raw read rebuild record ref references refresh release rename replace resource restrict return returning reverse revoke rollback row rowid rowlabel rownum rows run savepoint schema segment select separate session set share snapshot some space split sql start statement storage subtype successful synonym tabauth table tables tablespace task terminate then to trigger truncate type union unique unlimited unrecoverable unusable update use using validate value values variable view views when whenever where while with work"), + functions: set("abs acos add_months ascii asin atan atan2 average bfilename ceil chartorowid chr concat convert cos cosh count decode deref dual dump dup_val_on_index empty error exp false floor found glb greatest hextoraw initcap instr instrb isopen last_day least lenght lenghtb ln lower lpad ltrim lub make_ref max min mod months_between new_time next_day nextval nls_charset_decl_len nls_charset_id nls_charset_name nls_initcap nls_lower nls_sort nls_upper nlssort no_data_found notfound null nvl others power rawtohex reftohex round rowcount rowidtochar rpad rtrim sign sin sinh soundex sqlcode sqlerrm sqrt stddev substr substrb sum sysdate tan tanh to_char to_date to_label to_multi_byte to_number to_single_byte translate true trunc uid upper user userenv variance vsize"), + builtin: set("bfile blob character clob dec float int integer mlslabel natural naturaln nchar nclob number numeric nvarchar2 real rowtype signtype smallint string varchar varchar2"), + operatorChars: /^[*+\-%<>!=~]/, + dateSQL: set("date time timestamp") + }); +}()); diff --git a/modules/files/views/default/assets/mode/stex/index.html b/modules/files/views/default/assets/mode/stex/index.html new file mode 100755 index 0000000..2dafe69 --- /dev/null +++ b/modules/files/views/default/assets/mode/stex/index.html @@ -0,0 +1,98 @@ + + + + + CodeMirror: sTeX mode + + + + + + + +

      CodeMirror: sTeX mode

      +
      + + +

      MIME types defined: text/x-stex.

      + +

      Parsing/Highlighting Tests: normal, verbose.

      + + + diff --git a/modules/files/views/default/assets/mode/stex/stex.js b/modules/files/views/default/assets/mode/stex/stex.js new file mode 100755 index 0000000..318b63a --- /dev/null +++ b/modules/files/views/default/assets/mode/stex/stex.js @@ -0,0 +1,246 @@ +/* + * Author: Constantin Jucovschi (c.jucovschi@jacobs-university.de) + * Licence: MIT + */ + +CodeMirror.defineMode("stex", function() { + "use strict"; + + function pushCommand(state, command) { + state.cmdState.push(command); + } + + function peekCommand(state) { + if (state.cmdState.length > 0) { + return state.cmdState[state.cmdState.length - 1]; + } else { + return null; + } + } + + function popCommand(state) { + var plug = state.cmdState.pop(); + if (plug) { + plug.closeBracket(); + } + } + + // returns the non-default plugin closest to the end of the list + function getMostPowerful(state) { + var context = state.cmdState; + for (var i = context.length - 1; i >= 0; i--) { + var plug = context[i]; + if (plug.name == "DEFAULT") { + continue; + } + return plug; + } + return { styleIdentifier: function() { return null; } }; + } + + function addPluginPattern(pluginName, cmdStyle, styles) { + return function () { + this.name = pluginName; + this.bracketNo = 0; + this.style = cmdStyle; + this.styles = styles; + this.argument = null; // \begin and \end have arguments that follow. These are stored in the plugin + + this.styleIdentifier = function() { + return this.styles[this.bracketNo - 1] || null; + }; + this.openBracket = function() { + this.bracketNo++; + return "bracket"; + }; + this.closeBracket = function() {}; + }; + } + + var plugins = {}; + + plugins["importmodule"] = addPluginPattern("importmodule", "tag", ["string", "builtin"]); + plugins["documentclass"] = addPluginPattern("documentclass", "tag", ["", "atom"]); + plugins["usepackage"] = addPluginPattern("usepackage", "tag", ["atom"]); + plugins["begin"] = addPluginPattern("begin", "tag", ["atom"]); + plugins["end"] = addPluginPattern("end", "tag", ["atom"]); + + plugins["DEFAULT"] = function () { + this.name = "DEFAULT"; + this.style = "tag"; + + this.styleIdentifier = this.openBracket = this.closeBracket = function() {}; + }; + + function setState(state, f) { + state.f = f; + } + + // called when in a normal (no environment) context + function normal(source, state) { + var plug; + // Do we look like '\command' ? If so, attempt to apply the plugin 'command' + if (source.match(/^\\[a-zA-Z@]+/)) { + var cmdName = source.current().slice(1); + plug = plugins[cmdName] || plugins["DEFAULT"]; + plug = new plug(); + pushCommand(state, plug); + setState(state, beginParams); + return plug.style; + } + + // escape characters + if (source.match(/^\\[$&%#{}_]/)) { + return "tag"; + } + + // white space control characters + if (source.match(/^\\[,;!\/]/)) { + return "tag"; + } + + // find if we're starting various math modes + if (source.match("\\[")) { + setState(state, function(source, state){ return inMathMode(source, state, "\\]"); }); + return "keyword"; + } + if (source.match("$$")) { + setState(state, function(source, state){ return inMathMode(source, state, "$$"); }); + return "keyword"; + } + if (source.match("$")) { + setState(state, function(source, state){ return inMathMode(source, state, "$"); }); + return "keyword"; + } + + var ch = source.next(); + if (ch == "%") { + // special case: % at end of its own line; stay in same state + if (!source.eol()) { + setState(state, inCComment); + } + return "comment"; + } + else if (ch == '}' || ch == ']') { + plug = peekCommand(state); + if (plug) { + plug.closeBracket(ch); + setState(state, beginParams); + } else { + return "error"; + } + return "bracket"; + } else if (ch == '{' || ch == '[') { + plug = plugins["DEFAULT"]; + plug = new plug(); + pushCommand(state, plug); + return "bracket"; + } + else if (/\d/.test(ch)) { + source.eatWhile(/[\w.%]/); + return "atom"; + } + else { + source.eatWhile(/[\w\-_]/); + plug = getMostPowerful(state); + if (plug.name == 'begin') { + plug.argument = source.current(); + } + return plug.styleIdentifier(); + } + } + + function inCComment(source, state) { + source.skipToEnd(); + setState(state, normal); + return "comment"; + } + + function inMathMode(source, state, endModeSeq) { + if (source.eatSpace()) { + return null; + } + if (source.match(endModeSeq)) { + setState(state, normal); + return "keyword"; + } + if (source.match(/^\\[a-zA-Z@]+/)) { + return "tag"; + } + if (source.match(/^[a-zA-Z]+/)) { + return "variable-2"; + } + // escape characters + if (source.match(/^\\[$&%#{}_]/)) { + return "tag"; + } + // white space control characters + if (source.match(/^\\[,;!\/]/)) { + return "tag"; + } + // special math-mode characters + if (source.match(/^[\^_&]/)) { + return "tag"; + } + // non-special characters + if (source.match(/^[+\-<>|=,\/@!*:;'"`~#?]/)) { + return null; + } + if (source.match(/^(\d+\.\d*|\d*\.\d+|\d+)/)) { + return "number"; + } + var ch = source.next(); + if (ch == "{" || ch == "}" || ch == "[" || ch == "]" || ch == "(" || ch == ")") { + return "bracket"; + } + + // eat comments here, because inCComment returns us to normal state! + if (ch == "%") { + if (!source.eol()) { + source.skipToEnd(); + } + return "comment"; + } + return "error"; + } + + function beginParams(source, state) { + var ch = source.peek(), lastPlug; + if (ch == '{' || ch == '[') { + lastPlug = peekCommand(state); + lastPlug.openBracket(ch); + source.eat(ch); + setState(state, normal); + return "bracket"; + } + if (/[ \t\r]/.test(ch)) { + source.eat(ch); + return null; + } + setState(state, normal); + popCommand(state); + + return normal(source, state); + } + + return { + startState: function() { + return { + cmdState: [], + f: normal + }; + }, + copyState: function(s) { + return { + cmdState: s.cmdState.slice(), + f: s.f + }; + }, + token: function(stream, state) { + return state.f(stream, state); + } + }; +}); + +CodeMirror.defineMIME("text/x-stex", "stex"); +CodeMirror.defineMIME("text/x-latex", "stex"); diff --git a/modules/files/views/default/assets/mode/stex/test.js b/modules/files/views/default/assets/mode/stex/test.js new file mode 100755 index 0000000..727a7db --- /dev/null +++ b/modules/files/views/default/assets/mode/stex/test.js @@ -0,0 +1,117 @@ +(function() { + var mode = CodeMirror.getMode({tabSize: 4}, "stex"); + function MT(name) { test.mode(name, mode, Array.prototype.slice.call(arguments, 1)); } + + MT("word", + "foo"); + + MT("twoWords", + "foo bar"); + + MT("beginEndDocument", + "[tag \\begin][bracket {][atom document][bracket }]", + "[tag \\end][bracket {][atom document][bracket }]"); + + MT("beginEndEquation", + "[tag \\begin][bracket {][atom equation][bracket }]", + " E=mc^2", + "[tag \\end][bracket {][atom equation][bracket }]"); + + MT("beginModule", + "[tag \\begin][bracket {][atom module][bracket }[[]]]"); + + MT("beginModuleId", + "[tag \\begin][bracket {][atom module][bracket }[[]id=bbt-size[bracket ]]]"); + + MT("importModule", + "[tag \\importmodule][bracket [[][string b-b-t][bracket ]]{][builtin b-b-t][bracket }]"); + + MT("importModulePath", + "[tag \\importmodule][bracket [[][tag \\KWARCslides][bracket {][string dmath/en/cardinality][bracket }]]{][builtin card][bracket }]"); + + MT("psForPDF", + "[tag \\PSforPDF][bracket [[][atom 1][bracket ]]{]#1[bracket }]"); + + MT("comment", + "[comment % foo]"); + + MT("tagComment", + "[tag \\item][comment % bar]"); + + MT("commentTag", + " [comment % \\item]"); + + MT("commentLineBreak", + "[comment %]", + "foo"); + + MT("tagErrorCurly", + "[tag \\begin][error }][bracket {]"); + + MT("tagErrorSquare", + "[tag \\item][error ]]][bracket {]"); + + MT("commentCurly", + "[comment % }]"); + + MT("tagHash", + "the [tag \\#] key"); + + MT("tagNumber", + "a [tag \\$][atom 5] stetson"); + + MT("tagPercent", + "[atom 100][tag \\%] beef"); + + MT("tagAmpersand", + "L [tag \\&] N"); + + MT("tagUnderscore", + "foo[tag \\_]bar"); + + MT("tagBracketOpen", + "[tag \\emph][bracket {][tag \\{][bracket }]"); + + MT("tagBracketClose", + "[tag \\emph][bracket {][tag \\}][bracket }]"); + + MT("tagLetterNumber", + "section [tag \\S][atom 1]"); + + MT("textTagNumber", + "para [tag \\P][atom 2]"); + + MT("thinspace", + "x[tag \\,]y"); + + MT("thickspace", + "x[tag \\;]y"); + + MT("negativeThinspace", + "x[tag \\!]y"); + + MT("periodNotSentence", + "J.\\ L.\\ is"); + + MT("periodSentence", + "X[tag \\@]. The"); + + MT("italicCorrection", + "[bracket {][tag \\em] If[tag \\/][bracket }] I"); + + MT("tagBracket", + "[tag \\newcommand][bracket {][tag \\pop][bracket }]"); + + MT("inlineMathTagFollowedByNumber", + "[keyword $][tag \\pi][number 2][keyword $]"); + + MT("inlineMath", + "[keyword $][number 3][variable-2 x][tag ^][number 2.45]-[tag \\sqrt][bracket {][tag \\$\\alpha][bracket }] = [number 2][keyword $] other text"); + + MT("displayMath", + "More [keyword $$]\t[variable-2 S][tag ^][variable-2 n][tag \\sum] [variable-2 i][keyword $$] other text"); + + MT("mathWithComment", + "[keyword $][variable-2 x] [comment % $]", + "[variable-2 y][keyword $] other text"); +})(); diff --git a/modules/files/views/default/assets/mode/tcl/index.html b/modules/files/views/default/assets/mode/tcl/index.html new file mode 100755 index 0000000..e2e42a0 --- /dev/null +++ b/modules/files/views/default/assets/mode/tcl/index.html @@ -0,0 +1,129 @@ + + + + + CodeMirror: Tcl mode + + + + + + + +

      CodeMirror: Tcl mode

      +
      + + +

      MIME types defined: text/x-tcl.

      + + + diff --git a/modules/files/views/default/assets/mode/tcl/tcl.js b/modules/files/views/default/assets/mode/tcl/tcl.js new file mode 100755 index 0000000..ed2c697 --- /dev/null +++ b/modules/files/views/default/assets/mode/tcl/tcl.js @@ -0,0 +1,131 @@ +//tcl mode by Ford_Lawnmower :: Based on Velocity mode by Steve O'Hara +CodeMirror.defineMode("tcl", function() { + function parseWords(str) { + var obj = {}, words = str.split(" "); + for (var i = 0; i < words.length; ++i) obj[words[i]] = true; + return obj; + } + var keywords = parseWords("Tcl safe after append array auto_execok auto_import auto_load " + + "auto_mkindex auto_mkindex_old auto_qualify auto_reset bgerror " + + "binary break catch cd close concat continue dde eof encoding error " + + "eval exec exit expr fblocked fconfigure fcopy file fileevent filename " + + "filename flush for foreach format gets glob global history http if " + + "incr info interp join lappend lindex linsert list llength load lrange " + + "lreplace lsearch lset lsort memory msgcat namespace open package parray " + + "pid pkg::create pkg_mkIndex proc puts pwd re_syntax read regex regexp " + + "registry regsub rename resource return scan seek set socket source split " + + "string subst switch tcl_endOfWord tcl_findLibrary tcl_startOfNextWord " + + "tcl_wordBreakAfter tcl_startOfPreviousWord tcl_wordBreakBefore tcltest " + + "tclvars tell time trace unknown unset update uplevel upvar variable " + + "vwait"); + var functions = parseWords("if elseif else and not or eq ne in ni for foreach while switch"); + var isOperatorChar = /[+\-*&%=<>!?^\/\|]/; + function chain(stream, state, f) { + state.tokenize = f; + return f(stream, state); + } + function tokenBase(stream, state) { + var beforeParams = state.beforeParams; + state.beforeParams = false; + var ch = stream.next(); + if ((ch == '"' || ch == "'") && state.inParams) + return chain(stream, state, tokenString(ch)); + else if (/[\[\]{}\(\),;\.]/.test(ch)) { + if (ch == "(" && beforeParams) state.inParams = true; + else if (ch == ")") state.inParams = false; + return null; + } + else if (/\d/.test(ch)) { + stream.eatWhile(/[\w\.]/); + return "number"; + } + else if (ch == "#" && stream.eat("*")) { + return chain(stream, state, tokenComment); + } + else if (ch == "#" && stream.match(/ *\[ *\[/)) { + return chain(stream, state, tokenUnparsed); + } + else if (ch == "#" && stream.eat("#")) { + stream.skipToEnd(); + return "comment"; + } + else if (ch == '"') { + stream.skipTo(/"/); + return "comment"; + } + else if (ch == "$") { + stream.eatWhile(/[$_a-z0-9A-Z\.{:]/); + stream.eatWhile(/}/); + state.beforeParams = true; + return "builtin"; + } + else if (isOperatorChar.test(ch)) { + stream.eatWhile(isOperatorChar); + return "comment"; + } + else { + stream.eatWhile(/[\w\$_{}]/); + var word = stream.current().toLowerCase(); + if (keywords && keywords.propertyIsEnumerable(word)) + return "keyword"; + if (functions && functions.propertyIsEnumerable(word)) { + state.beforeParams = true; + return "keyword"; + } + return null; + } + } + function tokenString(quote) { + return function(stream, state) { + var escaped = false, next, end = false; + while ((next = stream.next()) != null) { + if (next == quote && !escaped) { + end = true; + break; + } + escaped = !escaped && next == "\\"; + } + if (end) state.tokenize = tokenBase; + return "string"; + }; + } + function tokenComment(stream, state) { + var maybeEnd = false, ch; + while (ch = stream.next()) { + if (ch == "#" && maybeEnd) { + state.tokenize = tokenBase; + break; + } + maybeEnd = (ch == "*"); + } + return "comment"; + } + function tokenUnparsed(stream, state) { + var maybeEnd = 0, ch; + while (ch = stream.next()) { + if (ch == "#" && maybeEnd == 2) { + state.tokenize = tokenBase; + break; + } + if (ch == "]") + maybeEnd++; + else if (ch != " ") + maybeEnd = 0; + } + return "meta"; + } + return { + startState: function() { + return { + tokenize: tokenBase, + beforeParams: false, + inParams: false + }; + }, + token: function(stream, state) { + if (stream.eatSpace()) return null; + return state.tokenize(stream, state); + } + }; +}); +CodeMirror.defineMIME("text/x-tcl", "tcl"); diff --git a/modules/files/views/default/assets/mode/tiddlywiki/index.html b/modules/files/views/default/assets/mode/tiddlywiki/index.html new file mode 100755 index 0000000..848f33a --- /dev/null +++ b/modules/files/views/default/assets/mode/tiddlywiki/index.html @@ -0,0 +1,142 @@ + + + + + CodeMirror: TiddlyWiki mode + + + + + + + + + +

      CodeMirror: TiddlyWiki mode

      + +
      + + + +

      TiddlyWiki mode supports a single configuration.

      + +

      MIME types defined: text/x-tiddlywiki.

      + + diff --git a/modules/files/views/default/assets/mode/tiddlywiki/tiddlywiki.css b/modules/files/views/default/assets/mode/tiddlywiki/tiddlywiki.css new file mode 100755 index 0000000..9a69b63 --- /dev/null +++ b/modules/files/views/default/assets/mode/tiddlywiki/tiddlywiki.css @@ -0,0 +1,14 @@ +span.cm-underlined { + text-decoration: underline; +} +span.cm-strikethrough { + text-decoration: line-through; +} +span.cm-brace { + color: #170; + font-weight: bold; +} +span.cm-table { + color: blue; + font-weight: bold; +} diff --git a/modules/files/views/default/assets/mode/tiddlywiki/tiddlywiki.js b/modules/files/views/default/assets/mode/tiddlywiki/tiddlywiki.js new file mode 100755 index 0000000..24a2478 --- /dev/null +++ b/modules/files/views/default/assets/mode/tiddlywiki/tiddlywiki.js @@ -0,0 +1,353 @@ +/*** + |''Name''|tiddlywiki.js| + |''Description''|Enables TiddlyWikiy syntax highlighting using CodeMirror| + |''Author''|PMario| + |''Version''|0.1.7| + |''Status''|''stable''| + |''Source''|[[GitHub|https://github.com/pmario/CodeMirror2/blob/tw-syntax/mode/tiddlywiki]]| + |''Documentation''|http://codemirror.tiddlyspace.com/| + |''License''|[[MIT License|http://www.opensource.org/licenses/mit-license.php]]| + |''CoreVersion''|2.5.0| + |''Requires''|codemirror.js| + |''Keywords''|syntax highlighting color code mirror codemirror| + ! Info + CoreVersion parameter is needed for TiddlyWiki only! +***/ +//{{{ +CodeMirror.defineMode("tiddlywiki", function () { + // Tokenizer + var textwords = {}; + + var keywords = function () { + function kw(type) { + return { type: type, style: "macro"}; + } + return { + "allTags": kw('allTags'), "closeAll": kw('closeAll'), "list": kw('list'), + "newJournal": kw('newJournal'), "newTiddler": kw('newTiddler'), + "permaview": kw('permaview'), "saveChanges": kw('saveChanges'), + "search": kw('search'), "slider": kw('slider'), "tabs": kw('tabs'), + "tag": kw('tag'), "tagging": kw('tagging'), "tags": kw('tags'), + "tiddler": kw('tiddler'), "timeline": kw('timeline'), + "today": kw('today'), "version": kw('version'), "option": kw('option'), + + "with": kw('with'), + "filter": kw('filter') + }; + }(); + + var isSpaceName = /[\w_\-]/i, + reHR = /^\-\-\-\-+$/, //
      + reWikiCommentStart = /^\/\*\*\*$/, // /*** + reWikiCommentStop = /^\*\*\*\/$/, // ***/ + reBlockQuote = /^<<<$/, + + reJsCodeStart = /^\/\/\{\{\{$/, // //{{{ js block start + reJsCodeStop = /^\/\/\}\}\}$/, // //}}} js stop + reXmlCodeStart = /^$/, // xml block start + reXmlCodeStop = /^$/, // xml stop + + reCodeBlockStart = /^\{\{\{$/, // {{{ TW text div block start + reCodeBlockStop = /^\}\}\}$/, // }}} TW text stop + + reUntilCodeStop = /.*?\}\}\}/; + + function chain(stream, state, f) { + state.tokenize = f; + return f(stream, state); + } + + // Used as scratch variables to communicate multiple values without + // consing up tons of objects. + var type, content; + + function ret(tp, style, cont) { + type = tp; + content = cont; + return style; + } + + function jsTokenBase(stream, state) { + var sol = stream.sol(), ch; + + state.block = false; // indicates the start of a code block. + + ch = stream.peek(); // don't eat, to make matching simpler + + // check start of blocks + if (sol && /[<\/\*{}\-]/.test(ch)) { + if (stream.match(reCodeBlockStart)) { + state.block = true; + return chain(stream, state, twTokenCode); + } + if (stream.match(reBlockQuote)) { + return ret('quote', 'quote'); + } + if (stream.match(reWikiCommentStart) || stream.match(reWikiCommentStop)) { + return ret('code', 'comment'); + } + if (stream.match(reJsCodeStart) || stream.match(reJsCodeStop) || stream.match(reXmlCodeStart) || stream.match(reXmlCodeStop)) { + return ret('code', 'comment'); + } + if (stream.match(reHR)) { + return ret('hr', 'hr'); + } + } // sol + ch = stream.next(); + + if (sol && /[\/\*!#;:>|]/.test(ch)) { + if (ch == "!") { // tw header + stream.skipToEnd(); + return ret("header", "header"); + } + if (ch == "*") { // tw list + stream.eatWhile('*'); + return ret("list", "comment"); + } + if (ch == "#") { // tw numbered list + stream.eatWhile('#'); + return ret("list", "comment"); + } + if (ch == ";") { // definition list, term + stream.eatWhile(';'); + return ret("list", "comment"); + } + if (ch == ":") { // definition list, description + stream.eatWhile(':'); + return ret("list", "comment"); + } + if (ch == ">") { // single line quote + stream.eatWhile(">"); + return ret("quote", "quote"); + } + if (ch == '|') { + return ret('table', 'header'); + } + } + + if (ch == '{' && stream.match(/\{\{/)) { + return chain(stream, state, twTokenCode); + } + + // rudimentary html:// file:// link matching. TW knows much more ... + if (/[hf]/i.test(ch)) { + if (/[ti]/i.test(stream.peek()) && stream.match(/\b(ttps?|tp|ile):\/\/[\-A-Z0-9+&@#\/%?=~_|$!:,.;]*[A-Z0-9+&@#\/%=~_|$]/i)) { + return ret("link", "link"); + } + } + // just a little string indicator, don't want to have the whole string covered + if (ch == '"') { + return ret('string', 'string'); + } + if (ch == '~') { // _no_ CamelCase indicator should be bold + return ret('text', 'brace'); + } + if (/[\[\]]/.test(ch)) { // check for [[..]] + if (stream.peek() == ch) { + stream.next(); + return ret('brace', 'brace'); + } + } + if (ch == "@") { // check for space link. TODO fix @@...@@ highlighting + stream.eatWhile(isSpaceName); + return ret("link", "link"); + } + if (/\d/.test(ch)) { // numbers + stream.eatWhile(/\d/); + return ret("number", "number"); + } + if (ch == "/") { // tw invisible comment + if (stream.eat("%")) { + return chain(stream, state, twTokenComment); + } + else if (stream.eat("/")) { // + return chain(stream, state, twTokenEm); + } + } + if (ch == "_") { // tw underline + if (stream.eat("_")) { + return chain(stream, state, twTokenUnderline); + } + } + // strikethrough and mdash handling + if (ch == "-") { + if (stream.eat("-")) { + // if strikethrough looks ugly, change CSS. + if (stream.peek() != ' ') + return chain(stream, state, twTokenStrike); + // mdash + if (stream.peek() == ' ') + return ret('text', 'brace'); + } + } + if (ch == "'") { // tw bold + if (stream.eat("'")) { + return chain(stream, state, twTokenStrong); + } + } + if (ch == "<") { // tw macro + if (stream.eat("<")) { + return chain(stream, state, twTokenMacro); + } + } + else { + return ret(ch); + } + + // core macro handling + stream.eatWhile(/[\w\$_]/); + var word = stream.current(), + known = textwords.propertyIsEnumerable(word) && textwords[word]; + + return known ? ret(known.type, known.style, word) : ret("text", null, word); + + } // jsTokenBase() + + // tw invisible comment + function twTokenComment(stream, state) { + var maybeEnd = false, + ch; + while (ch = stream.next()) { + if (ch == "/" && maybeEnd) { + state.tokenize = jsTokenBase; + break; + } + maybeEnd = (ch == "%"); + } + return ret("comment", "comment"); + } + + // tw strong / bold + function twTokenStrong(stream, state) { + var maybeEnd = false, + ch; + while (ch = stream.next()) { + if (ch == "'" && maybeEnd) { + state.tokenize = jsTokenBase; + break; + } + maybeEnd = (ch == "'"); + } + return ret("text", "strong"); + } + + // tw code + function twTokenCode(stream, state) { + var ch, sb = state.block; + + if (sb && stream.current()) { + return ret("code", "comment"); + } + + if (!sb && stream.match(reUntilCodeStop)) { + state.tokenize = jsTokenBase; + return ret("code", "comment"); + } + + if (sb && stream.sol() && stream.match(reCodeBlockStop)) { + state.tokenize = jsTokenBase; + return ret("code", "comment"); + } + + ch = stream.next(); + return (sb) ? ret("code", "comment") : ret("code", "comment"); + } + + // tw em / italic + function twTokenEm(stream, state) { + var maybeEnd = false, + ch; + while (ch = stream.next()) { + if (ch == "/" && maybeEnd) { + state.tokenize = jsTokenBase; + break; + } + maybeEnd = (ch == "/"); + } + return ret("text", "em"); + } + + // tw underlined text + function twTokenUnderline(stream, state) { + var maybeEnd = false, + ch; + while (ch = stream.next()) { + if (ch == "_" && maybeEnd) { + state.tokenize = jsTokenBase; + break; + } + maybeEnd = (ch == "_"); + } + return ret("text", "underlined"); + } + + // tw strike through text looks ugly + // change CSS if needed + function twTokenStrike(stream, state) { + var maybeEnd = false, ch; + + while (ch = stream.next()) { + if (ch == "-" && maybeEnd) { + state.tokenize = jsTokenBase; + break; + } + maybeEnd = (ch == "-"); + } + return ret("text", "strikethrough"); + } + + // macro + function twTokenMacro(stream, state) { + var ch, word, known; + + if (stream.current() == '<<') { + return ret('brace', 'macro'); + } + + ch = stream.next(); + if (!ch) { + state.tokenize = jsTokenBase; + return ret(ch); + } + if (ch == ">") { + if (stream.peek() == '>') { + stream.next(); + state.tokenize = jsTokenBase; + return ret("brace", "macro"); + } + } + + stream.eatWhile(/[\w\$_]/); + word = stream.current(); + known = keywords.propertyIsEnumerable(word) && keywords[word]; + + if (known) { + return ret(known.type, known.style, word); + } + else { + return ret("macro", null, word); + } + } + + // Interface + return { + startState: function () { + return { + tokenize: jsTokenBase, + indented: 0, + level: 0 + }; + }, + + token: function (stream, state) { + if (stream.eatSpace()) return null; + var style = state.tokenize(stream, state); + return style; + }, + + electricChars: "" + }; +}); + +CodeMirror.defineMIME("text/x-tiddlywiki", "tiddlywiki"); +//}}} diff --git a/modules/files/views/default/assets/mode/tiki/index.html b/modules/files/views/default/assets/mode/tiki/index.html new file mode 100755 index 0000000..7b85a44 --- /dev/null +++ b/modules/files/views/default/assets/mode/tiki/index.html @@ -0,0 +1,81 @@ + + + + CodeMirror: Tiki wiki mode + + + + + + + + +

      CodeMirror: Tiki wiki mode

      + +
      + + + + + diff --git a/modules/files/views/default/assets/mode/tiki/tiki.css b/modules/files/views/default/assets/mode/tiki/tiki.css new file mode 100755 index 0000000..0dbc3ea --- /dev/null +++ b/modules/files/views/default/assets/mode/tiki/tiki.css @@ -0,0 +1,26 @@ +.cm-tw-syntaxerror { + color: #FFF; + background-color: #900; +} + +.cm-tw-deleted { + text-decoration: line-through; +} + +.cm-tw-header5 { + font-weight: bold; +} +.cm-tw-listitem:first-child { /*Added first child to fix duplicate padding when highlighting*/ + padding-left: 10px; +} + +.cm-tw-box { + border-top-width: 0px ! important; + border-style: solid; + border-width: 1px; + border-color: inherit; +} + +.cm-tw-underline { + text-decoration: underline; +} \ No newline at end of file diff --git a/modules/files/views/default/assets/mode/tiki/tiki.js b/modules/files/views/default/assets/mode/tiki/tiki.js new file mode 100755 index 0000000..e789163 --- /dev/null +++ b/modules/files/views/default/assets/mode/tiki/tiki.js @@ -0,0 +1,308 @@ +CodeMirror.defineMode('tiki', function(config) { + function inBlock(style, terminator, returnTokenizer) { + return function(stream, state) { + while (!stream.eol()) { + if (stream.match(terminator)) { + state.tokenize = inText; + break; + } + stream.next(); + } + + if (returnTokenizer) state.tokenize = returnTokenizer; + + return style; + }; + } + + function inLine(style) { + return function(stream, state) { + while(!stream.eol()) { + stream.next(); + } + state.tokenize = inText; + return style; + }; + } + + function inText(stream, state) { + function chain(parser) { + state.tokenize = parser; + return parser(stream, state); + } + + var sol = stream.sol(); + var ch = stream.next(); + + //non start of line + switch (ch) { //switch is generally much faster than if, so it is used here + case "{": //plugin + stream.eat("/"); + stream.eatSpace(); + var tagName = ""; + var c; + while ((c = stream.eat(/[^\s\u00a0=\"\'\/?(}]/))) tagName += c; + state.tokenize = inPlugin; + return "tag"; + break; + case "_": //bold + if (stream.eat("_")) { + return chain(inBlock("strong", "__", inText)); + } + break; + case "'": //italics + if (stream.eat("'")) { + // Italic text + return chain(inBlock("em", "''", inText)); + } + break; + case "(":// Wiki Link + if (stream.eat("(")) { + return chain(inBlock("variable-2", "))", inText)); + } + break; + case "[":// Weblink + return chain(inBlock("variable-3", "]", inText)); + break; + case "|": //table + if (stream.eat("|")) { + return chain(inBlock("comment", "||")); + } + break; + case "-": + if (stream.eat("=")) {//titleBar + return chain(inBlock("header string", "=-", inText)); + } else if (stream.eat("-")) {//deleted + return chain(inBlock("error tw-deleted", "--", inText)); + } + break; + case "=": //underline + if (stream.match("==")) { + return chain(inBlock("tw-underline", "===", inText)); + } + break; + case ":": + if (stream.eat(":")) { + return chain(inBlock("comment", "::")); + } + break; + case "^": //box + return chain(inBlock("tw-box", "^")); + break; + case "~": //np + if (stream.match("np~")) { + return chain(inBlock("meta", "~/np~")); + } + break; + } + + //start of line types + if (sol) { + switch (ch) { + case "!": //header at start of line + if (stream.match('!!!!!')) { + return chain(inLine("header string")); + } else if (stream.match('!!!!')) { + return chain(inLine("header string")); + } else if (stream.match('!!!')) { + return chain(inLine("header string")); + } else if (stream.match('!!')) { + return chain(inLine("header string")); + } else { + return chain(inLine("header string")); + } + break; + case "*": //unordered list line item, or
    • at start of line + case "#": //ordered list line item, or
    • at start of line + case "+": //ordered list line item, or
    • at start of line + return chain(inLine("tw-listitem bracket")); + break; + } + } + + //stream.eatWhile(/[&{]/); was eating up plugins, turned off to act less like html and more like tiki + return null; + } + + var indentUnit = config.indentUnit; + + // Return variables for tokenizers + var pluginName, type; + function inPlugin(stream, state) { + var ch = stream.next(); + var peek = stream.peek(); + + if (ch == "}") { + state.tokenize = inText; + //type = ch == ")" ? "endPlugin" : "selfclosePlugin"; inPlugin + return "tag"; + } else if (ch == "(" || ch == ")") { + return "bracket"; + } else if (ch == "=") { + type = "equals"; + + if (peek == ">") { + ch = stream.next(); + peek = stream.peek(); + } + + //here we detect values directly after equal character with no quotes + if (!/[\'\"]/.test(peek)) { + state.tokenize = inAttributeNoQuote(); + } + //end detect values + + return "operator"; + } else if (/[\'\"]/.test(ch)) { + state.tokenize = inAttribute(ch); + return state.tokenize(stream, state); + } else { + stream.eatWhile(/[^\s\u00a0=\"\'\/?]/); + return "keyword"; + } + } + + function inAttribute(quote) { + return function(stream, state) { + while (!stream.eol()) { + if (stream.next() == quote) { + state.tokenize = inPlugin; + break; + } + } + return "string"; + }; + } + + function inAttributeNoQuote() { + return function(stream, state) { + while (!stream.eol()) { + var ch = stream.next(); + var peek = stream.peek(); + if (ch == " " || ch == "," || /[ )}]/.test(peek)) { + state.tokenize = inPlugin; + break; + } + } + return "string"; +}; + } + +var curState, setStyle; +function pass() { + for (var i = arguments.length - 1; i >= 0; i--) curState.cc.push(arguments[i]); +} + +function cont() { + pass.apply(null, arguments); + return true; +} + +function pushContext(pluginName, startOfLine) { + var noIndent = curState.context && curState.context.noIndent; + curState.context = { + prev: curState.context, + pluginName: pluginName, + indent: curState.indented, + startOfLine: startOfLine, + noIndent: noIndent + }; +} + +function popContext() { + if (curState.context) curState.context = curState.context.prev; +} + +function element(type) { + if (type == "openPlugin") {curState.pluginName = pluginName; return cont(attributes, endplugin(curState.startOfLine));} + else if (type == "closePlugin") { + var err = false; + if (curState.context) { + err = curState.context.pluginName != pluginName; + popContext(); + } else { + err = true; + } + if (err) setStyle = "error"; + return cont(endcloseplugin(err)); + } + else if (type == "string") { + if (!curState.context || curState.context.name != "!cdata") pushContext("!cdata"); + if (curState.tokenize == inText) popContext(); + return cont(); + } + else return cont(); +} + +function endplugin(startOfLine) { + return function(type) { + if ( + type == "selfclosePlugin" || + type == "endPlugin" + ) + return cont(); + if (type == "endPlugin") {pushContext(curState.pluginName, startOfLine); return cont();} + return cont(); + }; +} + +function endcloseplugin(err) { + return function(type) { + if (err) setStyle = "error"; + if (type == "endPlugin") return cont(); + return pass(); + }; +} + +function attributes(type) { + if (type == "keyword") {setStyle = "attribute"; return cont(attributes);} + if (type == "equals") return cont(attvalue, attributes); + return pass(); +} +function attvalue(type) { + if (type == "keyword") {setStyle = "string"; return cont();} + if (type == "string") return cont(attvaluemaybe); + return pass(); +} +function attvaluemaybe(type) { + if (type == "string") return cont(attvaluemaybe); + else return pass(); +} +return { + startState: function() { + return {tokenize: inText, cc: [], indented: 0, startOfLine: true, pluginName: null, context: null}; + }, + token: function(stream, state) { + if (stream.sol()) { + state.startOfLine = true; + state.indented = stream.indentation(); + } + if (stream.eatSpace()) return null; + + setStyle = type = pluginName = null; + var style = state.tokenize(stream, state); + if ((style || type) && style != "comment") { + curState = state; + while (true) { + var comb = state.cc.pop() || element; + if (comb(type || style)) break; + } + } + state.startOfLine = false; + return setStyle || style; + }, + indent: function(state, textAfter) { + var context = state.context; + if (context && context.noIndent) return 0; + if (context && /^{\//.test(textAfter)) + context = context.prev; + while (context && !context.startOfLine) + context = context.prev; + if (context) return context.indent + indentUnit; + else return 0; + }, + electricChars: "/" + }; +}); + +CodeMirror.defineMIME("text/tiki", "tiki"); diff --git a/modules/files/views/default/assets/mode/turtle/index.html b/modules/files/views/default/assets/mode/turtle/index.html new file mode 100755 index 0000000..5e56e57 --- /dev/null +++ b/modules/files/views/default/assets/mode/turtle/index.html @@ -0,0 +1,39 @@ + + + + + CodeMirror: Turtle mode + + + + + + + +

      CodeMirror: Turtle mode

      +
      + + +

      MIME types defined: text/turtle.

      + + + diff --git a/modules/files/views/default/assets/mode/turtle/turtle.js b/modules/files/views/default/assets/mode/turtle/turtle.js new file mode 100755 index 0000000..e118bfb --- /dev/null +++ b/modules/files/views/default/assets/mode/turtle/turtle.js @@ -0,0 +1,145 @@ +CodeMirror.defineMode("turtle", function(config) { + var indentUnit = config.indentUnit; + var curPunc; + + function wordRegexp(words) { + return new RegExp("^(?:" + words.join("|") + ")$", "i"); + } + var ops = wordRegexp([]); + var keywords = wordRegexp(["@prefix", "@base", "a"]); + var operatorChars = /[*+\-<>=&|]/; + + function tokenBase(stream, state) { + var ch = stream.next(); + curPunc = null; + if (ch == "<" && !stream.match(/^[\s\u00a0=]/, false)) { + stream.match(/^[^\s\u00a0>]*>?/); + return "atom"; + } + else if (ch == "\"" || ch == "'") { + state.tokenize = tokenLiteral(ch); + return state.tokenize(stream, state); + } + else if (/[{}\(\),\.;\[\]]/.test(ch)) { + curPunc = ch; + return null; + } + else if (ch == "#") { + stream.skipToEnd(); + return "comment"; + } + else if (operatorChars.test(ch)) { + stream.eatWhile(operatorChars); + return null; + } + else if (ch == ":") { + return "operator"; + } else { + stream.eatWhile(/[_\w\d]/); + if(stream.peek() == ":") { + return "variable-3"; + } else { + var word = stream.current(); + + if(keywords.test(word)) { + return "meta"; + } + + if(ch >= "A" && ch <= "Z") { + return "comment"; + } else { + return "keyword"; + } + } + var word = stream.current(); + if (ops.test(word)) + return null; + else if (keywords.test(word)) + return "meta"; + else + return "variable"; + } + } + + function tokenLiteral(quote) { + return function(stream, state) { + var escaped = false, ch; + while ((ch = stream.next()) != null) { + if (ch == quote && !escaped) { + state.tokenize = tokenBase; + break; + } + escaped = !escaped && ch == "\\"; + } + return "string"; + }; + } + + function pushContext(state, type, col) { + state.context = {prev: state.context, indent: state.indent, col: col, type: type}; + } + function popContext(state) { + state.indent = state.context.indent; + state.context = state.context.prev; + } + + return { + startState: function() { + return {tokenize: tokenBase, + context: null, + indent: 0, + col: 0}; + }, + + token: function(stream, state) { + if (stream.sol()) { + if (state.context && state.context.align == null) state.context.align = false; + state.indent = stream.indentation(); + } + if (stream.eatSpace()) return null; + var style = state.tokenize(stream, state); + + if (style != "comment" && state.context && state.context.align == null && state.context.type != "pattern") { + state.context.align = true; + } + + if (curPunc == "(") pushContext(state, ")", stream.column()); + else if (curPunc == "[") pushContext(state, "]", stream.column()); + else if (curPunc == "{") pushContext(state, "}", stream.column()); + else if (/[\]\}\)]/.test(curPunc)) { + while (state.context && state.context.type == "pattern") popContext(state); + if (state.context && curPunc == state.context.type) popContext(state); + } + else if (curPunc == "." && state.context && state.context.type == "pattern") popContext(state); + else if (/atom|string|variable/.test(style) && state.context) { + if (/[\}\]]/.test(state.context.type)) + pushContext(state, "pattern", stream.column()); + else if (state.context.type == "pattern" && !state.context.align) { + state.context.align = true; + state.context.col = stream.column(); + } + } + + return style; + }, + + indent: function(state, textAfter) { + var firstChar = textAfter && textAfter.charAt(0); + var context = state.context; + if (/[\]\}]/.test(firstChar)) + while (context && context.type == "pattern") context = context.prev; + + var closing = context && firstChar == context.type; + if (!context) + return 0; + else if (context.type == "pattern") + return context.col; + else if (context.align) + return context.col + (closing ? 0 : 1); + else + return context.indent + (closing ? 0 : indentUnit); + } + }; +}); + +CodeMirror.defineMIME("text/turtle", "turtle"); diff --git a/modules/files/views/default/assets/mode/vb/LICENSE.txt b/modules/files/views/default/assets/mode/vb/LICENSE.txt new file mode 100755 index 0000000..6083970 --- /dev/null +++ b/modules/files/views/default/assets/mode/vb/LICENSE.txt @@ -0,0 +1,21 @@ +The MIT License + +Copyright (c) 2012 Codility Limited, 107 Cheapside, London EC2V 6DN, UK + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/modules/files/views/default/assets/mode/vb/index.html b/modules/files/views/default/assets/mode/vb/index.html new file mode 100755 index 0000000..74dd5e8 --- /dev/null +++ b/modules/files/views/default/assets/mode/vb/index.html @@ -0,0 +1,88 @@ + + + + CodeMirror: VB.NET mode + + + + + + + + + +

      CodeMirror: VB.NET mode

      + + + +
      + +
      + 
      
+  
      MIME type defined: text/x-vb.
      
+
+
diff --git a/modules/files/views/default/assets/mode/vb/vb.js b/modules/files/views/default/assets/mode/vb/vb.js
new file mode 100755
index 0000000..27b2271
--- /dev/null
+++ b/modules/files/views/default/assets/mode/vb/vb.js
@@ -0,0 +1,259 @@
+CodeMirror.defineMode("vb", function(conf, parserConf) {
+    var ERRORCLASS = 'error';
+
+    function wordRegexp(words) {
+        return new RegExp("^((" + words.join(")|(") + "))\\b", "i");
+    }
+
+    var singleOperators = new RegExp("^[\\+\\-\\*/%&\\\\|\\^~<>!]");
+    var singleDelimiters = new RegExp('^[\\(\\)\\[\\]\\{\\}@,:`=;\\.]');
+    var doubleOperators = new RegExp("^((==)|(<>)|(<=)|(>=)|(<>)|(<<)|(>>)|(//)|(\\*\\*))");
+    var doubleDelimiters = new RegExp("^((\\+=)|(\\-=)|(\\*=)|(%=)|(/=)|(&=)|(\\|=)|(\\^=))");
+    var tripleDelimiters = new RegExp("^((//=)|(>>=)|(<<=)|(\\*\\*=))");
+    var identifiers = new RegExp("^[_A-Za-z][_A-Za-z0-9]*");
+
+    var openingKeywords = ['class','module', 'sub','enum','select','while','if','function',  'get','set','property', 'try'];
+    var middleKeywords = ['else','elseif','case', 'catch'];
+    var endKeywords = ['next','loop'];
+
+    var wordOperators = wordRegexp(['and', 'or', 'not', 'xor', 'in']);
+    var commonkeywords = ['as', 'dim', 'break',  'continue','optional', 'then',  'until',
+                          'goto', 'byval','byref','new','handles','property', 'return',
+                          'const','private', 'protected', 'friend', 'public', 'shared', 'static', 'true','false'];
+    var commontypes = ['integer','string','double','decimal','boolean','short','char', 'float','single'];
+
+    var keywords = wordRegexp(commonkeywords);
+    var types = wordRegexp(commontypes);
+    var stringPrefixes = '"';
+
+    var opening = wordRegexp(openingKeywords);
+    var middle = wordRegexp(middleKeywords);
+    var closing = wordRegexp(endKeywords);
+    var doubleClosing = wordRegexp(['end']);
+    var doOpening = wordRegexp(['do']);
+
+    var indentInfo = null;
+
+
+
+
+    function indent(_stream, state) {
+      state.currentIndent++;
+    }
+
+    function dedent(_stream, state) {
+      state.currentIndent--;
+    }
+    // tokenizers
+    function tokenBase(stream, state) {
+        if (stream.eatSpace()) {
+            return null;
+        }
+
+        var ch = stream.peek();
+
+        // Handle Comments
+        if (ch === "'") {
+            stream.skipToEnd();
+            return 'comment';
+        }
+
+
+        // Handle Number Literals
+        if (stream.match(/^((&H)|(&O))?[0-9\.a-f]/i, false)) {
+            var floatLiteral = false;
+            // Floats
+            if (stream.match(/^\d*\.\d+F?/i)) { floatLiteral = true; }
+            else if (stream.match(/^\d+\.\d*F?/)) { floatLiteral = true; }
+            else if (stream.match(/^\.\d+F?/)) { floatLiteral = true; }
+
+            if (floatLiteral) {
+                // Float literals may be "imaginary"
+                stream.eat(/J/i);
+                return 'number';
+            }
+            // Integers
+            var intLiteral = false;
+            // Hex
+            if (stream.match(/^&H[0-9a-f]+/i)) { intLiteral = true; }
+            // Octal
+            else if (stream.match(/^&O[0-7]+/i)) { intLiteral = true; }
+            // Decimal
+            else if (stream.match(/^[1-9]\d*F?/)) {
+                // Decimal literals may be "imaginary"
+                stream.eat(/J/i);
+                // TODO - Can you have imaginary longs?
+                intLiteral = true;
+            }
+            // Zero by itself with no other piece of number.
+            else if (stream.match(/^0(?![\dx])/i)) { intLiteral = true; }
+            if (intLiteral) {
+                // Integer literals may be "long"
+                stream.eat(/L/i);
+                return 'number';
+            }
+        }
+
+        // Handle Strings
+        if (stream.match(stringPrefixes)) {
+            state.tokenize = tokenStringFactory(stream.current());
+            return state.tokenize(stream, state);
+        }
+
+        // Handle operators and Delimiters
+        if (stream.match(tripleDelimiters) || stream.match(doubleDelimiters)) {
+            return null;
+        }
+        if (stream.match(doubleOperators)
+            || stream.match(singleOperators)
+            || stream.match(wordOperators)) {
+            return 'operator';
+        }
+        if (stream.match(singleDelimiters)) {
+            return null;
+        }
+        if (stream.match(doOpening)) {
+            indent(stream,state);
+            state.doInCurrentLine = true;
+            return 'keyword';
+        }
+        if (stream.match(opening)) {
+            if (! state.doInCurrentLine)
+              indent(stream,state);
+            else
+              state.doInCurrentLine = false;
+            return 'keyword';
+        }
+        if (stream.match(middle)) {
+            return 'keyword';
+        }
+
+        if (stream.match(doubleClosing)) {
+            dedent(stream,state);
+            dedent(stream,state);
+            return 'keyword';
+        }
+        if (stream.match(closing)) {
+            dedent(stream,state);
+            return 'keyword';
+        }
+
+        if (stream.match(types)) {
+            return 'keyword';
+        }
+
+        if (stream.match(keywords)) {
+            return 'keyword';
+        }
+
+        if (stream.match(identifiers)) {
+            return 'variable';
+        }
+
+        // Handle non-detected items
+        stream.next();
+        return ERRORCLASS;
+    }
+
+    function tokenStringFactory(delimiter) {
+        var singleline = delimiter.length == 1;
+        var OUTCLASS = 'string';
+
+        return function(stream, state) {
+            while (!stream.eol()) {
+                stream.eatWhile(/[^'"]/);
+                if (stream.match(delimiter)) {
+                    state.tokenize = tokenBase;
+                    return OUTCLASS;
+                } else {
+                    stream.eat(/['"]/);
+                }
+            }
+            if (singleline) {
+                if (parserConf.singleLineStringErrors) {
+                    return ERRORCLASS;
+                } else {
+                    state.tokenize = tokenBase;
+                }
+            }
+            return OUTCLASS;
+        };
+    }
+
+
+    function tokenLexer(stream, state) {
+        var style = state.tokenize(stream, state);
+        var current = stream.current();
+
+        // Handle '.' connected identifiers
+        if (current === '.') {
+            style = state.tokenize(stream, state);
+            current = stream.current();
+            if (style === 'variable') {
+                return 'variable';
+            } else {
+                return ERRORCLASS;
+            }
+        }
+
+
+        var delimiter_index = '[({'.indexOf(current);
+        if (delimiter_index !== -1) {
+            indent(stream, state );
+        }
+        if (indentInfo === 'dedent') {
+            if (dedent(stream, state)) {
+                return ERRORCLASS;
+            }
+        }
+        delimiter_index = '])}'.indexOf(current);
+        if (delimiter_index !== -1) {
+            if (dedent(stream, state)) {
+                return ERRORCLASS;
+            }
+        }
+
+        return style;
+    }
+
+    var external = {
+        electricChars:"dDpPtTfFeE ",
+        startState: function() {
+            return {
+              tokenize: tokenBase,
+              lastToken: null,
+              currentIndent: 0,
+              nextLineIndent: 0,
+              doInCurrentLine: false
+
+
+          };
+        },
+
+        token: function(stream, state) {
+            if (stream.sol()) {
+              state.currentIndent += state.nextLineIndent;
+              state.nextLineIndent = 0;
+              state.doInCurrentLine = 0;
+            }
+            var style = tokenLexer(stream, state);
+
+            state.lastToken = {style:style, content: stream.current()};
+
+
+
+            return style;
+        },
+
+        indent: function(state, textAfter) {
+            var trueText = textAfter.replace(/^\s+|\s+$/g, '') ;
+            if (trueText.match(closing) || trueText.match(doubleClosing) || trueText.match(middle)) return conf.indentUnit*(state.currentIndent-1);
+            if(state.currentIndent < 0) return 0;
+            return state.currentIndent * conf.indentUnit;
+        }
+
+    };
+    return external;
+});
+
+CodeMirror.defineMIME("text/x-vb", "vb");
diff --git a/modules/files/views/default/assets/mode/vbscript/index.html b/modules/files/views/default/assets/mode/vbscript/index.html
new file mode 100755
index 0000000..8c86f9e
--- /dev/null
+++ b/modules/files/views/default/assets/mode/vbscript/index.html
@@ -0,0 +1,42 @@
+
+
+  
+    
+    CodeMirror: VBScript mode
+    
+    
+    
+    
+    
+  
+  
+    
      CodeMirror: VBScript mode
      
+
+
      
+
+    
+
+    
      MIME types defined: text/vbscript.
      
+  
+
+
diff --git a/modules/files/views/default/assets/mode/vbscript/vbscript.js b/modules/files/views/default/assets/mode/vbscript/vbscript.js
new file mode 100755
index 0000000..3e1eedc
--- /dev/null
+++ b/modules/files/views/default/assets/mode/vbscript/vbscript.js
@@ -0,0 +1,26 @@
+CodeMirror.defineMode("vbscript", function() {
+  var regexVBScriptKeyword = /^(?:Call|Case|CDate|Clear|CInt|CLng|Const|CStr|Description|Dim|Do|Each|Else|ElseIf|End|Err|Error|Exit|False|For|Function|If|LCase|Loop|LTrim|Next|Nothing|Now|Number|On|Preserve|Quit|ReDim|Resume|RTrim|Select|Set|Sub|Then|To|Trim|True|UBound|UCase|Until|VbCr|VbCrLf|VbLf|VbTab)$/im;
+
+  return {
+    token: function(stream) {
+      if (stream.eatSpace()) return null;
+      var ch = stream.next();
+      if (ch == "'") {
+        stream.skipToEnd();
+        return "comment";
+      }
+      if (ch == '"') {
+        stream.skipTo('"');
+        return "string";
+      }
+
+      if (/\w/.test(ch)) {
+        stream.eatWhile(/\w/);
+        if (regexVBScriptKeyword.test(stream.current())) return "keyword";
+      }
+      return null;
+    }
+  };
+});
+
+CodeMirror.defineMIME("text/vbscript", "vbscript");
diff --git a/modules/files/views/default/assets/mode/velocity/index.html b/modules/files/views/default/assets/mode/velocity/index.html
new file mode 100755
index 0000000..fb59cb5
--- /dev/null
+++ b/modules/files/views/default/assets/mode/velocity/index.html
@@ -0,0 +1,103 @@
+
+
+  
+    
+    CodeMirror: Velocity mode
+    
+    
+    
+    
+    
+    
+  
+  
+    
      CodeMirror: Velocity mode
      
+    
      
+    
+
+    
      MIME types defined: text/velocity.
      
+
+  
+
diff --git a/modules/files/views/default/assets/mode/velocity/velocity.js b/modules/files/views/default/assets/mode/velocity/velocity.js
new file mode 100755
index 0000000..43a97ba
--- /dev/null
+++ b/modules/files/views/default/assets/mode/velocity/velocity.js
@@ -0,0 +1,144 @@
+CodeMirror.defineMode("velocity", function() {
+    function parseWords(str) {
+        var obj = {}, words = str.split(" ");
+        for (var i = 0; i < words.length; ++i) obj[words[i]] = true;
+        return obj;
+    }
+
+    var keywords = parseWords("#end #else #break #stop #[[ #]] " +
+                              "#{end} #{else} #{break} #{stop}");
+    var functions = parseWords("#if #elseif #foreach #set #include #parse #macro #define #evaluate " +
+                               "#{if} #{elseif} #{foreach} #{set} #{include} #{parse} #{macro} #{define} #{evaluate}");
+    var specials = parseWords("$foreach.count $foreach.hasNext $foreach.first $foreach.last $foreach.topmost $foreach.parent $velocityCount");
+    var isOperatorChar = /[+\-*&%=<>!?:\/|]/;
+
+    function chain(stream, state, f) {
+        state.tokenize = f;
+        return f(stream, state);
+    }
+    function tokenBase(stream, state) {
+        var beforeParams = state.beforeParams;
+        state.beforeParams = false;
+        var ch = stream.next();
+        // start of string?
+        if ((ch == '"' || ch == "'") && state.inParams)
+            return chain(stream, state, tokenString(ch));
+        // is it one of the special signs []{}().,;? Seperator?
+        else if (/[\[\]{}\(\),;\.]/.test(ch)) {
+            if (ch == "(" && beforeParams) state.inParams = true;
+            else if (ch == ")") state.inParams = false;
+            return null;
+        }
+        // start of a number value?
+        else if (/\d/.test(ch)) {
+            stream.eatWhile(/[\w\.]/);
+            return "number";
+        }
+        // multi line comment?
+        else if (ch == "#" && stream.eat("*")) {
+            return chain(stream, state, tokenComment);
+        }
+        // unparsed content?
+        else if (ch == "#" && stream.match(/ *\[ *\[/)) {
+            return chain(stream, state, tokenUnparsed);
+        }
+        // single line comment?
+        else if (ch == "#" && stream.eat("#")) {
+            stream.skipToEnd();
+            return "comment";
+        }
+        // variable?
+        else if (ch == "$") {
+            stream.eatWhile(/[\w\d\$_\.{}]/);
+            // is it one of the specials?
+            if (specials && specials.propertyIsEnumerable(stream.current().toLowerCase())) {
+                return "keyword";
+            }
+            else {
+                state.beforeParams = true;
+                return "builtin";
+            }
+        }
+        // is it a operator?
+        else if (isOperatorChar.test(ch)) {
+            stream.eatWhile(isOperatorChar);
+            return "operator";
+        }
+        else {
+            // get the whole word
+            stream.eatWhile(/[\w\$_{}]/);
+            var word = stream.current().toLowerCase();
+            // is it one of the listed keywords?
+            if (keywords && keywords.propertyIsEnumerable(word))
+                return "keyword";
+            // is it one of the listed functions?
+            if (functions && functions.propertyIsEnumerable(word) ||
+                stream.current().match(/^#[a-z0-9_]+ *$/i) && stream.peek()=="(") {
+                state.beforeParams = true;
+                return "keyword";
+            }
+            // default: just a "word"
+            return null;
+        }
+    }
+
+    function tokenString(quote) {
+        return function(stream, state) {
+            var escaped = false, next, end = false;
+            while ((next = stream.next()) != null) {
+                if (next == quote && !escaped) {
+                    end = true;
+                    break;
+                }
+                escaped = !escaped && next == "\\";
+            }
+            if (end) state.tokenize = tokenBase;
+            return "string";
+        };
+    }
+
+    function tokenComment(stream, state) {
+        var maybeEnd = false, ch;
+        while (ch = stream.next()) {
+            if (ch == "#" && maybeEnd) {
+                state.tokenize = tokenBase;
+                break;
+            }
+            maybeEnd = (ch == "*");
+        }
+        return "comment";
+    }
+
+    function tokenUnparsed(stream, state) {
+        var maybeEnd = 0, ch;
+        while (ch = stream.next()) {
+            if (ch == "#" && maybeEnd == 2) {
+                state.tokenize = tokenBase;
+                break;
+            }
+            if (ch == "]")
+                maybeEnd++;
+            else if (ch != " ")
+                maybeEnd = 0;
+        }
+        return "meta";
+    }
+    // Interface
+
+    return {
+        startState: function() {
+            return {
+                tokenize: tokenBase,
+                beforeParams: false,
+                inParams: false
+            };
+        },
+
+        token: function(stream, state) {
+            if (stream.eatSpace()) return null;
+            return state.tokenize(stream, state);
+        }
+    };
+});
+
+CodeMirror.defineMIME("text/velocity", "velocity");
diff --git a/modules/files/views/default/assets/mode/verilog/index.html b/modules/files/views/default/assets/mode/verilog/index.html
new file mode 100755
index 0000000..f7c88c6
--- /dev/null
+++ b/modules/files/views/default/assets/mode/verilog/index.html
@@ -0,0 +1,121 @@
+
+
+  
+    
+    CodeMirror: Verilog mode
+    
+    
+    
+    
+    
+  
+  
+    
      CodeMirror: Verilog mode
      
+
+
      
+
+    
+
+    
      Simple mode that tries to handle Verilog-like languages as well as it
+    can. Takes one configuration parameters: keywords, an
+    object whose property names are the keywords in the language.
      
+
+    
      MIME types defined: text/x-verilog (Verilog code).
      
+  
+
diff --git a/modules/files/views/default/assets/mode/verilog/verilog.js b/modules/files/views/default/assets/mode/verilog/verilog.js
new file mode 100755
index 0000000..708de23
--- /dev/null
+++ b/modules/files/views/default/assets/mode/verilog/verilog.js
@@ -0,0 +1,182 @@
+CodeMirror.defineMode("verilog", function(config, parserConfig) {
+  var indentUnit = config.indentUnit,
+      keywords = parserConfig.keywords || {},
+      blockKeywords = parserConfig.blockKeywords || {},
+      atoms = parserConfig.atoms || {},
+      hooks = parserConfig.hooks || {},
+      multiLineStrings = parserConfig.multiLineStrings;
+  var isOperatorChar = /[&|~>
+
+  
+    
+    CodeMirror: XML mode
+    
+    
+    
+    
+    
+  
+  
+    
      CodeMirror: XML mode
      
+    
      
+    
+    
      The XML mode supports two configuration parameters:
      
+    
      
+      
      htmlMode (boolean)
      
+      
      This switches the mode to parse HTML instead of XML. This
+      means attributes do not have to be quoted, and some elements
+      (such as br) do not require a closing tag.
      
+      
      alignCDATA (boolean)
      
+      
      Setting this to true will force the opening tag of CDATA
+      blocks to not be indented.
      
+    
      
+
+    
      MIME types defined: application/xml, text/html.
      
+  
+
diff --git a/modules/files/views/default/assets/mode/xml/xml.js b/modules/files/views/default/assets/mode/xml/xml.js
new file mode 100755
index 0000000..440343b
--- /dev/null
+++ b/modules/files/views/default/assets/mode/xml/xml.js
@@ -0,0 +1,328 @@
+CodeMirror.defineMode("xml", function(config, parserConfig) {
+  var indentUnit = config.indentUnit;
+  var multilineTagIndentFactor = parserConfig.multilineTagIndentFactor || 1;
+
+  var Kludges = parserConfig.htmlMode ? {
+    autoSelfClosers: {'area': true, 'base': true, 'br': true, 'col': true, 'command': true,
+                      'embed': true, 'frame': true, 'hr': true, 'img': true, 'input': true,
+                      'keygen': true, 'link': true, 'meta': true, 'param': true, 'source': true,
+                      'track': true, 'wbr': true},
+    implicitlyClosed: {'dd': true, 'li': true, 'optgroup': true, 'option': true, 'p': true,
+                       'rp': true, 'rt': true, 'tbody': true, 'td': true, 'tfoot': true,
+                       'th': true, 'tr': true},
+    contextGrabbers: {
+      'dd': {'dd': true, 'dt': true},
+      'dt': {'dd': true, 'dt': true},
+      'li': {'li': true},
+      'option': {'option': true, 'optgroup': true},
+      'optgroup': {'optgroup': true},
+      'p': {'address': true, 'article': true, 'aside': true, 'blockquote': true, 'dir': true,
+            'div': true, 'dl': true, 'fieldset': true, 'footer': true, 'form': true,
+            'h1': true, 'h2': true, 'h3': true, 'h4': true, 'h5': true, 'h6': true,
+            'header': true, 'hgroup': true, 'hr': true, 'menu': true, 'nav': true, 'ol': true,
+            'p': true, 'pre': true, 'section': true, 'table': true, 'ul': true},
+      'rp': {'rp': true, 'rt': true},
+      'rt': {'rp': true, 'rt': true},
+      'tbody': {'tbody': true, 'tfoot': true},
+      'td': {'td': true, 'th': true},
+      'tfoot': {'tbody': true},
+      'th': {'td': true, 'th': true},
+      'thead': {'tbody': true, 'tfoot': true},
+      'tr': {'tr': true}
+    },
+    doNotIndent: {"pre": true},
+    allowUnquoted: true,
+    allowMissing: true
+  } : {
+    autoSelfClosers: {},
+    implicitlyClosed: {},
+    contextGrabbers: {},
+    doNotIndent: {},
+    allowUnquoted: false,
+    allowMissing: false
+  };
+  var alignCDATA = parserConfig.alignCDATA;
+
+  // Return variables for tokenizers
+  var tagName, type;
+
+  function inText(stream, state) {
+    function chain(parser) {
+      state.tokenize = parser;
+      return parser(stream, state);
+    }
+
+    var ch = stream.next();
+    if (ch == "<") {
+      if (stream.eat("!")) {
+        if (stream.eat("[")) {
+          if (stream.match("CDATA[")) return chain(inBlock("atom", "]]>"));
+          else return null;
+        }
+        else if (stream.match("--")) return chain(inBlock("comment", "-->"));
+        else if (stream.match("DOCTYPE", true, true)) {
+          stream.eatWhile(/[\w\._\-]/);
+          return chain(doctype(1));
+        }
+        else return null;
+      }
+      else if (stream.eat("?")) {
+        stream.eatWhile(/[\w\._\-]/);
+        state.tokenize = inBlock("meta", "?>");
+        return "meta";
+      }
+      else {
+        var isClose = stream.eat("/");
+        tagName = "";
+        var c;
+        while ((c = stream.eat(/[^\s\u00a0=<>\"\'\/?]/))) tagName += c;
+        if (!tagName) return "error";
+        type = isClose ? "closeTag" : "openTag";
+        state.tokenize = inTag;
+        return "tag";
+      }
+    }
+    else if (ch == "&") {
+      var ok;
+      if (stream.eat("#")) {
+        if (stream.eat("x")) {
+          ok = stream.eatWhile(/[a-fA-F\d]/) && stream.eat(";");
+        } else {
+          ok = stream.eatWhile(/[\d]/) && stream.eat(";");
+        }
+      } else {
+        ok = stream.eatWhile(/[\w\.\-:]/) && stream.eat(";");
+      }
+      return ok ? "atom" : "error";
+    }
+    else {
+      stream.eatWhile(/[^&<]/);
+      return null;
+    }
+  }
+
+  function inTag(stream, state) {
+    var ch = stream.next();
+    if (ch == ">" || (ch == "/" && stream.eat(">"))) {
+      state.tokenize = inText;
+      type = ch == ">" ? "endTag" : "selfcloseTag";
+      return "tag";
+    }
+    else if (ch == "=") {
+      type = "equals";
+      return null;
+    }
+    else if (/[\'\"]/.test(ch)) {
+      state.tokenize = inAttribute(ch);
+      return state.tokenize(stream, state);
+    }
+    else {
+      stream.eatWhile(/[^\s\u00a0=<>\"\']/);
+      return "word";
+    }
+  }
+
+  function inAttribute(quote) {
+    return function(stream, state) {
+      while (!stream.eol()) {
+        if (stream.next() == quote) {
+          state.tokenize = inTag;
+          break;
+        }
+      }
+      return "string";
+    };
+  }
+
+  function inBlock(style, terminator) {
+    return function(stream, state) {
+      while (!stream.eol()) {
+        if (stream.match(terminator)) {
+          state.tokenize = inText;
+          break;
+        }
+        stream.next();
+      }
+      return style;
+    };
+  }
+  function doctype(depth) {
+    return function(stream, state) {
+      var ch;
+      while ((ch = stream.next()) != null) {
+        if (ch == "<") {
+          state.tokenize = doctype(depth + 1);
+          return state.tokenize(stream, state);
+        } else if (ch == ">") {
+          if (depth == 1) {
+            state.tokenize = inText;
+            break;
+          } else {
+            state.tokenize = doctype(depth - 1);
+            return state.tokenize(stream, state);
+          }
+        }
+      }
+      return "meta";
+    };
+  }
+
+  var curState, curStream, setStyle;
+  function pass() {
+    for (var i = arguments.length - 1; i >= 0; i--) curState.cc.push(arguments[i]);
+  }
+  function cont() {
+    pass.apply(null, arguments);
+    return true;
+  }
+
+  function pushContext(tagName, startOfLine) {
+    var noIndent = Kludges.doNotIndent.hasOwnProperty(tagName) || (curState.context && curState.context.noIndent);
+    curState.context = {
+      prev: curState.context,
+      tagName: tagName,
+      indent: curState.indented,
+      startOfLine: startOfLine,
+      noIndent: noIndent
+    };
+  }
+  function popContext() {
+    if (curState.context) curState.context = curState.context.prev;
+  }
+
+  function element(type) {
+    if (type == "openTag") {
+      curState.tagName = tagName;
+      curState.tagStart = curStream.column();
+      return cont(attributes, endtag(curState.startOfLine));
+    } else if (type == "closeTag") {
+      var err = false;
+      if (curState.context) {
+        if (curState.context.tagName != tagName) {
+          if (Kludges.implicitlyClosed.hasOwnProperty(curState.context.tagName.toLowerCase())) {
+            popContext();
+          }
+          err = !curState.context || curState.context.tagName != tagName;
+        }
+      } else {
+        err = true;
+      }
+      if (err) setStyle = "error";
+      return cont(endclosetag(err));
+    }
+    return cont();
+  }
+  function endtag(startOfLine) {
+    return function(type) {
+      var tagName = curState.tagName;
+      curState.tagName = curState.tagStart = null;
+      if (type == "selfcloseTag" ||
+          (type == "endTag" && Kludges.autoSelfClosers.hasOwnProperty(tagName.toLowerCase()))) {
+        maybePopContext(tagName.toLowerCase());
+        return cont();
+      }
+      if (type == "endTag") {
+        maybePopContext(tagName.toLowerCase());
+        pushContext(tagName, startOfLine);
+        return cont();
+      }
+      return cont();
+    };
+  }
+  function endclosetag(err) {
+    return function(type) {
+      if (err) setStyle = "error";
+      if (type == "endTag") { popContext(); return cont(); }
+      setStyle = "error";
+      return cont(arguments.callee);
+    };
+  }
+  function maybePopContext(nextTagName) {
+    var parentTagName;
+    while (true) {
+      if (!curState.context) {
+        return;
+      }
+      parentTagName = curState.context.tagName.toLowerCase();
+      if (!Kludges.contextGrabbers.hasOwnProperty(parentTagName) ||
+          !Kludges.contextGrabbers[parentTagName].hasOwnProperty(nextTagName)) {
+        return;
+      }
+      popContext();
+    }
+  }
+
+  function attributes(type) {
+    if (type == "word") {setStyle = "attribute"; return cont(attribute, attributes);}
+    if (type == "endTag" || type == "selfcloseTag") return pass();
+    setStyle = "error";
+    return cont(attributes);
+  }
+  function attribute(type) {
+    if (type == "equals") return cont(attvalue, attributes);
+    if (!Kludges.allowMissing) setStyle = "error";
+    else if (type == "word") setStyle = "attribute";
+    return (type == "endTag" || type == "selfcloseTag") ? pass() : cont();
+  }
+  function attvalue(type) {
+    if (type == "string") return cont(attvaluemaybe);
+    if (type == "word" && Kludges.allowUnquoted) {setStyle = "string"; return cont();}
+    setStyle = "error";
+    return (type == "endTag" || type == "selfCloseTag") ? pass() : cont();
+  }
+  function attvaluemaybe(type) {
+    if (type == "string") return cont(attvaluemaybe);
+    else return pass();
+  }
+
+  return {
+    startState: function() {
+      return {tokenize: inText, cc: [], indented: 0, startOfLine: true, tagName: null, tagStart: null, context: null};
+    },
+
+    token: function(stream, state) {
+      if (!state.tagName && stream.sol()) {
+        state.startOfLine = true;
+        state.indented = stream.indentation();
+      }
+      if (stream.eatSpace()) return null;
+
+      setStyle = type = tagName = null;
+      var style = state.tokenize(stream, state);
+      state.type = type;
+      if ((style || type) && style != "comment") {
+        curState = state; curStream = stream;
+        while (true) {
+          var comb = state.cc.pop() || element;
+          if (comb(type || style)) break;
+        }
+      }
+      state.startOfLine = false;
+      return setStyle || style;
+    },
+
+    indent: function(state, textAfter, fullLine) {
+      var context = state.context;
+      if ((state.tokenize != inTag && state.tokenize != inText) ||
+          context && context.noIndent)
+        return fullLine ? fullLine.match(/^(\s*)/)[0].length : 0;
+      if (state.tagName) return state.tagStart + indentUnit * multilineTagIndentFactor;
+      if (alignCDATA && /
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
\ No newline at end of file
diff --git a/modules/files/views/default/assets/mode/xquery/index.html b/modules/files/views/default/assets/mode/xquery/index.html
new file mode 100755
index 0000000..27acb89
--- /dev/null
+++ b/modules/files/views/default/assets/mode/xquery/index.html
@@ -0,0 +1,221 @@
+ 
+ 
+
+   
+    
+    CodeMirror: XQuery mode 
+     
+     
+     
+     
+     
+     
+   
+   
+    
      CodeMirror: XQuery mode
       
+ 
+
       
+	 
+
       
+ 
+     
+ 
+    
      MIME types defined: application/xquery.
       
+ 
+    
      Development of the CodeMirror XQuery mode was sponsored by 
+      MarkLogic and developed by 
+      Mike Brevoort.
+    
      
+ 
+   
+
diff --git a/modules/files/views/default/assets/mode/xquery/test.js b/modules/files/views/default/assets/mode/xquery/test.js
new file mode 100755
index 0000000..41719dd
--- /dev/null
+++ b/modules/files/views/default/assets/mode/xquery/test.js
@@ -0,0 +1,64 @@
+// Don't take these too seriously -- the expected results appear to be
+// based on the results of actual runs without any serious manual
+// verification. If a change you made causes them to fail, the test is
+// as likely to wrong as the code.
+
+(function() {
+  var mode = CodeMirror.getMode({tabSize: 4}, "xquery");
+  function MT(name) { test.mode(name, mode, Array.prototype.slice.call(arguments, 1)); }
+
+  MT("eviltest",
+     "[keyword xquery] [keyword version] [variable "1][keyword .][atom 0][keyword -][variable ml"][def&variable ;]      [comment (: this is       : a          \"comment\" :)]",
+     "      [keyword let] [variable $let] [keyword :=] [variable <x] [variable attr][keyword =][variable "value">"test"<func>][def&variable ;function]() [variable $var] {[keyword function]()} {[variable $var]}[variable <][keyword /][variable func><][keyword /][variable x>]",
+     "      [keyword let] [variable $joe][keyword :=][atom 1]",
+     "      [keyword return] [keyword element] [variable element] {",
+     "          [keyword attribute] [variable attribute] { [atom 1] },",
+     "          [keyword element] [variable test] { [variable 'a'] },           [keyword attribute] [variable foo] { [variable "bar"] },",
+     "          [def&variable fn:doc]()[[ [variable foo][keyword /][variable @bar] [keyword eq] [variable $let] ]],",
+     "          [keyword //][variable x] }                 [comment (: a more 'evil' test :)]",
+     "      [comment (: Modified Blakeley example (: with nested comment :) ... :)]",
+     "      [keyword declare] [keyword private] [keyword function] [def&variable local:declare]() {()}[variable ;]",
+     "      [keyword declare] [keyword private] [keyword function] [def&variable local:private]() {()}[variable ;]",
+     "      [keyword declare] [keyword private] [keyword function] [def&variable local:function]() {()}[variable ;]",
+     "      [keyword declare] [keyword private] [keyword function] [def&variable local:local]() {()}[variable ;]",
+     "      [keyword let] [variable $let] [keyword :=] [variable <let>let] [variable $let] [keyword :=] [variable "let"<][keyword /let][variable >]",
+     "      [keyword return] [keyword element] [variable element] {",
+     "          [keyword attribute] [variable attribute] { [keyword try] { [def&variable xdmp:version]() } [keyword catch]([variable $e]) { [def&variable xdmp:log]([variable $e]) } },",
+     "          [keyword attribute] [variable fn:doc] { [variable "bar"] [variable castable] [keyword as] [atom xs:string] },",
+     "          [keyword element] [variable text] { [keyword text] { [variable "text"] } },",
+     "          [def&variable fn:doc]()[[ [qualifier child::][variable eq][keyword /]([variable @bar] [keyword |] [qualifier attribute::][variable attribute]) [keyword eq] [variable $let] ]],",
+     "          [keyword //][variable fn:doc]",
+     "      }");
+
+  MT("testEmptySequenceKeyword",
+     "[string \"foo\"] [keyword instance] [keyword of] [keyword empty-sequence]()");
+
+  MT("testMultiAttr",
+     "[tag 
      ][variable hello] [variable world][tag 
      ]");
+
+  MT("test namespaced variable",
+     "[keyword declare] [keyword namespace] [variable e] [keyword =] [string \"http://example.com/ANamespace\"][variable ;declare] [keyword variable] [variable $e:exampleComThisVarIsNotRecognized] [keyword as] [keyword element]([keyword *]) [variable external;]");
+
+  MT("test EQName variable",
+     "[keyword declare] [keyword variable] [variable $\"http://www.example.com/ns/my\":var] [keyword :=] [atom 12][variable ;]",
+     "[tag ]{[variable $\"http://www.example.com/ns/my\":var]}[tag ]");
+
+  MT("test EQName function",
+     "[keyword declare] [keyword function] [def&variable \"http://www.example.com/ns/my\":fn] ([variable $a] [keyword as] [atom xs:integer]) [keyword as] [atom xs:integer] {",
+     "   [variable $a] [keyword +] [atom 2]",
+     "}[variable ;]",
+     "[tag ]{[def&variable \"http://www.example.com/ns/my\":fn]([atom 12])}[tag ]");
+
+  MT("test EQName function with single quotes",
+     "[keyword declare] [keyword function] [def&variable 'http://www.example.com/ns/my':fn] ([variable $a] [keyword as] [atom xs:integer]) [keyword as] [atom xs:integer] {",
+     "   [variable $a] [keyword +] [atom 2]",
+     "}[variable ;]",
+     "[tag ]{[def&variable 'http://www.example.com/ns/my':fn]([atom 12])}[tag ]");
+
+  MT("testProcessingInstructions",
+     "[def&variable data]([comment&meta ]) [keyword instance] [keyword of] [atom xs:string]");
+
+  MT("testQuoteEscapeDouble",
+     "[keyword let] [variable $rootfolder] [keyword :=] [string \"c:\\builds\\winnt\\HEAD\\qa\\scripts\\\"]",
+     "[keyword let] [variable $keysfolder] [keyword :=] [def&variable concat]([variable $rootfolder], [string \"keys\\\"])");
+})();
diff --git a/modules/files/views/default/assets/mode/xquery/xquery.js b/modules/files/views/default/assets/mode/xquery/xquery.js
new file mode 100755
index 0000000..95decc1
--- /dev/null
+++ b/modules/files/views/default/assets/mode/xquery/xquery.js
@@ -0,0 +1,450 @@
+/*
+Copyright (C) 2011 by MarkLogic Corporation
+Author: Mike Brevoort 
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
+*/
+CodeMirror.defineMode("xquery", function() {
+
+  // The keywords object is set to the result of this self executing
+  // function. Each keyword is a property of the keywords object whose
+  // value is {type: atype, style: astyle}
+  var keywords = function(){
+    // conveinence functions used to build keywords object
+    function kw(type) {return {type: type, style: "keyword"};}
+    var A = kw("keyword a")
+      , B = kw("keyword b")
+      , C = kw("keyword c")
+      , operator = kw("operator")
+      , atom = {type: "atom", style: "atom"}
+      , punctuation = {type: "punctuation", style: null}
+      , qualifier = {type: "axis_specifier", style: "qualifier"};
+
+    // kwObj is what is return from this function at the end
+    var kwObj = {
+      'if': A, 'switch': A, 'while': A, 'for': A,
+      'else': B, 'then': B, 'try': B, 'finally': B, 'catch': B,
+      'element': C, 'attribute': C, 'let': C, 'implements': C, 'import': C, 'module': C, 'namespace': C,
+      'return': C, 'super': C, 'this': C, 'throws': C, 'where': C, 'private': C,
+      ',': punctuation,
+      'null': atom, 'fn:false()': atom, 'fn:true()': atom
+    };
+
+    // a list of 'basic' keywords. For each add a property to kwObj with the value of
+    // {type: basic[i], style: "keyword"} e.g. 'after' --> {type: "after", style: "keyword"}
+    var basic = ['after','ancestor','ancestor-or-self','and','as','ascending','assert','attribute','before',
+    'by','case','cast','child','comment','declare','default','define','descendant','descendant-or-self',
+    'descending','document','document-node','element','else','eq','every','except','external','following',
+    'following-sibling','follows','for','function','if','import','in','instance','intersect','item',
+    'let','module','namespace','node','node','of','only','or','order','parent','precedes','preceding',
+    'preceding-sibling','processing-instruction','ref','return','returns','satisfies','schema','schema-element',
+    'self','some','sortby','stable','text','then','to','treat','typeswitch','union','variable','version','where',
+    'xquery', 'empty-sequence'];
+    for(var i=0, l=basic.length; i < l; i++) { kwObj[basic[i]] = kw(basic[i]);};
+
+    // a list of types. For each add a property to kwObj with the value of
+    // {type: "atom", style: "atom"}
+    var types = ['xs:string', 'xs:float', 'xs:decimal', 'xs:double', 'xs:integer', 'xs:boolean', 'xs:date', 'xs:dateTime',
+    'xs:time', 'xs:duration', 'xs:dayTimeDuration', 'xs:time', 'xs:yearMonthDuration', 'numeric', 'xs:hexBinary',
+    'xs:base64Binary', 'xs:anyURI', 'xs:QName', 'xs:byte','xs:boolean','xs:anyURI','xf:yearMonthDuration'];
+    for(var i=0, l=types.length; i < l; i++) { kwObj[types[i]] = atom;};
+
+    // each operator will add a property to kwObj with value of {type: "operator", style: "keyword"}
+    var operators = ['eq', 'ne', 'lt', 'le', 'gt', 'ge', ':=', '=', '>', '>=', '<', '<=', '.', '|', '?', 'and', 'or', 'div', 'idiv', 'mod', '*', '/', '+', '-'];
+    for(var i=0, l=operators.length; i < l; i++) { kwObj[operators[i]] = operator;};
+
+    // each axis_specifiers will add a property to kwObj with value of {type: "axis_specifier", style: "qualifier"}
+    var axis_specifiers = ["self::", "attribute::", "child::", "descendant::", "descendant-or-self::", "parent::",
+    "ancestor::", "ancestor-or-self::", "following::", "preceding::", "following-sibling::", "preceding-sibling::"];
+    for(var i=0, l=axis_specifiers.length; i < l; i++) { kwObj[axis_specifiers[i]] = qualifier; };
+
+    return kwObj;
+  }();
+
+  // Used as scratch variables to communicate multiple values without
+  // consing up tons of objects.
+  var type, content;
+
+  function ret(tp, style, cont) {
+    type = tp; content = cont;
+    return style;
+  }
+
+  function chain(stream, state, f) {
+    state.tokenize = f;
+    return f(stream, state);
+  }
+
+  // the primary mode tokenizer
+  function tokenBase(stream, state) {
+    var ch = stream.next(),
+        mightBeFunction = false,
+        isEQName = isEQNameAhead(stream);
+
+    // an XML tag (if not in some sub, chained tokenizer)
+    if (ch == "<") {
+      if(stream.match("!--", true))
+        return chain(stream, state, tokenXMLComment);
+
+      if(stream.match("![CDATA", false)) {
+        state.tokenize = tokenCDATA;
+        return ret("tag", "tag");
+      }
+
+      if(stream.match("?", false)) {
+        return chain(stream, state, tokenPreProcessing);
+      }
+
+      var isclose = stream.eat("/");
+      stream.eatSpace();
+      var tagName = "", c;
+      while ((c = stream.eat(/[^\s\u00a0=<>\"\'\/?]/))) tagName += c;
+
+      return chain(stream, state, tokenTag(tagName, isclose));
+    }
+    // start code block
+    else if(ch == "{") {
+      pushStateStack(state,{ type: "codeblock"});
+      return ret("", null);
+    }
+    // end code block
+    else if(ch == "}") {
+      popStateStack(state);
+      return ret("", null);
+    }
+    // if we're in an XML block
+    else if(isInXmlBlock(state)) {
+      if(ch == ">")
+        return ret("tag", "tag");
+      else if(ch == "/" && stream.eat(">")) {
+        popStateStack(state);
+        return ret("tag", "tag");
+      }
+      else
+        return ret("word", "variable");
+    }
+    // if a number
+    else if (/\d/.test(ch)) {
+      stream.match(/^\d*(?:\.\d*)?(?:E[+\-]?\d+)?/);
+      return ret("number", "atom");
+    }
+    // comment start
+    else if (ch === "(" && stream.eat(":")) {
+      pushStateStack(state, { type: "comment"});
+      return chain(stream, state, tokenComment);
+    }
+    // quoted string
+    else if (  !isEQName && (ch === '"' || ch === "'"))
+      return chain(stream, state, tokenString(ch));
+    // variable
+    else if(ch === "$") {
+      return chain(stream, state, tokenVariable);
+    }
+    // assignment
+    else if(ch ===":" && stream.eat("=")) {
+      return ret("operator", "keyword");
+    }
+    // open paren
+    else if(ch === "(") {
+      pushStateStack(state, { type: "paren"});
+      return ret("", null);
+    }
+    // close paren
+    else if(ch === ")") {
+      popStateStack(state);
+      return ret("", null);
+    }
+    // open paren
+    else if(ch === "[") {
+      pushStateStack(state, { type: "bracket"});
+      return ret("", null);
+    }
+    // close paren
+    else if(ch === "]") {
+      popStateStack(state);
+      return ret("", null);
+    }
+    else {
+      var known = keywords.propertyIsEnumerable(ch) && keywords[ch];
+
+      // if there's a EQName ahead, consume the rest of the string portion, it's likely a function
+      if(isEQName && ch === '\"') while(stream.next() !== '"'){}
+      if(isEQName && ch === '\'') while(stream.next() !== '\''){}
+
+      // gobble up a word if the character is not known
+      if(!known) stream.eatWhile(/[\w\$_-]/);
+
+      // gobble a colon in the case that is a lib func type call fn:doc
+      var foundColon = stream.eat(":");
+
+      // if there's not a second colon, gobble another word. Otherwise, it's probably an axis specifier
+      // which should get matched as a keyword
+      if(!stream.eat(":") && foundColon) {
+        stream.eatWhile(/[\w\$_-]/);
+      }
+      // if the next non whitespace character is an open paren, this is probably a function (if not a keyword of other sort)
+      if(stream.match(/^[ \t]*\(/, false)) {
+        mightBeFunction = true;
+      }
+      // is the word a keyword?
+      var word = stream.current();
+      known = keywords.propertyIsEnumerable(word) && keywords[word];
+
+      // if we think it's a function call but not yet known,
+      // set style to variable for now for lack of something better
+      if(mightBeFunction && !known) known = {type: "function_call", style: "variable def"};
+
+      // if the previous word was element, attribute, axis specifier, this word should be the name of that
+      if(isInXmlConstructor(state)) {
+        popStateStack(state);
+        return ret("word", "variable", word);
+      }
+      // as previously checked, if the word is element,attribute, axis specifier, call it an "xmlconstructor" and
+      // push the stack so we know to look for it on the next word
+      if(word == "element" || word == "attribute" || known.type == "axis_specifier") pushStateStack(state, {type: "xmlconstructor"});
+
+      // if the word is known, return the details of that else just call this a generic 'word'
+      return known ? ret(known.type, known.style, word) :
+                     ret("word", "variable", word);
+    }
+  }
+
+  // handle comments, including nested
+  function tokenComment(stream, state) {
+    var maybeEnd = false, maybeNested = false, nestedCount = 0, ch;
+    while (ch = stream.next()) {
+      if (ch == ")" && maybeEnd) {
+        if(nestedCount > 0)
+          nestedCount--;
+        else {
+          popStateStack(state);
+          break;
+        }
+      }
+      else if(ch == ":" && maybeNested) {
+        nestedCount++;
+      }
+      maybeEnd = (ch == ":");
+      maybeNested = (ch == "(");
+    }
+
+    return ret("comment", "comment");
+  }
+
+  // tokenizer for string literals
+  // optionally pass a tokenizer function to set state.tokenize back to when finished
+  function tokenString(quote, f) {
+    return function(stream, state) {
+      var ch;
+
+      if(isInString(state) && stream.current() == quote) {
+        popStateStack(state);
+        if(f) state.tokenize = f;
+        return ret("string", "string");
+      }
+
+      pushStateStack(state, { type: "string", name: quote, tokenize: tokenString(quote, f) });
+
+      // if we're in a string and in an XML block, allow an embedded code block
+      if(stream.match("{", false) && isInXmlAttributeBlock(state)) {
+        state.tokenize = tokenBase;
+        return ret("string", "string");
+      }
+
+
+      while (ch = stream.next()) {
+        if (ch ==  quote) {
+          popStateStack(state);
+          if(f) state.tokenize = f;
+          break;
+        }
+        else {
+          // if we're in a string and in an XML block, allow an embedded code block in an attribute
+          if(stream.match("{", false) && isInXmlAttributeBlock(state)) {
+            state.tokenize = tokenBase;
+            return ret("string", "string");
+          }
+
+        }
+      }
+
+      return ret("string", "string");
+    };
+  }
+
+  // tokenizer for variables
+  function tokenVariable(stream, state) {
+    var isVariableChar = /[\w\$_-]/;
+
+    // a variable may start with a quoted EQName so if the next character is quote, consume to the next quote
+    if(stream.eat("\"")) {
+      while(stream.next() !== '\"'){};
+      stream.eat(":");
+    } else {
+      stream.eatWhile(isVariableChar);
+      if(!stream.match(":=", false)) stream.eat(":");
+    }
+    stream.eatWhile(isVariableChar);
+    state.tokenize = tokenBase;
+    return ret("variable", "variable");
+  }
+
+  // tokenizer for XML tags
+  function tokenTag(name, isclose) {
+    return function(stream, state) {
+      stream.eatSpace();
+      if(isclose && stream.eat(">")) {
+        popStateStack(state);
+        state.tokenize = tokenBase;
+        return ret("tag", "tag");
+      }
+      // self closing tag without attributes?
+      if(!stream.eat("/"))
+        pushStateStack(state, { type: "tag", name: name, tokenize: tokenBase});
+      if(!stream.eat(">")) {
+        state.tokenize = tokenAttribute;
+        return ret("tag", "tag");
+      }
+      else {
+        state.tokenize = tokenBase;
+      }
+      return ret("tag", "tag");
+    };
+  }
+
+  // tokenizer for XML attributes
+  function tokenAttribute(stream, state) {
+    var ch = stream.next();
+
+    if(ch == "/" && stream.eat(">")) {
+      if(isInXmlAttributeBlock(state)) popStateStack(state);
+      if(isInXmlBlock(state)) popStateStack(state);
+      return ret("tag", "tag");
+    }
+    if(ch == ">") {
+      if(isInXmlAttributeBlock(state)) popStateStack(state);
+      return ret("tag", "tag");
+    }
+    if(ch == "=")
+      return ret("", null);
+    // quoted string
+    if (ch == '"' || ch == "'")
+      return chain(stream, state, tokenString(ch, tokenAttribute));
+
+    if(!isInXmlAttributeBlock(state))
+      pushStateStack(state, { type: "attribute", name: name, tokenize: tokenAttribute});
+
+    stream.eat(/[a-zA-Z_:]/);
+    stream.eatWhile(/[-a-zA-Z0-9_:.]/);
+    stream.eatSpace();
+
+    // the case where the attribute has not value and the tag was closed
+    if(stream.match(">", false) || stream.match("/", false)) {
+      popStateStack(state);
+      state.tokenize = tokenBase;
+    }
+
+    return ret("attribute", "attribute");
+  }
+
+  // handle comments, including nested
+  function tokenXMLComment(stream, state) {
+    var ch;
+    while (ch = stream.next()) {
+      if (ch == "-" && stream.match("->", true)) {
+        state.tokenize = tokenBase;
+        return ret("comment", "comment");
+      }
+    }
+  }
+
+
+  // handle CDATA
+  function tokenCDATA(stream, state) {
+    var ch;
+    while (ch = stream.next()) {
+      if (ch == "]" && stream.match("]", true)) {
+        state.tokenize = tokenBase;
+        return ret("comment", "comment");
+      }
+    }
+  }
+
+  // handle preprocessing instructions
+  function tokenPreProcessing(stream, state) {
+    var ch;
+    while (ch = stream.next()) {
+      if (ch == "?" && stream.match(">", true)) {
+        state.tokenize = tokenBase;
+        return ret("comment", "comment meta");
+      }
+    }
+  }
+
+
+  // functions to test the current context of the state
+  function isInXmlBlock(state) { return isIn(state, "tag"); }
+  function isInXmlAttributeBlock(state) { return isIn(state, "attribute"); }
+  function isInXmlConstructor(state) { return isIn(state, "xmlconstructor"); }
+  function isInString(state) { return isIn(state, "string"); }
+
+  function isEQNameAhead(stream) {
+    // assume we've already eaten a quote (")
+    if(stream.current() === '"')
+      return stream.match(/^[^\"]+\"\:/, false);
+    else if(stream.current() === '\'')
+      return stream.match(/^[^\"]+\'\:/, false);
+    else
+      return false;
+  }
+
+  function isIn(state, type) {
+    return (state.stack.length && state.stack[state.stack.length - 1].type == type);
+  }
+
+  function pushStateStack(state, newState) {
+    state.stack.push(newState);
+  }
+
+  function popStateStack(state) {
+    state.stack.pop();
+    var reinstateTokenize = state.stack.length && state.stack[state.stack.length-1].tokenize;
+    state.tokenize = reinstateTokenize || tokenBase;
+  }
+
+  // the interface for the mode API
+  return {
+    startState: function() {
+      return {
+        tokenize: tokenBase,
+        cc: [],
+        stack: []
+      };
+    },
+
+    token: function(stream, state) {
+      if (stream.eatSpace()) return null;
+      var style = state.tokenize(stream, state);
+      return style;
+    }
+  };
+
+});
+
+CodeMirror.defineMIME("application/xquery", "xquery");
diff --git a/modules/files/views/default/assets/mode/yaml/index.html b/modules/files/views/default/assets/mode/yaml/index.html
new file mode 100755
index 0000000..65e1ea7
--- /dev/null
+++ b/modules/files/views/default/assets/mode/yaml/index.html
@@ -0,0 +1,68 @@
+
+
+  
+    
+    CodeMirror: YAML mode
+    
+    
+    
+    
+    
+  
+  
+    
      CodeMirror: YAML mode
      
+    
      
+    
+
+    
      MIME types defined: text/x-yaml.
      
+
+  
+
diff --git a/modules/files/views/default/assets/mode/yaml/yaml.js b/modules/files/views/default/assets/mode/yaml/yaml.js
new file mode 100755
index 0000000..bdd303d
--- /dev/null
+++ b/modules/files/views/default/assets/mode/yaml/yaml.js
@@ -0,0 +1,95 @@
+CodeMirror.defineMode("yaml", function() {
+
+  var cons = ['true', 'false', 'on', 'off', 'yes', 'no'];
+  var keywordRegex = new RegExp("\\b(("+cons.join(")|(")+"))$", 'i');
+
+  return {
+    token: function(stream, state) {
+      var ch = stream.peek();
+      var esc = state.escaped;
+      state.escaped = false;
+      /* comments */
+      if (ch == "#") { stream.skipToEnd(); return "comment"; }
+      if (state.literal && stream.indentation() > state.keyCol) {
+        stream.skipToEnd(); return "string";
+      } else if (state.literal) { state.literal = false; }
+      if (stream.sol()) {
+        state.keyCol = 0;
+        state.pair = false;
+        state.pairStart = false;
+        /* document start */
+        if(stream.match(/---/)) { return "def"; }
+        /* document end */
+        if (stream.match(/\.\.\./)) { return "def"; }
+        /* array list item */
+        if (stream.match(/\s*-\s+/)) { return 'meta'; }
+      }
+      /* pairs (associative arrays) -> key */
+      if (!state.pair && stream.match(/^\s*([a-z0-9\._-])+(?=\s*:)/i)) {
+        state.pair = true;
+        state.keyCol = stream.indentation();
+        return "atom";
+      }
+      if (state.pair && stream.match(/^:\s*/)) { state.pairStart = true; return 'meta'; }
+
+      /* inline pairs/lists */
+      if (stream.match(/^(\{|\}|\[|\])/)) {
+        if (ch == '{')
+          state.inlinePairs++;
+        else if (ch == '}')
+          state.inlinePairs--;
+        else if (ch == '[')
+          state.inlineList++;
+        else
+          state.inlineList--;
+        return 'meta';
+      }
+
+      /* list seperator */
+      if (state.inlineList > 0 && !esc && ch == ',') {
+        stream.next();
+        return 'meta';
+      }
+      /* pairs seperator */
+      if (state.inlinePairs > 0 && !esc && ch == ',') {
+        state.keyCol = 0;
+        state.pair = false;
+        state.pairStart = false;
+        stream.next();
+        return 'meta';
+      }
+
+      /* start of value of a pair */
+      if (state.pairStart) {
+        /* block literals */
+        if (stream.match(/^\s*(\||\>)\s*/)) { state.literal = true; return 'meta'; };
+        /* references */
+        if (stream.match(/^\s*(\&|\*)[a-z0-9\._-]+\b/i)) { return 'variable-2'; }
+        /* numbers */
+        if (state.inlinePairs == 0 && stream.match(/^\s*-?[0-9\.\,]+\s?$/)) { return 'number'; }
+        if (state.inlinePairs > 0 && stream.match(/^\s*-?[0-9\.\,]+\s?(?=(,|}))/)) { return 'number'; }
+        /* keywords */
+        if (stream.match(keywordRegex)) { return 'keyword'; }
+      }
+
+      /* nothing found, continue */
+      state.pairStart = false;
+      state.escaped = (ch == '\\');
+      stream.next();
+      return null;
+    },
+    startState: function() {
+      return {
+        pair: false,
+        pairStart: false,
+        keyCol: 0,
+        inlinePairs: 0,
+        inlineList: 0,
+        literal: false,
+        escaped: false
+      };
+    }
+  };
+});
+
+CodeMirror.defineMIME("text/x-yaml", "yaml");
diff --git a/modules/files/views/default/assets/mode/z80/index.html b/modules/files/views/default/assets/mode/z80/index.html
new file mode 100755
index 0000000..133c870
--- /dev/null
+++ b/modules/files/views/default/assets/mode/z80/index.html
@@ -0,0 +1,39 @@
+
+
+  
+    
+    CodeMirror: Z80 assembly mode
+    
+    
+    
+    
+    
+  
+  
+    
      CodeMirror: Z80 assembly mode
      
+
+
      
+
+    
+
+    
      MIME type defined: text/x-z80.
      
+  
+
diff --git a/modules/files/views/default/assets/mode/z80/z80.js b/modules/files/views/default/assets/mode/z80/z80.js
new file mode 100755
index 0000000..ff43d32
--- /dev/null
+++ b/modules/files/views/default/assets/mode/z80/z80.js
@@ -0,0 +1,85 @@
+CodeMirror.defineMode('z80', function() {
+  var keywords1 = /^(exx?|(ld|cp|in)([di]r?)?|pop|push|ad[cd]|cpl|daa|dec|inc|neg|sbc|sub|and|bit|[cs]cf|x?or|res|set|r[lr]c?a?|r[lr]d|s[lr]a|srl|djnz|nop|rst|[de]i|halt|im|ot[di]r|out[di]?)\b/i;
+  var keywords2 = /^(call|j[pr]|ret[in]?)\b/i;
+  var keywords3 = /^b_?(call|jump)\b/i;
+  var variables1 = /^(af?|bc?|c|de?|e|hl?|l|i[xy]?|r|sp)\b/i;
+  var variables2 = /^(n?[zc]|p[oe]?|m)\b/i;
+  var errors = /^([hl][xy]|i[xy][hl]|slia|sll)\b/i;
+  var numbers = /^([\da-f]+h|[0-7]+o|[01]+b|\d+)\b/i;
+
+  return {
+    startState: function() {
+      return {context: 0};
+    },
+    token: function(stream, state) {
+      if (!stream.column())
+        state.context = 0;
+
+      if (stream.eatSpace())
+        return null;
+
+      var w;
+
+      if (stream.eatWhile(/\w/)) {
+        w = stream.current();
+
+        if (stream.indentation()) {
+          if (state.context == 1 && variables1.test(w))
+            return 'variable-2';
+
+          if (state.context == 2 && variables2.test(w))
+            return 'variable-3';
+
+          if (keywords1.test(w)) {
+            state.context = 1;
+            return 'keyword';
+          } else if (keywords2.test(w)) {
+            state.context = 2;
+            return 'keyword';
+          } else if (keywords3.test(w)) {
+            state.context = 3;
+            return 'keyword';
+          }
+
+          if (errors.test(w))
+            return 'error';
+        } else if (numbers.test(w)) {
+          return 'number';
+        } else {
+          return null;
+        }
+      } else if (stream.eat(';')) {
+        stream.skipToEnd();
+        return 'comment';
+      } else if (stream.eat('"')) {
+        while (w = stream.next()) {
+          if (w == '"')
+            break;
+
+          if (w == '\\')
+            stream.next();
+        }
+        return 'string';
+      } else if (stream.eat('\'')) {
+        if (stream.match(/\\?.'/))
+          return 'number';
+      } else if (stream.eat('.') || stream.sol() && stream.eat('#')) {
+        state.context = 4;
+
+        if (stream.eatWhile(/\w/))
+          return 'def';
+      } else if (stream.eat('$')) {
+        if (stream.eatWhile(/[\da-f]/i))
+          return 'number';
+      } else if (stream.eat('%')) {
+        if (stream.eatWhile(/[01]/))
+          return 'number';
+      } else {
+        stream.next();
+      }
+      return null;
+    }
+  };
+});
+
+CodeMirror.defineMIME("text/x-z80", "z80");
diff --git a/modules/files/views/default/assets/src/GPL-LICENSE.txt b/modules/files/views/default/assets/src/GPL-LICENSE.txt
new file mode 100755
index 0000000..11dddd0
--- /dev/null
+++ b/modules/files/views/default/assets/src/GPL-LICENSE.txt
@@ -0,0 +1,278 @@
+        GNU GENERAL PUBLIC LICENSE
+           Version 2, June 1991
+
+ Copyright (C) 1989, 1991 Free Software Foundation, Inc.
+ 51 Franklin Street, Fifth Floor, Boston, MA  02110-1301  USA
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+          Preamble
+
+  The licenses for most software are designed to take away your
+freedom to share and change it.  By contrast, the GNU General Public
+License is intended to guarantee your freedom to share and change free
+software--to make sure the software is free for all its users.  This
+General Public License applies to most of the Free Software
+Foundation's software and to any other program whose authors commit to
+using it.  (Some other Free Software Foundation software is covered by
+the GNU Lesser General Public License instead.)  You can apply it to
+your programs, too.
+
+  When we speak of free software, we are referring to freedom, not
+price.  Our General Public Licenses are designed to make sure that you
+have the freedom to distribute copies of free software (and charge for
+this service if you wish), that you receive source code or can get it
+if you want it, that you can change the software or use pieces of it
+in new free programs; and that you know you can do these things.
+
+  To protect your rights, we need to make restrictions that forbid
+anyone to deny you these rights or to ask you to surrender the rights.
+These restrictions translate to certain responsibilities for you if you
+distribute copies of the software, or if you modify it.
+
+  For example, if you distribute copies of such a program, whether
+gratis or for a fee, you must give the recipients all the rights that
+you have.  You must make sure that they, too, receive or can get the
+source code.  And you must show them these terms so they know their
+rights.
+
+  We protect your rights with two steps: (1) copyright the software, and
+(2) offer you this license which gives you legal permission to copy,
+distribute and/or modify the software.
+
+  Also, for each author's protection and ours, we want to make certain
+that everyone understands that there is no warranty for this free
+software.  If the software is modified by someone else and passed on, we
+want its recipients to know that what they have is not the original, so
+that any problems introduced by others will not reflect on the original
+authors' reputations.
+
+  Finally, any free program is threatened constantly by software
+patents.  We wish to avoid the danger that redistributors of a free
+program will individually obtain patent licenses, in effect making the
+program proprietary.  To prevent this, we have made it clear that any
+patent must be licensed for everyone's free use or not licensed at all.
+
+  The precise terms and conditions for copying, distribution and
+modification follow.
+
+        GNU GENERAL PUBLIC LICENSE
+   TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+
+  0. This License applies to any program or other work which contains
+a notice placed by the copyright holder saying it may be distributed
+under the terms of this General Public License.  The "Program", below,
+refers to any such program or work, and a "work based on the Program"
+means either the Program or any derivative work under copyright law:
+that is to say, a work containing the Program or a portion of it,
+either verbatim or with modifications and/or translated into another
+language.  (Hereinafter, translation is included without limitation in
+the term "modification".)  Each licensee is addressed as "you".
+
+Activities other than copying, distribution and modification are not
+covered by this License; they are outside its scope.  The act of
+running the Program is not restricted, and the output from the Program
+is covered only if its contents constitute a work based on the
+Program (independent of having been made by running the Program).
+Whether that is true depends on what the Program does.
+
+  1. You may copy and distribute verbatim copies of the Program's
+source code as you receive it, in any medium, provided that you
+conspicuously and appropriately publish on each copy an appropriate
+copyright notice and disclaimer of warranty; keep intact all the
+notices that refer to this License and to the absence of any warranty;
+and give any other recipients of the Program a copy of this License
+along with the Program.
+
+You may charge a fee for the physical act of transferring a copy, and
+you may at your option offer warranty protection in exchange for a fee.
+
+  2. You may modify your copy or copies of the Program or any portion
+of it, thus forming a work based on the Program, and copy and
+distribute such modifications or work under the terms of Section 1
+above, provided that you also meet all of these conditions:
+
+    a) You must cause the modified files to carry prominent notices
+    stating that you changed the files and the date of any change.
+
+    b) You must cause any work that you distribute or publish, that in
+    whole or in part contains or is derived from the Program or any
+    part thereof, to be licensed as a whole at no charge to all third
+    parties under the terms of this License.
+
+    c) If the modified program normally reads commands interactively
+    when run, you must cause it, when started running for such
+    interactive use in the most ordinary way, to print or display an
+    announcement including an appropriate copyright notice and a
+    notice that there is no warranty (or else, saying that you provide
+    a warranty) and that users may redistribute the program under
+    these conditions, and telling the user how to view a copy of this
+    License.  (Exception: if the Program itself is interactive but
+    does not normally print such an announcement, your work based on
+    the Program is not required to print an announcement.)
+
+These requirements apply to the modified work as a whole.  If
+identifiable sections of that work are not derived from the Program,
+and can be reasonably considered independent and separate works in
+themselves, then this License, and its terms, do not apply to those
+sections when you distribute them as separate works.  But when you
+distribute the same sections as part of a whole which is a work based
+on the Program, the distribution of the whole must be on the terms of
+this License, whose permissions for other licensees extend to the
+entire whole, and thus to each and every part regardless of who wrote it.
+
+Thus, it is not the intent of this section to claim rights or contest
+your rights to work written entirely by you; rather, the intent is to
+exercise the right to control the distribution of derivative or
+collective works based on the Program.
+
+In addition, mere aggregation of another work not based on the Program
+with the Program (or with a work based on the Program) on a volume of
+a storage or distribution medium does not bring the other work under
+the scope of this License.
+
+  3. You may copy and distribute the Program (or a work based on it,
+under Section 2) in object code or executable form under the terms of
+Sections 1 and 2 above provided that you also do one of the following:
+
+    a) Accompany it with the complete corresponding machine-readable
+    source code, which must be distributed under the terms of Sections
+    1 and 2 above on a medium customarily used for software interchange; or,
+
+    b) Accompany it with a written offer, valid for at least three
+    years, to give any third party, for a charge no more than your
+    cost of physically performing source distribution, a complete
+    machine-readable copy of the corresponding source code, to be
+    distributed under the terms of Sections 1 and 2 above on a medium
+    customarily used for software interchange; or,
+
+    c) Accompany it with the information you received as to the offer
+    to distribute corresponding source code.  (This alternative is
+    allowed only for noncommercial distribution and only if you
+    received the program in object code or executable form with such
+    an offer, in accord with Subsection b above.)
+
+The source code for a work means the preferred form of the work for
+making modifications to it.  For an executable work, complete source
+code means all the source code for all modules it contains, plus any
+associated interface definition files, plus the scripts used to
+control compilation and installation of the executable.  However, as a
+special exception, the source code distributed need not include
+anything that is normally distributed (in either source or binary
+form) with the major components (compiler, kernel, and so on) of the
+operating system on which the executable runs, unless that component
+itself accompanies the executable.
+
+If distribution of executable or object code is made by offering
+access to copy from a designated place, then offering equivalent
+access to copy the source code from the same place counts as
+distribution of the source code, even though third parties are not
+compelled to copy the source along with the object code.
+
+  4. You may not copy, modify, sublicense, or distribute the Program
+except as expressly provided under this License.  Any attempt
+otherwise to copy, modify, sublicense or distribute the Program is
+void, and will automatically terminate your rights under this License.
+However, parties who have received copies, or rights, from you under
+this License will not have their licenses terminated so long as such
+parties remain in full compliance.
+
+  5. You are not required to accept this License, since you have not
+signed it.  However, nothing else grants you permission to modify or
+distribute the Program or its derivative works.  These actions are
+prohibited by law if you do not accept this License.  Therefore, by
+modifying or distributing the Program (or any work based on the
+Program), you indicate your acceptance of this License to do so, and
+all its terms and conditions for copying, distributing or modifying
+the Program or works based on it.
+
+  6. Each time you redistribute the Program (or any work based on the
+Program), the recipient automatically receives a license from the
+original licensor to copy, distribute or modify the Program subject to
+these terms and conditions.  You may not impose any further
+restrictions on the recipients' exercise of the rights granted herein.
+You are not responsible for enforcing compliance by third parties to
+this License.
+
+  7. If, as a consequence of a court judgment or allegation of patent
+infringement or for any other reason (not limited to patent issues),
+conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License.  If you cannot
+distribute so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you
+may not distribute the Program at all.  For example, if a patent
+license would not permit royalty-free redistribution of the Program by
+all those who receive copies directly or indirectly through you, then
+the only way you could satisfy both it and this License would be to
+refrain entirely from distribution of the Program.
+
+If any portion of this section is held invalid or unenforceable under
+any particular circumstance, the balance of the section is intended to
+apply and the section as a whole is intended to apply in other
+circumstances.
+
+It is not the purpose of this section to induce you to infringe any
+patents or other property right claims or to contest validity of any
+such claims; this section has the sole purpose of protecting the
+integrity of the free software distribution system, which is
+implemented by public license practices.  Many people have made
+generous contributions to the wide range of software distributed
+through that system in reliance on consistent application of that
+system; it is up to the author/donor to decide if he or she is willing
+to distribute software through any other system and a licensee cannot
+impose that choice.
+
+This section is intended to make thoroughly clear what is believed to
+be a consequence of the rest of this License.
+
+  8. If the distribution and/or use of the Program is restricted in
+certain countries either by patents or by copyrighted interfaces, the
+original copyright holder who places the Program under this License
+may add an explicit geographical distribution limitation excluding
+those countries, so that distribution is permitted only in or among
+countries not thus excluded.  In such case, this License incorporates
+the limitation as if written in the body of this License.
+
+  9. The Free Software Foundation may publish revised and/or new versions
+of the General Public License from time to time.  Such new versions will
+be similar in spirit to the present version, but may differ in detail to
+address new problems or concerns.
+
+Each version is given a distinguishing version number.  If the Program
+specifies a version number of this License which applies to it and "any
+later version", you have the option of following the terms and conditions
+either of that version or of any later version published by the Free
+Software Foundation.  If the Program does not specify a version number of
+this License, you may choose any version ever published by the Free Software
+Foundation.
+
+  10. If you wish to incorporate parts of the Program into other free
+programs whose distribution conditions are different, write to the author
+to ask for permission.  For software which is copyrighted by the Free
+Software Foundation, write to the Free Software Foundation; we sometimes
+make exceptions for this.  Our decision will be guided by the two goals
+of preserving the free status of all derivatives of our free software and
+of promoting the sharing and reuse of software generally.
+
+          NO WARRANTY
+
+  11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
+FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW.  EXCEPT WHEN
+OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
+PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
+OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE.  THE ENTIRE RISK AS
+TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU.  SHOULD THE
+PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
+REPAIR OR CORRECTION.
+
+  12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
+WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
+REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
+INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
+OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
+TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
+YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
+PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
+POSSIBILITY OF SUCH DAMAGES.
diff --git a/modules/files/views/default/assets/src/MIT-License.txt b/modules/files/views/default/assets/src/MIT-License.txt
new file mode 100755
index 0000000..00f78e7
--- /dev/null
+++ b/modules/files/views/default/assets/src/MIT-License.txt
@@ -0,0 +1,7 @@
+Copyright (c) 2006-2012  Martin Wendt (http://wwWendt.de)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
\ No newline at end of file
diff --git a/modules/files/views/default/assets/src/jquery.dynatree.js b/modules/files/views/default/assets/src/jquery.dynatree.js
new file mode 100755
index 0000000..606f3dd
--- /dev/null
+++ b/modules/files/views/default/assets/src/jquery.dynatree.js
@@ -0,0 +1,3432 @@
+/*************************************************************************
+	jquery.dynatree.js
+	Dynamic tree view control, with support for lazy loading of branches.
+
+	Copyright (c) 2006-2013, Martin Wendt (http://wwWendt.de)
+	Dual licensed under the MIT or GPL Version 2 licenses.
+	http://code.google.com/p/dynatree/wiki/LicenseInfo
+
+	A current version and some documentation is available at
+		http://dynatree.googlecode.com/
+
+	$Version: 1.2.4$
+	$Revision: 644, 2013-02-12 21:39:36$
+
+	@depends: jquery.js
+	@depends: jquery.ui.core.js
+	@depends: jquery.cookie.js
+*************************************************************************/
+
+/* jsHint options*/
+// Note: We currently allow eval() to parse the 'data' attribtes, when initializing from HTML.
+// TODO: pass jsHint with the options given in grunt.js only.
+//       The following should not be required:
+/*global alert */
+/*jshint nomen:false, smarttabs:true, eqeqeq:false, evil:true, regexp:false */
+
+/*************************************************************************
+ *	Debug functions
+ */
+
+var _canLog = true;
+
+function _log(mode, msg) {
+	/**
+	 * Usage: logMsg("%o was toggled", this);
+	 */
+	if( !_canLog ){
+		return;
+	}
+	// Remove first argument
+	var args = Array.prototype.slice.apply(arguments, [1]);
+	// Prepend timestamp
+	var dt = new Date();
+	var tag = dt.getHours()+":"+dt.getMinutes()+":"+dt.getSeconds()+"."+dt.getMilliseconds();
+	args[0] = tag + " - " + args[0];
+
+	try {
+		switch( mode ) {
+		case "info":
+			window.console.info.apply(window.console, args);
+			break;
+		case "warn":
+			window.console.warn.apply(window.console, args);
+			break;
+		default:
+			window.console.log.apply(window.console, args);
+			break;
+		}
+	} catch(e) {
+		if( !window.console ){
+			_canLog = false; // Permanently disable, when logging is not supported by the browser
+		}else if(e.number === -2146827850){
+			// fix for IE8, where window.console.log() exists, but does not support .apply()
+			window.console.log(args.join(", "));
+		}
+	}
+}
+
+/* Check browser version, since $.browser was removed in jQuery 1.9 */
+function _checkBrowser(){
+	var matched, browser;
+	function uaMatch( ua ) {
+		ua = ua.toLowerCase();
+		var match = /(chrome)[ \/]([\w.]+)/.exec( ua ) ||
+			 /(webkit)[ \/]([\w.]+)/.exec( ua ) ||
+			 /(opera)(?:.*version|)[ \/]([\w.]+)/.exec( ua ) ||
+			 /(msie) ([\w.]+)/.exec( ua ) ||
+			 ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec( ua ) ||
+			 [];
+		return {
+			browser: match[ 1 ] || "",
+			version: match[ 2 ] || "0"
+		};
+	}
+	matched = uaMatch( navigator.userAgent );
+	browser = {};
+	 if ( matched.browser ) {
+		 browser[ matched.browser ] = true;
+		 browser.version = matched.version;
+	 }
+	 if ( browser.chrome ) {
+		 browser.webkit = true;
+	 } else if ( browser.webkit ) {
+		 browser.safari = true;
+	 }
+	 return browser;
+}
+var BROWSER = jQuery.browser || _checkBrowser();
+
+function logMsg(msg) {
+	Array.prototype.unshift.apply(arguments, ["debug"]);
+	_log.apply(this, arguments);
+}
+
+
+// Forward declaration
+var getDynaTreePersistData = null;
+
+
+
+/*************************************************************************
+ *	Constants
+ */
+var DTNodeStatus_Error   = -1;
+var DTNodeStatus_Loading = 1;
+var DTNodeStatus_Ok      = 0;
+
+
+// Start of local namespace
+(function($) {
+
+/*************************************************************************
+ *	Common tool functions.
+ */
+
+var Class = {
+	create: function() {
+		return function() {
+			this.initialize.apply(this, arguments);
+		};
+	}
+};
+
+// Tool function to get dtnode from the event target:
+function getDtNodeFromElement(el) {
+	alert("getDtNodeFromElement is deprecated");
+	return $.ui.dynatree.getNode(el);
+/*
+	var iMax = 5;
+	while( el && iMax-- ) {
+		if(el.dtnode) { return el.dtnode; }
+		el = el.parentNode;
+	}
+	return null;
+*/
+}
+
+function noop() {
+}
+
+/** Compare two dotted version strings (like '10.2.3').
+ * @returns {Integer} 0: v1 == v2, -1: v1 < v2, 1: v1 > v2
+ */
+function versionCompare(v1, v2) {
+	var v1parts = ("" + v1).split("."),
+		v2parts = ("" + v2).split("."),
+		minLength = Math.min(v1parts.length, v2parts.length),
+		p1, p2, i;
+	// Compare tuple pair-by-pair.
+	for(i = 0; i < minLength; i++) {
+		// Convert to integer if possible, because "8" > "10".
+		p1 = parseInt(v1parts[i], 10);
+		p2 = parseInt(v2parts[i], 10);
+		if (isNaN(p1)){ p1 = v1parts[i]; }
+		if (isNaN(p2)){ p2 = v2parts[i]; }
+		if (p1 == p2) {
+			continue;
+		}else if (p1 > p2) {
+			return 1;
+		}else if (p1 < p2) {
+			return -1;
+		}
+		// one operand is NaN
+		return NaN;
+	}
+	// The longer tuple is always considered 'greater'
+	if (v1parts.length === v2parts.length) {
+		return 0;
+	}
+	return (v1parts.length < v2parts.length) ? -1 : 1;
+}
+
+
+/*************************************************************************
+ *	Class DynaTreeNode
+ */
+var DynaTreeNode = Class.create();
+
+DynaTreeNode.prototype = {
+	initialize: function(parent, tree, data) {
+		/**
+		 * @constructor
+		 */
+		this.parent = parent;
+		this.tree = tree;
+		if ( typeof data === "string" ){
+			data = { title: data };
+		}
+		if( !data.key ){
+			data.key = "_" + tree._nodeCount++;
+		}else{
+			data.key = "" + data.key; // issue 371
+		}
+		this.data = $.extend({}, $.ui.dynatree.nodedatadefaults, data);
+		this.li = null; // not yet created
+		this.span = null; // not yet created
+		this.ul = null; // not yet created
+		this.childList = null; // no subnodes yet
+		this._isLoading = false; // Lazy content is being loaded
+		this.hasSubSel = false;
+		this.bExpanded = false;
+		this.bSelected = false;
+
+	},
+
+	toString: function() {
+		return "DynaTreeNode<" + this.data.key + ">: '" + this.data.title + "'";
+	},
+
+	toDict: function(recursive, callback) {
+		var dict = $.extend({}, this.data);
+		dict.activate = ( this.tree.activeNode === this );
+		dict.focus = ( this.tree.focusNode === this );
+		dict.expand = this.bExpanded;
+		dict.select = this.bSelected;
+		if( callback ){
+			callback(dict);
+		}
+		if( recursive && this.childList ) {
+			dict.children = [];
+			for(var i=0, l=this.childList.length; i 1){
+				res += cache.tagConnector;
+			}
+			// .. else (i.e. for root level) skip expander/connector altogether
+		} else if( this.hasChildren() !== false ) {
+			res += cache.tagExpander;
+		} else {
+			res += cache.tagConnector;
+		}
+		// Checkbox mode
+		if( opts.checkbox && data.hideCheckbox !== true && !data.isStatusNode ) {
+			res += cache.tagCheckbox;
+		}
+		// folder or doctype icon
+		if ( data.icon ) {
+			if (data.icon.charAt(0) === "/"){
+				imageSrc = data.icon;
+			}else{
+				imageSrc = opts.imagePath + data.icon;
+			}
+			res += "";
+		} else if ( data.icon === false ) {
+			// icon == false means 'no icon'
+//			noop(); // keep JSLint happy
+		} else if ( data.iconClass ) {
+			res +=  "";
+		} else {
+			// icon == null means 'default icon'
+			res += cache.tagNodeIcon;
+		}
+		// node title
+		var nodeTitle = "";
+		if ( opts.onCustomRender ){
+			nodeTitle = opts.onCustomRender.call(tree, this) || "";
+		}
+		if(!nodeTitle){
+			var tooltip = data.tooltip ? ' title="' + data.tooltip.replace(/\"/g, '"') + '"' : '',
+				href = data.href || "#";
+			if( opts.noLink || data.noLink ) {
+				nodeTitle = '' + data.title + '';
+//				this.tree.logDebug("nodeTitle: " + nodeTitle);
+			} else {
+				nodeTitle = '' + data.title + '';
+			}
+		}
+		res += nodeTitle;
+		return res;
+	},
+
+
+	_fixOrder: function() {
+		/**
+		 * Make sure, that 
    •  order matches childList order.
+		 */
+		var cl = this.childList;
+		if( !cl || !this.ul ){
+			return;
+		}
+		var childLI = this.ul.firstChild;
+		for(var i=0, l=cl.length-1; i
+			this.li = this.span = null;
+			this.ul = document.createElement("ul");
+			if( opts.minExpandLevel > 1 ){
+				this.ul.className = cn.container + " " + cn.noConnector;
+			}else{
+				this.ul.className = cn.container;
+			}
+		} else if( parent ) {
+			// Create 
    •  
      • 
+			if( ! this.li ) {
+				firstTime = true;
+				this.li = document.createElement("li");
+				this.li.dtnode = this;
+				if( data.key && opts.generateIds ){
+					this.li.id = opts.idPrefix + data.key;
+				}
+				this.span = document.createElement("span");
+				this.span.className = cn.title;
+				this.li.appendChild(this.span);
+
+				if( !parent.ul ) {
+					// This is the parent's first child: create UL tag
+					// (Hidden, because it will be
+					parent.ul = document.createElement("ul");
+					parent.ul.style.display = "none";
+					parent.li.appendChild(parent.ul);
+//					if( opts.minExpandLevel > this.getLevel() ){
+//						parent.ul.className = cn.noConnector;
+//					}
+				}
+				// set node connector images, links and text
+//				this.span.innerHTML = this._getInnerHtml();
+
+				parent.ul.appendChild(this.li);
+			}
+			// set node connector images, links and text
+			this.span.innerHTML = this._getInnerHtml();
+			// Set classes for current status
+			var cnList = [];
+			cnList.push(cn.node);
+			if( data.isFolder ){
+				cnList.push(cn.folder);
+			}
+			if( this.bExpanded ){
+				cnList.push(cn.expanded);
+			}
+			if( this.hasChildren() !== false ){
+				cnList.push(cn.hasChildren);
+			}
+			if( data.isLazy && this.childList === null ){
+				cnList.push(cn.lazy);
+			}
+			if( isLastSib ){
+				cnList.push(cn.lastsib);
+			}
+			if( this.bSelected ){
+				cnList.push(cn.selected);
+			}
+			if( this.hasSubSel ){
+				cnList.push(cn.partsel);
+			}
+			if( tree.activeNode === this ){
+				cnList.push(cn.active);
+			}
+			if( data.addClass ){
+				cnList.push(data.addClass);
+			}
+			// IE6 doesn't correctly evaluate multiple class names,
+			// so we create combined class names that can be used in the CSS
+			cnList.push(cn.combinedExpanderPrefix
+					+ (this.bExpanded ? "e" : "c")
+					+ (data.isLazy && this.childList === null ? "d" : "")
+					+ (isLastSib ? "l" : "")
+					);
+			cnList.push(cn.combinedIconPrefix
+					+ (this.bExpanded ? "e" : "c")
+					+ (data.isFolder ? "f" : "")
+					);
+			this.span.className = cnList.join(" ");
+
+			// TODO: we should not set this in the  tag also, if we set it here:
+			this.li.className = isLastSib ? cn.lastsib : "";
+
+			// Allow tweaking, binding, after node was created for the first time
+			if(firstTime && opts.onCreate){
+				opts.onCreate.call(tree, this, this.span);
+			}
+			// Hide children, if node is collapsed
+//			this.ul.style.display = ( this.bExpanded || !parent ) ? "" : "none";
+			// Allow tweaking after node state was rendered
+			if(opts.onRender){
+				opts.onRender.call(tree, this, this.span);
+			}
+		}
+		// Visit child nodes
+		if( (this.bExpanded || includeInvisible === true) && this.childList ) {
+			for(var i=0, l=this.childList.length; i b.data.title ? 1 : -1;
+			var x = a.data.title.toLowerCase(),
+				y = b.data.title.toLowerCase();
+			return x === y ? 0 : x > y ? 1 : -1;
+			};
+		cl.sort(cmp);
+		if( deep ){
+			for(var i=0, l=cl.length; i 0) {
+						// special case: using ajaxInit
+						this.childList[0].focus();
+					} else {
+						this.focus();
+					}
+				}
+				break;
+			case DTNodeStatus_Loading:
+				this._isLoading = true;
+				$(this.span).addClass(this.tree.options.classNames.nodeLoading);
+				// The root is hidden, so we set a temporary status child
+				if(!this.parent){
+					this._setStatusNode({
+						title: this.tree.options.strings.loading + info,
+						tooltip: tooltip,
+						addClass: this.tree.options.classNames.nodeWait
+					});
+				}
+				break;
+			case DTNodeStatus_Error:
+				this._isLoading = false;
+//				$(this.span).addClass(this.tree.options.classNames.nodeError);
+				this._setStatusNode({
+					title: this.tree.options.strings.loadError + info,
+					tooltip: tooltip,
+					addClass: this.tree.options.classNames.nodeError
+				});
+				break;
+			default:
+				throw "Bad LazyNodeStatus: '" + lts + "'.";
+		}
+	},
+
+	_parentList: function(includeRoot, includeSelf) {
+		var l = [];
+		var dtn = includeSelf ? this : this.parent;
+		while( dtn ) {
+			if( includeRoot || dtn.parent ){
+				l.unshift(dtn);
+			}
+			dtn = dtn.parent;
+		}
+		return l;
+	},
+	getLevel: function() {
+		/**
+		 * Return node depth. 0: System root node, 1: visible top-level node.
+		 */
+		var level = 0;
+		var dtn = this.parent;
+		while( dtn ) {
+			level++;
+			dtn = dtn.parent;
+		}
+		return level;
+	},
+
+	_getTypeForOuterNodeEvent: function(event) {
+		/** Return the inner node span (title, checkbox or expander) if
+		 *  event.target points to the outer span.
+		 *  This function should fix issue #93:
+		 *  FF2 ignores empty spans, when generating events (returning the parent instead).
+		 */
+		var cns = this.tree.options.classNames;
+		var target = event.target;
+		// Only process clicks on an outer node span (probably due to a FF2 event handling bug)
+		if( target.className.indexOf(cns.node) < 0 ) {
+			return null;
+		}
+		// Event coordinates, relative to outer node span:
+		var eventX = event.pageX - target.offsetLeft;
+		var eventY = event.pageY - target.offsetTop;
+
+		for(var i=0, l=target.childNodes.length; i= x && eventX <= (x+nx) && eventY >= y && eventY <= (y+ny) ) {
+//	            alert("HIT "+ cn.className);
+				if( cn.className==cns.title ){
+					return "title";
+				}else if( cn.className==cns.expander ){
+					return "expander";
+				}else if( cn.className==cns.checkbox ){
+					return "checkbox";
+				}else if( cn.className==cns.nodeIcon ){
+					return "icon";
+				}
+			}
+		}
+		return "prefix";
+	},
+
+	getEventTargetType: function(event) {
+		// Return the part of a node, that a click event occured on.
+		// Note: there is no check, if the event was fired on THIS node.
+		var tcn = event && event.target ? event.target.className : "",
+			cns = this.tree.options.classNames;
+
+		if( tcn === cns.title ){
+			return "title";
+		}else if( tcn === cns.expander ){
+			return "expander";
+		}else if( tcn === cns.checkbox ){
+			return "checkbox";
+		}else if( tcn === cns.nodeIcon ){
+			return "icon";
+		}else if( tcn === cns.empty || tcn === cns.vline || tcn === cns.connector ){
+			return "prefix";
+		}else if( tcn.indexOf(cns.node) >= 0 ){
+			// FIX issue #93
+			return this._getTypeForOuterNodeEvent(event);
+		}
+		return null;
+	},
+
+	isVisible: function() {
+		// Return true, if all parents are expanded.
+		var parents = this._parentList(true, false);
+		for(var i=0, l=parents.length; ia").focus();
+		} catch(e) { }
+	},
+
+	isFocused: function() {
+		return (this.tree.tnFocused === this);
+	},
+
+	_activate: function(flag, fireEvents) {
+		// (De)Activate - but not focus - this node.
+		this.tree.logDebug("dtnode._activate(%o, fireEvents=%o) - %o", flag, fireEvents, this);
+		var opts = this.tree.options;
+		if( this.data.isStatusNode ){
+			return;
+		}
+		if ( fireEvents && opts.onQueryActivate && opts.onQueryActivate.call(this.tree, flag, this) === false ){
+			return; // Callback returned false
+		}
+		if( flag ) {
+			// Activate
+			if( this.tree.activeNode ) {
+				if( this.tree.activeNode === this ){
+					return;
+				}
+				this.tree.activeNode.deactivate();
+			}
+			if( opts.activeVisible ){
+				this.makeVisible();
+			}
+			this.tree.activeNode = this;
+			if( opts.persist ){
+				$.cookie(opts.cookieId+"-active", this.data.key, opts.cookie);
+			}
+			this.tree.persistence.activeKey = this.data.key;
+			$(this.span).addClass(opts.classNames.active);
+			if ( fireEvents && opts.onActivate ){
+				opts.onActivate.call(this.tree, this);
+			}
+		} else {
+			// Deactivate
+			if( this.tree.activeNode === this ) {
+				if ( opts.onQueryActivate && opts.onQueryActivate.call(this.tree, false, this) === false ){
+					return; // Callback returned false
+				}
+				$(this.span).removeClass(opts.classNames.active);
+				if( opts.persist ) {
+					// Note: we don't pass null, but ''. So the cookie is not deleted.
+					// If we pass null, we also have to pass a COPY of opts, because $cookie will override opts.expires (issue 84)
+					$.cookie(opts.cookieId+"-active", "", opts.cookie);
+				}
+				this.tree.persistence.activeKey = null;
+				this.tree.activeNode = null;
+				if ( fireEvents && opts.onDeactivate ){
+					opts.onDeactivate.call(this.tree, this);
+				}
+			}
+		}
+	},
+
+	activate: function() {
+		// Select - but not focus - this node.
+//		this.tree.logDebug("dtnode.activate(): %o", this);
+		this._activate(true, true);
+	},
+
+	activateSilently: function() {
+		this._activate(true, false);
+	},
+
+	deactivate: function() {
+//		this.tree.logDebug("dtnode.deactivate(): %o", this);
+		this._activate(false, true);
+	},
+
+	isActive: function() {
+		return (this.tree.activeNode === this);
+	},
+
+	_userActivate: function() {
+		// Handle user click / [space] / [enter], according to clickFolderMode.
+		var activate = true;
+		var expand = false;
+		if ( this.data.isFolder ) {
+			switch( this.tree.options.clickFolderMode ) {
+			case 2:
+				activate = false;
+				expand = true;
+				break;
+			case 3:
+				activate = expand = true;
+				break;
+			}
+		}
+		if( this.parent === null ) {
+			expand = false;
+		}
+		if( expand ) {
+			this.toggleExpand();
+			this.focus();
+		}
+		if( activate ) {
+			this.activate();
+		}
+	},
+
+	_setSubSel: function(hasSubSel) {
+		if( hasSubSel ) {
+			this.hasSubSel = true;
+			$(this.span).addClass(this.tree.options.classNames.partsel);
+		} else {
+			this.hasSubSel = false;
+			$(this.span).removeClass(this.tree.options.classNames.partsel);
+		}
+	},
+	/**
+	 * Fix selection and partsel status, of parent nodes, according to current status of
+	 * end nodes.
+	 */
+	_updatePartSelectionState: function() {
+//		alert("_updatePartSelectionState " + this);
+//		this.tree.logDebug("_updatePartSelectionState() - %o", this);
+		var sel;
+		// Return `true` or `false` for end nodes and remove part-sel flag
+		if( ! this.hasChildren() ){
+			sel = (this.bSelected && !this.data.unselectable && !this.data.isStatusNode);
+			this._setSubSel(false);
+			return sel;
+		}
+		// Return `true`, `false`, or `undefined` for parent nodes
+		var i, l,
+			cl = this.childList,
+			allSelected = true,
+			allDeselected = true;
+		for(i=0, l=cl.length; i jumps to the top
+		event.preventDefault();
+	},
+
+	_onDblClick: function(event) {
+//		this.tree.logDebug("dtnode.onDblClick(" + event.type + "): dtnode:" + this + ", button:" + event.button + ", which: " + event.which);
+	},
+
+	_onKeydown: function(event) {
+//		this.tree.logDebug("dtnode.onKeydown(" + event.type + "): dtnode:" + this + ", charCode:" + event.charCode + ", keyCode: " + event.keyCode + ", which: " + event.which);
+		var handled = true,
+			sib;
+//		alert("keyDown" + event.which);
+
+		switch( event.which ) {
+			// charCodes:
+//			case 43: // '+'
+			case 107: // '+'
+			case 187: // '+' @ Chrome, Safari
+				if( !this.bExpanded ){ this.toggleExpand(); }
+				break;
+//			case 45: // '-'
+			case 109: // '-'
+			case 189: // '+' @ Chrome, Safari
+				if( this.bExpanded ){ this.toggleExpand(); }
+				break;
+			//~ case 42: // '*'
+				//~ break;
+			//~ case 47: // '/'
+				//~ break;
+			// case 13: // 
+				//  on a focused  tag seems to generate a click-event.
+				// this._userActivate();
+				// break;
+			case 32: // 
+				this._userActivate();
+				break;
+			case 8: // 
+				if( this.parent ){
+					this.parent.focus();
+				}
+				break;
+			case 37: // 
+				if( this.bExpanded ) {
+					this.toggleExpand();
+					this.focus();
+//				} else if( this.parent && (this.tree.options.rootVisible || this.parent.parent) ) {
+				} else if( this.parent && this.parent.parent ) {
+					this.parent.focus();
+				}
+				break;
+			case 39: // 
+				if( !this.bExpanded && (this.childList || this.data.isLazy) ) {
+					this.toggleExpand();
+					this.focus();
+				} else if( this.childList ) {
+					this.childList[0].focus();
+				}
+				break;
+			case 38: // 
+				sib = this.getPrevSibling();
+				while( sib && sib.bExpanded && sib.childList ){
+					sib = sib.childList[sib.childList.length-1];
+				}
+//				if( !sib && this.parent && (this.tree.options.rootVisible || this.parent.parent) )
+				if( !sib && this.parent && this.parent.parent ){
+					sib = this.parent;
+				}
+				if( sib ){
+					sib.focus();
+				}
+				break;
+			case 40: // 
+				if( this.bExpanded && this.childList ) {
+					sib = this.childList[0];
+				} else {
+					var parents = this._parentList(false, true);
+					for(var i=parents.length-1; i>=0; i--) {
+						sib = parents[i].getNextSibling();
+						if( sib ){ break; }
+					}
+				}
+				if( sib ){
+					sib.focus();
+				}
+				break;
+			default:
+				handled = false;
+		}
+		// Return false, if handled, to prevent default processing
+//		return !handled;
+		if(handled){
+			event.preventDefault();
+		}
+	},
+
+	_onKeypress: function(event) {
+		// onKeypress is only hooked to allow user callbacks.
+		// We don't process it, because IE and Safari don't fire keypress for cursor keys.
+//		this.tree.logDebug("dtnode.onKeypress(" + event.type + "): dtnode:" + this + ", charCode:" + event.charCode + ", keyCode: " + event.keyCode + ", which: " + event.which);
+	},
+
+	_onFocus: function(event) {
+		// Handles blur and focus events.
+//		this.tree.logDebug("dtnode._onFocus(%o): %o", event, this);
+		var opts = this.tree.options;
+		if ( event.type == "blur" || event.type == "focusout" ) {
+			if ( opts.onBlur ){
+				opts.onBlur.call(this.tree, this);
+			}
+			if( this.tree.tnFocused ){
+				$(this.tree.tnFocused.span).removeClass(opts.classNames.focused);
+			}
+			this.tree.tnFocused = null;
+			if( opts.persist ){
+				$.cookie(opts.cookieId+"-focus", "", opts.cookie);
+			}
+		} else if ( event.type=="focus" || event.type=="focusin") {
+			// Fix: sometimes the blur event is not generated
+			if( this.tree.tnFocused && this.tree.tnFocused !== this ) {
+				this.tree.logDebug("dtnode.onFocus: out of sync: curFocus: %o", this.tree.tnFocused);
+				$(this.tree.tnFocused.span).removeClass(opts.classNames.focused);
+			}
+			this.tree.tnFocused = this;
+			if ( opts.onFocus ){
+				opts.onFocus.call(this.tree, this);
+			}
+			$(this.tree.tnFocused.span).addClass(opts.classNames.focused);
+			if( opts.persist ){
+				$.cookie(opts.cookieId+"-focus", this.data.key, opts.cookie);
+			}
+		}
+		// TODO: return anything?
+//		return false;
+	},
+
+	visit: function(fn, includeSelf) {
+		// Call fn(node) for all child nodes. Stop iteration, if fn() returns false.
+		var res = true;
+		if( includeSelf === true ) {
+			res = fn(this);
+			if( res === false || res == "skip" ){
+				return res;
+			}
+		}
+		if(this.childList){
+			for(var i=0, l=this.childList.length; i reloading %s...", this, keyPath, child);
+						var self = this;
+						// Note: this line gives a JSLint warning (Don't make functions within a loop)
+						/*jshint loopfunc:true */
+						child.reloadChildren(function(node, isOk){
+							// After loading, look for direct child with that key
+							if(isOk){
+								tree.logDebug("%s._loadKeyPath(%s) -> reloaded %s.", node, keyPath, node);
+								callback.call(tree, child, "loaded");
+								node._loadKeyPath(segList.join(tree.options.keyPathSeparator), callback);
+							}else{
+								tree.logWarning("%s._loadKeyPath(%s) -> reloadChildren() failed.", self, keyPath);
+								callback.call(tree, child, "error");
+							}
+						});
+						// we can ignore it, since it will only be exectuted once, the the loop is ended
+						// See also http://stackoverflow.com/questions/3037598/how-to-get-around-the-jslint-error-dont-make-functions-within-a-loop
+					} else {
+						callback.call(tree, child, "loaded");
+						// Look for direct child with that key
+						child._loadKeyPath(segList.join(tree.options.keyPathSeparator), callback);
+					}
+					return;
+				}
+			}
+		}
+		// Could not find key
+		// Callback params: child: undefined, the segment, isEndNode (segList.length === 0)
+		callback.call(tree, undefined, "notfound", seg, segList.length === 0);
+		tree.logWarning("Node not found: " + seg);
+		return;
+	},
+
+	resetLazy: function() {
+		// Discard lazy content.
+		if( this.parent === null ){
+			throw "Use tree.reload() instead";
+		}else if( ! this.data.isLazy ){
+			throw "node.resetLazy() requires lazy nodes.";
+		}
+		this.expand(false);
+		this.removeChildren();
+	},
+
+	_addChildNode: function(dtnode, beforeNode) {
+		/**
+		 * Internal function to add one single DynatreeNode as a child.
+		 *
+		 */
+		var tree = this.tree,
+			opts = tree.options,
+			pers = tree.persistence;
+
+//		tree.logDebug("%s._addChildNode(%o)", this, dtnode);
+
+		// --- Update and fix dtnode attributes if necessary
+		dtnode.parent = this;
+//		if( beforeNode && (beforeNode.parent !== this || beforeNode === dtnode ) )
+//			throw " must be another child of ";
+
+		// --- Add dtnode as a child
+		if ( this.childList === null ) {
+			this.childList = [];
+		} else if( ! beforeNode ) {
+			// Fix 'lastsib'
+			if(this.childList.length > 0) {
+				$(this.childList[this.childList.length-1].span).removeClass(opts.classNames.lastsib);
+			}
+		}
+		if( beforeNode ) {
+			var iBefore = $.inArray(beforeNode, this.childList);
+			if( iBefore < 0 ){
+				throw " must be a child of ";
+			}
+			this.childList.splice(iBefore, 0, dtnode);
+		} else {
+			// Append node
+			this.childList.push(dtnode);
+		}
+
+		// --- Handle persistence
+		// Initial status is read from cookies, if persistence is active and
+		// cookies are already present.
+		// Otherwise the status is read from the data attributes and then persisted.
+		var isInitializing = tree.isInitializing();
+		if( opts.persist && pers.cookiesFound && isInitializing ) {
+			// Init status from cookies
+//			tree.logDebug("init from cookie, pa=%o, dk=%o", pers.activeKey, dtnode.data.key);
+			if( pers.activeKey === dtnode.data.key ){
+				tree.activeNode = dtnode;
+			}
+			if( pers.focusedKey === dtnode.data.key ){
+				tree.focusNode = dtnode;
+			}
+			dtnode.bExpanded = ($.inArray(dtnode.data.key, pers.expandedKeyList) >= 0);
+			dtnode.bSelected = ($.inArray(dtnode.data.key, pers.selectedKeyList) >= 0);
+//			tree.logDebug("    key=%o, bSelected=%o", dtnode.data.key, dtnode.bSelected);
+		} else {
+			// Init status from data (Note: we write the cookies after the init phase)
+//			tree.logDebug("init from data");
+			if( dtnode.data.activate ) {
+				tree.activeNode = dtnode;
+				if( opts.persist ){
+					pers.activeKey = dtnode.data.key;
+				}
+			}
+			if( dtnode.data.focus ) {
+				tree.focusNode = dtnode;
+				if( opts.persist ){
+					pers.focusedKey = dtnode.data.key;
+				}
+			}
+			dtnode.bExpanded = ( dtnode.data.expand === true ); // Collapsed by default
+			if( dtnode.bExpanded && opts.persist ){
+				pers.addExpand(dtnode.data.key);
+			}
+			dtnode.bSelected = ( dtnode.data.select === true ); // Deselected by default
+/*
+			Doesn't work, cause pers.selectedKeyList may be null
+			if( dtnode.bSelected && opts.selectMode==1
+				&& pers.selectedKeyList && pers.selectedKeyList.length>0 ) {
+				tree.logWarning("Ignored multi-selection in single-mode for %o", dtnode);
+				dtnode.bSelected = false; // Fixing bad input data (multi selection for mode:1)
+			}
+*/
+			if( dtnode.bSelected && opts.persist ){
+				pers.addSelect(dtnode.data.key);
+			}
+		}
+
+		// Always expand, if it's below minExpandLevel
+//		tree.logDebug ("%s._addChildNode(%o), l=%o", this, dtnode, dtnode.getLevel());
+		if ( opts.minExpandLevel >= dtnode.getLevel() ) {
+//			tree.logDebug ("Force expand for %o", dtnode);
+			this.bExpanded = true;
+		}
+
+		// In multi-hier mode, update the parents selection state
+		// issue #82: only if not initializing, because the children may not exist yet
+//		if( !dtnode.data.isStatusNode && opts.selectMode==3 && !isInitializing )
+//			dtnode._fixSelectionState();
+
+		// In multi-hier mode, update the parents selection state
+		if( dtnode.bSelected && opts.selectMode==3 ) {
+			var p = this;
+			while( p ) {
+				if( !p.hasSubSel ){
+					p._setSubSel(true);
+				}
+				p = p.parent;
+			}
+		}
+		// render this node and the new child
+		if ( tree.bEnableUpdate ){
+			this.render();
+		}
+		return dtnode;
+	},
+
+	addChild: function(obj, beforeNode) {
+		/**
+		 * Add a node object as child.
+		 *
+		 * This should be the only place, where a DynaTreeNode is constructed!
+		 * (Except for the root node creation in the tree constructor)
+		 *
+		 * @param obj A JS object (may be recursive) or an array of those.
+		 * @param {DynaTreeNode} beforeNode (optional) sibling node.
+		 *
+		 * Data format: array of node objects, with optional 'children' attributes.
+		 * [
+		 *	{ title: "t1", isFolder: true, ... }
+		 *	{ title: "t2", isFolder: true, ...,
+		 *		children: [
+		 *			{title: "t2.1", ..},
+		 *			{..}
+		 *			]
+		 *	}
+		 * ]
+		 * A simple object is also accepted instead of an array.
+		 *
+		 */
+//		this.tree.logDebug("%s.addChild(%o, %o)", this, obj, beforeNode);
+		if(typeof(obj) == "string"){
+			throw "Invalid data type for " + obj;
+		}else if( !obj || obj.length === 0 ){ // Passed null or undefined or empty array
+			return;
+		}else if( obj instanceof DynaTreeNode ){
+			return this._addChildNode(obj, beforeNode);
+		}
+
+		if( !obj.length ){ // Passed a single data object
+			obj = [ obj ];
+		}
+		var prevFlag = this.tree.enableUpdate(false);
+
+		var tnFirst = null;
+		for (var i=0, l=obj.length; i is the request options
+//				self.tree.logDebug("appendAjax().success");
+				var prevPhase = self.tree.phase;
+				self.tree.phase = "init";
+				// postProcess is similar to the standard dataFilter hook,
+				// but it is also called for JSONP
+				if( options.postProcess ){
+					data = options.postProcess.call(this, data, this.dataType);
+				}
+				// Process ASPX WebMethod JSON object inside "d" property
+				// http://code.google.com/p/dynatree/issues/detail?id=202
+				else if (data && data.hasOwnProperty("d")) {
+				   data = (typeof data.d) == "string" ? $.parseJSON(data.d) : data.d;
+				}
+				if(!$.isArray(data) || data.length !== 0){
+					self.addChild(data, null);
+				}
+				self.tree.phase = "postInit";
+				if( orgSuccess ){
+					orgSuccess.call(options, self, data, textStatus);
+				}
+				self.tree.logDebug("trigger " + eventType);
+				self.tree.$tree.trigger(eventType, [self, true]);
+				self.tree.phase = prevPhase;
+				// This should be the last command, so node._isLoading is true
+				// while the callbacks run
+				self.setLazyNodeStatus(DTNodeStatus_Ok);
+				if($.isArray(data) && data.length === 0){
+					// Set to [] which is interpreted as 'no children' for lazy
+					// nodes
+					self.childList = [];
+					self.render();
+				}
+				},
+			error: function(jqXHR, textStatus, errorThrown){
+				//  is the request options
+				self.tree.logWarning("appendAjax failed:", textStatus, ":\n", jqXHR, "\n", errorThrown);
+				if( orgError ){
+					orgError.call(options, self, jqXHR, textStatus, errorThrown);
+				}
+				self.tree.$tree.trigger(eventType, [self, false]);
+				self.setLazyNodeStatus(DTNodeStatus_Error, {info: textStatus, tooltip: "" + errorThrown});
+				}
+		});
+		$.ajax(options);
+	},
+
+	move: function(targetNode, mode) {
+		/**Move this node to targetNode.
+		 *  mode 'child': append this node as last child of targetNode.
+		 *                This is the default. To be compatble with the D'n'd
+		 *                hitMode, we also accept 'over'.
+		 *  mode 'before': add this node as sibling before targetNode.
+		 *  mode 'after': add this node as sibling after targetNode.
+		 */
+		var pos;
+		if(this === targetNode){
+			return;
+		}
+		if( !this.parent  ){
+			throw "Cannot move system root";
+		}
+		if(mode === undefined || mode == "over"){
+			mode = "child";
+		}
+		var prevParent = this.parent;
+		var targetParent = (mode === "child") ? targetNode : targetNode.parent;
+		if( targetParent.isDescendantOf(this) ){
+			throw "Cannot move a node to it's own descendant";
+		}
+		// Unlink this node from current parent
+		if( this.parent.childList.length == 1 ) {
+			this.parent.childList = this.parent.data.isLazy ? [] : null;
+			this.parent.bExpanded = false;
+		} else {
+			pos = $.inArray(this, this.parent.childList);
+			if( pos < 0 ){
+				throw "Internal error";
+			}
+			this.parent.childList.splice(pos, 1);
+		}
+		// Remove from source DOM parent
+		if(this.parent.ul){
+			this.parent.ul.removeChild(this.li);
+		}
+
+		// Insert this node to target parent's child list
+		this.parent = targetParent;
+		if( targetParent.hasChildren() ) {
+			switch(mode) {
+			case "child":
+				// Append to existing target children
+				targetParent.childList.push(this);
+				break;
+			case "before":
+				// Insert this node before target node
+				pos = $.inArray(targetNode, targetParent.childList);
+				if( pos < 0 ){
+					throw "Internal error";
+				}
+				targetParent.childList.splice(pos, 0, this);
+				break;
+			case "after":
+				// Insert this node after target node
+				pos = $.inArray(targetNode, targetParent.childList);
+				if( pos < 0 ){
+					throw "Internal error";
+				}
+				targetParent.childList.splice(pos+1, 0, this);
+				break;
+			default:
+				throw "Invalid mode " + mode;
+			}
+		} else {
+			targetParent.childList = [ this ];
+		}
+		// Parent has no